DTagWn32 (DLJtLLLd8BIM*bennnn*14:39:16 2/6/2009**x***++++Captured+++++"+!+IS 4000RIS_4000R++++ Experimental Experimental++02/06/2009 14:39:16+ Unmodified ImageUnmodified_Image+ + + + ++++No Lens Correction Done+++No Lanes+; ---------------------------- Date:02/06/2009 Time:14:39:36 ---------------------------- ##########User ID: 0 ; Username: ;Session ID: xEzBMmy5yg1M6Rvc7rPLLLl3MvKEXBt6ggsAiJHmnPA= ########### ----------(Decrypted Session ID: 02/06/200914:39:36)---------- Image Capture Source: IS4000R Username: bennnn Annotation: Capture Time/Date: 14:39:16 on 02/06/2009 Exposure Type: Time Lapse Exposure Exposure Time: 1.000 sec. Exposure: 3 of 3 (1.50 sec. interval) Total Experiment Duration: 4.00 secs. X-binning: No Y-binning: No Illumination Source: Multi-wavelength f-Stop: 2.80 FOV: 100.5 mm Focal Plane: 0.0 mm Vertical Resolution: 517 ppi Horizontal Resolution: 517 ppi Magnification Stage: No Filter Description: 3. 830 Lens Correction Done: No Illumination Correction Done: No Reference File: NA Image Warping: No Orientation: Normal CCD Temperature: -29.00 C Pixel Saturation Threshold: 65535 Percent of Saturated Pixels: ~8.26% ---------------------------- Date:02/06/2009 Time:14:39:36 ---------------------------- ##########User ID: 0 ; Username: ;Session ID: xEzBMmy5yg1M6Rvc7rPLLLl3MvKEXBt6ggsAiJHmnPA= ########### ----------(Decrypted Session ID: 02/06/200914:39:36)---------- User Logged in No Lanes8BIM ExJFIFCC" }!1AQa"q2#BR$3br %&'()*456789:CDEFGHIJSTUVWXYZcdefghijstuvwxyz w!1AQaq"2B #3Rbr $4%&'()*56789:CDEFGHIJSTUVWXYZcdefghijstuvwxyz ?MwH5` xs#"8e=šq<^)t2EĩUyN5in%9N,OZx bUX98-ZŒi|dž9'U!-Pex#Zgaqiwu> Ks"ryhRx A= CIn^ZY,uˋs Ezk&iݭsL⎙ 8kk7| ~hdӅ]>^:΍Vz?]:)B>!iirau/ֆݦsh%+Ş4QuELd#Z4j Vh." 6RW<#x]ilΗ]Z\ʗ_g(--nӧX-͕NXZSŖ=c|xAZjW7 ZAdDf7|qvFּ hQiz֝uǯCXt Zqqmiz%ݜ4[F5+kR/|Ru/!ιs޵7z խMtj:V}gn[M;M(o^i=:cX|UjvW;jo xsPKX,1e=oÖi>%I->iI|mǤj),Lj z]յ=NI6q0i}MSNJwx ^0>|'}hk^ /#cMrdN~uxWt/ OŞ-tbƺD ~d[gx7Zݟ5n[ Cpj1MyũO]x[G5]F}gO/V&,KU[MA|MG[[[kxU_5SZ5 uJּo}jJ&;a];M..h5eΧ? 4/|E__þ 7tTD\Zv🍭<9sGeXxGvSxcKg xk+Y \Ҷw=NGQ'Vյ ω~ |K.֟~ρql5ؼAԴhxim.-4¶ oٷ:֗} |k_ZG/*5>j:w|;xvU4/x;:c:i?kEIơ֮#{WIdAo kd0nxQyA?`#wd%o{rOӢUu QE4&9M_o~Du֣,xxz>}. M;LWť\7zUW7Mwh^qoC{fژ!O*"W#]+mO?q/gߔOjay 95gaVc7A4 C4Qv,.mE26aDQRHHLČdhGcDI9H;[1C-Ek\)6`!I q w~!>];;մ]pY.rKYyY $=#Z'yDFa6[iuVA J<ehsMr@%ߊwmr5R6~xwV-l"wEio٭tYمw'w~$MFW[.}ajQ^FoRmw,yex;WY_|h˧ɦXhZ>{kstm8K9KEޗqkŞI$[>4YΫ%iN}gj%Ŷ.-g e^64>W|}q4v7^'MZ 1H,{AZ5@"-N"̲/g]xFG/?VZ1y. T4Fi5=3T5i;;&3f?d ['VgܐQioeTb/?=2Zox_L{6ˈNVK6VS` iz\<Cie6>3Ft/xE=Nm_Ҵj76zn{ZjOl mgׇ,u;-t i<>?n XE8Ochw'-<9_ϢKbɫ[l':[e|eJQo kh.|&|;>-u_W[o|y7=83mG][O6{mxzL5Xv+/xW~KuSi/5е V;]x~C5ZYiI|8E/S|/qׄ]m?] mKLj%=i)aе*_ ZJ񅏊|MEhk=oOG( b7g/3 "j>լ;M:}K PU>j,?(xWg Q^'._⯃zkmT-%:h#v徫v:V6|9NZֱ |m-SAI4e?-/ h3B{/YIxZJ֛eey{k-vx&G-/PNj?- ŭ.6^% vMD-|)YpKx\F4E_5:G~#-֣o  #?"č.?h> uK o}OG>(.4Oi|5OQҠC~!|Gǟ I;\`4{6ǧ^[ŭǦ\XxzGAi]&7¿Vb|(/+ᧈz]5 mR6}w.QͨO_x۷Gu3>_̞)[.M F|Ii?ÒxOC76z#[O}>[u]6v6 KlY6&BQw2Hs-OFME#`$qm6C[LIh#潷[`fc{iʳQi#6.x(fƕ4ئ)nb?noȎ;^D;:Aq,1,i⸜<5ê-&o}v+oesqif]VCq6hn&n,-I3^ŦX^khqs[^Sl4Kcy}$1XO=ᇃWiLq<)kcSúfixm&X$|9oxZW#{=Mqg(7o!)].M?B&ךu[:ZBռSn|7T(oJ_ƟdO:׋| ؓ㖭gcTT^xޙq=W:&Xűz /Ěv}ׅacTGį)[- Hֹ.vZŎyk.jZ6>8` h42kzV'xL(6>'d4Ŀ4{M/ᅏ>,ksK!o}m3vyZ|4[ᾁn?UV~ wM+wzuώ<5VZ|A) mN=oO5Ŀ*wq&o#{_FE ]Yx ƣ}7Us];;%tDF>!Ưk&%2O7=X&xZݿڝ3ix&x%-Z)n]BX_ "j0i) zw-v_o5_Ejُ^Z}ih> <;,u ^jw~!v<C_ /Dt{Fehiן|4㾟ψ|[Ju{omGu%4JO<H'Z~+[_&ѮxoZJ<?+z|?? ܯ$Oj<|?߃:7^O)t )_ExனzGI:u۟ jxѴ&G|kM;Nu}{ρD׼s?IK+ k^{۝' W2>a\|5ů jR#/xx_sžR{m#k 3=/_>%DRAMM] L𝯅)4}#]ƞ$|MIu>y{Ηռkw|fk?ߵtz[YB'hŸ!"xno#şhEh$62*"/1:C3NM0wh謳=A|yRC Yacs$Wv;*-F);z,nA4{^IF>);M${_xk}%(uq1Xգk{Ye'9hWJ4XiK+-6:ܷiI9E6Q #M丒 Ǎk{أM&kc&o.ncn04i4 ,6ݭ[ۭg2\I>4 k(U=r/HnAӅ+ ~if?gd Ȁ>u[xV5RjROic ֯oirZiZE۽J ,vEhb\:՞ ]6ן~ux/qZ&[xP -lut5y\|C](AiZ}03 Ԅ7]LE-ר RX$d]R7wGvÚշE| .[5=>}OQ.m4+[í5ԏ U^R?K/x6?(5.ȷ$kQuJ}+;X|SgȿE%ek,4?:|-~xbm-5#_ յmWڿt]_RW-e|{Ow P_3wxj>&ý_KFðxV&CFӬt7<; r{^toGoCz։ž*~,?{DŽ11⩿+оx_||v}5xP5mi~.m_Ayu;:Χ Ei/GTE~~ψjF gM33>%QZj&&vS]ϷWPeu6ɫ/~'/~Y WW=@|?|/m5O!FşL54_xT9!GWt|eύ E>/V< | ޞo/Ou EeR2DzmX힦- -xSI[%>G;i巄<7{WխjQ)wn<F*Z.R?<{ [æ)o,}3^7C ,} {@ W+ k:7omj-rƚޙ MWNW^kW▋hshe6iW^&ӥoS5=kV!E)#=x:oxF 'xAᯆ^)~%xN)⋟?*33ŽZjkx> ')xg~07֭_Q4Wö)Z}nH=eԦ[˨\Qe;yeQ-0?(:$lꢽ*[jwwik+uZI q*_4 6k,7if8ȫ,kxG pr6hK+2Y$X>jvienM cx} kԵ5J #s;0q$ha d7و:n;+V^Cux ԫ9d3zċmcOmd>mEѵͳtO=q5֟a/Rɽ kQZ,hJ`.Ρ1[#%Y;G~G$_d d2xaIvM+]I-3+K.M>e?oe< :\z-DsCƑo%uWw}wqqyam}cwwNh8}?ꖶm16+M  2 ,5鴻sk]X7WQ_Gc./>;KIDjWV_55k("h[ygm:vמ#*FHh5(|}3R/Ӡ]-kӬo.~z"Xk{\:fxrM6&Y-`/|]j|7I-ǏZŧG>𞟬k~>#4 ~*^͝]67Kw>֯|M6,:j(4mT4=.Nk1~^45_:]NIM3]b)O{ߌ6:fo| ='ßt}/O7[xCV's wu?_M|]&/;x;wi~7?~|*7|2fq-%[{W>oּ7^~~/I}[BǿR {'6? ORF_H,5Ya|] W5+_.?a?;G5$O|U~Z\|n?F:O~3YY|Y6ڷ~'~3VjxMG/j~#ռOpg /\@𷆼//]jKU~%[xu Kϗ|o3h^ν=hHӾ6M.Sj'׼w{g}gn8oxk /|Ngax+x?78i1麯_xGKBk6M[}'I}^ |Ro?jv< x[Þ Ɯ!m4:槩>l<Zx~}D~GuZm@[Pnl6oSu=+º|ηgj~WKA2 6[XDf) !6$Bc`J|Z"{{[_,ФkpaboR3Ȧd9(]_5.k$3bp X\y_ciIL#C}/bdp7%ċA\ۖ+ ]y) 8i7z̗/|@cζ4"I&YR|"E62X3HbTՕ(Hm^-Q͒(ԆC{>}x%/y"m[WP> B@_ķ/:@A鷍j,ɰMu?mua=VgdӬ툂(dI$m`orڧѾiFCsMo/ oQ;S m _i׵Y^BF"YZUװݢx{Zj;&O&s5erwb@qFT:f3g}mJ;BDeBLWZ`>+g\|Z}[#Rm⯀/4M95 ꚝi:wvL~$HtV}CK6hZ?u_C>5Omx;ZM/7ƭ^^t6擣 [F][ށ4N7Jh)>Sx:ºs?4ExS_~xwOEg UxeZ|YOK ._]jI~8<~ xg75Y{]~ٽ>$ֳ~$ғø_xῇf\<+]e;rÚVfڣ4n~*hZKo 75I_w{|E1>oaug~cI5}NK<7OiƹHt6^xY扣--o{J0iS~ڕ5eோ%ZoMfAƒI^v(sKb}ⷊ5  n='>=|KIh[|G&JĺBx=>)iEߍjgú׍g5!9._>o_۳]j>,'RUc7]H]Vz v^ҵ+ -֗ZZP]V:η""J4V̍gWkc>fGG`F*zw5>kgmR[bIK5U;97yC FY6};Z"Ĥ#f9wzMlA򦸶I1,%Rgd'bZdW`A-ТMCZ#J ^|E4O{q]\.qw%M:+DC$[<>Ts- l-ųAs1_"+dKJH f'3A#ygb(]X N)N[[hJL8< КNXT>8fkIo>}B]Vma!5ޞC[1$B|s9G4[}N+> 8]6 o7?zϦdustEMP]t}|P<멦SH}/^|/kGgo4}kĺVvRIo蚥贓T !okGq|$[xuP[5so J[;Vm|6= 5 j,-> hrj͝ˬ4 e5cYJMkGu[^Q>xN.6V|Mˡu$["]ӯP!д}+[Ե;mIrQm{h"wĔѴ{JRp?|aŅ-D⣠jww8ӭ4uLj<'|i^Ϫi>+@- H3.XޯeZ{b.n!|PmU'cWޱhq/YX\]=HEg$PofмAmLYkR5zWzC8뺟?xcT<' 'k~fN^Y-'¾txmRkז:%ޑO^;k蟵kz4S%R-O:⛸i :]FMFö,bK(lvKֵ9 77q5msS4y5 o^%5;[!p`^ŏkZ|19O h:~#2œz&YԐ̷ /fgA- V>~0x@5kޭc?Ù4+;/ p2x֞'&u.mEnGqٛ}U|-L^3۵7j^.D%Wk^]XvP*v[{6O%ZLOmʷw#Ķ^ՖwiCW5-DgίZ_햲CVu? ><=ihi/-9m.:mqA [ܠ{wRcOIӘM[|n`v ʩvʡ@nF.$y{be-4"v:\Ŷs~$9wFt.e%2A*6JJ)3V(-6sɔqΆ\-ۤ5Ĩ6Mop]K,Úx!$#Es(x^(x94T M0QdY +7hC2j3uE|Ms6h^2Y5JXɽCE F햚.5\RhSJ4o"G @ͷ`]v"xsGyYf 5nTY3q௜VjVCs+sͤbekl`y7N!%d#_F>mwX6חǷQgF]\[NF_2dK"u)d?Rss-޽u2ˡj::]iZYZ3-"[K(|7i}v?7=KXҵqe=8$ŤkAvl[q{na3K [嵙4*O^> yZĞ)ž -nX:6jEֺu֖)mbQ.'[}?Zy~H&V)uYjc>]]ǥ֗$^2 4omsn&seeHO4=u$w?]V%H2V> -Ow_BIky/-p!}-kUxB u]#ZyVM'MԤK66{;OW+m7Q,n mվ+=gVN[wK}7ޛM{hiӬEkU &Q4$,LJ!GZmtNoTDH s[ kōl[)]K[>}{FOO Ԯ$wu YK(\krr"Ե_L ִ_dԯoZki pZֲ_=%o|Xg"cN;6")x%0^o]3IGBIm T lGBiHTlGBiDxGBiC  !"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~  !"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~  !"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~GBiS @-4 lSP[1mN#3$& &*07=.@C%EJRt[7doXyh&{2> ^F1^w16~~_|myx4wcwgusWqqn,lkjigQee+bb$_`^@]^\0[nWVWVTTSQ`OOnNMKJIIIkGGFEIDCBB@@X@ >;>;<=`;:89^867p554R333'11^01/.W.q-.2-+U,b*U*^)g)(('''['&%%%$b#$7"#)"!"!c!} T"j(Lt "?]qR$]\N.mGn/99pIlnk}aAS(AO "  m V l K * &GGBiFTlCȀG?  !"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~GBiDBSfDD7DFD3DL@DE@D7D?DZDaDr@D|Dx@D~Dt@DDD`DD@DD DD D@DDDDD DDDD@DDDD DD@DDDDD@DDDDDDDD`D DD@DD DD DE EEE E EpE2@E2 EEPE 0E#0E5E7E6PEIEMEa0E1E+EEEpE%E4E3EF E>E>E-`EEE`E,0E,E)E,PEEE"EBEFEE@E2E+E4E0pE+E8pE/E,EEEJ@EV0EZE>E; E:EKE;ELEXEfpEjEsPE`EEEE}pExEzE[EYEeEtPE[ESpEH`EXpEVEbEbE`@EmPE^EREUEQENEFE[@EbpEtEqEiEhEp`Ej`EYE]EuEEPEpEEEEEEEEEEXEEEEPEEEEEEEEEE0EEXEEĠEEEHE E@EXEEEEEEEpE(E EEXEPEEExE`ExEE0E8E0E8EʸEE؈EˈEE0EEEEEEEEEEhE(FFEE8E8EEEEE EpEE8E0FFF F\FFFEE`EE0E0EE0EE0FFFFFTEEFF FFXFFF F F PF FEEEEFHFdF lFF xF%dF(tF&F)F FF FFFF\FFFFPF!hF$FF!F$`F.F1F9F?8F9|FEF:F7F4F"F FPF xF F<FlFFFFE`FF F FFPFFF'F$F'hF%F*<F.F.|F)F#0FHF4FF \F"F&F,F-`F1F7F<(F;F=F2 F,F%0F`F+<FKFYlFT0FHpFAF:F1F/ F+ F$F!FFF\FFFFFF FFF F <F (FFFFtFFFF F*F2F%<FF)HF)F.F:F?FRFYdFhFXxFKFBF9F.@F*F-HF%F+F%F"F"FF!FF\FpFF FFFF$FhF<FFhFhF( F/F1,F4FH(FC,F>4FAF7F-F&dF$F&F(F"FF LF"|FF%0F$ F%PF0F/F5HF*F!F*hF!FtFF TF4F8FFFFFF( F1F7|F5F3F-F.F-<F3 F3F0F&F<F# F$HF#FFHF'F($F(F3FHPFMDFPFUF[FapF_FYLFNFKFAlFA`FEFDDFIFJFOpFXpF[FSXFRFR(FMF>F4F2DF9F2F3,F1\F& F#LF&`F)LF-F)F(xF3tF FhFtFDFFFFLF FF F|FFPF(F=FFOFXHF[F_(FeHFa`FbTFm$FgF`@FSFQFKFGFJLFQDFFFMFS,FFFMFRFHFNFHHFTFK4FHlFB(F<F:TF;F:F<F6F.F%F(F!F F$8F!F!F& F+XF3tF7@F>TF6F&FF$tF$0F'xF1F3F5F4F6|F<F9F=TF5F4F.F9$F7F1F/`F.F+dF,F+F+DF2@F10F:pF8F8F5FBFQ8FfhF[LFjFhF]FZTFTFSFSFYFgFyFF8FFFFFVFFFhF>FbF|FvFnFlFepFh\F^FWFE F;F7XFBFDFAF6F.TF3pF@FEFBF;F;PFEPFGHFKFL FW`FcTFb@F_F\FeFihFoFsFF4FxF_F\FWFNFFFFFO<FLFCF:xFAF?FAFEFIlFOLFGlFJFLFMFDFE|FNFWFRFIF<F3F4F5FAFNFMFMFBF>F:F5F>HFJ$FMpFEFFFJDFMxFeFFFJFFFFFtFv|FnF\FWFZdF]XFehFn0FlFv0FoFe|F]F]FrTF{\FF F2FxF2F|F2Fx4FF|Fk<Fa,F]Fg FnF`FTFZhF_Fa FdF\F`FZFTFSFQFNFNFJFTFYFdtFcFdlFYFRFWFfFk@F^FYF\FPpFQ@FS`FQXF\FaFQFK|FLpFX8FlTFaFdFcFNDFQ4F]dFgFxFqXFhFiFu|FtpFk4F^FX FLTFPFTF_FuF{PFmdFpTFb,F^tFTF^hFY\FRPF`Fb`F[F\FZ$Fl`FcFXF?FC FD\FFFHFPFWPFZ0FU$F[FNFKFOFDFFF?FJFTFSFYdF]FnFx`FeFl|FnFxFc\FYLFO(FVF^<F\tFmxFjFfFoFlFf<Fa$FVF_FxF8FvF2FFFFFFdFFFz FkDFe\FdF[PF`FrFFFFFFFLFxF@FwFzFFvPFrFmFnFpFlFf,FVF[hF]XFWF[FWdFUpFVFMFPFGFDF?tF>F?FHFRDFY|FqFsF|xFrFntFkFhFcFoHFlF|F>FF:FFFFF FFF|FtFF0FXFLFvFFFlFFFFFDFFFFhFvFFFFFFZFѠF&F0FFxFFFǮFF FF|FFFFFF`FF FzFFtF\FFFF^FF\FF0FdFFFF2F@F Fw<FwFw@F{ FmpFbFcF`FbF]FZ`F_lF[FZFWFVFTLF^hFnFFFF$FFXFFFFvFFFxFF>FFFFFFx,Ft8F|F{FFFF:FFFnFhFFbFF(F,F FFFFFHFZF FFFFFBFPFFFrF"FHFRFNFFFFҶFFLFFbFFF~FF&FFFF@FFFFXF6FnFF F"FFFF4FPFFFFF(FFFFFFFFFNFFtFFFFFF FF͞FFńFĔF"FFFHFFF0F,FFFF(F&FFnFlFFXFFFFDFxF̞FFFVFFJFZFFFɂFFFFFF,FF(F"FFF0GFrFhFFǐFFFFFFFF*FFF FFFvFF2FF8FzFF:FFFF~FFF F|FjFFGG G FFpFFlFFFFFFFFFF"FFTFF8FHFxFFFhFFFFFFFFdFFLFFFjFFFRFdFPFTFՆFFrFGG FFFׄFϔFÚFǺFFtFFFF6FFFF,F~FFnF<FFFFZFNFF"FɂFvG GGXGlG*G+G4G3G!GG5GFG|FnFFF|FFF2FʈFF~FFTFàFF:F2FFFfF<FHFFFFF F4FGoGGF@G^G G FJFFFFFFFrFFF FFɈFFNFFLFFFF,FFFF^F>FF~FbFFvF^FFlF$FFFFfFRFF4FFNFшF>FFFFF.F^F&FFZFFFG G3GZGGhGGGwFLGG7GGiG_GGG'mGGFGD>GbGDxGOGSGnGlGsGLGNuGLG>GEGDGiGooGGeGp GKGJG4G-G(G-(GFG@GIGkG^7GVGIGIrG69G7G9G+G2G2G+G$`G,GA6G>G GGFFDF>FFbFѲFުFՄFFFFFĜF$F0F,FۚF׎FFvF.FFۨFxGGGGG54G/UG@G2 G:G(GG G5GGG'G5G,G4GPHGVpGjG;eGCGE_G5}G,rG'G'G&uG oG 8GG bG*GGWG -FFvG[G:FF\G G#CGGGGGFFFFFF|F F*F6GGG2G9vG4G,GBG0G/7G3=G4G<G(=GrGF~FF:F$GGGG GGyG GG%G!mGKGGGG GyGG -G'G/_G-GG GVGGG/G)GG!GqG `G F<FFFFnFFFFGGFrFFF"FFF̄F˖FƒF^FԆFFGG GGGGKG2G?MGGHGFF~FFFFFF4GyF&FF*FFtFFbFZFFF۶FF˚FrFdG\GGGyF~FFFBFF݄FBFF>FFPFxF>FFFHFFRFǮFDFFF\F|FF FFF0F$F۴FrFFF<F$FFFxFFFFFFFdFFFTFFFF8FFFVFFF,F"FFFFFFFVFVF?F6F:F5FA FAFPHFWFZFDF>F= F'F,F*,F-PF8 FBhFH<FBFadFSFBF>FC@FG$FP\F\$FfFoFxtFqFmFctFK$FQF7F:F4F.F. F6DF@F?FLF<FBF.FFPF,FFFFEEHEhFFF FFFDF%FF&XF&F'FFXF F@FE0E@EEEEEEE@EEEEpEE0EEXEE EEEEEEE0EEpEwEaEMEBpEHELE@EHEPEQENEZEXpEmEm@EEEW@EG@EF EXEeEIE@E,E EE%0E!E `E%pE$PE@E'E'E@E@D4@D4@D<DHDHD?DDDGD^@DgDD@D DD`D D@DDD DD DD D@DD DDDD D@D`DDDDDD DDD@DD`DDDDD DDDDDDDD@DD@D E@E 0E PEE @E EEE%E-`E@EE%E4EKERPEO0EPpEV@E?E=E*EEEE3 E3EI E5PEBEP`E*EPE)E/E!pE)E/E'EEE6EN0ENE@PE=0E<@E;E0`E1PE1@E0E6EUPEm`EbEhEIEPE=0EOEFPENE]E`@EuEE EEEEHEE~pE]EfpEjEoEfE]EOpE[Ee EkPE_`EzEqEh@E]`EgEXE_E]E\EmE~Ez Er EhEjElEhEz EE8EEHEpEEĀEE˨EEEEpEE(E(EEE8EhExEE EEEEEE0EEEEŨEEEEEEEHEHEE(EEEE`E0E@EE@EE EEEE`ExEøE͘EEE(EEEE(EPEhEEE(EHEEEEF EEFEE`EhEEEEhF$EPFFF hF DFFFFFEhEpEEEEEEFFF 4F FFF F `FF@FFFHFlFFlFTFFFFPFF DF0F|F F(F.xF- F0F)$FF"@F#FlFFPF LF4FF\F$dF$FTFF,F/FF6F+F.$F6$FI<FftFdF^FN@FIFD@F=F7F54F&F!FFF|F LF FXFhF8FF FFF8FFF!@FFDFFF$F%F(HF.,F.0F,(F>`FJTFDxFJFYFfFdtFp`Fi4FSFLF@F3F<F9<F/F7DF9dF,F(F'F5F1tF0F4TF.F8 F(pF'FFPF`F#F3hF5F9FGFF,F>FGFOFMTFBFBhFDDF?F54F3F1F)F#F(F0F6F4F6hF9$F: F=FAF<F9F5F1,F&<FFTFF `F HF$F+F+0F)tF+F+lF;F@F?FFLFQF`FdFn<F~FlXFkF^FM0FEhFGFJFHHFTF^FZF[$FdF_F`F^XFX`FR(FAFA,FLXFLFAF6F7F0F+F,F3dF3dF6dF0F,lF#PFFdFF$ F"FFFXF"(F`F$F*LF6FBFEF=F@FGFOdF_FblFfFnXFp0FtFFFwFi(Ff$FfF[FTpFVFQ4FWF\F\FV FQFZFR`FTFUFSdFQ$FGFAF= F@F>\F@F;F8$F4F4F3(F2F6F/F/F2`F?FJ8FH@FHFAF6F9F3F6|F8F<F>|F@FJFJFT`FNLFRFV FOFIFHTFOFE4F@dF>F>hF=F@FCFHF?xFGFGFR8FGFGFVF`(FeTFgFu FuFe FS0FYTFcFq FFZF2FFF FFFFFFFFFnFFFFpFFFg FTTFPFMxFMPFHFCF>TF8F5FBFHTFMFKFGFAFG<FUF[F_PFjFwFwtFrlFk@F~ FFzFFFFhPFh FfF^FY`FU F[dF]F\FRlFWFWFYFRFY FWFPPFQFPFNFTFPFSFT F]FMlFIF@F?F>FHFOFThFVDFOhFI F@PF;tFCFDFPTFQFGFO FfXF}FZF4FFpFzFF,FF`FqdFkPF^F_PF^ F_FmFw|F~lF{$Ft|FrxFtF~ FF(FFFFFFFFFFFrtFn$FwFFvFwFeFf FkPFfFlFdFaFbF^0FW<FQ FO$F] F[FcFvDFuFhxFmFiFl\FnFq@FyF}F|FnFk,FmFiFrhFxF{$FdF[FeFFxHFF}FnFbFaFr FFFzF}dF~\FRFyFjF^@FQFS$FXF`XFpFvFwFuFoFcFeFdPF]F\tFX|F_FfPF`pFj0FwFlFn4FWFNFIFJFP0FUFTPFYFXF^FfFp FpF_`F\FOpFPF`F_ FmFudF{FtF FF|FyFmFalFh FohFuHFmFpFFsFvhFkFfFhF_FelFFZFFtF|FF|FzFdFxF2FxhF~Ft FpFsFf|Fr<FnFvFzF,F{ FTFF~F|FFF{FFFyPFudFpFnFqXFcFc@F_F[FUF\ FcLFwFodFcF\pFQFFTF@DFEFIHFVTFaFfxFnF~hFfFnFxFrFo8FvFpFFF6FHF2FFFdF:FF~FF FFFFʆFbFFFFFFFFFFFtFJFjFNFhF@F"FFZFF<FFLFF&FF$FԘFpFFFFFɒFNFHF"FFF~FFFFFFFfFFFtFFFZF4FF"FDFF8FFF$F*FtFzFsXFu,FzFFFFxxFq4Ft(FpF|FFFLFFF*FXF<F8F(F:FtFFFlF*FF:FFFF8F8F0F"FvFFFFFF\FFFF~FLFpFdFBFGG&GFRFڐFfFFdF^FFNFFFVF˴F\FFFۤF(F@FF8FFFzFňF\FFFFvF0FFFFFFF"FHF0FF6FFFFڌF FF2FȊFFFLF:FFF|FĚF&FrFnF@FFFFpFZFF"FTFFߒFFVF^F.FFbFFFFFFFFRFFĀFFFFrF~FFFFդFٶFF۪F^FtFξFFfFFǐFJFtF"F6FנFFfFlFFnFGFG sGFrFF FF"FFvFFvFFźFNFXFFfFF&FNFF2FFFFFF<FFFFΰFHFζFFbGG G8G2G FFLFFF"F FF0FFƶFF0FnFFF FFpFFNFNFFFFDFFFfFFzFFbF:FǒF8FGFFF2FFFGGzGaG sGTG FFFhF*FGG0GG,FF͔FҜFFڰFzFFRFFlFxFȒFF*FަFFJFG1G FGGG&G.GBGaGijG@/GG.GGG GJFFFFFfFxFFtFˆF͞F^FF F@F FFFȊFnFFܾFݰFbFG G(G G+G^G GG>GGFF`FFؾFZFF.F$FFF0FFFF0G#GG/GGFFFFFHGG GGGFFFvFbFVFFF<G GGG 8FFFF^FFFLFFFFԘFFFFZF F&G GFFGHG G `FFGSG mGMGGG#G&~G1HG%G G?GdGUG\^GXGvVG| GwG^G^GbG\Gi GnGGGGGGGwG`GFG8G.G-G<GKGLG`qGS:GMGSGRVGBG@eGS]G>G5G0qG7G4ZG.G;G1~G;G SGG GG`GmFHFLFFFF FFXFFƪFDF FјFLFlFFFڼFG GGG*G2GAUGH2GNG>GYG?G:$G GpGG&G/SG&GeG'G8aG*,G%G'{G%G%G&GdG;GZGDGG GGG7GG GGrGG%KG:GOrGF[G:G+{G_GoG3GL)G^xGXGb4GmlGVGDbG-G"GG@G9G3G2G4rG8G5G8G3{G6GGG:G5GG4G'`G+G>OGGG)XG&#GBGWGWEGL GMGUaG1#G G@G$G 3FFFFFFٰFFfFϜFFFFFFxFGTGG;G GGkGdG GG9GG`GGG$gG(&G&IGGGG GHG!G0G0pGG)XGzGGG <G2G>G!GTG>GXGTZG_=G^GlWGTGNG4G4GG0GG(uG*GWGPG G |G G GSGF,F&F&GVFF0GG FFFtGGtFGFFdFFZGFFGG"G0vG3+G?G9G1G/G+/G#dG0uGG =FFF؜FТFFFZFFF^FނFHGG*G!(GGgG G"GSG FGGGG&G3:GG GGGZG&G!iG hGwGGGGG"FHF&FFFrFGG sFG?F|FXF~FFTFFFFFFFGGG >G qG`G'oG/G%kGbGFFPFfFbF\F FFFF8FݺFFFtFڢFGF&FFFFlFvFGGGGKG G G FF&FFFjFŬFxF FFZF&FFFF4FFFJF,FF$FFGGGF^FτFFFоF`F@FBFӦF|FZFFFFpFFnF>F~FFFFFF|FF|FFFF,FF>FFFFp<FAXF2XF0@F/tF9DF;(FCFB F\dF^dFKlF>tF;F+FF!XF#F)F1<F9F9FTLF`FJFCFIF;(F4F@FSFilFgFrFjFcFAF3FAFC,F2hF=F8F3F:FCF8FK\F;F4F,FtFF<FFxE(EHE8F8EFEXFEFFF FF F F4FF F FhEXEEE0EEEE0EE EEEEhEEEEE(E0EHEE8E0EEXE@EzEc`E]EREREF`EK EJEHEOEIPEDEEEJE\EipEPEEuEKEEETEqEfE^E>E3E#E$E'`E@E'`EE"E+ E2@E5E`DBDBD6DCDSDRDZDIDIDdDr@DDDDDDD`DD D@D`D DDDD@D D`D@DDDDDDD@DDDD@DDDD`DDD DDD`DD`DנDDDD`DߠDD`E EE EPDEEEEE EPE E"E:PEKEb`EfEJPE=E80EAEEE`EE. E*@E4E'E"pE/`E"pEE*pE%E%E!E+E(E E'PEHEQEAECPEFE8`E7PE+E-E0E?0EA`ElEE|0ElEfEJEDEHEDENpEUPEPpEE@EPE0EEEx@E0E|EkEhEbE]EeEh0EUE`Er EtEsE8EEnEmErEEwEq0EnEw0E`Et EkEoEoExEE8E@EXE@EE0EȰEE(E`EEEpEEEEEEXEEE@EpEEExEEE8EEEEE0EEEEEEEEEEƐEE˰EE`EEEEEEEEEEEˆE`EEEEE`EEFlF|FF4FEE(EEEFF FPFHFF$F`FTEEExEEXFFtFF PFxF FFF TEEhEEpEܐE EEF|F(FdF |F F$FFFhF FFF FFTF FTF FxFDF F pF F FLF pF$F1F1F6F6F,\FF4FFF4F FpF <FF#F!<F(F'F.$F5pFG4FLTFhF_|FMF=dFG8F;dF0FF0FFFFxFFFFFFtF FXF$FFFF&LF.F.F6HF/`F1F3tF3F4\F6FGpFMFP$FWFhFQFMFW8F_ F]F`FNFJ,FLtF@(F6HF@FQ`F[Fq<Fg(FqTFdFUFHFGFGF9(F*LF#DF lF!FFdFF FFFF"F |FFF#F)tF)F"FF F"F$@F*F7F= F:LFAdFRFNpFN8F]XFapFfFkFqFgFW4FS<FUFLFNFAF=PFAF>F:F9F@FKF;F;F<F:(F9PF7F/F+XF*(F-F3|FQFRF[(FWFV\FS,FLFQFJFN`FRFX FG\F7F4F5HF:F5DF7F:FDFFFIdFNFLFUFJFMF<F;lF1F)(F) F4F7DF7HF3F<F=,FBFCFAFM`FMFGTFPTFNFJFHFDFJF@F88F2F3F<(F8F:F.F+F>F@FMFaFd(FqF|FF}Fp$FkpFgF^<FVFQFR8F]$FdFhlFgFmFsxFFqDFhF\,FSFWFq8F\F[FIFGFElF>F<8F>DFBF>F9|F4F3DF/pF'F$F%F'F$FF"pF*F1F3F8F=FC FLFOFIFHFNFUdFWF_tFn|FFFFFFFFF2FFt4FmFn`Fo@FnFuFj,FZFX\F[$F[4F[dFXFUFOFGhFF<FCF<FC`FAFFFFDFjFF*FRF|FnFVFFFnFFpFFFF.FFtFxFFFF(FFFTFF8FfFFFF.FFFFFrFFrFFF@F(FFFnFFRFdFFFFFFF|FFFFFFF<GG G GfFbFFFƬFJFМFˆFjFdFՖFͬFFlFfFPFGF\FrF6FpFF:FF^FFF,FPFnFFF&FFbF&FbFhFF2FFHF0FFJF8FJFFFF*FFF0FDFżFDFF4FFFFF:FzFF|FFF*FFFFFFFXFrFFzFFzFZFnFۮFFF̊F$FFF FFFZFFFFˢFFFFFǐFFFŔFFrFF,FF,F<FG G G FFFF~FF^FFFnFҎFFXFxFFFFєFVFՆFFFĎFɶFFzFɞFFFF˖FˌFբGVG GGGG,GGFRF FFŦF,FϠFpFѸFFFFF FbFFǒFFTFF0FFFהFF`FF`FFfFF:F`FFLFGG G{G]G GGsG GG(gG%GG G 3FFGNGG!cG*HGG lFGMGFFFFBFFF:F.FPGuGGGG *G-GTG+DG1G-G0GHG\G`GR3G+G 2GGGlG G8GFFFFFFF\FFrFFF®FFתFF^FVFFGGGGG%G VG"GjGG G#PG"#GF(F~FFRFFFкFtFPF:FF\FG'GGGG.!G7G-GG aG GGG GGG"GG lGGG5F:F>FF\G G G GGGGG FLFHFFpFNFF<F۔FF FDGFNFGG^GG .G ;GLG gG^GG$G#GG&jG5GB GUGGRwG=G?G\GYGY'GM Gd)G|GGtGx7GqGqGG{QGoGGGGGGq\GRGDDG2 G?)GWGVGQLG] GW4GXGXGGY`GJ3GB?GE9GVGLG>-GCbG8kG.G+G)GGGGGGG 2GlFFpF`FFF:F4FɒFFJF2F2FBFFFFF GvG#GDGG'pGFG]!G`GO Gf GeGEG9G)>G)G(G1G+G/iG,'G)1G'G%{G%G!G%GG"5G*G" GGG#uGGG GfG4G!G8GG5nGgGdGMG7G)G!G%wG-G?5GeG`'GgGqOGlGWG:BG*G#PGG(G+mG2pG*\G0G6G=GMVGMGQEGH_GXGG=G<5G:5GQ+GYG4G.GMGXGahGKdGJGAG0IG'G$GG#:GGFFPF~FNFFҔF֢FFF^FFzFbGG GG|GGG8G%KG GG G?G dG :GGG%GWG G GG[GjG_G!G-hG0G4G1GcGG G^GGG!G>GdTGzG}GyzGGt+GKG1;G6G-2G*2G G4,GAG;G-GGG%GQGG F,F0F8GFFFdFZF FFRG QGG-GG G FtF<G4FGBG G"G3G6 G=GEmG6G$G G ;GGgG F<F:FFF,F6FFHFFĈF@FFGG%G*G GeG3}G$G&G:]GfGG!FG)uG'GGG GGGGGGG G/G#KGGG2GGZG GGGNG G 8GGGGFbFFXFFFFFGGG5F`GGTdGGGnGF.FFFʠFF FFF֠F^FFFٜFdFFG FGFJFFDF׮FBF`G )GGGOF.GEGF(F̐FFђFFF<F F(FFFFFFFPFjF˶F:FLFFGAGFF@FFFlFF˒F F4FxFF^F.FFFFFbFFFFF^FvFFtFFFFFvFnFuFVFFFFmFQPFDF0 F3$F00F:(FGFDFLFYFZFLFEF/F"F F%F$F"F-F2F58FMFPFJ8F:`FEF5F+|F98FJ|FY@FfFnFiF^F<|F,F1F1TFLF.hF4F-F7 F3hF.<F(F'tF#`F|F FFFEE`E EExEPEhE EEHEEEEE(EF\EE EEEEEĠEE8E`EE`E0EEEpEEEhE8EEEEEEEEXE0E{EoEaEWpE^ EIEMEDE@EEEDEBEFEE0E@EPEIEfEhEspE`EH EPpE]EjEX0EM0E/`E0E'E$`E#`E%E'E E"E1E1E#EDW@DW@DNDND`DP@DfDd@D`@DZDpD`DyDDD@D@D@DD`DDD@D D D`D DDDD@DD@DDD DD@DDD`DD D`DDD DDD DÀD`DDD DDD`DDDE0DD E E E`D`EEE E`E E'EPE0E;`EQ@EMpE-E2pESEF E*EE E0EEE#E EE E"E#E*pE!E!0EE#E$PE+E+EO@ESpEBEAEZE;E7E2E8EFEeEpEvEpEjEnEV@EGpE;EL`EDE9EEESEE EEE(EEnEw0EtEl Em@EkEkEqEbEe EiEsEvE}PE{pEyEq`EPEEE EEE}`EEm EwEqE~EhEEEEXEEøEhE8E`E֘E0E˸E(EEEEpEpEEEhEEEpEEXE EPEEPE(EHE EhE EE8EEEEExEEE8EΈEExEHEEE0EEEEEpEEѠE`EPEF@E@EE(FTF8F FpF(F F F\FTFTFF$FFFFF F FFEEEEEF8FtF XF4FdFF`F FE8EE8EEPEEFtFFFxF F FF FF&F#FFFFF`F F FFF4F TF FFFFF)F6F5F.F(FFFDFFF HF|FFTFXF$F'F.F0hF:FEFRFVTF`F_@FIFJFPF>,F.LF0FFLFF F#FFFFFFFFFtF,F&F0xF0LF/F.DF6F7HF@ F@4FD<FJFZ(FdFcLFc0FiFmFb$FoFhFe8F^F_F[FOFQFIFG\FT<F]FgFsF{FFgF[FXFMFL|F9F.hF' F)F# FF (F"<F#F)F+F)F)F'F'F.(F4F7F3F.F*F.F+F/0F;TFHFIFKFTLFbF]TFaFbFg FjF|FFdF(Fv Fb,FlF[FYFVFLFKPFJlFIFFFGFDFGpF@LFC8F:@F3xF2F2xF6LF?FQFblFdHFkFcFfFb FQFUFX F_tF`FMFEFAF=FHFAF<F=FCFG\FODFK,FQ\FSDFN FE|FAhF<F4F0hF1F8F:F=F6FEFNFW\FSFN,FIFL<FP,FVFTFQFPFGPFJdFNFBF?F9F?FG4FBFG$FAFGFSFZXFnhFwFFnFFF<FFF~8FcFfFrFxFFFBFFFVFFu FlFl<FdFkFmFeF^F\FPFKFCF=,F;F?F>F@F;F6F1F0F+F,(F*F.F*F1F=FDFI$FG@FAFMDFVFSPFMFFdFKF^Ff F~F@FFfFFpFFFBFFF|FpFw<FxF0FvLFxLFi F_\F_dFgFfFZF]\FXFTFO$FTFQFKhFFFC|F9F9F7\F;FEFHtFR FXFdFp4FiFbFeFdFmdF_FRFXFaTFgDFoFxFF~FFFz$F}Fk<F`FaHFk`FiFf4F\FQFS|FJ|FVhFT(FMFTF[(F_`F]|F`FcFoFVFFFF~FwPF,F,FFFJFLFFF&FFF2FFFhFFFHFfFF(FFTFJFFbFFFFF\FFedFXFRtFXFY$F[DFcF_FoFFF@FRF^FF FFFFFF>FF<F,F FjF@FwFmFrFsFNFFFnF@FwHFpFlFk0FkFo@Fi,FbFppFgpFfF^pF^F^FUFbHF^F`,FsFs`Fo@Fb FZFSFKFDFHlFZFeFc Ff0FwFFFRFFFFhFF^FuF|F~FwFrPFvFxF~ FFF FFFFFFF.FXFFF,F`FFFXFFFlF4FFbF6FFHF|FFFF>FFzDFsFh4F`FiFt$FsFtFxFsFF>FFFFFFFF FF F FF0FFwFutFTFFpFF(FpFFJFJFFrFFF*F&FFF}$F|FFFdF8FFF2FXFRFFtFqPFm,FmFkFFvFfF}FuF|FyFtF~tF{FvLFyFFDFFFFFLFF~FmPFk,FxF8FpFFF2FFFFFFFFbFTFNFLFFFFF^F<F~FxdFpFpF*FFFFFFFyF|FtFxFz,F{FtF`FF}F|FFFFFF8FFFpFFdFzFJF<FFxFRFFFxF~FF:FFFFFF2Fr4FbPFfFk0FqFvLF~$F}FF|FTFBFFFF FFFFFFF\FFXFņF.FFF\FXF0FFFFFFF\FВF̠F2FFZF¶FPF0FXFFFFpFFFF,FFFVFٺFFӦFۺFFFlFFFʒFFFLF`FFFFvF:FFFFFFFFRFlFF<F6FFFFFFF.FdFhFVF`FhFrFFFFFF(FF2FFxFF`FFFFFFfFFDFzF0FF̨F*FF:FzF(FFFFF"FF0FFFfFFFFFF`FFFGyG<GGGFFFLFF*FFFҮFjFDFZFFFNF8FGVFFFFFF4FFĬFFF,FzFFFBFFFFFnFF FFڲFFF:F FXFЮFvF FF:F&FTFF†FF&FF^FFF*FFHFFFLF6FJF&FNF FRF>FFFFBFFFFFF֌FFFFFFfGFFFFFFFFюFdFFߴFHFFXFFڬFFFFFF FFrG/GGG KFFFFFlFˆFѲFFFFײF4F0FDFFFӪFjFFFFFF\FF&FFFFưFLFPGGG#EG2G8'G?rG:G SFFJFBFFFFFFFFFF|F҈FfFF>FFJF"FBFtF0F$FʈFFlFDFF"FFGoGGJGGGG;cG;)G)GGG2G G"G+G+GsG UFGcG$G%[G0G)kG)G(uG G-G G GFFBFvFFG G|G2G@GGGGdG$G:GAG?G8GZGq]G`GVG;GGGTGWGMG FGFGFVFѬF6FrFFFTFFnFJF$FFzFFFzFXG GGmG$G-`G.JG37G3G=AG(G)G!fGQF0F(FFFnFF<FFFNG~G 2G5G"!G,KG:cG<G6G7vG'GGGG$G<G"9G#=G-G7GGGGGGFGGGG)GG tGGGG [G<F.FF֪FvFFFFFG?F0FGG}GGGGWGGGG,3G2G*OG*G=GWGdGmGO,GRG\FGTGjGYGfGmGpGdnGGGGGGGGGGGGaG[.GDGAGEGVG\ GW3GVG`G]GjG_GpGrGGGaGIqGRG7zG#G&G2IGzGqG mG GdG(GGxFFFFF FFhFlFϠF>FFLFF~FF0GGEG GGEGG+G;GVuGkGHGNGP"GGDG=G.G0GCG@G9ZG9yG4GCdGBkG&uG'GG)G GG$`GjG"G!}G%kGG GGhGG3:G" G!G?GzGdGPGRG_G7G6G8JGQYGj4GHGOVG`jGSJGNG?GBG6G,hG3G,IG7GHGFcGDHGFjGIGUGjGk+G]G=G8*G>GIGGXG?7G?G9GIGPGJG9G8UG**G!G(G#GG#G GGGFFFFFGFRFG0GGG G?GG"G/KG'vG,GGG@GG GGG G7G ;G GGG GG iG7G<G4G1wG3G#XGG|G`G G3GTGlGs Gs\GG~GmGMG>G1G2G,G.GL7GQIGWGU@G>G"GGG G|GRFFVF FFFFlFـFrFJG aG G G)GdGG EG -GGGGG GG"G.G2VG9mG#G#oG!GG&G[GFFFFF~FFZFXFFFԀFGG!.G, G8GPG:FG2G5RGLG@G0G#G.G4DG2iGGaG]G hG$GG(;G$GC0G?G99G(G!vGGmGMG;G#uG#.G GOG GCGG9WGGFFvFFrFFזF<GG GGGeG/|GG FF(F0FF&FFFFFF҄F\FFrFFFF`GGtG 8FzFF*FFLGGGFG FF>F2FdFlFFFĖFFFFFF\FFhFFFVFFϔFňFFFFzFFFFvFĶF2FFFFFFBFFF&FzFFjFFfFF|F8FlFFF>FFFFxFrTFmF|0FxFrFr0FSFEF6F6FA$FC,FOFdFSlFPpFVpFW,F\FUF-F&xF)TF$tFXF<F#F/LF/FIF:F+dFF#tF2F=$FB0FRDF^Fc FxFu\Fn@F`F7F"F|FFF)F&tF1 F.\F+F1F,FhFFFE(EEE`E`EEF0F EhFPFEPEFF0EEFdE8EE(EEðE EEEEEPEhEEEEEhEEE0EHEEEEE`EhE8ExEyEa@EYPEXEUECE=E@E;@E?E=pEBEA@EEEW0EeElEhEiEr`E^EZEYpEVEM@E? E<E+PE*EPEE' E#pEEE"PEEEEDUDUDMD_@D]DSDhDsD^D~DgD~DDD`D@D DDDDD@D`D`DǠDDD@DD DDDDDD@D DDDDDDDD`DDD@DD`D@D DʠDDDEE@D@EEEEDEEE,`E D`E`E!E7E!0E(E)E E.E;E9E*E#E50E?@E4pE)EEPEpEE pE!0EEE&pE`EE `E*EE!pEE&E#E3EQ`E>EB EKEME: E@ E8EDE^pEE`EvEZ E]EdEYEHECEJECPEEEA0E\ Ev EyE@Em0EXE}Es@E~0EvEh`Ei`EbPEcEh`EjpEvEzE{PEEE E~`EEEHEEEpEEEEXExEvE(EEEEEEEE֘EpExEոEEEEExEEEhE`EEXE0EEEEEEEhE EEE0E EEEEXE0E@EpEEEˠEEEEEEXEEEE0EEEËEEEEEHEFF$FFFLFF$\FFxF FXF F FFFFFF FF FEEEEFF,FF |F DF(FF FEEE@EEE0EPF F LF ,FFPF FF|F F$F0XF-F$FFFtFDF FFFFFFHF$F$FF&pF4F;0F7xF3,F1F$FF$FLFF F xFFFF%\F(F7FAF@FFFZFYFfhFZFLFKFDlF;F&4F#hFFF!F+(F9dF(F#`F$`F"LF HF!FF*dF&F/F6F8F>lF>F:FGFJHFMFMFZFbFiPF|4FylF.F{ FxF$FxFkFjF^8FcdF[F]FPFGFN@FcFrFy@F{(FFoFeF`dFVPFG8FG(F:F4F3F40F-tF(F/F(F+F2F>F7F:F/F3F F=F8F/F2TF0F2F=dFItFRlFVFXXFqXF@Fp`Fg FHFFFFFFFxFyFn F`FYFPFGFBF>F>FFFL(FLpFKLFFFAF@0F<FE`FQ FaFjF{DFxFxFFF{Fe@Fb F\F]`F^FXFPFUFS<FMFJF?F>FGFN$FMFMFMFMxFOFMFI FAxFGFBF@FCxFO8FOFPFWxFmFrlFjFdFX FRlFQFNFUFODFIFLFL FTTFKF=tFNFYF_\F_F[LF`XFa<Ff<FyFF2FF FF^FFFfFFFwFtFTFFFFFFFFFydFy@FoFrFmxFk`FiFmFqLFWFMpFEFM<FGhFJFIFC FDF?FFFFFFFFFXF F\FF0FF:FFFtF4FFFFFBF0FF$F FFFF~FRFjFF^FFFFF FFFfFFFF{FqFtXFuLFvFFF{FxF~hFwFFF2FFFFxFF8FFFpFbF6F@FF}FFF FF>FLFFF`FFFFjFFFxFFF&FF$FbFhFhF6FFHF,F,FZFFF2FfFFzFFFhFBFFFF$FNFFFFzFFFRFDF$F$FFF(FF0F$FlFFnF$FFFFFFFbFRFF2F^FF$F FFF FF:FjFFFFFxFF FtFhFFZFF؂FF,FFӂFF,FRG0FFFFFFFFFFFٔFF|FƠF FڼFFtGGFGF&FFFFJFFזF߈FG uGGGFFFĄFnFFFFFFɪFF FFXFXFFfF@FFdFXFfFF^F6FFFFfFFFpFFFlFFjFFFFFFFFFzFF^FzFRFFDFFFFFRFѠFFFFFF:FFfF6FFF:FFFfFFFFFFPF"F>FnFVGLG GGyFFjF4F֦FFbFrFFǸFFۖFFDFFFFNGG GFRGGFF6FFFFNFFF*F>FǦFjF F0FpFFnFtFHFVFGGmG F`FdFƒFbF<FFȄF^FXF϶FjFFF(FdFHFHF>FFnFFFFFFhFFhFFFFPFFFFŊFǾFjFFF`G'G~GFFLFF FF FˮFɂFʺFF2FFPFFFFF^GVFF FGG$GGGG GFFFFFHFӬFF:FTFFTFfFFBFtF߄FFFF:FFhFFFFۘFF8FFΈFGGG!6G*3G'rG2G$G FF F FFFTFFGGvGkFFPFPFFNFFF2FGGFhFFF^FߘFJFF|GGGG'G`G/5G5G03GEvGEJGAG4WGG,GG&qG!nG&GLG GLG @GGQG2G#G!G%G.6GGnG5GFFFF:G*G sGGGGDGGG$G:2G9 GNGWGWGzQG[qGDG2G'G!G!G$GGG 9GGFF޾FFFFtFFFTFɈFFFF~FFTFGGGG3G,}G0vGLGGBG:QG2GQG'GF&FFTF6FF\F(FFGGG#<G!3G&G&G7VG?^G:bG7G,G4G.[G*G RGGG-G@zGIG07G#G(IG'G!_G GGGGtGGGGVGG G&G3FFFFFGG%FrGGGGG GGlG G GGGGG*G,^G-`G=GCKGUeGgGowGaGqGrGVGY$GSKGTGgNG^kGXGkGGGGGGGGGzYGiG^GO?GQGVGK{G`!G_)GdGqGlG|GGGGGGGGeGPGFG1G+G2$GGG jGCGOG?GG]FFFFFFFRF2FޚFTF@FG GcFFF FTG GGGGG0GUGvG;G8XGAGIGBuG@GEuGMGb GPGLG@GSGYGLG0G(GG(G$GG{GGG(GGGKGG#_G<G@G2GI3GsSGrGUGLGNoGdGG`G^G^GsGOGGGRGO?GXG[cGSGFG@GDG6G/G6GNGWGNGRFGYpG_~Gn_GofGIuG3G1G<'GFaG-G7G;GDGCGBFG1PG,G%HGG'7G3EG"G&GG8GG GFF2FGSGvGG$G TGG@G&SG$GG"G'UG&KG&GGGG GLG G wGG bGGGGGGG1G;GFWGP)GLNG)G ?G GG,G:GG=Gh<GrKGwGsG{GtGx*G[oGBG.G)dG:-GSGeGb;GG\GG"G1G$SGlG G hG;GFFFtFFFzFF*FFGGGG-SG'GGMG GGHGGG#GGLG!GGGG"G G#G GGFPF@F4FFVFFFRFFFFGG)G&xG,G4GAGIG97G_Gq&GNG0GAG6G1G7lG)LGG G"GG-bG8GEG+EG GG&zG QGG HG kGG G zG G>G\G^ GcNG aGGWFFFFFܮFFPGFRFRGvG UG_G F8FFFdFǶFbFFF0FF"FFFFFʂFhFlFԐFGFGZG GAF0FGTGG$GRFGF˺FFFxFFLFbF$FFFFFtFFFJFFbFDFFPFFrF FjFFFF4F*FHF~FjFF:F6FFRFFFFFFFxFFZFFFFFFFF4F@FFFwF|TFvdFk\FPF9xF.F.F6F?TFLtFY0Fc Fe FVFqFxF{FW0FAF6F'F*F F0FF"FXF F,hF FlFhFF4FHFKFZFhFFFFkFOF1F!F<FFF!8F:,F6tF>F>(F?F3F7tFFpE@E0EE0EpEpExEF F$F xF FF FFEE E`EEEȈEEhEE`ExEhEEEE@EEpEEEEEEEE0EEE8E(ExEu@EtEiEZEMEMpEZ0ENPEEEH E6E9EC0EBEAEY@Ec`E`0EZEPEaEbE_ E]EO@EGE: E:pE/`EpEEE`E0EEE EEE EE)D_@D_@DKDXD]@DdDiDDD~D{DoD{DD@DD D`D`DDD DDD DD@DDDD@D DD`D`DD@D DD`DD DDDDDDDDDD@DʀDDDDEE DE!E$EE`EE EE*PEDEE(E*pE#@E/E+E*pE?EFE,E'pE E;PE4E=pEE`EEE'E'E'E&E&EEE0E" E.@E0 E/0E%E1pE#E7E;0E<EGEHpE<EFE;ETEdE0EEkEkEbE_0ElE^@ELELEL@E:E?`ECpEX@EbEhEfE`EpEoEt0EEEi`Ee@EgEbElEwEEE|pEErEEEEE0EE8EpEEPEEEE0EEPEEhE`E͈EHEɈExEEXEEE8E@EEE@E(EHEE(EEPEEEhEXEEEEHEEE8E`E EEHExEEE(EEҨEE(EEƘEEEHE(EEE`EǰEEEEEE8EEEFxFFF<FlF%F)F&HFtF FF(FFF(F\FF F tFFEE0EE`FF<FFF F $F F F0FEEE E0FF F FFFFFFF 4F$FHF* F8F1FFFF0FFF FFF FFtF%F*F&F*F-0F7`F5F,xF*F"F!F4FFF F F"F'F0F/<F*hFA@FJFM<FL FStF`FfFXFCFBPF3@F,F)FF#F%F5F?pF;F0(F+F$F"F&,F-F6 F,<F7F@FFFJFBFAFE,FUFUFJFY FT(FeFzF~FPF@FFrFF{FrF`<F^FeFVhFWTFP|FMF[FoDFpFqxF@F{FjDF`FR FWFQFHF; F;F=F<FCF@4F6 F< F:F>FCFBF7TF;F:<F<F:F=F7F;F?F<F=FCFWFWFfhFvFdFF}F~FFFFFF.FFFFtFsFilFOxFDF?F>xF?FHhFW0FUFVFLFP`FT$F\HFaFT$FiFpF}F:FFFF4FoFj(F`F\\FZFZFNFLFQFZFU(FKFIFMFW(FWF\dF_FR FTFWxFUFX|Fh|F_FN(FOxFcFrFlxFe FuFFuFlFgF[HFVFU@FW FZF^F`F\F]F]TFbFfFqFs4FtxFx FF~FF&FFFFFPFFFFFF>FJFFFF:FF\FF\FFFXF~FhF|FwFy@FFPFFFrF_F^FW FQFO\FRFNFLFO@FXPFUtFH|FBFGFJpFO0FSF]0FkFlFa FR FXxF\Fa0F`F\pFWFz8FjFFF6FF@FFFF^FF:FFFlF0F~FrFn\FklFq|FqFghFj\FuhFpFiFmFjFiFpLFT0FKFKFKFRFSDFPXFX|FgFnFt0FFjF{FFrtFnTFj<Fd(FkHFoXFrFxF FFFFbFHFtFy(FpFqF{F~xFpFpFcF_FY0FZFbF]Fg|FiFlF^FedFx$FoF^FF.FFFFFFĔFF<FFFBFFF6FFnFFF~FFFFFFF8FFFFNFFƼFFF^FFJF{FyFw\F|dFFFFF~FHFFFxF|FFbFF̐FF&FJF FvFF.FFFFFxFFFFFFjFFFFFFlFFF:FFFhFFF0FFHF`FFtFFF F,F~Fs8FyFF}hFFHFFFFFF2F<FFBF\FFvFFFxF~FF(F0F$F:FFFFFDFưFLFF֐FFFFFFF2F^FTFFfFNFFFFFFFF8FFF}FF{HFtFxF|FFFFzFF:FFF<FFFFFFFFRFFFPFvFF8FFF(FF:FF,F FFFFFFFrFDFdFFJF@FFtFF$FFF F4F{lFy4FzF}|FFF}FFFFzFFFFFFFFFFF2F8FFhFFFFF(FFFzFF|FFFFxFFFFJFFFFFF F0FFFFFZF6FFFFtFFbFFF0FjFFFBFFzFF:FzF"FF$F FFFtFFVF FFFFFFFFFFFFF\FFVFFFjFFFFFFHFpF"F$FF FFF@FLFFF@FFG[GFRFFܜFzFlFpF^G4GQFbFيFzFxFF$FFBFFFFFzFݞFlGFGGGGG G\GJFFfGGFGGGG.+G.G"G#GF FƘFjFF|FvFpFFF>FFFF<FFFFFFƘFFFlFFFxFFF8F\F4FFFFFFFnFjFFtFF¼FNF@FF,FF\FFզFҔFFFxF\F(FՒFFFF~FF&FFzFvFFFFVFFFJFF@FܚF|FG6GGFG-G(GGFhFFFFFF FF`FVFnFFBFFG GG GG G FFF*FךFF2FFFF~FFFFüFhFjFFFFGGG)G PFFPFNFFFjFFҾFFقFFFĞFFxF|FˀFFGGGGAFdFFFݘF۾FզFFFnFF FFܼF*FFtFVFG GG GG iG F FFF FTFNFzFFFFFZGG G G\GG1G?GGG?GG&GYGxGFF8FטF4FҘFTFHF$FFF F8F^FG?G WG vG+FFGG FނFFނF0FrFFۘF0G\GG"G0G2CG/G$G%GG@FGFFdFLFGGG FFFFGGF G cGJG GFFF^FFF GGGFGG+bG,G;LG2G1G0=GFAGIG@5GJ1G9G=sG"4G'G) G)|GGGG1GG19G6sG$G#G G,G3|GBG&GGFHFvFJGG G GG(cG"GG)G,GDG@GIGP?GgG~pGc<GPG7G){G$pG#G')G uG'G pG&FFVFFlFhFxFFFFFÂFͬFҮFF2FF<FGuG IG G=cG5G9GJGAYG2G8zG-9GGGGGGGFJFGG GpGpG :GG'NG/.G9rGWGJG=G4{G0>G)G-$G!+G*XG G$G:GEG@7G4ZG4G,`G0G%GG GGG"TG")GG GGG$^G:GwGG {GoGiGG >G GGGGGGG G jGsG-G5GGpGDG"G*G,GBMGO_G]G`%GfGZG~G~GgGUGPGU)GmGWG_GGGGGGGz+GGGuWG_GCG6G<GMGS)GdGgGZGGGGGGGGGGGsGatGRhG;G3G98G%aGGGGG5G OG :GsFFFFFdFFhFFDGUGGG yG GFFGGzG9G HGG8GM>GltG<GJGQZGK(GHeGFGGGVGhG_GO\GU2GS"GQGFGEG1<G VG(G-rG)G!GG0GIGG#G&GG,eGNG?G5GYGi]GxGl GRGWGuGlGiGg3GvGbbGa0GVGf[G^GWGa<GNGGGDGIG4G:=GBqG;G=G9AGE~GFGW6G[G3G2\G1WG4GE/G.G*6G-G6`G@iG44G8FG/OG)G >G$G,G,G- G%G.G.G1GRG ^GUGGG G;GGGGG%G G"G!G\GlGGGGGzGGGGF`GG&G]GGG,G2WG3qGAwGIGE G)QGCG!G,G<GSGmGcGG^4GsGq=GTGpGQaG4G9G:G[GoXGwGGGz`GAG#GGG>G bGGGG)FlFFFFGG KGOG'RG:YGEG-4GG!GGLGGDG{G^G(RGGG-GGGVGG YG cFFFFlFFrFVFǼFFFFļF`GG?GGG)dG9LGFUPFj$Fe`F_FZFc(F\FqFRF:F.F$F"FLFFhFF FFFdFPFF#F5\F2FCFEF`DF`F:FcF@\F;XF,FFpFFF&FBFD<FP|FFFDF=F5F)FFF\EEEEEPFF FF FFF pF pFPEEEE(EEǠEEpEEEpEEEEEE`E@ExEEE8EE8EXEE{E}EhEEp0Ey`EnEbERPE:EO0EcECE?E9E7`E?ECE@EFEBEHEQEDEOEW`E_@EfEPECE4E'EE`E E`EEEPEE E PE `EEpE `EPDbDbDm@D[DcDx@D@DDDDDDDD@DDD D DD@DDD`DDDDD@D`D DDDD@DǀDDDàDDDDD`DD`D@DD D@D DD؀DրDD DDD E`EE@EPE E EE E E @EE`EE,E!E9 E4E5EApE@EP E?@E+E0E?EQ`EF EE@EE E/E(PE5E/EE'EE(E5EVEFED`E< E5PE7pE1EG0EGEPEJE?pEHEOE_EEE8EPEi0Ei EiEuEe EXEXELEHEQ0E[EV@E\PEsEzPEq`EnEq@ExpE@El@El ElEnEsEy0E(EEE}EvEwE(EEE`EpEEEEEEEEEEEEEEXE0EٰEEHE8E̐EEhEEEhEhEE EpE8EhE`E EEEEŸEEHE0EEEhE(E E8EEEEEEՈE0EhEEEǘEhEEPEEEE EEҰEEE(EHEPEEPEFPFFtFF F%lF2HF)$F1F(F ,FxFF FFFFHF(FF@FEpEEEFFF FFdEFF @F FFEXEF`F<FF%|F#@F"PF*FF\F F FPFF*dF3HF0F'FF FFF F dF F F F|FF,`F0xF0F+0F,F+F4PF)$F-,F*F& F(F!FFDFF.F2FCF8F:XFBdFGFE FOF[\FfFgFSFNFFF8F6TF+F,F/|F5FFFEPF=F;xF/F(F.XF9lF<F6F<F> FGFBFC0FNDFPF\FRFRFQFX\FeFs(FF:FvFF`F|FFyFiFadF\FahFPFP(FOFNLFSF_Fz8FwFoPFkFmFcFVF[F^FL8F=0FC`FDFE FBLFB@F>FB8F@FHFDF=F=F:FDF?LF<F?@F@hFElFHxFGFHFMF[HFeFrFPF(FF|F{FFF.F`FlFFFFFvFblFTDFKFAFE<FRFdpFkFdxFf,FiFiFxFFkF0FF$FFF FvFFtF|Fo4Fi F_F\FT`FQFUF\FW@FhFaFmFgFu@FhFv(Fv,Fj Fl@FiFxFx<FjF[FaFdFsHF~@FxFqFF@FFwFgF_FoFcFiFldFg8FgFoF{DFFFFFdFFFFFFFFFF>F`FFFFFZFFtF F~FF~TFFFFFF&FFFlFF}LFFjFFFfFo,Fe$FeFXPFKFNFNTFRXF]FjFeFWFMFUFVFYFflFhFmF4F|Fk\F^FatFhFi8FcF]FmFFFFFFFFFFFFbF(F*FFBF(FrFFu,FlFu(FrlFwFhF~Fr,FlFpFsFoFn F^$FRFS|FMFWFUdF`FkF{F\FFFdFFxFoFs8FpFp FFFFXF8FRFFFTFFF~PFpF|FFF|FwFpxF^F_F]Ff4Fm|FmFqFrFmdFvXF~$FFFF@F`FLFFFäFހFVF*FBFFРFFFFFFF FFFF|FdFFFFŒFF4FjFdFFF(FrFFFF~F>FF`FTFzF<FFFHFFZF,FFFԠFFF˘FńFFhFbF$FFFbFVFFfFFXFFFFFFFF`FFF*FFTFFFFFFFF*FF6FVFFnF F.FFFFFFF:FFF0FFF`FFFF F>FFFFF^FlFFRF\F8FTFFF^FFFjFlF(FFFFnFFFFFFFFF|FF>FF FFFFfFFNFFF\FFVFFlFF F FbFFhFFFFFHFFFRF\FFF(FRFtFFPFFFhFHFFFF̊FFFVF&F\FFFFFFjFFNFF$FBFzF\F8F2FF|F0FFFlFFFFTFHFF\FFFHF6FPFFF&FFFFFFFFzFHFF^F&FhFrFFFFFFFZFFF FFF FxFFFFRFFF0F>F FlFFFF&F8FpFdFzFFNFFF̲FژFzF@F`F٘FFxFFDFFNFFFFFF*FâF FՌF۶FFF8FF<FFlFFFFFFFFFDF.F4FFTF"FdFȜFGGGyFJFFFFFFtGG _GGFFFFFFG/GFzF^FFFFG GG# GoGNG>GGFGpF.G GGGGG8TG(GG9GRGFFϖF|FʾFFrFXF6FӀF FȀFFFF F|FF܊FFF6FFDFFFFF"FFNF0F\FlFFFFFFjFFNFnF,FFG.FFGGFFFF FFFފFfFFFFJFF*F@FFF\F|FJFFfF˔FHFFF&GG*G GGGG(GG FFFGG F>FbFFFrFFGaG)GGGG!G RG`GFHF,FބFFFFFHF~FFFRF6FТF@FF݌FFGGG#G6GeFFFDFFGFFF2FFF FFƔFF׀FF|G GG""G=GG GF~FFF<FоFFF(FؒF(FFZG GGLG G G#G'G%8GGbFF,FݒF6FFFJGWG FGZGG GoG'#G1G(G/G#9GG\GGG"G!GxGMGFF*FhFӒF"FdGG0G G qG{FGGGlG FTFFGbG dFFbFFF@FGGAGGsG5UGBG2iG0G GGG^GG GG G SG 3G G'G #GGHGGGGG#G:G,IG#G|F FFGG G *GGG+cG<G?:G?XG8G6G9GXBG^YGKGNGMGC(G#XGG"GG$GG rG #G#G(G<G4,G06G.GA_G=}G?G1"GpG CFFJFFGGG G&G.G6G0G>/GGGWGeCGn5GqCGqG]>GHG=;G'G*#G,G3vG&5G# GG FFFFlFRF`FzF˺FFFF^FbFFFFF4FNGGG6G1GEGMGWGSGTGHG0GYGDGGG GG8G>G rGG.GG"G'G.(G=GClGdGQzGFEG9G4G=PG3vG#G!?GG!G.GCGLG1G<G<G?G9G**GPG(G'$G0G*iG8G*GG1G9DGGGGkG +G G)G vGG/GGfGPGGG iGG-GG^GGJG"G#G*zGQGQ~GhGlGoGGGGGsTG^_GUGbcGTGVtGXG`Gu7GG{G}GhGqGhGbGNnG=G.ZG9GAGTGoG{GaGGGGGGGGGGGGaGTGFG9G,G)zG!GGG(GG;GG FFGFF0FF8F8G 'GGzG.GkG"GG8FGG!GnGGmGO,G^GoGwGG\GK3GAG@GFGYGeGqGGpGj/GwGQGLZGHG@!G.G7GG3G8G.G<G>GGG GG+GCQGG_EGq:GmG^5GkhGuwGaxGhVG]`GLKG]GQdGIG7G<G6UG>G?GBGOGB~GBG:G<G.G6G3G=G G)G/G,GFG:G6G1G/G!G(aG3G;pG6G9G;:G/,G,G MGGGjG GGGG#GG ,GGGG 'GGGG GFGFGG GFJFFFG 1G G#QG&G'G7GAG%G G*UG$(G&tG%G5>GCGTkG[Gv~G_{G^GPG[GR G?G<G>GHG]GyGGGGfGJG.G"%G kG G"G'G,@G'G*GFpFtF݀FGyGGG*PGCG=G)4G+G%[G=GtGGGGG&G#GBGGGgGSGG FFۮFߘFFFFFFϨFFFFFžFFpG GGG,G;G:GGGQGJrGLVGSGPG>GG*MG:G'?G/G4 G5G/G4G&GiG4G GsGGG(F*F\F|GG|G \GG=GG.GG sG G FFnFjFFFւFBF2F&FbFF2FFF~FF4FnF^FFfFFڐFzFFݎF~F*FXGGFFFFҚFTGaG RGG8G FF.FFJF FFFVFFFvFĦF.FFbFF\FFXF.F*FFFTFFFF<FVF8FF"FF FFFFFFFFxFfFF.FF0FlFFFFFTF.FTFFFFFFF6FFUF<@FF0F$FFFJFH\FPFHFKFEF?F6F)F,$F*HFF FF4FXF <FFF F FFpF|F,tF)dF0F&F@pFYF>F6F$F<F"DF`F4F,FlF!FFFNFqFUFKF<F& F `FFF `EEpEE8EF\F |F<FEEE8EPEEEEEpEXExExEEE0E`E0E0EEpEEE`ErEE{pEEEEzpEhE{E~`EExEEEtE\EKEHEJE5E5E5`E2E1E8`E6@E70E8E;PEHEMEOENEf EjE[ELEHE7@E.0E EE E `DE EEEpE E E EPEDDiDiDiDeDx@Dj@DDDD{DDDDD@D DDD@DDDDDDDD@DD`D DDDDD@DȀD DрDD@D@DŀDDDDDD@DDD€D@D DD@DD@DDD DE`E EPE EEPEPD`EDE `EE=E:EIpEC E:E90E9E@EBE.EE7pEIE4E EE.E(E< E;pE8E9`E'EpE%E:EaE^EJ@EBEE0EPE<ES ERpEYEUEK`EF0EM0EWEoEE0EEE|EaEhEuE_EdEm E_`EUEZPEYEWElErEPEt0ErEnEwEErEwE@EE|0EyE`EE(EpE~EEE EhEEEEEEEEEEEhE`EEEEըExEEpE0E@EExEEpEEEEEE(EEEEEEEEEEE@EEEPEEEEŀEXEEhEhEPEE(EhEΘEpEEEEEEEE0EEE`EF8EpEEEEhFF8FF#F$F+(F'F"FPFF F$FFF FhFFFEPEEhEE FF PF F FEhEE F FFFFF F\F%F&F(F(XF0F%,F(F FF FlF#F(xF+F/F0F0 F&F,FHFFFF @F\F4F#F,F8F4tF)xF$8F(F-tF'(F#F,(F,`F'F%F HF"F7F;\FEFKFEFEF>F@8FKFIFXFjTF`PFN`FKFBlF@F7F*F4TFCFOFeF`FJF>PF5,F/F6FA0FEFBFIDFOFSFPFOlFY<FbFXFNFH|F_Ff@FqLFzFFFF>FFFyF]F\ F]FZFjFVtFPFCFC,FUxFr`Fq<FrFcHFcLFlFg(FcFb<FYFIFMFMFLFKF@dFE@FG0FE F> FCFBFC@FAtFBDFNFHTFE|FLFIFJFTtFJFNFWFkFzFF`FFFFw0F{FXFFFFFFjFFqFjF[ FNxFIhFX$FiF|FsFoFuLFFF FFFbFFFFFFfFFXFuFjDFcFdFd4F_lFkFi@FldFwF}xFhFFFFFFFxFydFrxF~F~$FwFuFxFwF}$FNFFFRF8FFFFFFFy`FvFzFtFmFvFFvFFF"FvFbFtFF6FFFFRFFzFFFF>FFF0FzFFjFFFFF FFFFFFnF~hFFFFVFF|FxFoXFX<FNFI FMFUTF`(FcFoFbFYFd(FaFbdFiFgFtPFF@FFcFbFjFwHF{(FF FxFFFPFxFFFFFF FFFFFFF6FbFF~FFXFRF2FytFsPFoFn0FtF{F}FuFcFXFXFbFfXFhFp8F}0FFhFFF$FFF{Fw<F~FPF"F*FFFFrFFPFFFF*F6FFFFF{FnTFdLFixFldFn$FtPFp$FtFvFuF~FFFXFjFFFFFjFFʰFRFFZF׾F0FF@F\FFFFFFFFFFbF:FFFFF"FRFFPF^FFF0FdFFFhFF0FdF FjFFFF|FPFFʖFF@FnFFF2FFDFF&F6FFFFFFFFFPFF4FFFFhFpFnFF6FFFvFtF"F$F|FFFĚFFFZFZFFFFFFFrFFFFFF^FF*FF,FFFFFFhFؔFFۨFzFFFFFFFFXFF6FFnFfFFFF,F\FFFF FDFJFFF6FvFFFF0F&FFFF|F&FFF*F&FJFFFFFF,FFFF|FFxFHF.FTFFFFFFFHF"FvFFFRFZFFFFFFFFƶFFFFFfFxFFVFTFF6FLF>FFFFFFF FFlF²FrFFԨFӺF&F:FĊFRFLFFFٔFJFFFFbFFF:FF\F~FF FFZFFFFvFFFF&FlF6FFZF FnFbF$FFVFhFxFFFJFFFF8F6FvFFRFϊF<F\FFFF`FFpF4F4FFFFF$F.FlFF|FFFRFݦFVF<FFnFFF FFFFF~FZFFF"FFFpFؤF>FGGG *GF*FF&FfFGGG OGFFFXF,GG /G GGGFFjFGGG G%}GGCGGG >GF~FGMGGGlGG)0G0GfGGG!FdFFF8FҲFՐFߘFFFFϪFFĶFFʹFDFFFFFtFF˚FJFFFFFFÒFFFFFFFDFFFdFFFnGG GGG G GGG GsGG FFFŖFtFF4FF2FFFrFFFdFFFǬF,F<FFFFGGEGG8GF.FFFlGnGwG"GEG+1G3G=G/8G2uGG GGGGSG#GGGGG-G)G1GG#G!G%G,G7G=G5G&GGeF"F,GGG GBG'G9GC GH!GIGKG>=G6 GWGUGSGEG9GCG4G!G2GGGGtGG!G)G9GAG:G2GCG=G/LG+(G>GFFFGmG.GG G6GAG=G3GDsGRGb|GGGGG~WGdkGB%G0G. G2+GAwG1G/G$GGFZFRFvFF"FFFFnFFF2F&FFFFFFFGG+G4G=fGTGcG]|G`5GYgGX6GSOG=OG *GG G.GXGGXGG bGG{G(G9 G:GG^GNG^wGZGO\G<G2gG>G1G+G'G ?GG/GGpGBG<GKGKsG>GGG4G& G(G)G+G:G6G:G8MG=GNG'GvG|GGsG?GPGG$G.G%G'GGGG`G2G!G#GGsGG)G+G6LGFBGZGhGiBG^ GGGGGGtMGODGGGE!GLGKGUGgG{G{GinGgGiGbGlGj]G\{GR GV+Gi\GwGoGGGGGGGGGGGGGGa0GWvGJG<G,G0G GGGG&G G G GGFF F`GkGG GG!G&,G$,G4G;vGGJGGG%.GGDG)G^G]uGpGzGrG]GG^GDGFGMSGU"GnGuGGGG.GY+GYGTGUG<1G8G?kG+GGGG#aG+G9Gf=GZ2Ge[G]ZGZzG^BGJG[1GcGlGkGrGZaGlGoGnG|GrKGU%G[/GSDGCVG5oG6 G:wGD;G>GC9GOGJ7G@ GMG;GHVGCG6G;G"G)G,/G2GQwG;G,G,8G#G G)G2G;G;BG:G:GAG6-G$G5GSGGGrGG 7GGIGwGGG GG GG3FvFPFRFFGGFJFZFXFRFlGG\GGG%G*|GOGGG!G/MG'G%G-G:GISGP[G^G^GNGFIG@!GFG8]G3G=GCGN$GjGGGhG]GKBG9G(yG,G4G9[GFGKG@gG*GG GF>FFGG uG#G7hG(G/\G9G#G)G!G ]G_FG G GGG GTG!FFpFF^FfFFFFdFF6F.FFFFFFÔFFGG GGGG$G&G)MG*GCG>pG3^G&EGGG"[G3EG,G&GG&fG-GFFGXF*F|FFFFFFF\G SGSFFGG]G GGGFGFF FFFFBFFҺFמF̆FFFFF΀FTFZF,F^FF8F¶F>FFFF۬FFDGFFtFFlFFrG GG#SGLGFDFF2FF6FF8FFFFF2F8FFFFFpF"F4FǪFFF^FFFxF,FFFF6FF*F4FFFzFFFBFFFFF6FǦF:FFpFFFFFFF$FFFVFFd(FMFDF$FF#TF1FtF$(F-F-F'F'F!@F $FFFF F FlFFHF EF$F F FXFFF F F F@FF8F<FF FXFFF FDF$F/F)FEXFJFCF2@F0FF8F@F@E`EHEEFFDFF EHEE EEE(E EpEEEEEՀE`EE(ExE@EPEEhE(EPEEEuE@E~EyPE0EE`EEEpEPEEEEEfEUPEOECE5pE1`E10E*E/PE4`E0E/E*`E5`EApESPEN@EpEe0Ed@EaPEO EEE9pE.E,`E%EE0EEEEE E EpEEDEDaDaDd@DmDDkD|D~Dv@DDDDD DDD D@DD@D@DD DDDDDDDD@DD`D@DDDDĠDD`D`DנD@DDD DD`DȀDDDD DD`EpEEEDDDEE EE E`EEPE`EE E E&E? EHPEi0E^EAE:`E5E' E.E10E%PE1`EFE6 EE.E3E)E;E9E7E,EE! E3EKEiEf0EZEBpE>EHEKEXEeEsEIE:EXEXEd EhPE}EpEEzE~EbEgPEuEqE|E~pEq E`0E`PE\ EiEaE}pEhEE_EUPEoEx`EypEEEE8EE0EE`EEExEEvE~EE|E}EHEEE@E0ExEhEPEEhE(EE׀EרE EPEEpEEEEEEHEEE`EEØEpE°EEpE˨EE`EEE¨EÀEEEEE(E8EЀEpEXEPE0E`E(EʈEEEEEE˜E ExEEEFEFDEEEEEExFlF F`FFF F$FXF\FF0FF|F@F\FlFHFFFEPE0E0EF,F F FFDEEE0F F (FFFFF,F+F/ F$F'tF$F#`FF <FFFF*F/@F5F;F>F7F4tF% F!F'@FF FHF,F'F/F8F@tF1F)@F*lF+<F-\F'F) F-F5F:F0F,F6FBFG`FTFVFOF>8F>\F>(FJFWFVFbFa<FBlFAFAF6@F2F3F8FIpFZpFhFa4FSFI$F:F<FCpFB(FAFK\FTF\LFYFTFWFVFQFSFYFX<F`Fq@FFF&FFF:FFuFhF\FRFWFRFeTFVFDFE FGF]FcFbFjFlF{FFrFdF_F]FZTF^lFULFNFHFHXFGFEFAF?FKFQFPDFNFRFTFKFLFNFZFXlFZpF\LF]FlFF6F F.F.F FnFy$Fu8F{FbFFFFJFFFzFjFh<FaFX\FbFkFzFqF{hFFFFF`FFFF*F@FFFdF\F8Fm|FhlFgFFF^F{FnFF FFFNFFFFFFjFFzF$FBF(FdFFzFFFFFFFF8FFFF@FyDFFn\FuFF"FFFFZFFtFFdFF^FF@FdFFF>FF,FF0FFFFFRFFF(FFFFvFFFFFyFFfFFzdF~xF|pF`DF]FVPFP`FRFXF^hFeFoFpFbFfFbF`FiFlFwFFFFwFlFxFF"FLF|F|FF8FFrF,F>FFxFF>FFFnFFFFFFFPFFFHFF0FzFvFyFxFF}FFuFjFfdFiFmFuFpF~@F$FFrFFFtF(FhF.FFpFXFFDFFFFFFFFFFzFFF"FFFRFzFt(FjFj@FglFvTFt\FpFFFdFFFFFFFFF,FfF:FߌFFԚF.FPFF:FFNFzFnFF,F&FF FFF FFtF~FFFצFFFFFF FFFFFRFF̶F|FRF.FFFӼFʐFFFF~F6FLjFFF8FF~FFFjFFF.F>FFlFFhFtFFFFFZFF:FFF4FpFFF*F4FFFFbFfFƒFFF FFFFFF6FlF0FFFBFFFFFlFFFFfF6FFFFF>FzFFDFnGGGFFFF"F~FFfFFFFʮFFFF|FFFFFFFFF\FFFF:FFBFFJFF`FߢF(GFJF4FXFʰFFFF*F FFFFǜFFHFFFnFFF GfG UGG GFF>F:FFnFŦFJFXFXFFFFF|FxFFFVFFPFFNFFFFFdFPF*F(FFްFtFFGG:FFF*FFHFXFFFnF<FFFRFFFFtFFFFFXFFfFFFFFtFFFrFF,FFFZFFFFFF~F:FF&FFF`FF0FFF0FFGGGFFFvFFFF<FFFFF.FڄFFFFFjFTF͊FFFFXFLFFF^FFFFtFFFFF(FTFG.G2GaG GGGGlFFlGFFGF(FFFZFFGHGRGGGG7G ?GGfGG G)gG8GKGG GG^GFtFFGGGG%G)HG+GGGGF>FXF<FF݂F۞FݪFF F"FߴFۂFFFlF֚FFFRF~FҢFVFҬF\FFFFFFFFFFFF,F:FrFxFFnFF|G OGGyG)-G1GGGfG G G GBG G=FFJFF(FxFFFtF"FF^FHFFFǪFӄFЂFۺFPFFGG=G(GAyG:KG)G/YG&GGGG9GeG"GGG GTGZFGG GG (G G,G'FG$GG GFFFxFGKGiGGGG GAFFBFFFFGG^GG#G GPFFFGFGG G<GGGFFFFF~F2GGGG%G+G0G+yG XG G FFdFFhGGFFFPF|FGG=GGGGG0G-G#GGGWGGcGWGGQG-G G GGG*GG2YGFGMG=GC@GPGDG7G;G)G(G!GGG'G/FFFF~GGGcG GHG#G GeGG fG<FFF8GG uG,G7GGwGGG GeGG-5GEGQGB.G?}G7G1G/G.G&G'WG1G$G(HG0vG+G?GDG(G,G*G/G0G5G8GBVG-G/KGiGHGF~GG GG'G.(GEGW~G?G?^G3G;GBGP$G[GLGBSG<G6G3G:0G;PGFG&GG!G lG3eG;G@>GLGPGFxGmFGhXGKDGAG$GG GGuG GAG G G6G<#G2|G5'GD GgGvGGGGGGuQGpGC@GCG@GHG0G*G*G!GFfF F&FRFFFFpF2FFFtFFF FhFFJGOGG.GEGY GmG`G~GlGmGqGURG90GGG!PG"G GG GG XG5GBG:'G8WGAGIGsGRGBG8 G9G:G6uG.G7OG%G \G,G7gGB|G=GOSGCGLG@G>G1G:G:G=GG(G1GGGZG GiG"G 5GGFFFjGOG'G GG GG"G)#G.G+G G G!GG(G2dG-DG6G[G_GaGqcGxGmGNGA\GGGLGQGdGo<GrrGh<GGkOGiGGnXGwKGTSGJG]GhGP6GQxGI|G@G)G-GGGG'GA,GX;GKGQJGEGAoGMGQG^`GgGqGp'GlG[Gf1GjGZG{GkkGfG\pGSG[GGHtG:GN%G=G8G8GHkGMMGBaGO6GOzGTG>G2G57G-G%G$G5PGVG2G'-G(G[GvGGG3GKGL~G>G@XG;G&G!GG GGGG BG G:G!\GGG}G GGG FFhG=FpFFFFFFF2FF6GGGGGGGFF,G $GGG*G8G>/GGGEG>tGYoG]G=QG?3GBG*oG,G;GHGh#G{wGGvGZGM3G?3G>1G)G8G:G:GKG`hGhG;G7yGGG*GFGZGGkG%3G*G"G-^G-G!RGGG GGG G2G G^F FFFnFFF͜F&FlF8FFFFĞFFFxFFFFFJFF:FFG#GiG cG G^GG =GGGZGG/G"G#GGG'FNG GFF>F FFFFnFFxFFFFFNFԖFרFGGFF>FFGFٚF:FF(FɎFĦFӎF:FǾFݤFBF~FFFZF<FʆFLFF@F,F®FѦFFԐFF.FFȬFpFRFGGGGGaGF(FFjFFFF"F`FFvF*FʈFhFFHFFlF~F6FF0FFF.F(F:F4FF^FFFFFFFdFFFBFFFFJFFFPFF|FFFF6FhFF@FFFFFvF`FGF1F8F.F FXFFFF FF|FF F F ,F DF FEEEEXE(EFTF(F$FF(FPFEExFF FE0FF@FdFF FF,F&xFhF<FF,FF#PFFF FEEEEpEE(E FFpF$EEEEE0EE8E@EEEFEEPExEEEHEEEEEE|@EzEuE|@EEE E}EE0EEEhEE@E`EpEvEgEIE>E*PE)E' E+E.PE&E@E4E9PE@EP@E_EeEx Eh@E]EVEVEPpE9PE4E&E"0E`E EE0E@EE`EE0EDDD`D`D~DtDzD~D DD@DD`DDDDDD D@D`DD D`D DD@DD`D@DD`DDDDDDĠDD€D@DDۀD`DDǠDDDDDՀDDD D@DD`EE EEEPE E@EpE@EEE@EE E`E0E E0EE"E8`EG0E]EXEIE5E4`E: E10ECE:E40E9E$E'E.E8PE&0E4 E-E$E$E#E#EEEEU@EN EHE:@E;EEESE\EyPEhENE>@EYES`EdE{EmExE{E~0EvEp`EeEgEzPEEExE@Eh EcEeEiEmEm`EhE^@E^EcEvE0EE@EE@EEEE`EEE{ Em EoEpEE EHEHEhE@E(E0EEEEΐEEHEE˘EE(E8E@EEXEEEEEEEEPEpEE@EEHEEEؐEـEEEE`EEXEpEExEPEʨEĐE EEExEʨEEEEXEEEĀEјEEhEEEEHFEEEݰEE`F@F F|FHFF$FPFF<FFFXF8FFFFFXFF F FFPFFF(F F hF (ExEEFF F8F(F FFF$\F5`F1F&F F'F"FLF\FPF!`F1DF7FEFJFLFKFAF<F)F+F$FFF|F.F7F2FQF>pF.F-F.tF-F.F,XF/F<F?F=F8F=FC4FEFY\F\FUFFFBF>FJFUFPFWhFbFaFFF@F9hF9`F@F>FNFSFeFlF`HF[ FRFGFAF?lFIFQFXF\PFZFUF]lFJhFRFU`FUFRFe8Fu|FFbF2FnFFF|Fp FiFVFKTFNLFRxFWFWFVDFRFJFJFYFg<FaFmFoFpFyFhF` FhFc\FfFqdF^FUFIFIFL\FIFOFPHFWFJ@FFFQFRFU(FRFNlFWdFbFpFsFkFx8FF$F^FFPF~hF{Fx8F{dFyFFnFFF6FF$FFF}FuFjFcFpFtF}FFtFFlFFFFFFFfFNF6FbFuFbFm4FpFsFF:FFFHFbFFnFHFF\FFdFF^FFF|FFFFFDFvFFVFFF^FFPFFF F4FFFFyFFzTFFFFlFFFpFFFbFFFjFFFFFFFDFbF&FFFF2FFFTFFbF FFhFF*FFFFF}FxFwFitFeFaFTPFSFZF\FaFuFyFxFkxFndFnpFqFs`F~dFFF\FF~4FyFpF"FFFnFFF.FFFFFF>FF FF<FF FFF$F FFFFtFJFFFFFvFF0F F^FxFyF{hFJFFFF4FVFFFPF>FFFFFFFF&F4FFVFFFFFDFFFFFFxFFF{DFuFhFs\FsLF(F{FF~F8FvF~FFFF&FXF$FDF4FFFF˒FhF FFFrFNFFF4FLFRFFF2FۺFFbFFFpF$FFF˔FFF\FVFFFFxFFFFFҾFFFFZFFFFFFFFZFFBF0FF@FhFpFFFFF$F,FFF4FFfFFFFTFF>FF>FFF~FFbFbFF&FF@F(FF<FlFFbFFFFFFȮFFBFFPFFFFrFF*FpFF®FΘFFF\FpFFFFGWF>GFbFFFPFFRFTFTFbFFfFFFӬFNFӌFzF:FFFF$FfF F FxFFhFFFFF`FrFߎF$FPG;FFؒFF^FFFFLFFFFFFFҸFFF&FFFjFbGG G GFF|FܰFFFFtFؠFbF4FFXFFFlF8FFFFFFFƨFՒFjFFFFF(FFF8FGG6G oGJGG"G&GFTGGGFFF&F|FFFFFFFFF"FFFF˰FFF2FFFFF<F>FF^FшFFFFFʨFHF$FFHFFFFFFFzFFFFG GGmGF&GGGF<FpFFŒFbFvFFPFGGFF@FؾFFFFF0FFtFFF~F FFFFFFF®FFGJG G GzG%{GG SGG-GFFJFFFFF$FFFG GGGGIGlGGGGeGUG}GGKG&GGGG.F|F*GGlGGG,G2'G#BGGGEG>G GFVF0FF܌FGF~FLFvFpFF4FF6FF4FjFFղFF֤FFVFJFFFF¸FbFòFzF.FFF"FF̞F׶FFjG$G$G80G2G'5G&GG%GuG}G8GGG:GFFFFîF&FFFXFF8FFFȔFnFF.FF֪FF~F$FG2G&G$G3GDdG2G&G$GG!GGGG"GGGGYGeGnGGG $G GSG#GG-GxG!:G GFF^G!G sG bGUGGHGwGFRFFFFFFFG GG!GnGbFF>GFGGG sG MGGzG=FFFFG/GnGG!_G(tG$@G6GGGFFHF"G G G GGkG"G[GGGGGrGWGGG?|G:`G>G3G"G#GPG GGGJGG*GGG! G.bG.G<GCGIGIGC#GDG; G7G6QG%_G!GkGGGmGNFF*FLFGG pG GGaGxG&G%GGqGFFGG ~GGGG4GGGEGG$G/G8GIhGIGCrG?:G1sG6G:|G<G1qG1G1aG<G5ZG50G4G>G1=G-vG6G5G99G;G>pGU G8G)G$G\GG GGG6GG1 GNG\GM@GJG?G,MG:GDGRLG0G.G63G93G4HG1GE]G?cG(G JGEG1G95G5GIG\fGSGXG\FG_(GLQG=G!GwGJGoGGGGG GG"GBGUG6G:GDGI3GMKGJGD}GBGYGnHGwGGv3G_{GwkGGGGGGGGGGGGGGn@G`}GX GFG;DG1rG)G GGGGrGGGFGjG AGG GG GzG$G`G):G#G*>GG_G%=GG'G&]G<G;GKqGQGaGlGoSGgGGFG<_GFGWPGJ GXGeGpG[GzGp[Gp8GyhGw\G^GZGSG]GIGBeGGGMG<G6G;G)*GGGGG2G@LG;GCG@G5G3kGCGNG_=GeGmGq^GG}@GbGr=GsNGkGiwG^G? GCGKxGGGG`G5G2G7G>G>UGFGfGZGTuGDG6G-(G)(G&@GKG)>GA G1G4G 1GG *GG!mGGOGIGZGHGAG0rG+OG'GG >GGGsGGGG7G;G -GF>FLFF>FFFFPFFFfFFFFFF<GFFF\G G FRGYGGG <G*AG,G:8G67G.G/yGFqG[UG/GCeGGG(G$GEHGImGXGGGxGTG;G-G9OG;G.KG;mGGG]ZGbGuGsGCG5G*GFGG 'GGG$G+GG.YG0G'fGPGoG &G GGG FdFFFF؀FFɪFĞFFF|FǘF FF`FHF&F$FFxFFF@FFFFՖFGFlFFTFGG GuG OG GGGG NG #G GFF6FGFFGFF"FVFFnF(FbF>FתFbFLFvFF:F"FvF"FFFFצFĎFF&FäFFԠF0FFFF^FhFzFFʔFFFF8FJFFF FžFFĦFFF,FNGGGAGFtGNFF֦FNFLF>FFFdFFFFDFBFNFF:FF(FHFxFF"FpFFFFF4FPFF@FbFFFXFF:FFFFFNFFFՊFFFF FFtFF~F FFlF~DFzFsFbFJF1F1F#F FFFF DFFFdF4FFPFFF FEEEHEPEE0EEF FTFXFFEEFEFFLF`FF"FF$F*F(FlFF TF FFFFFxFEEEFFpEEEFpFFEE(EEEEèEEEEFdF F FtEטE0EEEE@E0EE{ExEoE}EEt`EEEEpEEExE EExEErEm0ET0EDE?E6E/PE6E8E0E,E#0E(E1EEEPEJE_EaEb`ESPE_@EqEQECE5PE00EEEpEE0EE`EEE0DD@E DvDvDlDo@DD|@DDDD@D DD`DDDDDD@DD`D`D D DDDDD@D`D DD`DD@DΠD`DƠDD@D D`D݀D`DD@D`DD`DԠDDDD@EEEE!EEE@EEEpEEE,0E&E EEEE!pEE EE3EBEW ERpEDE/pE=@E<`ECpEFpE8EDE/E*E4EE0E'E!E4E.E$PE+E-@E,E/PE1E3pE;E( E.PE?EXPE\`EcEEgEPESEjE[ElEaEgPE@EEEwE0EgEhEEhEEE`E|ElEo`EhEkEb`EdE` Ec`EtEXEXEEEE0E E@EHEEEEw@Eh EjEzPEE EEEhEXExEEÐEHEEPEPEEېE`EXE0EhEEExEPEHEE0EhEEEրEEEEEEEEE@E@EE(EˆEӘEEpEE԰EHE˸EEEEPEEEE@E`EE`E(EѠEEEEEEEXEEޘExEhEF`FF FFFFF"FF F FFFF`FFFF0FF F <F FE(EpEFF F\FEXE8FF F"F(F#xF(F)F,DF/F6F,\F'@F&PF#pFPFF.F18F9FEFO F[F\FMFG0F=F.pF,F%FF((F'HF=FGFFFEF5PF-F5tF4F4F)4F9FA FQFKFFhF@FFFR,FT8FalFbFPlFH<F; FAFL FK FAFTFfFVtFELFDFGFGpFO<FRdF[FbFwFtFkFh,FTFI\F@FOFT(FWFU FT|F^F]FVFKFNFO(FK@F\Fl F}8FFBFF$F^FsFfhF_ FUFI$FCFH(FTFd|FhpF]FSFK\FOF_F_FeFkFo FqFwFgxFhF_FbFpFrFdFJ\FC FD,FMxFTtFXF^FVFXFTDFWFdF[TF`$FfFqFFFFFFFFFFDF}Fy|F{lF}F|0FFF2F(FFFRFF}tFtFwFiFnFsFFFFFFFFFhFFFFFFBFyFnFaFnFFFrFBF(FFFFfFF$FF~FFHFZFFFFFjFFFF||FPFF(FF$F2FFFFFFVF$FrF(F~FFFFFFFNFFFFFFFFFTFvF2FFXF>FFFFFFFFFFFFHF~FFFFFFFFFFxFx`FoFhFd@F_tFbFdHFs,FnFFF FFw(FyF{FFF6F.FF\FFDFFF"FRFzFTFXFFF&FFFFFhF<FxFFFPFtFtFFF(F2FFFNF$FpF.FFFFFFtFF}$F|FFFFFFFFFFF\FlFFFxFFfFFFnFFFFFFFFFFF4FF8FF0FFFdFuPFwF(FNFFpFFFdF(FFFFFRFRFXF:F0FbFFFFPF6FFFhFFFFӄFtFFXFFלF FF>FFvG^FFFDFFFFBFFFzFFDFFF@F4FFFF>GQFF,FGSFFFFF^F>FFFFXFFDFFFDFTFFFFFF0FFvFFFFDFFʨFF`FЖFFGFHFFFFF<F"FF<FFF8FF֚F̨FɨFTFzFlFFFXFFFFF,FF FGGGsFFG$FF0FFFFFFfFrF˺FFFΞFlFF$FFӜF|FŨFFFvF FBF2FF2F.FF FF4FFFxFFGTG -G FFzFdžFFvFFFĊFǸFFFFfF@F@FFFTFҼFGIGGG GtGFlFFԼF6FfFVGLG FFFFFFFFF\FFFhFFFpF.FGYFFFG'G}GGGhGGG gGG*GqG1GG ;FFF4F FPFFF2FFFF|F FF<FFFFFFFFʄFFFbFFF2F0FFݖF4FFbFڦFFFlF&FFFF4FF~FFVGF&GHGGGGGGOFpF`F.FhFFpFFnGGFBFzFFFXFF>FFFjFrFFFFF.FȆFF~F FzF,FFGZG %G3G-GGGLGG GGG G>GgG!FFFFGIGG{G#GG (GG"GG]GrG"G"GGG3GiGXG GGGG GGgGG'G0G0GOGGGGGFG`GGGGFFFFFNFF:FFXGFXFLFˠFFF4FȰFFÄFƀFȪFFrFF|FF@FȨF,FFFjGGG'G3G1TG+4G&G/G#G%#GGGGGhGFNFHFfF|FFF.FÞF¬FF&FzFҞF>FԚFFFGG (GGG'G _G=UG1G$_GCGGG#9G-FG2ZG(nG+_G.GGWG GG GG GG GGGG-G.YGG GGwGGG*GG GQG!KG?GF@FFXFFF:GG.G)G4G G\FjF<G/G"GGG<G 3GG G :G7GyG GGGGG G%G( G6G2GG |GGG GG+GIG'GGG GFGGGGG"G=G2G4"G(@GGG]G {G 3GG{G xG`GGtG!G/ G3nG=GAxGFEGC2G6QG1)G*G,G,G#{GG" GG G XGGFFFGGrG GGGtGGGGG uGFGGGG GfGG\GsG#XG#G)jG>G1G;!GHGIG?G8G.G,G9GEG@.G6=G?GO^GQGnG@G=GQQGuG~GGGGGsG{GO GRGZGJGEG? G$vGGVGQFFF"GG :GGGG kG;G2GRFtFFFFGGG ?G$nGFxG_G]G]ZGjGxuGbGd<GLGIG?IG9yG/G:G4G G!GGG-G1G;WG?%G8G7GEG9G0G.G;G<G5G/!G*G$G\G&G+GAG?GQtGUGR~GVGTG=tGI5GC GQGEG4[G(%G5G1G%G(G2bG4<G1G-zG0GFG[PGTGK8GYvGMGQG=G9G(G G!]GGG#G0GTG G&G3_GSJGVGU=GffGjaGGGy3GGxGqGZ GQGG9G;GLG$,G G,GE!G@G;G:GAGWGpTGdGlGsGd GjGGGGGGGGGGGGGxGzG]GNGBG5G,G&GgG=GGGG GG9GGG G G GG rG GG&G `G*|G5gGGGGGGG#AG*G2uG@`GOuGWGsG^GEG;G?GGGAFGIXGhKG`G\GbjG^G^EG`Gd0GN$GKkGMGUGCG@mGGGGYG+~G&?G,KG9/G*AGGKG"G0rG(G.|G2G.G"=G'G><GV*GpGycGGGGy_GiGc G[GlG\lGAG5G5G9WG:G=G5JG/G@G=G;G^G\OGdGI+GLG86G"G UG1G&QG@ G5<G&G G-GG'G<GD*GHGImGW G=G(G3G"GG GGGWGGGyGGGJG FFbFFFPF*FPFjFxFFFzFFFF&FF8F@FFGqG G{G jG+MG>G9G>G3G07G1G.G1RG/$G5KG=G4G.G4kG+~G@G@tGUzGkGfhGGeLG-:G'G&=GEG,@G/$GNxGRGW3GsGiG7G'G :G FGG 'GzG EGGWG&G=G0CGBG% G'GyGGGIFF0FTFFFјF؜FFFF6F̘FΜF\FFFVFFFF`FFF^F8F~G/GFFxFFF*FFFpFZFhFVGGsGnGGGiGF4FFFVFFFDFFxFjF*FFFϰFzFhF@FFFBFFFF,F,FVFF&FΪFFFF~FF&FFFFdFnFrFF`FFvFhFFFFFF`F4FFXFPFFFFRFݮFFFbFFNFFFF:FöFFfFFFFŢFFFFFFFtFFXFFFF"FFy4Fz`FFF*F,FFFhFFLFPFFFlFFFFFݠFF4FFZFF*F F~Fu,FlHFzFFmFFuFUFCXF'F F*FTFXFFFFFFDF(FF F"4F`FExEEEHEE0EEF FFPFFEPF FF0F 4F,F$FF$<FhF+F)F"FF FFFFFEE0EPEE`FExEPEEEFFEEEހE͸E(E8EEȸE8E`F4F FExEhEEEEE8EE EhE`ExExEuE@EHE0EgEfE[EzEEEEEx`EipEf`E[EPECE6E0E/pE1E:E@0E1E10E#PE"@E3E>E;E9EDE?EZE_ENEJ@E7E,PE'pEpEE0EEEEEE `E EEPDDp@Dp@DDhDDD D D@D DD`DDDDDD@DDD@DDD@D DD@DD`D`DDDDDD`DDрD@D DD DD`D`D@D`DD DDE0E DE0EE# E"E%`EE@EEEPEE'E&E'E$E"PEEEF`EE@E"`E$pE/`E9E?EGEJE5E6EB@EDE=EEEJE9E3pE*PE.pE7E&E)E2pE2pE#E2PEAE1PEE!E% EpE! E(E?EUE^En EEeENPEaEr@EEs`ErpEHEEHEE0EEpE0EEE@EXEXEvPE~Er@EkEXEWE^E_0EvExEPE@E0EEEE8EEEExEEnElE@EEhEEEEEEpEEXEݠEEPEEEEPEhEE0EEpEEHEEEEEEEEEEEPEEEEEEXEXEEhEE@EEEĸE(EEEEEEEEEhEEE(E@EEԀEEEExExEEEEEF XF F\F|FF FFF 4FF 4FFFFF\FF xF F F!|FFF FtEEEFHF$E@FFdFLF!LF&dF)F(F18F(<F+F78F9hF3F)pF $F"F%lF)F)xF/,F9LFLFWFaF`FTFK FDlF4F4 F3F)F9F<F;FEFE,FDF>HFBF9F:`F6xF2XF:FDFSxFYFXFBFIFJF^FcFeFWFCFClF<FDFFtFKHF@FSFj|F\F`XFVFUFQ<F^4F]XFdTFpF|0FvhFhF\4FS<FGFLFYTFT4FSFTFW8F[xFIFGHF9hF? FLFP8F\FjFvFF FF FtdFYFYFUXFKFM FMF\ FgFf0FdFSF\FXFTF\FeFaFp4FqFw FkHFeFYTF\F`FfFltF^PFSFOFYFfFwPFt4FgF\LFQDFY FhFf8FdTFl(F{FFFF F^FtFFFF>F|FtF|8FwFslFFFBF FpFFFF FBF0F|xFzFpFrF@FFfF\FFFRFzFFRFF(FFFF}Fr@FmFp(F|F~F6FFFFFFFdFFzFtFFFFF&FlF(FFFJFFFFFFFFRFFF0F4FF8FjFFFFFxFFFFFF$F F8FFFlFF^FFFFFfF:FFF0FFFFFFFFFF(FFF~FFF$FrF*FbFF|FsFjFbFg<FiFjFptFF FF\FRFF{PFFF2FFFFjF FFF^FFF F(FXFHFVFFרFFnjFF$FFF&F~FPFFFF:F FHFtFHFF FFFFTF~FFFFFBF^FFfFFFlFFLF`FFFFhFFF|FFFpF8FFF&FFnFBFZFFNFFdFFFF$FFFFFFFFFF F4FnFFFF̞FXFFFVFhFTF(FZF"FFFFFFȌFFFFlFˠFϲF$F.FFFFFG:G5GFFٮF0FFFFF¾F FFٺFXFXF݆FF\G?GGGFF6FFFF8FʄFFFFFFFHFFnF$FFhFPFFFFFFFF<F0FF:FFȘFFtFF6FFGGfG0GGFFF2FذFFFFܶFܨFӊFƶFFlF2FjF>F8FnFȸFzFFհF G GGG &GGGFFFJFFFFFF8F@FFpFF>FFFF܎F׶FFFFFFF^FF.FF8FFɮF`FF0F FFFXF*GpG _G G9FFFҠFDFF՜F\FFFFGG;F>FجF2F>FG+GCGG;G]GG AFF:FFڨFF2G GG5FF@FFJFLFhFFŒFFXFFܲFG2GOG `G &FF0G GGGGyG!GGGXG ;G\GG GGGGFFFFԜF۲FhF:FFdFF`FdFF`FFFtFHFF~F٢FܢGgFFPFFFFF&FpFFvFFzFɈFðFF`FPFFFFܐFVFFtGGGrG GGF|F FFFFFFFGGFFF6FѲFFF4FpF<FFFFFdF<FrFLFFFچFLFFbGGGG G.GG"nG#G"SGmGyGGzG GG GlFZG:GGSG GG"=GG"G"HG%gG"G$G)lG4oG0G%GGG&GG G QG G0GXG#GOGNG@GI G3G#fGGOGGG GGGKGpGGFFF$GsGFFFF>GpGEFTFȴFfFF̶FF̺FFnF&FFbFVFhFfFLF׬FRG:GGG GG'G5oG1G-G&JG%&G&G'_GGG@GGGEGF>FFdF&FRFŒFRFƘFrFFFFF*FلFFnGGGGG-G'G/G3vGqGG +GG$G.G)G-G6xG)yGGGG'G%GG/GG GGG-G,G2-GGfGDGGOGG"MGGGG G$*GVGFGFFFGiG rGG,G>GWG5GGGG4GGGGGGGG5GfGG G GG &GwG&RG7'G%GGG(GGGGeG#G5G%GG&GGG vG;GGG$G(GAGBG5rG+ G#G)G%GG GQGGGG'G*G%eG)/G/G>G<GAGT1GQ%G3G$/G {G!4G#GWGGYGGG GCG }GFFG .GGG]G.G~GG!G!GGAG(GGGSGGG G\G&zG6G=`GG4G$yG!;G5aGMpGYrGgGnkGc>GZ(GUGJGEG[GX?GP&G6G/G6=G&!GDG\G'G,GGWGW1GMGU:GI5GHUGJ,GOG=wG3>G@dGY_G=G9GUG&nG&nGG1G)BG'GGGGWGQG-GGnGGxG*G> G^GVGGGzGjGk#GbGEGJGIG4GGG1G6UG0G-G7G5GAbGNGGcGcGc&GKpGFG#GG!G#GG%JG"^G@G2G)G&GGG!G7GIrGEoGB4GBG3G%/GGGxGGWGGG PGG!G GG\G)jG F(FFFFFFdF^FF\FZF0FF&F2F8F4FfFJFvF޴FpFGlG!gG3G:G?GFG7G1EG6G1G6G%qG4G<5G,G* GG$oG:#GF'GEGHGTuGWGY9G/GJG"G2G,;G2G:GJGLEGRtG8G.SG7GlGGG8G G G!GGwGG2G' G5@G7G)GGVGGGFdFFFF݄FǔFFFF FXFF FvFFFpFHFF*FFFFGGG}F:FҼFƬFFĆFF6FbFnFGiGGGGGG)FZF0F*GFNFXFjFJF*FTFpFFߚFF^FǜFFFFZFFF$FFFŨFˤFʺFFJF~FFFɦF8FF>FF4F`F6F0FFFdF$FtFbFFFLFFrFFF:FFTFFFϠFjFVF&FRFxF<FfFFFFFFFF˺FDFFFFFrFTFTFFF2FFFFFjFvFDF8FFFnF^FFFVF<FrFFFRFRFF&FrFxFFǎF^FFFF~ F{FxFmFcFsHFmFFoFWFAF1lF#hF!F%,FFF,FFFF!F$FdF#FTFF xFEEEEpEEE(F FtFEFFFFFHFF/F)PF% F#F(F-F dF FFHF8E(EEEHEEEE0EPF(FEE8E E(EFEEXE܀E٠E`EEHEEɐEHEE܈EEE0E8EEXEE8EEE0E0EHE}EHE@Ex EmE[@EEETE``EzEdEj EYEXENEDE:E6E00E1E5 E2 E3ECEH EJpE0E EEpE%pE!E% E:@E7E3E<E0E4E-E'E-PE1pE/E+PE$@EpEE`EE E E DEDDDtD~D|@D`D DDDDD`DD@DD@D@DDDDDDD@DDĀDDDD`DDD`D`DDDDDD`DD`DD݀D׀DDD׀D@D`DD@EEEEE(PEEE0E 0E E EE(EQE00EE"E'E EE1`EnpEoE=E$E1PE5 E0`E-0E:E=0E>pEXE:E0@E@@E;E2E!E)E+`E/`E-E4E0E)@E(E50E6E,pEE0E@E E%E0EKEapEcEgE_EUEREdE^pEEEEEEE@EExEv@EEE EEEExEEoPEhEaPEa Ef0EepEE@EEE E(EEEEE8EEE|EuE}EEEPEXEEEhEEXEͨEXEEEEpEEEEpEEEEPEEøEhEEEEEEXE0EFFEEhEEEE@EE0ExEEEEˆE`EEEXEEE`EE€EEE(E@EňEE@EEpEEEEE0EE(ExF 8FFFFF F FHF HF DFdF $F DFDFdFFTFF\F F8FpF F@F$FFEFFFF |F(FF\F'F/xF.F+F8F4F.F)F4F'DFFFF |F&F0pF8tFPF`dFlFg8F_FL FMF4F2`F6DF2@F;(FIdFM`FMFE4FEF?FKHFIFAF9HF6FGLFWFXFcFUFIFHLFPF^(FgFeFX,FOtFHFJhFI$FE`FQFN$FUPFkFiFlFaFcFl(FkFfFoFrFvhFw(FtF^pFWFN@FLFHFFFCFEFJFMpFGFB\F9XF7 FBFPFTFlTFv|Fz`FFFHFpXF]@FQFPdFF$FGFKtF_FoF~ FjFZHFZ0F]0FWFbFeFeFhXFwFFrFZtF[FW4F\Fa|FnTFkF_FQFYhFqpFPFnFmFVFO(FQFV<FfFgFiFtFFFF~F*FF^FhFFFFzFnFmFspFFFFF8FFVFFFFF}FzXFnXFtlF F}FxF|F{FBF4FXFFFF*F F|FFPF}F~FFFF FFFFFFFBFFF(FF\FF<FF2FbFzFnFFFdFFFFFpFFFFFFF~F(FlFF\FNFFFIJF6F>F FFFFFnFbFJF6F\FFF FtF$FFZF4FFFF6FhF4FFFnFF|F`FTFFFFuFzFrFoFeF\F`FiFqFz(FHFFFrFFbFFJFrFtFFJFFF FFFxFFFFF\FFFFF(FFטFFFFFFrFFFFhFDFFDFrFFJFBFzFFJFzFFF:F4F$FF6FFFFNFF^FF,F,FFFFbFFFFFvFFFFFNF\FFF FFF0F&FFFFF\FF^FxFFFZFpFF:F~FFxFFFFlF4F*FFPFNFFFnFFF<FFFFĒFrF6FӪFFfFFJFشFDFFFFGvFF F^FF.FF|FhFjFòF|FF*FF~FFFbFGF^GFFFFFFTFٴFF(FFFTFFF&F^FFFFVFFF6FFFFZF&FFF4FxFFJFFFFZFF^GG AGGGF(FjFFߴF2FFF~FFFjF*FFFFF$FݔF|FjFFF<GGoG$G$GEGfG G[G>GGbG GFFFFFFdFFG&G G_F.FFdFF˚FFFF̔FFF4FdFF>F@FFFDFTF:GG=GG UFFvF"FՒF׆FՒFNFGFFvG RGFzFFFbGaGGG)G0cG#_G%GGSFFF FGGGG #GG/GFFFFӰFvFVFLFΔF|GG GG dGG AGG GG GG~G$G8GGyG2GG -GSGGkG GcFF2F0FچF&FֈFzFFvF`F2FtFzFFHF$F~FrFǴFF|F~G5FpFFDFXF FGGGeGFF֮FܜFиFFZFFFF(FԚF٨FFF&G uG GG GFF0F FFFGG*F(GGBFFjFLFƚFFFFnFhFƦFDFFFF2FHFFFFFG GGG VGGGGG!G%IG%ZG&GG 7G-G-GGGGWG,G=GZG!wGFGGG"G >G#G+G%G7GJG9G7G.GGKG3GG /G wGG G'GNFG|pG^GaGOPG<|G$^GWGGGuG6G GOG G GGVG FGsG %G FVFVFrFGFFFFFҺFƌFPFpFFNFFF^FTF˘F F\FFhG GGGG G'tG9sG:G1AG.G(GQGGGOG&G-G&UGG FFNFJFxFFFҜFFTFFDFFFƶF~F>FGG G$GHG|GG+*G;G GGwGG,G0(G,G*RG1G-yG%G*2GGBG YG0G]GG$GG G.G0G5G(>GGqGG 7GG$G G$G%G%G#G5G )GGGFHF>GGG.G6GG&G GGGG7GmGGkGnGG&G,G&G GGGG |GQG+GG)G#dG4G|GGGwG+G, G0@G3XG/G)GGGGGGGRG#DG,G*G6GAXG5HG0G5G1vG'YG$G/ GG$sG!G(G2G8G(G+BG8GAQG?WGMGBGOG9G*G(}G,^G+4G/lG$pGiGoG GG~GGG"GG"GaGGG'GG"5GwGGGG"G1DG#'GGGyGpG"G(G7G?GG>G:G6GS4GJqG;GG.G$G#G4GNG7G0G!G18GE GKG=gG;G3G.G5DG<=G8G?GGyGYGV|G7fG5G.G(G"wGGGG)G6G"G.OG'ZGGG GbGG%@G,GG&GGGGZG#=GG zGG6GG'G. G!lG7G,QGIGWGFG3GHGG ]G"GQGG@GGG!G/G:~G5G?|GB#G[GtGuoGGvCGGGLHGJGFGGGIG<G.G,EGG!GG.G1G,GG#JG'G&GG GqGGGFFF.GG6G@GA=GpGGGGGGGGVG5GvGG.*G.GGGGG"sGGG-/G0G*G3G)VG- G&PG2}G7G9GDWGAG<G)G!G*G,6GA@GHGRGi"GbGaGIGRYGQGXGL GFxG*G%G$G(,GGfGG!kG3G:GAlGN1GOGV,GZGgGeVGHwGAGAG2G.G'G&G)KG(G fG*G2G))G- G G+;G+G+~G(YGKGcGgG`GCGI/G;uG8G1IG0nG/G+rG:GFGK6GPRG?jG;G6GUGEG?\GHGS\GaXGLGTGGmG{GGGGGGGGaGlG^GSGOGC|G6G#GgGGFGeGFjFFF,FXFGG@G GGGWGGG.zG,GGfG G%G G_GG GG G.G,7G@!G?G+/G)aG3G<GCG=dG?GcGaGPG3 G7G:GWbG@G)G8eG9+GG*gGLG$PG$PGGiGGG*GGiGG _GmG GSGG YG%WG,{GB GAGhGneG`GgGxGyGNG;gG2GG,G*G(SG0G1G:@GDVG>MG5GN`G[<GpGKpGHGEGAG+LGG$G G4G$G$GBGGG:G0G=GE!G@G4G1G$G"GGG xG GF^GDG GKG8GGGG&DG!1FF4F0FFF FFFFFF GFFrFF,FF߸FRFZGG&GH)GIGK3GTG7G)G#(G)zG'GhG*]G/HG%GaG G pG+=GBkGFG<G1GMGFqG%RGCG G-jG$G/G, G=GT-G8 GGGGG GFGGG6GG&^G :G*G%GbGGG\GGG G9FFhFFXFFǐFFFlFFFFxFjFFxFFFFF F|FFGEGeGFhFFFFζFFNF|FFF@FG G IGKG FGFFGDG7FFF*FhF2FFXFFvFF؄FFhFFFFZFZFFFFFFFFFFFFF&F FXFFLFFFFF8F2FFzFFPFFF$FpFFRFFHFFFZFFFdFF$FtFFFFnF6FFzFFjFfFF&FFFFF4FFFFFHFFpFFF^FZFFFHFzFFFFPFFF\FFZF6F$FӜFFtFNFFFFFFiFb@Fa F_FbFm4Fj`FVtF<\F;F-FF(FFFFFHFFFF!FFTFdFEEEE@EEXEۈEِEXEFE(EE`FEXEEF F0FFXF@FxF4FFEEEEEpEExEEEEE8FEEE8EEExEEEEʨEPE0ExEEEEHE`E0EȠE͸EՀEEpEEXEE EE8EE E(E0EEw E^@EVENPEGPEBE<E@E=E7E5E7 E-E-E)E(E8E>0E@ECEVEP`EDE80E#pEpE`E(E E$0E'pE'E-0E3`E9`E=EEbEhEjElEdEWEOEP E^EuEEEE}@EEEEEEEE0E{ E{ EtE@E~El EjPEiEa@EpE{EExEhEEEpEEEpEEEEEEE8EEEPEEEE EEϐEEEE EEEE8E@E0EPEEEEXEаE8EHE0EנEEFFFF hEE@EE(E8ExEĠEEEEEEEĘEEE`EHEEhEXEEEEE͐E(EĈEƘEȰE`EXEE`EPE(EEEEpFFF0FFFEEFFF FFFFHFFXFFPF FFF%TF&F FFFF|F LF FFF#PF$F'F6F6|F8DF7LF1F-F*hF FFFFPFF! F>lFFlFMFbFq0Fe$FX0FSFJF5F2\F5F=FLFQFN FSFNFOFIFWFNF=FFFO,F\Fa<FXhFaFKXFJFKXFYFgFjFa,FeXFRFWFLFKtFI@FLFUFo8Fp8FtF{\FzF|FFF~F{`F|F}FnF_FPFYHFPF?hF?F@F:(F=<F@FA`F?tF1DF4F<FHFVF_FzFFF>FHFFnFSFFF;F>FIlFt4FuFyDFpFeF]lFfFf F[4FcFm$Fr(FuFqFtFfFYhFV FFFNF[FjFuxFX,FUFl FFFqFcFY4FWpFSF_FiPFy,FrFqlFXFFFFFVFFFxFFFtFpFLF$FF~FFdFFFFFF$F0F$FFwF{dFyF~F{lFFF FvFVFFxFFFF FFFFFFjFF.FFFFFVFxFFFF6FbFFFFFFFFFzFFFbFFFXFFFFFF`F.FFFFF8FFFPFFFF<FF&FFFlF0F<FF^FXFZF FFFFFFFFF&F,F*FFFF4FFFFF{FqFpFgHFpFkFhFfDFnHFsFxFyLF FFFdFF,FFFFFFtFF^FFFFFFFFFFF׾FF FڔF؈FFF<FFRFF,FFBFFvFFFFFlFFFFFFFzFFFFFF@FFFFFFFFvFF0FFxFlFFXFFFFF\FFFF@FFFF`FlFFFFFF^FFPFnFFFFFFFvFFFFFjFFFRFF&FFFFFFF(FFdFVFZFvFHFFFF^FFXFF8G7GG%FvFFFPFFFFHF`FפFFҮFF߾F\FԘF|FpG<GGGGGIFNFFFVFۂF̤F:FàFF>FfFFJFFHFF6F~FFFjF F FFFFFFF|F(FZF~FFFGGGGjGGFGEFFXFFFFjFFdFFrFFFݢFFښFXFߌF GG :GG?GG[GG yG G GcG GGYGGWGGGGGG GGG GFFFFFPFjFFFܨFښFF FFFFNFF<FFFFFGGoFF*F*FFF0FxG.G 1GGG GG OFF@FvFG `G,bG40G5G3dG,GwG?GGGG GIGZGGmGwG GFFXFFFG pGYGGG,G GG4G G@FGGG G<GG*G8G&G \GG{GGGFGQG G<FF FFFJFHF~F֔F~FF~F<FЎFٰFFFFF̈́FԬF FTFGFF`FXFzFGGGGFHFвFNF FͼFFFFFœF`FF&FFG G -G GFFF؊FRFGPGFNGFFFFjGFF@FDFFFFҞFBFўFfFȌF,FFF(GG FhFFG8G4GGGG"G%G!G'wG$G'wG"G)G1G1]G#GG G kGSG&GJ@G>LGBGG5G//G.G5G.G4]G9GAgGDpGD?G8G/pG&cG!GG>G G G3GEG%GGGJJG]GUGMG2G*4GGG-GA G(GGG jG#G+G+6GG GGnGyGGFHFFjFFF FFFzFҔFTFFFFpFNFޒFhFF<FG G,GG0G7G/G,\G9G;hG?8G?G-G!bG\G&7G"G*G,xG,GkGtFFtFFFF*F۬FFFFFVF"FآFΊFJFݐFG+GGGeGGuGGG"GGGG!8G'G0G4G,MG4 G9MG3G&GGGG&"GpG9GG!G(G.G(G+)GGGGG~G%#G5G;G*G,G,GBGGGGGzFGG GGG G G#GGG GGG=GG,G@G26G/G%eG"G>G XGG MG GG'G) GG_G 6G/G/\G@GDG.tG6G0G2jG'wGYG"GfGG%sG'5G10G'7G"G8*G?G1G(G3(G0G)G(HG-G9G=G;GF5GHG=ZG6GGpGHGAOGCGBGSzGLGW'GOG|GSG=#GE*G2GGGHGGG QGGGGGGXG"G+LG4G1G3G.G*G1GZG:%G&GG2GGG)G1GLG8G;VGCDGMGFqGChG2G+G;G)G4]G1G(#GYG;G2GBG:G;G:G3BG2G8RG>BGHBGT<GW6GfGM?G?G2-G2(G*rG$GG0G0OG3G'G,G.G G GIG GG,hG7G08G&GG%G ZGGGG +G GXGGG"G,G$.G-GBGSGDGG GG GKG$G"KGGGmG%8G-(G0G3<G;G<GGGcEGkGxGwGvGGJGQAGGGDGD\G;G@G?G*iG!EG%G'G&G!G"G$fG-G8G'GfGnGGGFFVF6G GG.G?ZGGGGGGGGGm`G8GG 1G:G,GG"7G%$GG G#GG"bG! G" G)JG*G)G$G-gG/G9YGBGEVGFAG9G2G"IG%wGsG,G&FG-;G0yG3GEG5GJGN-GQGwGaG=G7GKGFDGJ_G<G4GFGDG>GXG_G}xGG&GvGGGGwLGg9GfyGfCGZGLGGKG5G)GG GaGGGGFF6FFFFG$G GwG G{G&oG(#G.GDHG&G &G&GGG GG G5G%G&G'.G3!G0hG'G1dG<GIrGfGW9GLtGXGOG^zG=FG.G.PG: G>GG"GGG5G%~GGGGGGzGGYGUGgG3GFFXFG,GGG-GG7G GGzG)G*G/G/GI7GKGITGRQGcGGd%G^rGITG:G%GjGMGG+wG!GqGGcGGG.G-G:G1\G+G2G"GGGGG6GG G;FGG*G"GGxGG/8GG7G}FnF FFNFF0FF6FF*FFFfFFF"FFFbFGG)KG6G>GS$GGzG,G/ G5G G"G G%GG oGGGYG.G<G.!G6 GbG!G"GGNGGGG'G+'G1G"GG gGGGFfF$G+GF@G,GGG,G.G)G,GG wFFGWFFFFFFFFJFVFF*FFF"F,FFFF,FhFFFȒFFFJFXGVGG%FF,FFުF׮FFF*FF@GG G GFF:FGjGFFBFzF<F`FFvFFFFFJF~FFFFFVFFFFF&FvFVFF2F,FFFFFɸFȆF`FfFF8FFpFJF~FFFDFF"FFF~FzFfFFFjFFpF~F2FFFFFF*F.FFnFXFvFFFFF@FzFFFFFFF~FF8FF&FF`FFF FpFFnFFFFFzFfF:FFrFZFhF0FF.F~FFFqHFbFUDFG0FVFF FEF`hFTF6F,,F"FFFHFFFlF F FpF F`FFhFF F4EE@EEߘEEXEPEÈEEhEEXEEEEӸE0E`FF0E FF FE8EEEEEEEEEݠEԘExEEEEXE@EXEHE8EEE`EE`EŀEEEEEEEEEExEE@EEEEEEE@EEpEEEEzEE~PEbESEDE?EA`E5E6E*E(E'E!E)pE!E,@E0E@EL@EVE`pETECE3E%E!E$0E!EPE)E)E&`E30EDEL@EWEGEGEMEVECpE=E1E$E"EEE EEE D@DDD@DDD D@DD DDDD`DD@D@DDD`DDDDD DD`DDD@D`DD`DDDD@DDD DDDҠD D D`DDDD@DDDDE EE E EE#E+@EE EE&`EE)EOEJPE@E-EE$E"E:E< EJEIE%E$E EE EE(ECE@`E0pEE' E1pEE1PE)0E(E1`EPEC@E7E#PE%E'@E/pE,pEpE" E!E*EA EE@ELE~EEpEuE{EU`ENEFpEUEkEEExE{`EsEEzPEEE`E`EyEoEmEpEEErEdPEn`E_EmEE EEEEEEEEEE@EhE0EEEEEEEEEEEhE E@EE@EXEEXEEEEHEhEEEE0EѐE0EEEExE(FF lFTEE E`EEEۈEEpEHEEE`EEEE8EEhEEExEHEͰE EEѸEEhE`EE8EEPEܘEEE߸EHEE FFTFFtF FEEEEhFFF F|FF(F"FFF$FFTFF/F/F!FFFFTF LFFFF*<FF)F<F7F8F0F(DF-F&FFFFXF|FF%<FA@FJFTFU`FZFdFcFVFOF>4F1F>FGhFZF^FThF^FaFQFPF^FXPFHFOxFSFVFZhFWF_FPFK4FJxFf8Fx Ft$FcFe@Fb0FMXFEFJ(FTFWFjpFgFoXFFFFF~F{FzFxTF\Fl(FZ@FNFQFLFLFBF;pF8F0F:8F?F?F5XF1F<FFpFNFXFcFFLFFNFF{FYFMFGHFDXFUF|,FFBF,FxFsFh FhFdFe`FeFcFaPFmFyXFlF_FPLF@FEFOFmFnFbFelFhTFF FjFNFq$FiF`lFdFiFi@FqPFtLFdF6FFXFNFFnFFDFFFnF~ FFFJF(FFFFFF,FFFFJFLF>F"FFFFF6FFFNF&FLFjF\FFFrFFrF0F"FFvFHF(FFFFF^F0FTFFF$FFFFBFFFFFF*FFFF>FFFFFFlFFFFFFlFFF>FzFŶFFêFźF`F0F F>FHFFnFFFFFzFFFFFtFFF.FlFFtFFFbFpFFF^FFtFFFrFsF{ F}FwhFt\FsFoFvFFFRFFfF(F8FF"F~F*FF<FhFF(FjFFFFFFFF0F\F8F@FF0FF F FFvFF FFFXF FpFVFFFVFF͘FFFDFF2FFF>FzFFLFFFJFFrFFFǨFvFF(FRF´FF FF|FFF6F F,FxFF.F&FF0FFFfFRFtF&FF6FFhFFFFFF^FFFF*FtFFFF@FFFFFZFFFFLFHFFXF>FRFGG"FFNF2FRFFhGGFFFFdFFFƢFDFٸFޘF FFFFFZFfFnF.FFGG nG wGFHFRFFHFFF2F<FjFFvFF4FFFFFZFFfFFFtFFFFFFFF6FF"F4F:FFNGMFFGHFFFFFFG G qGGFF^FFNFFF@F0FbFFFGlG+G-G! G3GG!'G G GIG`GTGRG)GGGGGGG GGGGHG/F<FFFFF&FxF߰FtFFFF$FFFpFFFFhFFFF*FGGFFFF$F`FFrGOG GG GG jGFXG?FGG"WG:{G>xGAG3G")G%GGG~G)GG"G"G#G#GTG9FFrGG G FGmG%GzG GGGMGGG BGzG yGG}GG,4G#vG*G+G G G "GQGGjG]GGGG#GFpFGFFFFFFFFьF~FݾF2F8FքFFFFGtFFFG$G GbGuGFfFzFFNF٦FdFDF^FFFFFFHFFFGGGFZFdFFxF|GGG|GFFHFrF8FFF"F4FFF"F8FԎFFҶFђFFGpGGG G GFNFdFFG GGGG3G6SG6 G- G)|G2G;:G8G:G,GGGGG#G@GFGEG=nG;FG;GCG<GEGJGAGGGMG>G4G*GGGG8GGG*G G7GEGZBGcG\\GLlG9~G'GG+KG4G1lG#G*G/IGIGMG2G)G'ZG,?G'GAG[GGPFFFFvFFԮFҠFѼFFԆFFF٘FނFTF8FFF GGGG+gGYGK8G4qG7G5-GE7GIG>nG2G'yG LG'G*G6G1G4G*rGsF6FdFNFdF$FFtFFFxFFF٦FFvFGZGG 8GG G"+GGG+G$G)G!9GGVG1G<G4G1G'G3G1G+$GGGG &GGG$G*G'G*G/G5G,G pG<G!GG!#G*G4G-G)G*}G"G@GG G PGGGmG GjGG MGG4GGGG ^GGG$G*G8G-G-G$G*GLG qGG ^G3GGG!G'JG1G"G8G2GAG@MG&G5nG=G6G0G'GG GNG,SG)G*GG'G7jG;G:G0G*0G1G8G0G11GF:GECGGGPGQGSG@"GDwGMG:G0G:GKeG_GYMGQGlG]GZGESG/G':G@GG GG$G.G-G'G(G3CG.G= G?|G@5GBRG@G6G0{G>GfGXG9tG9G(G\G_G)_GE]G[GTG^ GJFGMG?eG4&G1>G.G/GG$oG( G"XGGGG*JG0oG5hG7G.G.G3GBGcSGg9Gc5GbGrGdGPGHG;EG1G/G,G59G.G#G'yG(GGGG G!G<GHG<G<;G! GGGIGiGGG1G)GjGCG+1G7-G'gG1GGS{GYG`8GAGB_G3G/=G2GAIGCGVGjwGnG^GSRGOGl[GG{GlG\%G=G6rG>~G?G.LGwG";G@'G;GI]GWGB G>GC5GJGMGVGBGLGCiG>G;^G4NG8hG3G$uG(XG#8G"rG"tGjGFG0G.wG+G1GN'GVGS,G/UG-G-/G*yG4G7 G>GG?G1$G6GIGQRGFGDvGDqGjGGr|GhfGh7GboGnGe3GmGkGqGZGX|GBuG6G'GG)GGGG PGGF&FrFF&G GG rG/G 2G!G,G5G2G-G*NG$QG*G&-GGG G GG)&G$ G,GAG3NG*G1 G9bGHGp^GnGdG\_GFGEG0G)GYG%&G(MGQG G<GjGGGG GGG G F~FFF4FjFFF8F FGG GGBGH~GO G<5GVG]Gp|G[G=G$GGGG#G mG-G.-G=GBGSGFEGTGlGNTG]GCG(GG6GGG7GGGG[GG!G+G# G%TG JGGG6G+G+G-GGPG}GG GGGvGdGG.;GGZG?GGFFF6FFF~FbF(F*FFFF:FFF FFFG=G!{G,WG4G%vG6ZG*G G*G+tG:vG?GGG FFG|GG$ G%GG yGGG 8G GGGG}G%GGGG HG G FFFFFFFZG G!G"GKG4GGtF|FFGAFFFxFFѠFFFFFF FxFF&F\FFfFFpFFhFFFFGKFGKG dG F<FjFtFF:F.FFF>F:GFFFFFGGJGvFFFFRFF@G GFHFFFؠFξFFpFˬFTF>FFFhFFF*FFFF~F(FvFFFFFϪF&FF.FF(F|F}F}F$F F*FF{F>FFPFFFFFFdF$FFFNFFF6F FjFFFVFFFFFF FFFF|xFllFzFvFFzFupFwPFx(F|F0FpF^FF0FrFFF4FFF"F0FFFvFFFFFFFFlFUF;F. F=F+F.8F.,F!F\FFF FFF FEpE0EFtFF 8F FFEEEE(E0EEEEEEE0EhEpEEE8EXEEEE8EEE`EEEӨEPEEE@EϐEEE@EE@EEXE(EEHEİEEHExEE0E0EXEӀEHE EȐEpEEpEXEE͸EE@EExEEEEHEEExEwEzEEE8EEE EaEDE=E;E1E,E,E+E$E!E)pE,E-pE6EOEVE]@EVELpE:E)`E*PE*E/`E,E2E6 EBEHEJEUEWE`E^0Ec0EiET`EZEAE>E,E.pE4E4 E)EpEE EpDDDD`DDDDDD D@DD@DDDDD@DDDDDDDD@DD@DD@DDDD@DD@D`D`D`DD@DDDD`DD@DD`DDEDEE EEE0EEpEEEEE8 E(`E%E?E<E?E*EEpE&E2`E;@EDE; EPE`E E`EEE4`EDE/EE PE)pE-PE/PE(E(E1EEENpEJE*PE$E2E(E-E0E!E5E)PE9`EGEU E]EpE}ElElEgEIEJ EHEHEZ EeEi EoEE|EEwEEEEv EiErEwEEEmE`EmEcEUEYEvEXEEEEEExExEv EEExEhE@EE0EEEEExEEEEHEʨE@E(EEEEEɨEXEEE EFEEEؐEEE EEFFFTFEE`EhEˈE`EhEEE8EEEXEE0EhEEİE(E8EEHEEpEXEEE˸ExEpEEhE֨EְEXEE E`ExE0F F @FFF pFDEEEPF|FF$F FF0F"FPF!8FF FXFhF!F0 F,F\FFHFpF F <FFFF!FF&F:4F9F3@F,pF!F*F <FFFF F4FxF1DFELFMFRdFOFYDFmLFhFVLFJ,F?F9pFEFTF`FqtF_F`FVFQFY<F_F\FNFRXFUFZXFX\FSdFNXFSFLFMFsF},FpHFkTF]FPFQFS(FT@FXFg|FhFj@FzF@FFFFFF|F|FpFlFl8FYHFIFJ@FGF>F?dF94F6F6$F7tF<\F8F;LF9FL,FTPF`F]FvF}FFFFdFfF\XF\FcFd(FF(FhFFFFyHFgF[LFWFXFTxFblFqFuLFxFlXFXFSFPFTFgFrFu<Fl FnFyFFzFFdFqFkFhFiFp<FnF}FFFhFF2FF.FFFF"FFFZF:FnFFFFPFFRFvFDFFFRF~FFFFFuTFzF|FFFFrFXFHFFFdFFFFF|FVF4F$F4FFFFFTFFxFFF`FFFfFF<FF*FFFFF^FF:FFVF|FNFFvFŢFF FFF8FtFFFȂFjFŶFF$FFFbFFVFBFpFFFtFZFFXFFFFzFFFVFFF>FFF,FFFFFFtFFpFyTFDF>F~FzF|FpFxFFNF&FPFnFFbFF FZFFFFFFTFFF$FlF@F0FɨFZFԞFҼFFFTFFF۸FLFFFFxFFnFF<F&FưFFtFpF>FފFRFbF8F`FFFFF2FbF^FxFFzFFF&FFFFFFǸFFDF*F~FFF FFFFPFFFDFžFFFžFĂF4F6FF FFFFjFfFF2FFrFF<FFF<FFF0FNF,FFFFFFPF,FNFȪFߐF2F6FF6FG5G GFBFFFFG$GFFpFlFRFFFFFFVFTFFFF.FFFF0FFGG GG GTGFF*FFXFNFBFFôFFFF8FJF`FrFFhFFFΰF̬F2FFdF"FŐFǜFFFFFȒF:FGbFFF:FFbFG4FGWG GwGGdG WFFFFXFFFFGZFFGaGG,tGbG4GG%IGgG+GnGG GJG"GGGGeG}GG G G <GG 4G 7FFFhFFFVF4F,FLF.F&GaGsG G0F F FFFFFFFFRGzFFF4FF>FPFGG G$G-GGGGGvGG G)GFGF G=G/JG0G+G0G.}G(G)cG$G/]G05G,:G/G?G GG /GG&G G G'G GDGGGGG1GG G VG GGG xG G!rG+sG(G "G AG GGGGGMGhGBG WGGGGFFFFFF4FXF@F˺FͲFڒF@F߮FFF؎FҊFrG)GG 8GGG;GG #GGFFFFFFF֮F2F4FɄFFFFFxFFFF<FFFFFGGFG *GNFtFFFvFxFFF FҪFFFFFFGG GGGGcGFNGcGFGG G&GEG3~G5GDGAG;"G=G?G@$G90G(GPG"G&G@GNGKBGDGBKG9GDGVG^GeeG`GPGJGH;GAG-G%-G!GhG5G yGGGG#G/GIsGY!G_GcGL{G:.G+G#G+~G4G:G< G1=G7GIGG}G0 G7G0G.zG&G"9GGMGG[FFvF FۜF؜F F F FF؄FF>FFlF<FGG_G GUG bG2GBGA,G, G1GCGB GHG4G:;G: G1.G7G-4G0YG7FG:G4G$GFBF(FBF\FPFF.FFFFTFؤF*FڄFFtFG GcGG!GG%GGGiGG G G>GQG=G0G$7G!hG G$<GG GNGGGG G#+G 4G$FG G,JG!G FG G GnGZG%XG.G54G/+G0G .GGGG6GxGGqG GGsG G6FG|G+GGG fGUGTG!G(G'G*QG$G+G)KGG GGNGGGNG&G%G$G1G6G9G:UG20G6G/PG*[G0PG(GGG tG$}G%SG(uG"=G*(G)G,G+"G%SG'G+G-G1&GEGJGG@GNGoGfG@G7G%G"G-G)G=G`OGhGZGJGHG@G2G5G(GGG G&G!GeGFGGG-G<G1G1$G/G0RGOGhGkGoUG~GGGrGdGOGEG=G7iG7oG3 G1G.G,GNG GEGG,aG0GK>GIXG\G:G)G 9GGG G/GrGG!yGG)CG'G,G>GUG;G9rG=G:8G8GDuGRGGGF+G;G;`G4GDG.G+G0MG/+G,G5GOGe GhGm-GqGeG`XGFGA@G>\GBGDgG.6G*G/GEQGTLG:G49G#IG&G*5G)G'gG,GG EGGFGF|FGGG1hGN#GGGGGGGGeMG[G]GX'GMGJGFG;G?G?NG(G0G! GG#jG'G%GG;+G9GJ,GN:GHGSGSGj GG"G>G7G2G:wGF!GLUGVG\Gj<GmGhGkmG|YGG}8Gu~GdtGKuGCwG@(GFGE(G1kG3mG9GHGQOGX2GQjG9G5hGMGUpGXGEZGMSGHG>GC G=GN5GJG5G3G!G6G kGGG'G,sG,G;GCMGQKG>G8G4G,sG*G(G3G9(G=GQGfGvGGGG\GGGMGGG> GSGFGfGfG]hG?GOGnGkG[+GTG\GiGd-GjoGpGaGBGBGGGGGRGGG G 3G GYGNFFF&FFFGG GRGG*G0G*GDG>G0'G&iG8G<G/TG/GcG_G-G3eG?DGF3GIrGI@G.OG6PG5!G<GS GcG`GiqGOeGSG8wG#FGXG(G GGGG G 4G GG IG`G &G(G GHFhFFFFFtF,FF FFG G.TG9G3G3GFGP&GgGaGKGDG'3GGGGG)G+:G>G9GKxGGGPfGWGH_GaGG;G'GaG G G G G\G}G oG GGG1GTGG qGlGGG!G XG'G$MG AGFFGbGGGGNGgGhGGEGGFFFFlFFFFFFGxFFFݒFFFZF:FGGG#G[GGGGGG$ZG&2G!7GgGGFlFG GGiGGFZF8F*FJG;G G G G GGvGGG GGFFFF4FF8FzGMGGG?+G2PG#GFbF6FJFFFFF.FF$F,FF0FxFbFzFFfF~FrFFFFFFVFbFFzFGFFXFF`FVFFFF\F,FF>F"F(FFFͼFFFGIFBGHFRFF\FFܔFFtF4FLFtFFrFFF4FFFFFFF2FvF FFFFFFDF6FFFFVFFFFFFFxF|FFF,F~FwFvFFFZFFNFFFFtFF`FLF<F0FFFFyFFFXFFFNFFFFFrF|FkxF]FXFulFFFq8FXFXxFaFj8FgFtFF"F2FFFZFRFFFF4FsFFFFbFTFcF[hFZ|FHF>XF.dF"F|F,FhFF$FF FhFxEEFEE`EE(EEEEXEEExEE@EEPE8EƈEEpEE0EE8EE`EEӘEEpEшEEpEۨExEE`EXEE@E0E̘EExEpE(EHEEɰEјEpEHEEE E`E0EPEE`EEEEPEܸEpE(ExEEE8E0E`EEEhE E@EEE`EXE{E`ExE@EE EEEs@ET@ENEJEGE>0E2pE6E'E)E@E$E(0E(`E6@E=EBE@EGEOE,E-`E1E(E;`E7E:EL0EXEaEdpEfEpEaEXEaEq EmEY@EJEC@EGEB`EEEK0EGPE8EE 0EpDDDDDDDD DDDDDD`DDDD DD DDDD`DD DDDDDDDDDDDDDD`DD@DD DDԠD DDDDDDEE E E DE E`E E0E E PEE+@E#`E)PE6pE=pE1EEPE0E$pE4E<E1PE*EEDEE E1@E: E)PEEE/`E0E=E-E0pE/EFEHEHpE-0E%`E.@E7pE:E%E)E.E@E3EPETE_EpEjEmEapEgEZEMPED0EIpEQEcEipEyEEEXEEEErEsElEipEopEEHEEnE]E\ Ec`EI@EREh@E~EEEEEEEEE8EHE`EEEEEEhEEEEHEEpEEEEܨEИEEhEE EXEEEEFEEXEXE EEExEF F$FpE EE`EEEEEXEHEE0EPE E@ExEpEðEрE`EɀExEEhEE֠EPE@EͰE E`EEhEhEEEpEE(EpEFF FFEEEXEFFFFFFFFFFpFFdFFdF 0F&F$,FFFPFF FpFFLFdFFPF% F-F3F0F#FPF#HFFFF8FFF!F58FDlFHhFEFJFXFb0F^,FSFLXFFpFAFMFUFa\FzFcXF_PF_FY Fb|F_\Ff FhFT4FJ(FMFHFIFHFEFNFcFwFvpFkFV8FIhFGFKFK,FKFTLFZFn8F}FzFFFFF|FlFwFaPFdF^(FOF9F@F@XF9PF<F0F/F1F58F:F>F>FFXFZ FbFfFnFyFzFF:FF}PFr`FaFn$FFFvF0FFFfFFhFRdFYFZ<F\FbF`8FgFo FgFvFcFhFiFwFrFPFFFFF FFFFwFz`F{$F}`F~FFFFFFXFFFFzFFFF"FF^F FFrFDFFFF`FFFFvFs FLFyFy@FF|FFtF{FFFFRF8FdFF"FFFNFFjFBFFF.FRF.FFvFF.FFNFF,FFFFFFFFJFFrFFFFFRFvFFFFxFZFF FFFXFFӔFFFFFFXFFFZFFFFFF^FFFFfFF^FF2FnFFFFFFTFFFFPFF FFFFFF~4Fz8Fx@FyHFtFzFFFFF2FFZFF FFFFFNFFFFFBFFFnFFFFFFFzFvFFFFƐF|FFFFFXFF~FBFF>FFШFLF<F*FFLFFFFJF*FFFFFFF4F(FƚFȆFF FFFFFFFFFFNFFFFvF*F̶FвFɨF FFF<FFFF8FFFF6FJFrFĜF:FFFFFTFFFFFFF<FzF4FFF8F(F2FFFFF.FGGnGGVFFF<FGG)GFFFFFFFFdFFFFvFFFߎF݄FXFF2F"FG GTGGGFGGlFVFFFʈFXFFdF¾F´FjFFFF>FخFFӈFԞFߎF<FDFVF֚FӪFFFFFFFGF0FFFBG?G|GGG HG GG G"CG GFFF6FbFFF GFG`GwG _G GGOG GGG!GGGGGG&G,G+GG G%G2G _FF*GF$G /GFFVFFFFFF|FGFG GGGpG 1GGhGJG)FFFFF2GtFFrFFFtFnFFGGZGG.GG {G GG xGG>G7GI:GIGA)G:G4\G8G)cG*G(G'G9GDG;uG6G0 GOGG G GWGGG%`G3GGsGyGvGGG GG GjGbGG GwGGGbGG G GGGG G"GG G G GG*GGFFPFrF@FjFFF*FԊFFFBFXFFF@GGbGG G GG G wG G OG GIGGFpFF8FHFؼFԦFJFFFFzF<FVFPFFߪFΊFhFF<FFBFGAFFF*FF FfFĄF,F€FȲF2FGFvFGG lGPGG 'G.,G* GRGGGG*GGG"AG1G+G,mG4G@qG?G4GAGG=GEG-G#G&`G/G=GTGYlGJfGCG@G=GRGcWGsG\GIG=_G>ZGHG4WG!GGG5G)G*cGG2(G'NG%G? GZGl_GoGUGLG5G,G,G=GbGgGMGMG[|GX GTG>FG(gG9G0TG5G cG GGFFFۜFڢFFF~FrF FvFFVFXF$GG zG)GGGG(G53G; GM]GGfGB$GHG\GSuGKG?G?.G6G4G2G44G@#G:G/G!G F8F FFFFFFFfFؘFVFlFFFRG G 'GG GlG GUG%ZGGGGGGG/G7G))G!GGGGGG7GGWGGGDGGGGG"G03GFGG G.G GG%G:zG>G),G#sG GGGGG G GG 9GFG|GGFdFZF2GGGGfG3GG!BGpG!G0|G1GG$GGnGGGG%@GG/G(sG5G/G=G;G5EG)G,8G7gG*-G$GGG.$G'G-nG%G%G(G*}G+yG2G'G-IG-G+G88G>GPGZGoGGGcGMGPGPGJGC,GVGfGbGcGnGGv1GYGIG=uG.NG&G({G+G1*G1G'G4GB=GU<GUgGKZGW7GehGhZG]VG^GcGJGhGnGFwG.G&RG6G%QG5G=:GQ0Ge8G\KGO^GIGFRG8gG.G'GGGGGVGGnGG?G&G-?G(+G!G.G6$GHpG_Gr:GuDGGGGGkGZ@GSHGOG>GCG6G1SG(G+yGUGLGGG(G?GRCG^GnG:{G-:G#*GG G$GG GGLG(GG'qG4 G4GZGEG>GCMGGGJG[GTGT!GWNGKzGFQGQGPG:G-G/9G)G(G!GCGcCGaGhGc0GrGXGJ8GG`GK.GPpGBG>%GBG5UG?GfG\)G9sG0G'G*G!G!yGG G PGGGG!FbF@GG @G&G*GU&GuGGGGGGOG^GNGQ(GDGJGK(GG<G3G1G)yG.GcGGGxG!G,GAG?GAxGKGQGDGLtGUGBGIUGFG9kG<G?GC\GNGWGfGi8GhGc!GhG{GGwJGvlG`GR-GRGK/GIG=GGGG0GNBGX)GYTGPGBGIDGRGKGUGPGYyGQ-G9-GEGL%GWGTGHG@@G4G+GGGGGG$G9zG=OGNGCGBdG,LG%G*ZG-sG3G9G2GFGcGxGGGGcGQGNTG\G]GWGhGrGG~GoGj<GTGPG<2GDGDGI)G=GSgGfGCG;G6 G2G$XGwG G)G 5GG G G FF<FHF0FGJG EG GG!G.*G8 G.G-$G7G0;G)G39G.G2=G(G/GAGGGPGFGDGWGKGBVGS$GaaGUPGcGl6GtGGjXGOGHG-G}GG FFHGG GGbG kGG1G+GFGFFFFFF`FԮFȨF:FTFFDG DG6G"*G/GH{GLGVOG`7GQ{GVG>G%G4GG-G-G2:G>zG?G@GNG]GKGdVGOG/G(G GG G G sGG G GVGG ~GGG#sGSGG <GGGGGGwGF8G5GG,G8~GMG G GGFFF"F"FPFDFFڀFچFFҀFޖF0FFFєFFzFfFƢFFFGG#F6G>G GGG G GGGG 0FFF<GGdGFGaFFFFDFۘF\F`F"F\FFFFG`GfGFF8FԾFF>F:FFFFG NGGhGrFPFbF6FjFF^FzF8FϴFFdFF FFF.F FJFF^FqFr0FuFhFFFFFFF4FF\F԰FҀFFˆFFĀFF$FFFFF>FXFlFFǢFFVFhF*FܦFFFFlFF΢FFFFRFFF FF€FDFF̊FɚFFxFBFFF8FFFNFNFFF0FFF,FFFFFFFyFLFvFk0FkPFkF`FwFrFFFFFFFFFFVF>FF*FFpTFlLFiFsFoFk|FsF}FFFuFmtFkFd(F[8Ff`FjdFVFFgXFZLFXFLDFOFULFeFyFbFFqFl,FbHFj$Fc@FoDF|hFxFbFpPFv,FvFzFkdFW FU0FH,F9lF1F+FFdF@FFFFFF|F FFEExExEEEڀEEEEEhEEE٠EXEȘEEHE@EXEEEEظEߘEXE(EрEǘEE0E(E(EƨEϘEEhEEE`EǘE EEEEEpE0EEǠEˆEPEаEXEEEސEE(E@EEݨEEEEEEEEE΀EEpE@EE E(EEPE`E(EEE EEEHEE|EqEQEGEHEIEHE:EA0E6E)0E'E$ E# E%E%pE'0E1E2E6`E>PE;E6E2PE2E<EC`EDEIE[ E^pEQE[ERPEPENETEbErpEsEf0EUEHEAEDEY@EvpE~ EQE=E$ED`D`D DDDDD@D`DDDDDDD@DDD`D@DDD D DDDD@DDDDDDD DDD`D`D`DDDЀD`D΀D D@D@D D@D@D`D`EEEE E DEEE EPEE E0E0E,E+`E5E.`E'E$`EpE E)ECE=E+0EE E E @E EE< EE0EE%E10E:E>E/E*`E<EHEA`E, E$E!E-E:pE>@E"E"pE'E2E5EJE[EqElEiEbEb@Ej`EPETEaE[EYEdEe0EHEEEXEEvEvEnEc0EuEc@EaE~pEPEyEcE[PE`EY`EDERpEmEzEEE8EE(EpE8EE(EEXEEEEEpE@EEEExEXE0EE8E`E8ExEEEEhEEE(EFEEEEEFpE@EEE8FEEEEXEExE0EEEEEEưE8EèEPEEPEְEEHEިEEE߸EEE8E˜E(E E0EPEEExE EhEEEhEFF\FFEFF F F FFF$F FFFFDF DFFF(F<F F&F((F,F FHFpF$F FF FFF|F!DF*F&FF FFFFPFFFpF&F3hF@FIXFJFG8FMFbF_FTFULFIhFQ,FOFRFaFuTFh\F`FXFdxF\FZTFfF_FTpFL8FDxF=FBTF9FMFV8FcdFlLFghFMFMFI\FN\FZLFWFXxF[FdF\F8FF*F.F^FF|FoFd(FZ8FXFOTF?<F3F3|F2,F3pF1tF0F$xF,F9F?FHlFQtFZhFblFldF8FFFFFFFuTFvFkFFFhFFFFFFjFXlFUhFQF[DF[dFYtF_Fl<Fp$FrFuF\FzFFFyF|FJF FlFTFHFFFF*FRFFTF8FDFF\F*FFFFFFFF:FHFF^FFF.FHF<FFFFFF\FFxF{FzFzFnFFFFxhFxF}F*F*FBFzFFFFF^FnFFFFFF.F,FFFF,FFFzFFFFFF"FFFrFFLFFLFFF2FFnFFFBFFF FƀF FFFF(F&FFFFFF|FFZFvFFF F^FVFFFFFFFFFFFFrFVF(FFFFFFFFF2FnFFFRFzFuFuF~HF|\F|TFzFyFtFFFFxFF<FF F6FrFFF8FvFFFfFF2F*FBFF܂FFxF$FFRFtF:FFFbFZFnF(FFFtFFPFFF:F8F F(FܒF&FFFFF8FFFFFrFlFF FJFFʦFhFFǤFFTFTFFʰFFFdF,FFFxF FF~FFFFZFϲFFߒF,FDFNFPF8FFTFF6FFϠFFFTFFFFFFF FfFFnF FF0FF F|FF6FFFF\GGG ;GFpF`G7G5G GZF|FFFFxFVFFFF6FFhGFFvFrF$FFFpFG=GGXGsGG GGFFFFzFF̎F6FŞF8FFF|FFFϚFFDFFFFFF*FоF2FrFϤFFFFGGGiFFGGG EG SGGGGJGGG 0FZF0FBFFFGG/GWG^GG pGG GnGG#G)PGGGG VG[GHG GJGHGGJG0G@G #FFFGGFFnF݆FFGGFFG GG eG8GOG ;GzGfGGFFNFrFFFFFFFF(F.FvF.FGuFFGGG G GGGG#IG4GCG=[GGGDGBG7^G'G(lG/GCGJ.G:G.7G/G#G}G%G>GG G"G6G0,G+GQG%GGGGG G |G xGGGGsG G GGaG G {G GGWGoGMG\GG2G GGGG"FFHF$FFFFF`F֦FFFZFӆFڢFGG-G$GGG]GGG"GhGIG $G !GGG GF<FFژFFFFZFF6FFDFF F0FrFvFF6FHFlFFFFHFFF٢FVF,FFF@FLFVGGG)FGG G,GDG{G!G+GGKFG9G [G%pG'G+G+G&6G5aG>DGA0GIRGPGIG<G:G02G/G1G>0GMG]}G`pG_GMG>'GE0G^GXGLdGJG7G9GDG0HG" G3G!VG#G,G.G0#G/FG5G-G<GQ!GYGbGXGHGAG82G0GGGcGxG]GUGZyG^GZG5G&6G51G.jG,BG0GGVGGGF@FF׼FѼFFFFFVF FFGGGG G GdG+G8G<GLGS3GO]GJ)G8~GRGRGGFGEG;G+zG3oG5G9uG=G/G G FFFLFFF6FJFF FFFlFFFGGGG^G G8G GGGG GGjGGG7BG&GoG@G=GGKG G zG G cG G GG 6G GG GG.G'G(=G=GGGbG$G'sG8GBG+G!OGGG G>G G RGGG G +G.G VFFFFFGFXGGGGG1GKG$DG. G(G- G+G%G%bGeGG%G!G&G)G0G0XG0)G.]G-G,G0rGD5G;G+GGG!GGG"G.G0G? G:G+G&sG(G,qG%G2GGFGYG]GzGGGGlGcFGUvGF=GGGZGsGGzGGx.GtGjrGVGS(G9G-G)"G2HG>GRqG=G;DGIGQzGKG\GdGGuGrGnGhGYGTGrKGw7GHZG.LG)BG%VG#2G7G<GJG[GJxGDGMGA(G8G)G'RGGGG |G GGG=G MGG0G2VG.sG9G51G>KGTGdGhGrGGGGmGS%GOhGE-GEGI[GFtG>G.G)2GjGG !G1GG<GQGm*G`_GEyGDG<`G+G06G,G!GG"cGG+EGG!G(9G4GSGG:GHGHGU GWGpG`G^GRGLGGMGGGFG;!G/G,G&G"G%G<GNGTGZGfG}GfGVGSGHGUrGCzGAGBGGGGFG%G GFG5GGJG*G G"dF`FܸFFFތFFFjFRF6F FFžFvF4F>FFFtFFlFFǾFTFFTFFFFhFF.G G GG*G GHFF\FFF|FFFFbFhFFɜFF2FFFFFFFFFFxFFF݈FFrFFFFFGrGGKGFκF6FF͸FҾFFFJFvFFFFF FFPF&FdF}FoFatFbFsFzFv`FFFFFFFFFFbF&FFFnFF&FFFfF$FFFͤFFXFF*FƚFFnF FnFFFZF*FhFF@FFNFFF@FF0FLFTFǾFFBFFF:FbF|FFFFdFFF*F^FFFFFF6FFFF|F|FFo FuLFFqFvF|Fk FuFDFFF@FF<FFFFFFFFJFiFdFe(F\F]F\FftF`PF]\Fc FaXF^F]FoFfFaFy,FFpF]$FOFGXFIFGFTF`\F_FTFOFEFQHFIFT F\FdDFSFdFlFfFvFrF\FLFPFYFDHF7F*F)dFTF 0F FEPEFFTF@FFEEEPEpEEΨEذEEEHEװEEXE@EͰE°EEE8EEEEE֠ÈE0EEӨEE8EEE0EEpEEHEEE@EEhEHE͈EhE¨EȈEHEEEˆEEE܀EʘEEEEEEEEE8E0EEE8EEވE(EEEEE@E8EEhEEE EEnEjEjEfE[`E^E\EZE]EIEKENEC@EAE70E,E$PE&E#E%E*`E,pE'E/`E5@E5E7E,pE$E3pE>PE@E@ETEWEXPEOEKEMEM`EPEOPEiE_`EbEYE?E>0E?EUPEvE0EEWEUE<E!DDD@D`D~DDDDD`DDD`DD@DD DD`DDDDDDD@DDD`DǠDDD`DD`D D DҀDD@DߠEED D΀DȀDD@D@DDDDEEpE pE E EPEEE@E EEEE E&E@E*0E&E,pE @E0EPE`E pE'E& E E@E@E E pEpE EE0@EPEE$ E1EF E9 E=E90E;EOE*`E$0E0EE(PE+PE)@E(PE4E.E0E7EB`EQ0EeEdEZE[EcEbE^0Ed@Ej@EVE^@E_Ex`EE(EEXEEhEuE^EoEl0ESEU0EiEvEh@E^`E^E^PEUPENEW`EnpEt ExEEEEE8E0EEEpEEEEEEEEEEXEEEEHEE̸ExEpEXEHEɐEȸE8EۀEEE E EpEEEFEEhEEE@EEE0EEEEEEE`EhEEEEHEEϨExEEEhEE԰EEEܠEE EEEpE@E`E0EE@EEذEhEָEHFF8FEFFDF FF (F|FhF|FFF F FdFxF F F FFFxF5F#DFF FFFFxFFFxFFF$FXFFF FhF FFFXFFF F4`FDFS FTFRFVhF^8F\FMFUFOFKFFFNF[FYFZFbFh(FWFR|F^,FfLFZdFO FFFC<F>,F9F>FF|FLF`FodFmFSLFI|FTFPDFYFdFa`FvFwFFhF4FFFFFfF\DFRtFMFFF>F,LF*LF)F3F3F, F#|F,XF7FH8FNlFSF^<FmxFvpFFjF FDFFwFFtFnFtFzF|FFFlFFFFFmdFf FYFPFRFW@F^ FjFkFmFpF|FFF`FdFFFFLFFhFFjFFnFF{ F FFFFFFF6FFFvFlFFF:FzF*F&FFF~FrFxFF^FFFF|(FF~DFxlFsFwF6F,FF|$F{FFF$FrFFFtFFF\FFFF\FFFFvFdFFF"FFF\FF`FTFFhFFFFFHF FFFF~FFPFFFZFFFFFlF|F FHF F@FfFF(FXFzFÆFF|F(F FvFFBFFF.FFF&FFF(FFNFFFFFNFFFF FF.FFFFvFFtFdPFkFkPFvdFyFu8Fq F{FtFx<FFFZFFnFBFFFFFrFFbFF FTFRFlF@FbFLF2FFFxFFrFFFFƎFȌFF&F˜F&FFFTFF*FF׎FFvF܎FpF.FȂFrFFFFF>FF8FFNFLFךFFFֶFXF,FFƦF6FΎF۶FJFFTFFFFFèFFFF2FFFF6FFlFF FFFňF̈́F٨FFFFzFFFFFFF<FF"FFFFFFFFFnFFFFrFFF"FG;G GGG5GGKGxG G G1F(FF F޶FFFFpFF8FFFnFFFϲFbFG G rGG G!dG$GFG "GTFFFlFFFjF:FFĄF:FHFJF2FF4FFͶFFPFFFFFTFFF0FFFFPFGFFHFGG G G GGG%pG$G GG G FFFhFF$FFGG GGXGtGGtG#G%CG0pG(GGmG&GG3GG9GG G2G :G^G 1F`FrF$FFTFFFFZF|FGFFFZGGaFFG]G GGFF8FpFFpFF4F<FGG{G$GFLFrFFGFGGCGGBGGG9GG7 G6GDG8G:GBG:G5?G5G2G7GCG4G!cG#G'GvGG:GDGG#G$G6G*G$GG5GGGG G G2G ^GGGcG G yG 0GG GGG dG-G"2GGGG4G9GPGGGF FFTFFÄFFFJFFzF F$FFFZGG^GGG}GGGG GGGG\GGGG FFFF&F<GFrFFFآFFFFFžF FBF,FFFXFF0FFFF~FFFNFFPF,GGG GFFGG G!GGgG%>GsG (FGSGG-6G RG$JG5<G9G1G5BG:QGWvGSVGQ GSGJGH`G:G&%G'G5GAuGKmGaGZGK;G9*G5GYGH;GIxG?G7G-`G+G)GaGG#G:G6G=GFhG3G15G'G/%G7MGH}GU`G@G?G@G1G3.G>Gm6GGZyGYkGZGcG\IGFG2GTRG\G<G!GG GFfGFPFFvFϠFϐFFFpFF~FvFRGZG WGG FGUGG&G/GNGX|GEGGG5G<;GKGCG<G7rG;G3oG2G9G<G1KG';G FF FFFF0FFnFF0F߾FF0FZGuGGGGGGGG kGG GqG)GGDGG,G)G'GGGGZG<G GGGGFFGG 5G LG4G.2G(GYGG rG GWGJG G)6G9jG9GGGG+GG:G GGG 4GAGGFFFFFzFjFFXGCGeG=GGG(7G@G4G)G(2G*~G2NG:(G8GA[G(uG/G%G3G1G8CG.=G#|G,GK GSGg%G@GGeGG GsG(*G;GE4GNGIGALG>G3G8`G'G4GHGVGdGlGGGGp2GfGWGbGeG]Ge(G|GqfGvMGmnGxG{Ge<GIGAG7,G1G;GKG`G\GLGKGPGExG\G[GeGjGYGWGSgGW GaGnGWG5DG0KG"G($G+G,G;GEXGHG7GFG1G,JG!kG%pGGGGGnG hG }G GGG6GGGGHGXGRGGGr5Gd{GBG*EG3G-GgG+G GG LGvGNGGFFHFGGG[G)G:G@GCGRGjG[`G2G=kG:G?QGWGFG,;G2DG3G1aG,FGIG7GG$G#G)%G1|GQG[,GHGVG7GAGAG3G7G6^G+G8MG4G0G#G/G>$G[GqHGtGlGGGGGu*GjGuGuG~G]tGDGDGLpGNG`GJGdG]G`.GpCGkHGsqGjG^GTGXeGWGEGNGfGg\GKGTGGG9hG*GGGGG3jGGGEGBG;<G2G4G0G'G:(G=.G;@G<{GazGvGGGGvGXaGSG`GXGeG~1GGpGGaGLGF G5OG%GGGG GG\G GG?G FPFFF:FRF^GGG F8FF8FFHFFG |GLGG5G6GEGDWG<G%G$WG*G3GD G>hG$G"G/GEGFGZGbGKG2GCGUGqGrGvOGoGZG^G@G@AG-zGGGXG$G]GnG{GJG GG^GGGF.FPFzF&FFFTFպFFFFFZFFƜF(GGG)+G8G.nG<GAG)*G" G2G,G QG`GGG)G%aGGG(G.5GGGGCG wG G GG )GfGG BGGFFGGkG G IGG>GG G FFFRGF6F^FFPG GGG@FFfFѤFrFFjFpFF*FʲF:FFF@F\FFFFFÔFzFFFFٔFFFHFԞFFfFVFG GSGG AFF*FF܎FFF4F6FFNFFFFFF<FFFFԼFFFF0F\FFɔF8FVFFFF4FF<FVGqFFFxFFFHF<FFxFծF͂FFlF*FZF<FFFbFmF^FZFZ(F^FiFj(FlF|FrF"FF$FpFF̚FFFFFFFTF4FF~F FÒFnFFbFFFFHFxFFFFFFFFFFBFzFDFJFFFFF|F&FFFF>FFdFFhFFbFFFF FJFFHFFFFZFdFFFF,FptFwFyF|PF{FzFu F}FF<FFjFFFVFJFFPFF<FFvFsFoFgFkFfdF`8FXFSFZFflF`DFb8FtFl FdFgFcFcFj$FXFKFBFGPFPFM`F;F7|F.F4F>TF=FHDFEFMFW,FsFbF\FoFnFalFRFCFBFHpF+F+F)F&FdF EEEHEEExEEEEEרE`EPE@EˈEȨEEŀE(E0EE@EXEEEE@EEXEEEEExEːEٸEE`E E EE¸EEEpEEE8EEpEEE(E`E0EEExEHEEEEӈEE`EEExE@EEPEEрEE`E0EE EEEE`EEPEEEEHEEEE}ElEY@E_PEH`ETEdEbExE^EY@EEEMpEAE6E8E1E-0E4E8E+E.0E1PE-0E. E3E8`E1E*E1E2E1E4E^E~EpEb EZEXpEL EF0EPEW@EMEHE80E+E= EL@EnEEE0EE`0EK E*`DDDDDD`DDD@DD`DDD`DDDDDDDDDDDD@DDDDD@D`DD DD@DD`DDDǠDDEDDȠDD@DDŀDŠDӠDEE E`EEEEPE EEEpE"E)pE@E%EEE$ E,@EEE E@E @EE EE EEE0EE EEEEEEPE6EBPE>E=`EApEIE1@EE@E!E@E(@E"E-E"`E/E)E3E>E@ELEKEWETEYEdE_0ElEh@ErEt@EiE[EqE`EE8EEEuElE_@EZEZpEJEEEUEXPE\EQ`E[E`@E\E]EbEn0EnEzE0EEpEXExEEE(EEEEEEEEHEEEPE EPEE@E(E͠EEE E@EE0EEE0E EEEߘEEPFFEEڨE0E0E`EаEEEEXE EEE`EPEEPEEEEPE߰EEEEEEEExE֨EHE EPEEpEԸEـEE؈EEpEEEF$FFEE@FFpFFF HFFFEE(F F F%@F FFxFF FF$F*FFF F F F`F FFFF lFDFF FF FFFF|F(FFF!F. F8FFFYHFULF[FYF^,FPFKF@HFCFDFKlFRFJFPFQFSFc,F]FU$F[FWFTFFFIF@dF3PF8F6FEFXhFgFcF]|FFFIhFLFXFbFaFcFpTF}4FF8FF4FFv<FrFGFATF<F?F6$F-F&(F(F.F4F5F3 F9F6FBFOFVFcdFd\FvFnF2FF0F}DFhFmFhF]FcxFd,FqF{FXFFFzFLFy8FpF_8FaF^XF]pFoFu<FnFvFyhFFFFxF*FFFFF FFF(FrFrFZFFFFF(FFFlFFLFHFF4FFFFrFFlFFxF{FFF&FvFw,FFFFFBF}Fq|F|F<FFxFFFFF~FFF FFF&FzFFFFFFFFFFFFlFFFFFpF4FFF~FFF:FFFFFFFlF$FFPFF6FFhFFFFFFTFFFFFvFFLFFF~F$F4FFF\FF>FFFvFFFF<FFF^FFFZFFFlFFdFFFFFFFFFPFsFd<FfFelFoF~FzFsFxFwDFxtFhFFFFF FfFPF FF.FpFFFVF&FFFFF~FF FF@FFFZFFF¶FF`FFFF4FFFGSFސFLFFچFF(FגF˶FF>FFXF$FF$FFŨF:FtFFG FFFzFdF$FFF<FLF̎F̞F0FVFFFFFݚFF6FFbF"F|FҸFӂFFFF߼FTF~FFF.F.FFhFհF̾FFlFFFLFZFFFFFFF4F(FF|FxFjFXFFFFF*GMG;GGGFFJGG pG G$FFFFBF.FFFFF`FFFF|FڔFFF0GGG G G mGGWGG tG 8GUFFߢFFFFF\F:FF6FFTFFFȂFtFFF6FlFFDF8FvF̠FFfFFFjFrFFF>GGGG GPGRGG&G/G*G)FG$GGFF\FFrF(FFGGG GFjGG"G+KG$G&G$GG'GG9G0GGGGG GGG!CGyG5FFFFFdFF8F<FLF`FzFFݺFF|FF FFGwG ,G qFFFJF FfFF:GG;G>G4GGhFFFFdGG]FnG!G sG (G GGGSG G**G1%G=G7&GEG=G5G>KG;kG4G9G3cG%]G*GGtGG!GfGGG0G>>GKqG/G!>GhG}GG'G#G?GGtG BGGGG !GG GGFRG8G,GGG{FGGGxFF(F<FFdFHF>FFF\FNFVFF8F(G G zGG GGGGGnG%GGG@GGGGGeGGF FFF8GAF\FFFxFvFFFF@FFFFFF̦FfF(FFFFFFFF(FFnFzFFGGGPFpFG NGG GgGGG FGGG&zG#G$-G1G?~GFG5[G<4G]GVG[&G`GFGAcG5G+G0G4G7G8GDGL\G?G;G/G?1GEGDGNGGG-G$.GGuG!G.G/QG>G@G9G"G/G0GEGVGmGZGWGUGkqG^GS|GBG>GNGIG+G!G G7FF\FF FFնFFF(F"FF&FF\G GGGsGGvG GG*G;GXG>G;G.jG:G@kG5G8G/G/tG1G1G1G1G0dG"G G FDFzFFFFFjF@FܴFFFGnGGG8G G8G +GKGG>G#vG$G)G"FG G GCG&G,0G";G"GGG FFF(FFFFJFNGG GG"5GGGG hG/G]G G'G(:G?xG)GGGGGG"GZG G dGyG yG"G?FF<FFFlFFFFGGG[G+;GSGVG=G2:G5G2xG?<GU<GSGCG7jG(G,zG%JG6/G4G7G=G9GGGYGZGDG0G*>G+QG+G&|G&GBoGFGeGnpGWGGmG2G/G(G2GFEGOXG]GGGGGzGnGoYGjXGS~GCGSWGgGfG_GgGyGlJG^\GT%GMGGGBGQHGc~GGcGXG[GbGLGdG[GZ4GZGYGhG^GbGmGGcGFGHRG2G'cG"G'G0GIEGZOG>WG3G+!GG[GGGG FFGGG>G#-G&G3GKG:TG+G#PG.G8GOGZGGGG|GpyGX<GMG?G@GNGGJGGG8wG+JGGGEGGG/G?9GlGaGEG:0GFWGE^GFG3}G)GGGGNGGG!fG,xG?zGK G9G;GBGSGjyG\GPlGJGCGTfGISGAGGG+/G%>G"hG$bG{G*G?GIGJyGW'GW GWGT}GNGNG;oG;GLGXAGOGJ}GzIG`GKG/0G-G,6GGG7G @G G GG G FZFFGGG 1GG+gG)G.G)G3G1_G'G/G5G;EGFG>DG'G$:G0}G3G7G)GGGG G#G-GEvGCG=GFG.QG'=G,G1$G/G2G$G'G-G2=G%?G/G7QGNG_SG_ G]GkXGGGuGqGraGGGrlG\GKGOGL<GY.GjMGVG^GZ4GMGbGe2G}GlGQGVGW'GSGNGX8GoGgQGbGc GRG@~G&hG!GGG"G5 G@G9G4VG9AG8G;G'G&G8GDGFGAGN[GdGGGGY9GCGJ"G:G?G_GjGGGuGdGLBG9MG/sG#}G9GG uG*GG GGGuFjF*FيFFܞFHFGGG G'GFFF^F>F6G;G[G#GCG2G?G5GG+_G)G'(G'pG%G)pGG0G G-GB?GBGMGdRGMG:G.GF>GTGdGWGeGlcGAmG=GAmG)G4G" GG#G!G!G!G=GG \GGQGGF&F:FFLFZFXFF2FFrFFF<FFrFF0GG (GoGG G/|GjGGGG"G%GG GfGGGG@GGhGG GG GGGG}FGLGGGFjFG^F@GRFFFGF<F8F׺FքFFFF*F\GGGF^F`FRFFfFFFFFF"FFF\F:FFFFFVFF,FFĮFdFFԢF^FF4FFxFFFƞFlFGF*FFF՜F$FFFFɢFFxF FF:FF FFFFFFfF޲FFJF8FFFFF¤FFʢFȼF.FF6FLFzF,FFdFlFFFžFFFɜFFFFFvFF}xFqFblFY0FPFPFTFZxFYF]TFlF~tFFFFNFFޒFFFFFFrFBFFFFFF¨FF FhFFFF>FZF|F"F$F6F@FFF F(FFFFpF0FFFF0FF FFFXF|FF`F*F}dF0FFnFFFFFFFFdFF$FFF~LFuFtTFFrF FpFFDFJFxFFFF:FFzFtFFFFvFFFkFkFrFfFcFb`FSFctFh FZ,FvFwFfLF[FQF^dF_xFaPF`(FFF6FA$FNhF88FFTFF pF+F'8F?FM@FOFL0FVTFVF^FhdF\FYpFHF;F=xFNPFBtF3F*F,F"FF E0EEEEӀEHEhEpEEE֐EEPEEEEPE0EE(EEEE`EEEEEèEEE`E0EȈExE`EEEEEEExEEEEEEɠEXEEEEE(EEpEEEEEEHEӰE(EEEE8EEE@EEEpE0EݰE`EE(EEEHEhE(EEEEPEEE~`EmE_E``En`EjE_ E\@E\@EY0EGEK`E9E5E4E8 EFBF>XFOFFFBF>FRF^F`FdXFU@F]|F]FTFFF<(FBF3F8(FEFKFLpFOFNHFHF=FB FTF`8F_HFcFjTFnFzF|F}FkFyFtFcXF@F8F,F1F1F+F/F2F0F+F5@F5F8 F7F> FDdFMFXFZFoFwF~F|FTFupFfFS4FZFZF`FjtFc`FwF`FFF,FFFmdFiFl4FjFrFzFwFFpF\FF<FFzF.FFF}F&F&FFF0FPFFFTF~FF,FTFFFBFBFFF"FF,F|FFFFF&FrFiLFkFy\F~FyFvFs(F2FF*FFF}F F~FLFFFFF{|F0FFFFFFFjFFF|FF:FnFrFFFFFFFbFvFFFRFzFFRFFF FF,FBFFFFFFFDFF"F>F.FVFFFFhFFFFFTF&F(FFF F@F^FFFFFFzFFFFFFFjFFFF FFFFF|FFFDFFFFjFtFvFnFeFcFiF{FF~F~XF~F|\F.F|LF*FyFlFFnF*FF(FFFFFFFFFF6FFFF FFFFFLFF&F*FFFfFFFFFFFPFFÆFFlFF̈́FLjFF FFFFF(FFFF FFFBFFFNF2FFFΪFXFFFƢFFFtFFFFFjFF˜FдFBFpF F~FFFFNFF F FLFBFFhF$FF&F^FFFFJFFFFFXFFFF|FFvFF FFFFFG G GFzFFFFfGG GFFFFFF@G8FFDFFFFjFDFԢFnFtFpF4GG GGG GGGXGPGFF`FF^F"FFdFF@FxFΦFFNFF FBF F:FF2FFFFF.FF̤FРFFF2FFGG GGGGGGG!G/MG4G)nG*NG GGFFFF FFGGG bGGGGjG"G"GtG% GGTGGGGGG G ?G GGG0GFlFFFNFFpFFtFFGGGGQFZFFnGgGKFF4F:G<GFpFXF6FfFTFjFFFzFFFGeFFFFFFFFGG G GDG ^GqG G GeGsG&G1ZG2G.G4G>GOGH\GA$GAG*\G!RG"G G!=GGGGG%G2G:AG2G$G$GG$G(G!GGGGjG GGGrGG ~GGQFFDGG G GFFF|FFFF"F<FF:F FNFȒFnFFFFʔFG 3G6GGcG"G$iGG)?GGMG(G&GGGG6G GGG=GVFFFFFrFFFjFFךFFFFFFhFFxFҘF(FԠFFȢFFFFFFFʞFvF<GG@G FFGlGwG'GG GGGGGGG/G0vG8GHhG;G3G<{GR GZG^9G_+GJ4G9*G1G"G'G-zG7G;G: GCGAG=G)<G0G6GDGEGAG.<GG}GzGG"G5fGG=GRVGKEGEoGI(G=LG(G+G+ G0G>G6wG?YG60G<GCGSG_1G}`GhGSGYGQGOG7G6*GCG9wG0"G!GmGxGFFFFF֨F"FjFGFtFFG`FBGaG G GGTGAGG#G+nG6~G9G/G'G)~G,G+IG/GGG G-JG,G*G/YG"hG uFZFFF<FFpF"FFFFtFFXGG1G GGGGGGGGGGpGGnG zGG(NG#GGG7FtFFFFF>FlF<FFrF2G8GGGG GG G#GG G$G8GLG6hGfGGGG>GDG jGGMG3G G G FF(F(FFPFFtFdFFGGG5cG?GEG<G3;GJxGDyGEGSXGRGA4G90G#G'G* G,G7jGCG>G@GAG[G`G^@GBG,G;G3%G1G.YGJGa[G_GnGUGCG:G/G"G+%GTGoGGGGGGoGR!GcGcGZ8GO3GGGWGa GW9GZGaGS+GKGJTGLG^gGJnGL G[GeQGpoGaG`1G\G[=GXGgNG[GVGcPGfrGMsGdGgGGhGNG>G:G)G+G(G/8GQGG^GGG:XG(GG^GG 0FpF,F"FFGEG "G~GG+GAG<G.G.G!G(GA4GP=G\Gb[GsGGm\GYGMGHGAG;8G;G9bG=G7G.GGHGxG GG)G5GQG:0G8tG:%GQGI GRGMG+G"GGG GhGGG,G? GDTG(MG-G:GDGkGkGRG6TGD-GE%GEGBwGBG)GG*G(G'/GuG#^G?G?GIGTGLGJGGGFGSGH0GA&G@G<6GCG` GGtG_hG8G1&G*GG G G 1G!GGG0G }FF FGGGG&G'GMG(G"GG%G#?G#fG'uG1}G<,GG3+G*dG-<GDGCaGpGr~G^%GLGJG,GGG G GFFFFHFZF6FFF.FXF6F`FGGGVGGGGXFF4G:G GG&G9&G1GB<G-G( G,gG-G"GGGG GrG)GMG2EG8GEfGEG2G.JG3uG>GIG6GIGYJGJG?GDG+G}G2G'GGGGGGG FpFtFGFFFFFF&GGG$G3FvFpFFFvFFFF<G GG GGG GG-GGGDF.GG GGGqG GGGGG.!G!GdGrFG LGFF8FFvFFFFF:F^FpFxFRFFFFæFFFNFFGBGFȀFFFtFFFFF,FFF|F4FzF|FF\FFFTFFӔFFFڞFFFFFF4F6FFfFŨFGGFFFFѶF^FFVFbFTF.F^F<F&F&FFFFF FFFFF^FFFFFFFF6FFRFFFTFFԈFdFFZFF$FF.FF|FFFFFFFF}TFk F^0FS(FF(FFFDFGFM4FRPFbFzFFFtFFbFFFFļFFFFF>FxFF(FF8F`F@FFFbFFFFF4FFFFF>FF FF FDFFFFFFFHFFFFFFFvF~FyFFF$FFFjF|FzxFxFyFhF$FFF&F{FvF}FFpFyFyF0FFFHFxFFF*FFdFF`F~FFFsdFF}FkFiFZdFg,FjPFWFqpFoFlPFmxFaFgFe,FXdFMFPFXFNF@,F)F+F8FF`FFPFF(F(8F2dF>FF\FG,FMFHFWF` FSFJF:F60F5FBF:F@F6F1F+hF$F@FF EE@E@EEEE߰EݠEEE`E֘EEXE8EˆE EPEExE`EEpEE0EEEEE0EXEE(EExEEpEEEEEEEEEE`EHEE0EEEhEEEhEEEڸEѨE0EE8EEPExEEEŘExEXEhEE8EEEԀEɈEEXEEpEEEEEEEEE(EbEfEsEuEcE\E]EW EZ EJ EBE7pE9E90ECPEPEEEI EKEV EGEOpEWESETENPEYEFEOErE0EEEEpEE8E{EhEqpElEX0EVEaEwEEEEpEEz0E_ EO@E: DDDD DDDDD`D DD`DD@DDDDD DDDD@DDDDD DDD`D@DDD@DDD@DDD DD D`D DӀDɠDDDDDԀD@DDE E PE@EEEE E%`E.0EEpE#E EEEE`EEDD@EPDD@D@D E E E EEE EEE`EEPEEEE*E9EBE/E+pEpE@EPE E00E9E&E&EE(E'PE/E5 E?0EV@EZ`EXEpEtEkEwE~ EyEpE@ElpE\pEhEN E^EaE|EvPEy@EeE[pETpEL@EKELEOEP`EH EcEbEnEaEZpEe@EgEhErEiEoEz EhEPEpEE8EE(EEEE0EEEEEE0EEEEExEHEhEE`EEEEE(EExE(EE`EEӐEPE@EʠE8EEExE`ExEE EEθEEۨE0EސEEΐEEوEE߈EEFTFF0ExEڠEEEEEEE߸EհEEHEEȸEEhEFFlF F EEpF FF LEXEFFFFE F F PF$FFFFF|FFF FFFF@FhF (F 8FFEE(EEEEFF FF ,FhFF FF,F;F=FHFRTF[FV@F_0FVFKF7 F3F6\F<F?F6F8XF8FMFaFdFZF]F\F[FKFFhF?F8F>F> FJFBhF:F9xF2F-F2F?0FR4F]F](FlLFgFnFwF~FbF]xFWtFQFAF-F!8F F#lF*F.F3tF2F)TF+XF5F8HF3F8F:4FElFI4FQ$FdFaXFdFrFF|FuFR|FK FZFgF`LF[FdFkTFvXFr4FwFw<FF}`Fv`F|FFXF.FDF~,F~0FFF|FF F.F0F}FFFFF@FFJFFFFFF0FFF2F.FFFtFF FVFFFZFFxFFwpFeFa FgpFjxFg<FohFrF}FzdFF|dF|Fv0FmFtFvFoFuFF"FF|PFFzF~TFzFF\FFFFFFdF>FnFFFRFFFFF*FFfFF<F$FZFFF`FFFF6F,FF(FFF@FFFF2FFfFhFFFFFFFFTFRFF FFFFFFFF}FxF<FF4FF|FFFFFFFFF&F FF8FFhFFxFzLF{Fx8F}FrxFkFk8FopF{F F:FvFxxFuFt@FnFp<FkFuXFuhFyFFZFRFFFFF`FFFFFFFzF޶FbFjFFFF"FӬFjFFF^FFF^FFFtFVFxFzFBF~FFnFFFFNFHFFFFF4FxFF8FF"F.FFF΂F:FxFVFFFFFFFFFFFF FȢFFFF.FFF`F FFFFFݘFFrFFFFNFFFDF FFFtF8FFlFFFNFtF(F.FZFTFFӞFѾFTFתFFFGCG G@GFFhFGZG$GGFFFFޠFzFFFFFFFFJF:F FdFڐFGMG LGyGbG GG*tGGGFNFFFDFFRF0FF4FFF*FF̢FF6FnF FFFFFRFFFXF6FߨFdFFFG GGG6GGGG!G*G)&G.%G."G7G3yGGG^G-FjFFrFGGGGUG%G <GtGGG GGG G G GG?GFFF~GGbGG XFFzFیFnFFnFFFFG ?G -GGFdFFFRFF\FnGFFFzF"FbFTF2F6FDFFFFF6F6FFFFFhFFFGYFFbGGG/G 0GGG& G,G7 G==GWGL'GFoG7rG-:GGG %GLGGGG!G!tG,fG+G=,G2G,G^GWG$|G!GGkGG6GG 3GG G/FzFFFF(FG7GGUF4FFFFFFFFFFFxFF4FF¬F*FFlFJG GG.>G-G'G"GSG$%G$G$G)G!iGG GGGGGGG GFFFFFTFtFFFVFlFZFZFFF~FF FF.F0F&F@FFF,FF6FFnFF|FTFnGGF*FFFGTGG`G GqFF$GGiG)G/G5G8GG6G<^G9G9&G4G-G6vGGG QG GGFGGFFJFFFF6FFFtF8FG?GG2G:JGFGR,GHGa3G^GRGUGJZG;}G7qG G)G!G,G5G;G@G5GPGcBGdGVG9QG)G8G.G7kG<GOG_Gk G{GyGdGVGEG.G=G^GGGGGGG{CGTGQGVGK5GMG6G;GHoGAGI*GNG?G0GFG[GaCGRGN6GYGg'Gm`GmG__GWGQXGMGZGOGD0GO"GXvGL:GYGGG^ GDGCGDG=G<9G6G9GUGXGPGJfG6GGG GFxFBFFFFvGGG'G/GOG?G/>G+`GG*G?GGYGVGYGeG}GaGOGHGBG6G1G'G'dG#G$GrGGGG GG G8.GCG6G7vG?GD_G<G5fG8G&0GxGG G GGG^G!G'PG!G2oGGGRLGU+GVGMAG4G7G=xGHG<\G7G)bG#G"XG"GEGKG'G6EGCGNGCG;G@GF#GL_G;G9G@GKGWGdGr4GcvGkGIG5FG"hGGGGG 0GGG G FpFlFXG7GG|GGeGGGGvG G#G"[G'G0tG9G!6G!6G_GCGG*6G-GGGGGGG,G03G$~G#QG8G G G XGqGG)G+G3G7=GAG7=G5sG6G8G9G:GS:GX\GbGY7GSG_GYGZGrGkAGbIGNGNGPG_G\hG[GTGK{GXGYGSG8HG(G?GVG\GOBG\G}GXGLGVaG?GEG9G0iG#mGG:G$G)G)YG,oG GtG"G!eG*G1>G-*GEGKGJG`YGjGgGd8GDG-[G$G EG G,`G/RGK@GGG0G/0G,GTG YGGFFF<FF4F:FӀFFʦFFDFŘFӖF\FnFnGGGGG[FFFG}GIG {GG%G-G7)GGUGGG}GTGbGGGIGG'G ,G'4G/GDG+G+<G3G4G0GG+G6GBG>G/ GGtG GG GG GGG dG FFRFFFFFGGGaGGGGFNF FF8F<FĜFFGGiF.FF,FRFFFLFG FFGWGGG@FFGG GG#fGGGGHGGG8FFFF.FFF@FFƖFF˨F F͈F>FFnFVFFFF<F^GFfFJFFJFFBF@FBF@FF>FF6F>FFRFF0FRFFFzF FFF FFFFFF FPFF2FpFFRFFlFFFFFѤFˤF6FFFdFFFFFFFFFFF\FFFFFhF~FFbFFF*FF˘FjFFFFFVFFFdFRFFF>FFFFF@FFFnLFZ0FO FJF=F6F>F;F;FV@F_Fh`F}lFFJFԔF:FFtFFFFFF"FTFFFFFFFFѶFzFFhFF<FFFFFF.FtF~FF<FF(FFF:FF\FFF*FFFFFFF~Fx FzFsFFuFfFfFjFeFcFFF,FfFxF>FFwFdFzFkFpFvFqF~8FF FFFzFFFzFFFFTFFFoF[FYF[FWF^FcFc(FyFyFZ(F]FVFTFYFN4FGFHF>FLFHFBFE0F9F-F'dFF FtEpEEؐE0EEEۨEE E E@EވEEXEEEŨEpEEEEEXEEEhEpEEEEEE8ExEEpE8EExEE8EEEPEEpEE0EаE`EƨEEEHEF HF,E(EE֠E(EE@EEPEEE׸EPE˜EEEPEHEܐEEEEʠEHEEEEPEEEE@EHE8EE{EPEpEiE^pEfEbEc0EWE;ECEA0E>EAE8EKpEOEFENESE[EREb@EoEe`EVESE[PEsEu`EEEEE8EE@EHEEhEEEmEy`EpEhEHEEE(E{EfEREAD|D|DiDDDDD@D@D@DD DD@DD`DDDD@DDDDDD@DDD D`DDD@DD DD`DDDDDD`DD`D@DD DɠDƠD D٠DD`D߀DߠDE E0DEpE E @EE*E"pE E EE pEPE`D@E`EDD@DD DDE EE EE E EE PE EEpEEE`E E,E;E)EE0EE 0EE&E,`E,EEEPE,E%0E9E>`EFPEfErEtEhEEuEr EEeEEpE`ESE@EIEEPE\EmEwE]PETpEYE\PEAEEENEY0EY E[E^EdEcEWEVE[`EkpEf EupE\ EjEEE0EEEEEEXEEE0EEE EEEpEpEEHExEEEEEEEE0EEEEEEXEӰEӐEΘEEE E0E`EEEEEEEE8EE0EE0EE EEEE(EPEFFE(E EEEE@E EEEhE`EǠE0E̐EǠE EEF<F lFXFEEFF EEEE@FFF4FFFdF @FFF<FFF(FlFFF0F FF F F 8F EEEEE(EEF hFFFF F FFF F+0F9FIFTFSFJFTHFT@FJF7lF5DF;F8LF84F2F:FBF[dFhFeF^F_F[LFWFDF>F8F3F;FH(F?4F2F(F"F DF,XF/F8FTHFjFp$FjFdFdFr(FkFJ(F?FFFFFzFFFhFF,FFFHF<FFFFZFFFFVFxFmTFqFyFtFsFqPFl\FrF}0FFwFwpFyFiFfFjFiLFeFoFx,F&F*F(FFFFFbFBFBF<F(FF¨FFzF8FdFhFlFǒF`FʜF4FFFzFôFFXF|FFFìFFنFDFFF@FĚF F@FF$F:FFFNFFF"F`F4FFF|F2FFFFF FFFFzFFFFFdFFFF\FFF|FզFFDFЀFFVFF FFڼFFצFF FFXFZFFnF$FpFPFFFFFpFpFFFFFFFFFF8FFGGFxF0F0F~FXFFFnFFFFޘFFϲFFFFfFFFFVFFFFFDGQG MGWG}GG!bGGG0GLG GFFFFNGGGFF\FθFtFFҞFFxFFhFFFGFF&F,FzFJFF:FGGvG G GoGGG$@G%G6G :G=G&G1G,G% GGFFPFFFG GGGzGhGGG5GlG#G+G,FGZG G GGGFjFFFGGGXFFFרF&FFRFFFFZG G,G GGFRF<FF FF FNFFFpFݔFՌFFF܀FFF FZFFFF<FFFrF*FFRFG>F.F8FGF|FG-GGG%jG1G?G>GC#G9G0G+nG6GGGsGGGGpGGG,rG,kG2lG/G&GG!G'G&G]GGGG G.G`GfF"FZGGFFGGG F~F~FZFDFFނF8FbFLFFlFFVFBFFFF.FGSGjG+G,PGGG"GjGSG+G%G! GtGmGqGGKGG1GG FF~FFFrFFFVFFF6FNFF`FFvFF&FFۊFFFFLF\FFFFFFF̺FFިFF<FFFFFHFFGFLFnGGG#6G-G,G1EG1G5G1IGKIG_GtYGr-GbKG.rG'G#G"G#|G-G9G7nG8G9tG5G:G6G<G;G*G&G? G!GGGOG3G2GBGLZGTZGZGbGXG8G:(G@G7GN0GSGOGO]G[4GaGTGZGgeG__G\ GmeGiG\GU*G7GBGYWG:eG_GG fGG,FFjFьFF,FF,FF$G?GG GGG GGF*GGG"GzGGSG LGGoG!GGGNGGuGG%GG\GXGFF"FFFvFFFFېFFPFFGGGG0G?JG+~G6WG.G>{GEsG,cG.GGGF8GGJG vG GFF~FVFZFFF2F>FTFFFG FFFNG GFF,GWGGFG.%G-G:NG)GG GGGkGfGyG4G!GFGFFFFFFFF FFFGGGG/VG?G[kGVGcPGoGGKGPGAG3G0GiGRG!G&sG,5G7SGLGEMG[GpGh'GQaG3G#G,G9;G<GEhG}5GxGdGw0GqGiGh+GTG9G7IGPHGpGGGGGGGT~GGGRGAGDhG0G8hGCNG6G.G;G5G6VG8GOIG`6GTXGHGQGsUGz$GGzGQXGOzGQG[0G]GNG@DGCzGGGNGUGmGgQGP GW`GLdG4GAGGXGEGQGUGK*GJMG,G;GFGGF$FNFF\FGG3GCG!G4G5=G.[G%$G&G!G.G6PGDiGAGIGRGZ(GTGCG2PG/G4 G'G G"WGGsG1GxFG GGG GG)G%GqG+"G1G0G&rG)G JGYGGG )G GG 3GG UGGeG+[G-MG3G>G7G10G+G1*G3'G,G&IGGGGGGPGGG"G,G7G0pG*G3G2SG?GBMGEGAGQIGRGNGqGY+GMG-kG-*G!G G ,GGGGGAGrG|GRG GG GG#bG) G.tGGGaGG&GG GG#G+G0GVGGG GG&UGqGGQG GGGGG G GGG~FBGG2G)@G(G.G2OG5G4G6G9cG2G/G(VG-;GE^GIGWVGReGMGRGMEGYGcGR(GKGFGB|GJ`GPG^)GaGYGTNGIGNgGA)G$GG(G4G>GWGCGS-GH*GFGSGKGEwG;G&GGGfG!G!WG(G"GGGGGG!G(WG/}G.G?GQ]GV G\GXGE]G,zG0G GGGG3G-GGGZGFFFFFF(FF FFFpFFFFFF֔FpFdGF|FGG0F,FGWGG G GGG3LGGGGLG GGG SGG GGG GPGGG!GGG(G&G%CG\GGhG G,mGGGEFGG2GGG 2G qG GgFFFF<FFFFDFGGGVG%GG LGF`FךFFFZF`F2FF@F6F@F|FFFdFF^FFTFrFFGGGG G G^GqG GG+G$yGFNFFFDFDFFF$FzF`F$FܴFF*FF<FF$FjFFFFFFFnFfFfFHFFfFF$FLFFFFF8FFFLFtFFLFFFFȮF^FF٢FVFFVFpFͪF@FFF,FFFFzFFӶF"FްFvFݔFFFF@FrFFFF,FFFF FFFF:FǐFFFF6FF2FDFF F2FFƘFF$FFFFFF FF.FFFxFF6FF6F2F FPF<FiFSlFBF?F>(F<F5LF1F1F<FEFWFgPFFFFFFԊFFFtFFRFuFFFF|FFFFFTFhF"FFFFFF~FFFFFFF:FF0FxFFF4FzFF~FzFFLFFFtFFFF{FoFrFx(Fu FjF[tF[FSFbFmLFrFxFwFxF~FqFlFf0FZF\`FXFbF~pFF,F,FFFFFFFFFFFqxFrFhFY4FT|FUFMFRFQFIpF`FjDF`F`dF\FaFZFPFIFH4FDDF2F2xF) F"dFFFlFFF$FFF"F&$F*,F.F7PFLFYFJFMFIFDF@FKLFAF@F=$FGF1PF#F@FFFEEEHEE0EE EEpEEpEEEXE`EHEEE EEEEE@EEEExEEEEEEEEE0EEhEEE@ExEEĠEpEԐEEEE@EPE`F(FFFLFE@E8EݨEܠEEXEEXEEҐEXEEΰEE`E@EF$F|FEEEEEEEE0EEEEpE0EEEyPEsE\E[@EUEY@E_@EO`EYEGEHEJpEJ0EEEME:`ECER0EXEdEhpEs0EpE]0EcEkE{EEE EE@EEExEEpEhE(E}@EEEPE}E0EEE(EupEaEPERDo@Do@D@DnDyDD`DD`DDDDDD@DD`D@DD DDDD@DD@DDDDDD D@DDD`DDDDD DDԀD`DРD@DD`D DDDD DDDDEE EEEEEE"E&EE(EpE `DED DDDD DDDD DEEE(EPE E E `EEE PE`EEE 0EE%E;EE`EEEE pE$0E(E*@E%@EE!@E$PE3PEB`EL0EQEcEhEw@EEq`EfEdPErpEbEqErEI@E:EKE; EOEW@EW`EXEbES`EUEXENpEF0E]`EeEdpE^EfE^@Eb@EN0EK`EYEOERElEaEt@EmEEEEEEEXEE(EEpE EEEEEEEEE EpEEEEHE(EE`EEEEEhEڠEʐExEİEEEEE0EE E`EEE`EEPE8ExEE0E(EϨEE EEEE(F|F0EhExEϰEƨE̠EEhEEEhE0EEEE`E٘EPEF F18FFXEE8E(EEE`EEEpF|FDFFHF 0FFFLFFtF LFFFPFFFFpFFPF F EEEE0E8EF\F FF tF F F FFxF"DF0F?TFDFIDFBFEFLFJF=0F0F9(F=PF5F5F<FFpFK0FVLF_FeFTFWFJF>F9F.F1tF/F:FHF3F(F"tF!F%@F+hF3FO,F\FkTFmDFeFVLF_0F\FMF3F%lF#F!FFFFXFF#0F&F+0F*F'8F'TF,tF"xF%@F*`F1TF?FD`FFFLFY$FSFmFx0F~FUF`FUFVFYFUlFTF`,F^FaFcF]lFi8Fz<FFFFF8FFvFF8F{FrFvFZF,FBFNFFFFF,FFFFVFFFFF,FF@FFF0FFxLFvFxFuF{8FyFtlFdpF\TF]F_\FP FOlFDFQFb0FeFjXFhhFh<FYtF\FTFZFaFgF|F\FHFFbF^F}$FFFuF{FFF^FFFFF(FdFFZFF$FBFlFFF~XFFFFFF6FF FFFFFFFrF$FF*FFFF,FFFFF FFFvFFFjFFFxFFFF^FF(FNF`FFRFFlFFTFFFF`F"FDFFFFFJFFFFFrFxFsFpFxFvTFrHFoFqFtF~FzF6Fz(FqPFoFyFwFjFyF~F"FFFFFFF<FFFJFFFpFZFÊFFxF@F@FF:FRFFFFbFFFFƚFvFFF,F:FF֞FFFPFFFBFFFFFFrFFJFPFFЬFFRF FFlFFF*F4FFFFFFLF:FrFFFFFDFFFFȤFªF`FFFF FBFF>F|FˎFF2FÊFFFFXF4FpFbFFFFFFFFZFFFȔFFdFF FFݘFdFFFFFFFF2FF>FF6FFäFFZFFFFFF:FFFvF.FG4GQGGGZGGGGG1GtG GxGFFGhG"G FFF܄F,FFtF\F2FF8FFFGLFFFFHFrFFFG G G G G=G)^G(G(G)G#GG@GuG!G*(G)GtGoFFPF(FFFGG!GG GGG}GBG<G'G G$GG G GG&FFFF0G$G GF\FقFpFFFF0FHFGG cGGGGwF*FٮFxFڐFF٬FFF@FFFFFFF|FFFFTFPF<F$FF.FTFFFFFFZFFhFNFFFFGGG'RG;G>G:tGFGDG0G(,GmG|G$GwGXG1G&}G#?GGG+hG7G2G)'G!GdGiG%fG$GG$SG=GGG G HGLGGGG GFPFTF6GqFF.FFLFFXFFFF:FF<FռFFFpFոFxFGsGG([G(G&G`G5GGGG!G GG G GGoGGTG GFF:FFFFFFFF&FFFF˜FFFFF FŢFFdFF<F6FF(FFFFFxFFFF֢F2F4F FtFxF~FFF<F`FGG GG G&eG$G.jG!G$kG:G\"GkGbGdeGJG.G%rGGVG G)SG&G1G9G.G3PG-G/G+sG,G(/GEuG@!GGG.LG"cGG,G65GQ GBG?eGKG@)G8cGEGEGJGMGWGRGU"GNG\G[GPtG\G_ G\GbG`GPG[GKGSGeGEG'G0G 7G FBF*FF֌FPFмF*FF@G4GGG GEGG G'G GG aGGGGoG(GEG>GGG GGGGrGGGGG _GF<FF(FF6FԠFFFF,FFG G2iG7G(pG<GN=GWGDmGJ)GDSG@G/G28G"G2GFF2FbFGGFFFFF:FFFPF@FFFFFTFpFGuGWFtFGnG WG#GgXGpGG)GFIG G0GFFFG oGG GGGFLF,FFFG$GXGG4G1GGGGzGHG7G<GGxG9GMG^GJcGOGBG2G-aG'9GG&G*G/GGIGF#GIBGfGXGaGsMGG~bG}Gh>GO=GOGJ%GJGIG?G;G8G7UG@LGORGXG@GSGOG=SGBGDcG=GPG`dGUGLGGGnGIF~FHFFF8FDGbG`GGG%,G3G.G"G%G"G0(G3oG?GAG1^G7GJ GFdG+YG#dGG"bGG>GGGGGYFBFzFtFxG@G GYGGG(SG>G+1G#GGEGG>G SGGeGG+G GGG"XG$G(G.G2pG#G'G%G%GLGGGG(G fGfG9GG GGBGGGG%G*G4{GCG]GgGG[$GYGtmGPG<G"MGGG 7FFFGG?GGGGG G8G GGG)G$G kGGG&GGG)GG"G.G'GgGGGGG|GF$GGFF$GGGfFtFTFFGgGkGG4GCGG1G0G"G%G(G(8G"*G GIG7GGG:GRGHOGSGGLlGX7Gp{GXjGBGGG<GBGLGB<GM~GJGGG@G3G7SGG]GaGOGG5G5G:iG4TG90G9G6~G2G+GGCGGGuG$G&GG GXG G GG G dG^GG0GLGJGEGAG*GGGG G GG.GGF^FFFF>FHFF>FԘF`FFFþF0FvFBFFFFF^FFF8FF,F6FrFF(FGGG GGGG G 7FNGFGG @GGzGF GGGGGGGGG!"GGoGG GG$DGG G+FGGG G%GGG<G&FhF2FlFFFxFDFG GG"G6GGaGG6FZFFFFrG gGFFFvF FFLFĞFܢFF>FXFFFGG GG]GpG*GG*_GGTG4FXFFFFFFδFF$FɦFfFHFF~F>FFFFFTFFFFF2FFFFFFjFFLFFFVFFFFFF<FFvFFF^FFzFF@FHFxFrFdF|FF8FFJFFF\FbFTFFFhFhFŬFBFfFFFFFLFRF:FF0FFTFFF(FĜFFFFFFVF|FdF$FFFFFFF|F FFFFFFTFFFdFFFF@F\FFFFfFYFF|F?F<F:F5F/,F-F3F:4F@FQFwDFFF6FFTFdFTFFpFFrFtFF2FTFLFFFF*FFJFFFvFF<FFFFFFFFFFFFFFFdFlFFFF FFFF"FFFFvFt F~0FFtFY,FV(FHFZFhFg<Fy`FrF~(Ff0F]FfFYDFNxFTFQFJFm<FxPF,FFFFFFqFFnFFuFnFqxFl,F_F^(FOF;FAF5F9@FLFTF]FnFpFh@FeF[FRFRFRPF8tF<\F6$F$F*F$F+PF"FTFF FHF F'F#F1F3 FI<FPTFHF@<FBFC,FF$F=F:F>F,LF4F&FFF TFEEEEPE0EEE EE߰ExEE(EEEEEEE EEEEEE@EEEEØE E0EEEEEE@EEŐExE0EḚEňEEEEEXFFF F pFFFFFF PF|EEF \EhEE8EEE(EhEPEhEFFF ,FFEE@E0EE E@EEEEEEEEE EEw@ElEfEbEbE^@Ed EoE_@EY E[@EWEVEQEOEJ`EXEqEdEjEq0EwEw@Eq`EuEEEpEEEEEEEExEE}EvEm0Ev0Et0EXEXE EEEv EmEzE\D}D}D D D@DfDDDD DDD`D@D@DDD DDDD`DDDD@D D`DD@D@DDDD`D`D D DDD D`DD@DD DDDDDD`DDӀD`D@D@D@EpEEE0E@EEE0EEE E E EE`DD D D`EE`D`DDD`EE#PE"EEEPEEDE@E `EEE pEE'0E3EED@DEE0E EE#@E!PE0E E E*EGE]@ERE` E^E0Ey0E[ELEP0EbELEUEJEBE<EFETES`EbEYENEVPEGEK EDpEP`EOEd`EpEm EcEdEaE[ERpEFEHpEPEWEUEjEmEwEEE0E0EE EEEEE8EEEXEXEEHEEEEEPEEE8EXE0EوEE0EEېEEEEhEEHEEEEEEEEE EEEEɐEEјEɈEhE`EXEEEhEܐEEpFpEhExEE@EEEEEE(EEEEXEEEHEFFF&F<F8E`EEEEEEE@FEEFLFEE0EF DF PF FE8F4EEEFF`FEEEEӨE@EȠExEEF F tF F FdFFFFDF#F2PF4F;F6F70F2F?F9F2F/hF5F8F;F1FHFEFQ0FRFT<FHFGFLFDhF1$F,F(XF*F-LF4FN F5F'|FFF(F3FCFUTF`FdFcFVPFKFLFBpF)DFLFFFF F lF FFDFF"\F6F.F'xF#(FFHF&F%F1F0F2F:0F<FC<FH\FXFbhFsFmFR,FKFQFV@FLpFHFOF[F\|FZF[4FaFvFFFFFF8FuXFy|FuFoFjFkFpFF8FrFFFFFFFTF FF@F FFFFF FF\FFrFfFeFjFkpFnFiFWFL FO8FZFY FM$FHFPlF\FfFh$FkPFhF^FZ4FZ F\8FhFeFF6F2F4FF,F0FvFxFuLFl\FmF|FFZF|FFFDFBFF>FFrF F&FFF~FF} FF8FxF.FFF2FFFFFtF|FFFFFF@FFDFFFœFFF\FhFFFFFFFFFFF,FFFFFF|F~FFF@FFF@FFF FF.FFRFFFBFFF(FFrFqFsxFulFv<FwFtFjLFiFqF{DFFFFwF{0FuFxF}F{HFFFFJFFFdFFFBFdFFhF.FFDFXF\FFFFFFĤF6FFFFFFVFFӢFFFFܪFFҘFRFFpFF(FFFFFhFFFFF^FPF8FŘF FtFFlFFFFfFF4FFFFF`FFFFNF<FFF,FFŲFF0FF>FFFF٨F;FXFƼFHF̰F:FFFFFFFF\FFnFFFFF@FF(FF4F>FFFFvFFܶFFFFF$FNFFFFFڸFδFF:FFӜFFFFFRFLFFFzFFGG vG GG:GGGGGGGGFFxGG wG GGPFHFFF FpFҖFٴFFDFF\FrFFF^FZFFNF$FG-G sGG sG GG'G!xG(G$5G hGBGG-G3G UGGxG&FJF\F>FFFFFG>GGG"G"G3G70G:vG/G%GXGGG G "FFF"FFGGZFFfF@FHFFزFFzFZGGGG*G3G{FFF8FTFJFlFF@F\FFFpF٬F^FFG?GFFF$FFDFF״FFF߲FۈFFFF8GFFFZFG GG%G=GTHGBG@GNG4pG"GGGG'GGG#PGUG,G).G1G8lG(G(5G#GG G)G+G!)GG5GG GGrG G GGGGFF6F|FGFFFF|FFFlFF|FXFFݘFFF͜FtFגFGG UGG%G%G- GnGvG9GG*GG6GG G HGGaGGGSGFDFFFՆFHFFFFF*F:FTFRFF FFFFFͲFFFFFFVFF:FFFZFF&F֖F<FXFFVF˔FFFІFRF$FFDFG G;GGG"jGGGG.GAGL2G_GbGZG?G$GxGG#;G*G#G(sG/EG,vG(zG*G)G&G$zG!G0<GHG6oG*EG&G G* G6GB/G;%G5G:GIG+G*G7{GMGWGlGgGd0GcGQGOoGRGUGgGeGz.GsG^GDGKGG-GQGMG2G!GGFFFFFӈFFVFϜFFNFGpGGXGGG LGGG0GGGG G G oG G#GG"]G9GGGGGG!G GG1FFFxFFF֚FFFFFvFBGG7G=EG9cG5GOnGb.GlG`GWuGW;GUGKG;)G$GG "GUFF8FGGdG vFFFFFFnFЂF.FF\FFFFfGGFHFG=G GG0G\G,{G$?G%sGFFDFzFGGGG GFFFF4F FGG GZGGGF|FGG%G,9G%cG8GBGKGICGQ+GENG9G:G+G&G)/G1G/EG;GRFG[RGIG]GYGUFGN|G9GBGL`GFG>GAGVGkrGyGl!GaBGJGCG9G8GPcGm$GqmGiGkGyGGqkGZwGSMGJOGM*G9DG2yG'G%>G%.GGG'7G=GHGHGL?GhdG|=G|Gz#GGGGOG^IGKG>G@tG>G,G'rG'G2"G5G;G<3G0G.,GCGAdGAGBqG2tGAGdGa6G[GHcG'GGFFFFFFFFPG G(GG* G)G(G)G)uG%OG/GLGFG/:G4G?.G9G!7GGGGGHGG"G G oFFFژFF FFGGBG mG]G+G*pGG,G mG GGFFFG^GYGG 7GG <G 3GG#G$HGG?GKG GG ]GXGG FGgGGGnGG GG }GGGG-;GE<GJGGGAG@G[G[ G@kG/G$8GlG-GFFRFF0FGFFGNG G fG GG?G. G,yGGGGtGGGG >GG$G1G G3GG GG"FFjFFFF GG gG FFxF0FGgGG5GG<G#G9G#TG'1GdG GG BGG(G4G;>G9`GDGGUGGG\G\)GRGFG?G2G9G=RGAGBG<"G;#G3G,G,XGOGGG G 3G 1G.G%HG$GG(G%G'G'yG!mG$}GGG GGG!hGbGGjFpFFVFFG GGG% G,_G#G)GGoG5G G+GF<G |GeFFRFΈFF<FFFF2FFnFFLFF\FFFTFFF FXFFFF$FFFFتF$FFFFGGG,G%GvGFnFFF:GG6GYGbGG #G'G}GGG GGGGGGG G6G>G +GGAGGG6G4FFGGGGFvFZF|FFDFFGdGGMG"qGGGGGFFFGFNGG iGFF߰FFFFlFTFކFFDF$FFnFGGG RGGGG#^G 0GG/F0FHFPFF.FF6FFFFFƆF.FFFFFF8FFFHF2FFFFFtFFFXFRFTFF6FFJFtFFFFFjFFF^FbF FF FFǤFFFvFFFvFfFvF͈FFFFFpFZFFFbFF¦FFFFlFFXFFFNF}FFFFFFFF FFRF.FpF|FFF$FFFF(FHFLFFFv\FqPFt8FyF{0FoF{LFxFF8F0FFF,FFFPFn8F_dFHFAF>F9F9F/0F2F+F.F6FFF[4Fd<F~,F|FyFFnFFF{FqFhFo8F}FFFF\FFF*FDFF4FFFFNFrFpFXFFTFr8FnPFuFFDFFFLFFFFFFFFFFF~@FxFFF F.FFFnF^FPFQFaFZFeFjFYFZpFVFRFP4FBFAFApFW(FtFvlFFFFuPFfFF{F8FFqHFbFgFeFeFfFadF[@FAHF6F6F<FHXFKF],F^Fa|FvxFfF[FX\FKFIFOLFKpFA F8FB4F6F>F>LF,\F FFFFtF1F3F/F<FDF>F=\F>DF3F2F,F0XF!F`FFFF FDE`EEEXEEEEE8EEܠEEHE E EE0ExEEEEEEEEŸE0ExE`EРEE EEEEEXEEE EPEEʰEШE E`EՈEXEFFFF F FdFF FF(FFF <FFF TFFEEpEXEިEEEEF8FF`EExE۠EHE(E0EEEEEE8EEEHE(E EE@E|PEdEv`EvE~`E}PE|Eo`EqEyEnEkEVEIEPEXEjE}`E(EE`EEEEEEEEXEEEEEPEEE E EyE{`EhEHE0EEEhE}EEtEcDDDDDDD D DDD@DD`DDD@D`DD@DDDDD@DDDDDD DD@DDDDDD D DDDD`DD D@DDDD D D D@D̀D@D@DDDD`DD@DDEEE0EEEEE D`DD@D@EE E EPDD@DDEE`EDEDEPDDE D D EE EE E pDDDD@E@E `EEEEE@E!0E E&pEAE_PEXEPpEf EsElEH`EKEH@EG0EJEHEAECEIEFER E[0EZ EJ@EBEBEDEJ0ETEVEZEgEqEjESpEVEaEdPEI0EJ@ECpE@@EYEQEs`EE8EEEEE0EEEE8E(EhEE(EEXEHEEEXEEPEEHEEHEEEEPExExEE݀EEpEpEEEEEEEE`EEE`EpEEEEEEEE0E0EXEpE@E@EEhEEEPEEEE@EEE8E`ExEEEE`EʠEݘEF FFFDEEXEXEEHE8E E EEEEhFEpEEEFF4FxFEE E(EpFFFF0EPE؀EE EExE@EF F F F@FFhFFF F(F)hF*F(F-|F-F+DF*F.F4F-<F(F*F9F:F?FEFLFMFLFHF;FEFCF/F(F#LF"F'F&XF6F;F7F%FF$\F%F5F;dFSF[FSFSFI\F>F3F,FF$FFFF FLF<FFFF/F4$F/XF&DF$$FFF F"4F!lF%F&0F)4F,,F3F7 FBFY(FfF\lFRFQFYFUFKFAFJ8FI\FPFQFSFbFv4FFFF0FJF>Fz FhFjFbF]XFkFoFFFFFNFFF&FFFxFFF<FFJFFFFFFg$FR|FTtFPFYFUFM$FIFBF?<FL,FT$FP4FJ4FGFXhFn,FsFqFnF`lFaFSFQFa\Fc4FsFdFF FxFVF"F|Fz4FvFmFdFhF}HFFfFFF4F6FFFFFtFF}FzFy$FvF|FFFFFJFFF0FFF FFFZFFpFF&FFFFF>FXFLFFLFF(FFFlFFFtFFZFFvFXFZF4F>F~FF|FFFpFFBF>FFFFFlFF^FFFF(F0FFyFFt0FrHFvFt Fu<FjF^XFj,FRFFnFLFrFrFrFzFzFF8FzXFTFFFPFFFF(FFZF F"FFFFF`FFĜFbFFFFFF<F:F:FF~FFFFVF2FxFŎFbFDFFjFFHF^FbFFRFFhFFrF FtFFhFFFF`F*FrFhFFFFTFFFFF.FFF"FNF6FtFBF FFFnF8FĤFTFFF̂F FFxFdFFFJFFFBFFFdFF8FBFZFF:FFFFFFNF&FFF|F,F FFFFFFFhFӂF̐FFFFFFͤFhFbFްFFFGFzFvFFGZG GGnG!G%G$G%^GG{G$GG `FFG%G<G{GG ,FFFFFØFjFFFFfFF~FnFFFF2FӎF~FF(GCGG G/GJGGG-G%G"GGGTGGG"G GGGF FFބF߈F4F&FGGGCGG#hG;gG(G*GGG GG 4GFRF^F FۂFF2GFFFFLF FF:FFGfG GG GGGFFFHFӌFXF6FtFFnFҰF.FΔF.FNFG GFjG=GcGFFBF2FFFxFFF4FFFFFdG%GG_GG&GMSGZ@GR?GSyGRGDG,GAGGG8GvG$G-G+G09G,G*YG$G-LG)vGG G%'G*EG3G6G @GdG5GBGG#G+_G%G#GG GFFFFGFFۤF F:F FFF2F,FFNF.F|F҄FFPFtFGGG$G!G4DG72GG 4GpG G GG}G gGFFGlGG FFFͮFvF8FFFfFzFFF4FF2FNFvFFFþF FFlFնFXFpFbF2F>FFF6FFœF`F>FŨFxFFьFFFǘFϚFFFFFF6GGIGgGtG'4G!GdG#%G1GCGbGTnG>vG4G$GGbG7G.BG'G%G0G+5G!G!uGG G GG$#G:G#]G*G!bGG$G.G6G4G-G.GCG1\G(G.GU|GOGowGbtG^GKGNGK GBGQGkG_Gd GvGfGWGNGRaGOG@G1"G"GGFZFF|FF8FXF¶FƔF6FPFFFGJGvF^F>FFJFFG0GG-GGGwGKGvGG GGGG$GGFF6FFFvF޾FڒFؐF&FtF|FFGwGGG#G VG<:G9GHGaGwGnyGdwGWGWcGDG<G/GG/FFNFpFFFGFvFFNFFxF&FF"FFF`FF^FFF.FFFGG G!GRiG(G*G$nGG0FFxFFGDGuFF^FFFFFfFFZGG FFFfFFF4GGGPG*G/G7G<GJ8G>pG<G1G)G"G!G'G(G0GNGI/G;G;=G@GBGN\GQG=xGK GGG7G=GKGZ;GXGLaGSeGFG<G-0G7GG*vG-G5HGD3G0GBG]UGi=GOGHiG!ZGGF*FFFFF2FHFG8GwG5G(GGXGGG"G.KG4GDG*^G"G*G+&G;G MG GG0G[GBGG GFFzFF҆FFFFFGbGG%G%^GG rG GGuGFF`FrG)G,G FF|GG{GG]GGFFFFF*GG=FFFGG G <G_FF4GG GG G)G8EGLsG=G3GEG^GKGG }G 9FGF0FFFZFFHFJFFGGG GgGbG/G+G'G GGYGpGG GGYG"GGGFGG LG!FFԘFFFFF0GFFFlFG\GWG*vG*aGG JGG/GG/G$LG)GGGGjG&G.fG8`GIhGAGLG_+GUgGRtG:G5 G*vG1G*G8G,G!hG#G/mG'6GG GGGKG GXGGGG[G GGGGGG\GGG GGGFF G2FXFHFfFFFJGUGG FGSG GGG7GGFF~FFF2FFFFlFF|F\F(FF FF&FrFFF`F6FFF(F FFƒF$FF϶FfFFFFFZGpG wGGkFFF.FvFܠF@FG<G %G GzGHG UGG GGGNGG'GGGTGGGGJFGGOG0G G}FFTF@FFF<FݐFܔFFВFjF^FFGG&G FbFGTFDFFFPG]GGG GdFF&FFFF8FhFF|FӐFFF(F,GGGGG GGF&F|FFF0F$FFzF@FFFF0FFFFFF6FFXFFF|FFFXFFtFF<FbFFFF|FF˺F6FFFFFF F4FdFFFF\FjFDFFڜFFFFF2FFFTFFFFvF.F2F>FFF"FF"FzFNFFF2FFVFFpF}PFzFxFFFFFFhF~PFtFzHF&F8F^FFFFTFZFFPFoFghFPdFLFV FfFfdFkFqhFzF4FFFfFFzFFFFaFBLFBLF; F5XF2F6F5F.,F2F4PF@F\F]FctFrF|FFpFFF`FqFkFiF{0FFF`FFhFxF~FFFFFFFFF4FnFF\F}XFlFpFxF|FFFXFFjFF FvFFHFw<FbFZFzFxFv8FFFXFFPF(FaFX`FVpFTFHpF]F]xFWFWFO0FP<FJFEhF< F;FKF^<FiFnFrFwFf FRFNFqFxFFuFlHFtDFsTF_(FcFcFZF6F6F4,F/F?FMFY FVFOLF]4F`tFjdFYTFSFTFKLFNFJ0FMFDFIFPFR8FPF2F-pF&F@F F.|F:F>FGF<FHF;\F/4F(F+F"$FF`F8F<FF FFFEF FFEE E EEEE`EʠEpEXEXEEE EEXEE0EPE8E̸EEEEHE(EXFFF F TEE`EPEEHEEhEpEpEhEEE@F4FFTF|F F F tF FFFtFFFF 8FxFhF F FFEEXE8EEpEF0E0E8EوEHE8EEEEE(EEEEEEEEEEE8E`E8EEEEEPE}E~EuElpE[EVEXE_E~@E{EExEEE@EEEрE0EEEEEEEHEEExEExEE0EE@EEE@E@EE{E(DcDcDrDDDDDDDDD D`DD`DDD`D`D DD`DDDD`DD@DDDDD D`DDDD D D`DD`DDDDDD`DD DD DɀD D DD D`EEDDDDE0E @E EE EE(PEEDD`EpD DEE E`ED@DDEEDDDD`D@DDEE@E EEED@EE EEpEEE pE EEPE EE#@E"E%E=EG@EOEEEZ`E^EU`EIE=@E1E<E?E;E5EE`ECELEfpEWEGPE7E>EJEBEEEQEZEc0Eo0Ex0EfEVpEY`EZEcEKPEQ`EF0ET EREj`EEE0EEE0E EEEEXEEExEE0EEEEPEEEHEEEpEEEE@EEpExEEELjE8EEEE8EE8EEEEE0E EhE@EEEEhEXEE@EEEEEEHEEEpEPEEEEPEEE`EEEEE@EEEĈEEFF$EHEEhEEEۘE֐EјEEڐEhEHEEEPEEpEPEF\FF EEE@EEEEEEޠEΘE@E0EExE˨E8EF FF\FlF<FF FFhF F"DF&F"XF#FF!(F$lF)F)tF$ FhF*F?FDFBF@FRFGFBF5F-F8,F2DF+F\FPFFF%hF2F1F3,F$F!LF#F$F2$FBLFTPFJTFEF?F7F)F/FF,F \F<FFFF FFF$TF@F%F+F(F#(FFFhFFdFFFF"<F%F(F6hF>pFP\Fh\FXFR<FLFJFEF<FFHFFFFFpFrFFdFFFFFFF~FFFFiFWFMFEDFDFC FAF9tF4F5F8hFAFBF@FG8FL4FfFnFkFtFiFgF[FUF^ FeFoFxdFF&F"FFXFFx$FsXFkFfFb`Fh$F4FFFFdF*FFFBFFFFz|FnFsFyFFF6FFFFFF<FFFFFFFdF.FDFFF8FFFRFF(FўFFRFFF2F FFFFFhFnFFFhF}F{|FFFFFF`FF*FPFrFFF4FXFF^FFFFF}FwFxFjFFfF~8FjF{FFwFkFuFFpF F{F|FvFrFs0FsFzF|FoLFt,F@FPFFFFF:FFF:FF@FF*FFFFFhFFȚFFFFFF(FpF6FfFFFFF:FPFFxFFFFpFFFFFFF(FFLFFFFFFhFFFdFFFFFFFFVFBFFFFFFNFF^F FFFBFF.FBFFbFFFTFJFFlF$FZFXFFFFFF|FFRF0FF8FFZFFF8FFFFFF FvFF*F8FߚFFFFFȔFpFxFFfFFFFFߊFFGF`FFJFFGG kGG&G,iG0*G/G!6G)PG&GG"G{GGGGGG6G[FF|FF2F F8F"F0FFFF.FvFHFF FFFhFtFnFRGG@GG =G8GG"4G!GGG1GG G.GBGMGGFxFRFF\FlFҊFٸFGgG[GGGoG5eGG-GSGCG#GGkF^F$FF~FиFFrFFFJFLF6FFʨFF\FFGG GGAGG5FNFBF FZF@FFF&F|F,F|F̶F,FFFG3F4G9FfGGIGGFFXFFFӄFͬFӔF(F,FFF(FFnFDGG$G:&GDGLGIEGFG<G1G%GG G G_GG"G0G6G"G"G%yG0G$dGGGLG(G%2G0G+G]GnG!G)!G$?G0CG+%GGGG FxF6F@FGFFFFFF F>FF F.FFF܆FF$F FF`FGwGzGG*G*G!-GGGqGGG cGFFFGGZFF F\FNFFȞFВFעFԤF FۦFלFĖFFFúFžF(FF"F`FFݠFFɆF$FZFFFxF2FFFFVFFFňFbFXFڎFPFF2FFFFؘF>F<FFGGG%cG,7G#G G)G;GBxG>G4G-!GGGG)G*aG(yG. G+G(YG'G G).GGG'G6GKG>G0GGIG*aGL4GKG7G-G*G5:G2BG# G1G?TGJ.GZGfGRGT|GC4G@VGAXGF1GLGUG`GkG`GGGA$GH G?LG2lG(VG^G GFFFFFxF*FFFFߪFF>F`FFZFFFBFjFVFFFDGFF0FFGGG9GGWG GG G FXFFF\FFFF6F4F,FFFFfG.GG&G/eGKGQGjmG|Gr"Gn0G_GQ,G4G0G)GG XFFF FFF2FFLF@FpFhFϒFǶFFZFFFFܒFFFF؀FFnFHF8FFGPG G2G1G G oGG G GFG>GGGzGFFFxFRFFF&GpGFF`FFFrFGQGGGG"OG5G7G6GCG7G$GGGkG'G& G0>GDGC@G<%G5G0G!G%TG4G.GAGOlG>G>GI^GHGFMG>yGEMG<3G0G%G'G3GJGvGmoG]G_fGh/GoQG]GM G:G5rG:G,G!GGGG nGGsGG8Gg:GZ<GdGtGGGGG| GCG2cG:G5G9uG'>GG G G?G$G!wG$AG4G4G G,G;GCGBGUGOGNGNG+GGG7FFFFڬFFFXFG G GGrGGG#&G 1G(lG+G:GvGGGG %GGGGNGGG GsG8F8F>FFFŞFϊFfF\FNFG GGGGGGG >FFbF>FF G*FFdF FFFFFFDFFbFDFޒFFFlF GPFGGFFlFFFFFG G=GG!<G9G>G*G0G6GFDFJFeFlpFmF}FFnFFvFFFxFlFXxFhFiFGF=F8xF4,F:,F5F7tF2 F8F@FO$FWF`FzFFFFxFRFFFtHFr\FFFF<FFFFsF{FFDF}F&FFF<F4FFFFxFRFmFoFs(F}\F(F\FF@FF"FFFuhFqFiFmFl FnFgFmFhF2FFxFFiF[@FKFNdFRFUF[F[FX8FQFU0FSXFIFFFFdFMFaF\F{@FqFbFS\FRFFFU`F`lFvFuFkFsFnPFe4FmFaFTFB4F:F5F0FBFOFYFSFZ|FblFZ4F_FVF[F_lFSFUdFTLFTPFW0FV$FfF^FdFjFOF7F+(FF/FD\FDhF?FNF0F'(FLFF0F8FFF F<FFF 8F4FHFFFF FE@EސEXE0EΈExEEE@EEPEPE`EĀEEȨEhEEE(E@E0EEEFlF F FF|ExFhE0EE0EhEEE͘EEEEFF,FFLF F F FF F!F!FF@F)lF,F+F"FFF $FPExEE F4F EFE0E(EhEXE0EHEEE EhEXEHEEhEhEEEpEE8EhEhEEEEEEEEhEEn`EnpEhEZEcE{EEEEE`EEEE˘EhEEE(E EXE0EEEE(EXEEE@EXEE EXE0EEHEEDuDuD`DD@D@D@DDDD DDDDD DD@DD@DDD`DD@D`DD DDDD`DD@DD DDDDD`DD@DDD@DDD DDD@D DΠDЀD@DD DDEDDDEPEE E E EE`EE DD`DEEE `E@EEDD`DDDD`D D@DD@EDDED@DEEDEE EE EE`E DEEE EEEEE%0E,EA@E=`EJPEMEYpEPE?`E3`E5E3pE3pE<EDEIEFPETEd`EWEGE7EDPEEEBEEpENE[EbEh EkPE[EQE_EXE\EIEKEPpEb0EbErEEEE8EEEEEEXEEExEE0EhEEpE0EEPEEEPEEEEE`EEEE`EEEEpE@EEEE EEEE0EE0EE@EE0EE8EEEEEEEEE0EhEEEExE EEE(EhEEXEEE`EEPEExEĈEhEEXEEE`EEHE؀EEEEE׀EHEEpEװEhEEEpFFF<F@EEpE(EEEEHEpEEĀEPEEEEEFF\F FFFF F F<FF"XFlF0F F4FFF!F)F$F F F,4FAFCFH FFFLFC F<F*hF$F5F*FFXF 4FDFFF\F%(F$pF@F$tF'F)F1lF<FEXF:F7|F,F*F!FFF \F FFFF FhF F lFFF F"<FFFF FtFFLF|FF%F#F"F,F2F;xFQLF`F^FHF>F?F>FBF@FFFJLFIFNF[,FaFslFxFlxFoFRFwFmFdFkhFtdFtFiHFf\F{\F`FjFFFrFFXFVFFFnF F(FFF\FFVFyFXFFF:F2F4F8F5F0F,F4XF3F0|F9F=FGFOLFSFeDFoFm FtDFgtF^FQFSFcFg$FdFhTF~(FFFF"F},FtFiHFkF^FXPFd`FuFFFF F8F\FFFsFvDF{FjFdlFtFF>F|FFFFfFFF$FFFFF>F^FFlFbFFFFFFfF^FFFFFFFXFzFF~F*FFFdFFFw`Fu8FFFF FFFFFFF(FFFFFjF|FFFFF~$FyFhF$FF~FFdFFF}DFz8F8FFFF} FuFx Fx|Fv8FqF}FxF{Fz F}FdF,F<FDFFVFFFFfFvFvFHFFFnFFzFFÒFFFFF&F6FFBFFFFF2FFbFF\FVFFBFnF&FFBFhFFFFFFfFFFFLFBF"FF:FҀFFFFF FFXFFFFPF^FFhF^F,FlFFFF FNFFxFFFFFFFTFPFFlFFFFFFF*FhF(FFFZFFFTFTFFFFFFFFVFFrF>F֜FFFF^FJF^FF`FFF0FFFGFzFF.FFGGoG8'GCWG>G87G1G*8G GGBGGGdGF4FFGGFFF*FFFFFFRFFFHFޮFFFF\FF:FFFG9GGGG GGGtGIGGG G GFFFGF4FF6FTFFFǚFF:FFdF0G :G GGGG OGEFF<FFpFF0FFF2F`FFFjF"FȐF(F"FPFlFHFڜF|GFG FGFhFLFhFvFÜFZFRFFFɜFFFĸFFFGFVG|G GG`G,GFFӄFF>FPFdFؘFFFXFDFxFFGG G)G4G/7G1G+G&6G!KGQGFfF6GG G(G#G$G" GG^GeGGWGGG G5GGGGGaGGXG#G%[GxG GG F>FjFDFFFFFF6FFFFFRF|F.FFLFF>FFFfF:G!GGG4GoGsGGFFFG GDFXFF&FFF:FFFvFFFüFFjFΆFܼFӬFnFRF6FPFѸF˴FÆFFFFδFFӢFjFfF,FFF~FFrFBFFF̠FȰFBFFFFFF4FFFFϢFfFFFFGGGG KGGGG&gG-G/G)G!hG!GGGGG*G*G+#G+ G*G6G9 G:G(G0G,mGK&G5G0G) G&GG-5G'G#\G'YG"/G-G/G*G&G6G@GV@G_VGaGRiG@MG>G<G5G1VG6GP G\vG`0GF G5G8G6G2TGVGGGFFhFFHFF^FFFDFFVFFfFFFFdFXFF:F,F<FF8GGFF@FF4GGG UGyGGkG'GEGFTFxFFF~FFŔFDŽFF^FFBGG GiGVG0^GMGVG`RGoGgGTGLGGGAgG/G&GG FbFFGF,FFFFhFF FvFHFXFFhF*F΂FF`FªFĒF<FFF&F.FG G0G$G [G TGGG G GGYGiG GKG^FbFFTF FFFGzGFHFFFܸFF>FFVGGvG =GG*KG%G+]G$G*GG GG.GfGLG.G;G8GA0G(G(GGuG G!>G+G6G0G2G6G3[G4G/ G+G$GG[GG$G:G\FGfGcGl\GZGg'GLGQGF&G.G!GGzGGG -G QGG GG4XG(.G8GGGZGrGoG}$GGyKGRG3G08G.G2HG-0GGUG G %GGG LG GG G"G$G/+G.GE<GIG4FG)2GxGGbF>FFFF>FpFFנFdFFGG GG GGG{GSG GgFGGG1FFGG 7GGG oG F`FF&FFdFdFFFFՐFܰG`GbG_GFF FFFzFFF|FGFF(FFbFF"FFFFF&FFHFFFFFGG\FRFݮFFF^FضFܶFG GrG#G+G<3GGGsGQGZG GF,FZFHF F,FFF(FF6FGGFFGGGPGGGG GGGSGQG GGG/FF4FFшFόFàFFFFFFFFbFFGG GOGGG GG G G2GG*GGG]GGG G'G2nG@GfGVGXGeGdGLG FIF[8FbFbXFk(FiF.FFPFFFwFhF^FYFXFU|FG<FCF9F/F6F;8F7 F6\F@FQF\@FjF}FhFFhFFuhFm\Fz,FzFuFFDFFlF<FtFFw4FrFxtFnFz F~FFFFFF8FRFFr<FxFyhFpFo,FpFqhFFFFdF"FF{pFuPFbFbFaXFhLFYFj`FjFFBFFF:FkFc<FXFZtFf0FWlFXFWDFQ$FUFOFGFNxFQFQF`xFT0FihFYFPFVFTdFJFMFI`FblF_HF`FzFiFfFqFlFRxFHF8PF0F6FMFZF^FL8FXpFZdFYFVF[FjFhFnFY`FZFUFWFcFoXFyFwxFFkFeF:hF/F94FJHFBF-F(F)F%FFF(F`FF!FtF|F F'F FFpFF#F. F`FF E(EPEE΀EEhEEƈEE8EEEĨEEEؐEEXEpEEEpFEHF FF$F F FF EF XEE`EEE0EPEhEEFF 0F,FXFFtFF#XF8F;F(F(TF'F2@F7F8F*F#FFF TF EFFF4FFhFlEEEEɐEƈEEEǰEEEEPEEEEEEpE`E8EEE`EEEEEEEE{`EEo EpEzEE(EEEEEPEEEE`E0E(EEPEEEE EEExEEEhEEEEEXExEpE0E|DZDZDwDDDDDDDDD DDDDD`DD@DD DDDD@DDDD DD DDD D`DD DDDD@DDDD DD DDDDԀD`DDDD D`D`D DD`DDDD@EpEE EEpEE E0EpDE `E E `E E0EEE DDDD܀D`DD܀DD D@EED`EDDE0EE E 0EEEEEPE E 0E EEEE!@E@E!E" E5E?E:0EKpEQEaEGE4E9`E.E7 E5@EF7F/F"F F \FpFFFFF FF 0F DFLF\FFFLFFTFFF dFFF|F<FFF!LFFF,PF2F4FMF^|FOlF8F+F3 F/F7F;F;FCFTFIFJFTFZFXpFY$FgFxFs FeFf(FeFqFp\Fh`FuFqFFFF>FbFF{FFF(FFFFFFF\FwFXF>F/F)F'F+F4F3F'F(<F.8F.F+F2FBFIFQFXFb`FiFdF^FQFL(FOFTF[ FiFbFhFlTFFhFjF}FmF^FWF]xFTFZXFjFpFF(F F^FF@FF~FFzFFs FuFF>FFjFFbFFFF$FFVFFF|FFFF*F~FFFFF`FxFzFF4FFFF@FPF~FFFFhFPF|FFFzDFFFF,FFFjFXFFPFFlFFFFFhFF"FFF|Fz<FwF|FHFbFFFFFFFFF~@FpFFF{FoFxxFtdFl,FtF~FyFoFfFjFnF~F<FnFlF0F*FFFFFFFbFrFFFFrFF FF$FFFFPFbFF|FFFFFFFFF(FFF~FFFFFFFFFFFFzFtFF FɨFxFVFF<FFFFRFFFFF*F\FFFXFhFFFDFFFNFpFFF\FF FhFLFBFXF~FFvFFDFFF.F FLF:FFFFFbFFFZF(FFF$FFFFtFF`F@FF"FFFBFfFFFFF.FFvF(FF^FFF"FvFG9G5aG8kG1QG/G8G> G/_GpG`G#GGDGGDFF<FLFF*FJFÐF FFrFFFۈFFFFFFBFF FFFBFG(G)G G )G GGGGGGG GGFFF4FFFNF@FFFFFpF:F6FFFpFG{GG*G FFFfF߆FFڂFǰFFBFF,FFF FȮFFFjFFF^F&FRGF4FFFFFFvFFnFFFF¤FFLF8FhFJFPFFG.FFFpGG GG{F~FZFFFZFζFՂFF@FF|FFFzFG G!G!G(G&GbG:G FXFF\FF^G>GGGGG|GG2GGHGG GsG^G?GqGGGGGGGG G _GG)G!FFF FFFFFFFFFF0FFF\FpF6FՆFdFFFfGG GG!GGGG GFF|FFFFXF޶FٔFF:F֌FF@FFFNF6FFɀF&FĮFFFFFlFFFFFF FÒFzFFFjFpFBFFpFF0FFF˞FFиF*F\FݮFF\FXF~FFF6FFFFF6G WGdGG1G GGG#G/GrGLG GGGsGG%GGRG)GHG,G,G*G%G#(G/G1G:G59G'7G G6G<G&MG"GG"`GG%G$G(G5GNWGQG[TG?%G6G%G G& G$BG1GFFFFŔFFXFFFFG G%TG=*GLG\GwNGcrGTXGOGE>G2G)G:G\GFFXFFF$F.FJF FߖF,FFPFFF0FFFnFĨFFF:FbF:FrFFRF6G7GG$G FF^FGGPFFRF4GTG G *FF&FFFՠFF`GG FFFpFFhFnF,F6G)GGGGG7GGPG#GGG G(G:G-G G1G2G-G"GGGG GTGG)=GG#gG+TG(HG+2G+*G'GGG G G G#G?GTGKGQ)GQGaTGT_GIG;wG.oG(GGG GG4FFGGG$1GGG&GJ]GlfG~GuGGhGRG&~GG#G#GG JG$GWG=GG dG`G XGGGDG;GYG!3G/lG>HG0GGG<FzFFF.FFҎF>FըFǤFNF F~FGGKGGEG /G mG GGOFFNFFDFbFGGGGGG FFlFvFFFFFFRFnF>F:FFBGFFhFFFF,FdFFF\FFFFHFFFF̞FΐFFFFFFNF@F`F^FGGF FܶF6FF~FθFF GOG .G 5GG)GiG GGG GG FFޢFF2F,FTFFVFF FxFDFFFJFGqGhF6GGG(G 7G>GGG1GwF@GUFF*FF~FFF4F2FrFFF@FFhFFFF~GGVGjG pG5GG G G G GgGJG BGG GGGG)G8MG]>GYGTGNKGTG>ZG.G,~GGG G GFvFG.GFFFѰF٬FlFXF:FZF>FդFFJFfFGGFF4FFFzFFRF4FF8FnFƶFƶF‚FFFϲFFF2FF2FFFFFLF4FFF"FFFFFDFrFNFFFPF~FFF,FFRFFFrFF:F@F&FF6FFFlFpFFѲF<F,FђFFFFF2FTFvFF FF\FFF@FFVFFFFȮF$F GJFGFFۖFDF FzFFFFFFGGGG *F&F>F<FzFFFFFFFǾF̠FDFʰFFFFFFFFҼFFF^FFFFFFzFF4FFjFFzFFšFdFFՄFΔFؚFDF\F~FFFɀFFbF FFFFFDFFFFFFFFFrFyFp<Ff4FdFjFgFdFhFtFnFs Fe F[pF`DF_\FlF@FFcTFoFF@FfF0FRFjFF\FrFdFfFiDFyFFlFFFFhFFFFFFFlFF~FFF0FZFF*FFF0FPFFFFFF|FzFyFx,FvFgFjpFdFf@F_FRLFZFWPFGPFFFGtFIFMFQFRFVFW FZ4FX0FQFM\FJFDFBFBPF8`FAFLFUF_,FkFlTFlFtFFhFu4FgFpFVFC0FF4FT FRLFFdFA(F=xF<F>TF?F<FBFVF_Fs`F|0FFDF0FFrF`F_`FxFuhF>FFFFFF{hFuFmFgFk$Fu(FtF&F`F6F|F&F@FFF|\Ft(FwFq|FvlFFvFmTFv0F~FFxFbFZFF}FhFflF]FZFWFhFzFF.FyFkPFXFZFalFUF\FrFjXF`FZFY(FYFOpFL8FWFTFXF\FaFhFRFW$FQF[F\FI\FK(FK\FKFSFb(F_PFc4FgFhdF[DFMF?F8F@FQpFpFFtFmFT,FNF`|FjFr|F|FzFxFdLFY`FShFs8FFFF,F0FFYXFGFNFHF%F\FFTF+F4F8F$F$,F FtFF+F1F3F&F(F/ F4xF0F4$FD F#F(FEEE޸E(EEԀEE(EEߨEhE EEEF@FFFE F$FFFFF*<F#F"F|FFF FF @F,F`ExEEFF$FFxFhFFF F&F/ F8F@F0F:F1HFLhFV FRFJ F5FlFFFF FF FF FFFEE(EpEEƘE0E`ExEEEؠEEEEEʸEEEExEHEEEEpEEEE`EEEuEEEE E@EEEE`EE(E EEXEE8E@EPE0E@EHEEEEPEEEE(EE(EE EEE{DtDtDD DDD@DDD`DDDDDDDD`DDDDDD`DDD`DDDDD DDDD@DD@D@DD`DDDDDD@DDDD@DD DDD`D̀D@DޠDDDD DDE E E"E EEE E E`EE PEPEPEPEEE ED DDDD DDD֠D@DEEEEE EpEDE EEEEE 0EE @EpE`EEEE!E%E`E'E/E3EBEGEQEC@EFPE6PE7E0`E5E.E3`E;E>E8E?EKpEIEM@E;E9pE0E<EC`E:EFEFEVEupEdpEK ELE]E]EcEc E_ElEuEhEEEEE(EPEEpE`EE0EEEEE{0EyEE E`EE EEEEpE@EEEE E`ExE@EEEEEEXEEExEHEEEE E0EEEEPEEEEEEEEXEE E EèEEEEEE0EE E EEPEEEEEEE(EEhEExE׈E۰EEEE͠EɰEEE͘E˸EEhEE8EE`EܠEFFEEEEЈE0EǰEXÈEE@EXE(EEEhEΰE(EFFdFlFF FFFPF |FF FPFF XF|FF FFtF(F F#F/FD FEFI`F@LF3F)xFlFF F@FlE`E`FFF F \F\FFF F#`F+F!F*\F/DF&F$FF`F FFTEPEFF4FFFF F\FF FF F|F`FFFFFF(FFF|FFdF+ F,`F0FELFXFNF.F#F&F,xF9F>8F=4FF0FCdF@F?HF;$FH0FOFTF_pFlDFiFVFcFeFgFnxFaF^FjTF}8FFF$FF|FsFsLFtFr(FFFy8FFvFwFwFnPFDDF-F&F)F+PF+F.\F*4F)F,F(F)F/pF:FEFIFQ|FR0FY Fe<FXFRFGFFFN FWLFZF[hFVTF\Fi Fx`Fu<FsFhFVFNFKpFNF\<FZF_FnHFFFFFFFFFFF}hFsFFFFvF<F<FF\FfFFF"FFFsFs4F FFFnFZFxFdF.F|FFFFFFFFbFpFFFF4F6FXF:FFvFrFyFzFnF&FFXF6FFFFDFZFF<F(FF\Fz|FtHFsFwFtFxtFvFFLF>FF2FFFHF|\FyFFFFuFoLFd<F_`FfFjFmtFvHFqFhxFm FqF{FFFnFFF>FFFFvFlFFFFDF"FFFFF F~F*FFFnFFF:FFFFxFFFFFFFFFFFNF6FFhFfF|FF FFFFLFўFPFFFF FFFF*FPFFFLFFFFF4FFFFF2F(F^FF*FFFF&FFFlFF6F\F.FFFzFFF(F2FtFFNFFbF~F.FF>FF$FFPFFFbF4FNFFF F&FVFF FFFFРFFVFLGGFFFFGGXG6G'G*G."G$ G"G`GGDG"G+GdGGF(F߂FF\FLFƜF*FdFF F*F4FZFFވF F>FҖF@F\F,FrFFFVFGGGGgGGG G ;GGG :GGFFFFFFFǪFFF2FFFFFFRFFF2GFNFFxFFF2FFF>F FFRFFFFFPF|FF|F"FF FfFHFG F`FFFpFtFF4FrFFfFFXFF"FF,FȎFF4F FGgGGGHG G F$FްF׼F@FvFvF`FFNFܲF8FF2FFlGJGGGG1GGFFF FԒFXF2F:FFGGOGG GGJGUG [GGG GIG VG5G G G G GmGGGFFFFFFFFVF,FڄFpF F,FFFNFfFFբFFF4F&FۮFقFFFGGGdGG 8G@GhFFFFFFFvF>FnFxFFBFNF`FFFFFF.FFFFzFFbFFFNFF FFFFNFFhF*FFFF FdFPFFFBFFFhFF>FFF:F@FFLFXFFlFFFNFpFG?GaG %GGGG QGG zGGFfFFjGGWGG,G8G;-G8XG'G#=GtGGG&IG(G/G5G G!G/MG#)G.G":GGG9G!G{G G5GAGM9G:sG*$G!GtGG!G1=G?GQGYTGNG+yGCG#G"GGgGGFdFFFFTFF*FFvFFXF@FFFFFvFFFFFrF֜F\F0FFFۂF^FFԮGUG rGGG$G GGF^FFpFFFFFFFzFVFضF8FGGGG7GVGeGT6GNG>G9GG+G0G`GGbFFFFFFFRF`F&FF.FFF&FF FFRFFFFIJF8F"FHFtF(FGG/G(G]FDF$G/GF"F"GGcG GGFFF\FF FGG3G4GF<FFHFFxFlFFFPGG0G GGGGzGOG;GG#@G(3GHG)`G#GGGG>FFtG DG [GGoGG)G"G oGGGGG G G.G G7GUCGBG86GMGDG<GF͊FFF6FbFFFFnFF(FFŠFFFߤFhFGG(FFGGGoGCGpGG7GGGGGG>G!G?GXGBG7DG;G.G&VG0NG!G \FFFFNFF4FۜF&FFF,FFFFFFFFFδFFfGFF8F FdF(FFtFʖFRFF>F̌FFFF˴FvFnFFfFF.FFFFF.FZF^FF6FFZFF@FFFFF$FF2FFF"FFF8FFFFFFFFF.FFFFF:FFhFF:FȴFBF(FԂFȌFF.FdF FHFFFFFFlFFF FFjFFFdF`FҐFFFtFhF FFPFFFFZFFFF2FFFFFFFxFF&FnFFFFF^FFjFFPFǠFFXFVFFF<FFF^FFFFFJFJFNFfFFFF^F>FŤF֮FFHFFVFFFFFlFlF FjFFDFFF FtHFkFhFhXF`FfFb`FgFeFmhFm0FeFVFKF]FotFetFFnFqFiF||FFFFF^FFF~FcFctFnFwFzFlF4FF.FF@F(F FFFHFF}FtFz|FF*FFzFFFF{8FFFF"FJF@FFvDFjFiFahFhFkhFsFfFSFK(FK(FI F>xF>F;xFGFEFLLFNPFTFLF\dFO FRTFTFT FMFE0FHPFH`FHFMFVF[pFe F_F{FcFZFeFe(FmFQFDFAxFHLFZPFMFMFJFH FFLFJLFQ$FSFdFnF F4F*F0F@FF~FjFhHFmFXFyXFFFFFF~FmlFj FeFodFqFmxFkFxF,F|FFFFFx Fy\Fq$F|F}FsFq(F\F.FvFFFFFFyFF{FgF]tFTFvFRFhFkFdFZFTFPFOFa@FlFelF_F]DFqxF`xFW$FZFXdF\F[FgFk4FrFaxFdFfF\FMFTDFL FL FIFS FSFWxFj$Fg$Fc`F`FTFOFM<F^pFgFFPFDFFdFRFdF`FtFxFpFmDFnFgFgF FFnFFF|FjFsFY FKF:F2F(8F(F5F@FXF]|F?`F&\F)F 0F$F2`F5F@tF/F5pF;FOhF[ FI4FMF3F,$FPF dFE E܀EE`E׸EhEEEEEEPF FFFFFFF F(FhF8F#TFFF(F<F F FF FFF |F ,F `F4FF&4FF F&|F.F#F#F7F@FAF8HFFFLFVFaFe\F>F0FFPF FLF,F F$F FEPEXFEE`EXEEEEE8EEHFF FE8EE͈EE0ExEExE@EE EEExEEEE EEpEEE8EhE(EEEExEEEEEEEhEEEE@EpEEEEpEEE EEpEEhEEED@D@DbDu@DDDDDDDDD@DDDDDD@DDDDD@DDDD D@DDD`DD`DDD DD D@DD DDD DDD`D D DDD DD DD@DԠD׀D`DDDDEPE E0E,E!EE@E@EEE@E`EEEE`E E pE0EDDDD߀D DDDDD`D`EE@DEPE`EEEE PEE0EE0EE`EpEEEEE@EE$E2E+EFEN0EGE@0E9E1E+E9EAE40E0E<0EBEIEKE9EMELEEE4pE4E+E4E7E@E4E=EG EVEK@EQETEWE[`Ej Eb`EcEi`EwPEEEzEEE0E(EEE@EEEHEEEzpEpE| EPEE`E8EEEXEEEE@EE EEEEEEEPEEEpEEEE(ExEpEExEHEEEEEEEEE`EE`EEEEİEEE@EEHExEE(EEEE8EEEEEEEE`EE˨EEEPEEېE׸EEEE`EEEpEE8EE˜EEEFdE(EhEXEEEEE0EEEEEHEEҐEEEEFF FPFFF FxFFF!FdF FFFFF,F $FFFFLF,`F7 F<F:F9LF+ FFXF FFpEpE@E0E8FF F@FFFhF<FLFF F!F@FFFF FEEHEF`FFF FF FF F xFFFtFF FdFLF |FFxFFFF4FFF F#4F/FAFGF<\F+(F0F#F"F/F=F5F;DF/F&LF+F-F90FKFFpFQFVFVFW$FZFXFjF^FTFSF]pFiFtFRFpFcFd`FhFiFiFF}<FFz FwFuFkFeXFNxF8pF$F"F"F$$F.tF(8F,xF!F"F&F/F:(F?FItFTFW|F[F\FTFUFPFO FHFMxFSFQFOFTFXFfFmTF^FbFW`FNFNhFQ|FUF[DFVFjFt\FF`F{FF(FFw$FtFv`FuFu0FtFtF{FyFF|FdFF(FdFFDFl`FitFkFgFuF}(F|FFF$FFFF<FFFFNFFrFFF$FFrFFFBFFFF{dFtFo,FsF\FFDFFFFFpFFFJFFFLFFwFphFbFeFdFpFZFfFFtFF0FxFFFqFiFxhFFrtFkF\FWFVFTF`\Fa FfFr$FpFjFhFn F8FFtF<FFFFnFF4F6FFhF@FFFFFF,FF.FlF~FFF$FFVFFFF"FFFFFFFxFFF FFF&FF.FF.F$F FFFVFFʐFFhFFFFFFdFXFrFFFFZF~FylFyF}PFF&F|FRFFFFFF6FF0F4FFFFpF@F\FFFFF8F^FlFFFFF2FBFFFFtFFFFrFF FDFFFFnFHFHFnFPFF FF(F"F߄FFxFPFFFFFGG&8G,G$GGWGOG"G G GG#GgG 9FFF\FڎFdFFF|FFrFFFF"FFFFبF@FЈFFFFFhFdFF,G_GGqG G,G NG GGGJGGCF*FF~F*FϢFF*F&FFFbFF8F̘FFFFxFFdFhF6FnFڜFΊFFF FRFFXFvFHFBFFFFFFzFFjFNFהFFFFFFtF:FFFFFFFFF>FFxFfFFFGG GgGGPGGGFF8FFFnFFdF$FF,FՌFؒFTFFFFGGG:G GFFF՘FF͘F̢FݲF<F\F<FG eGcG G G DG EGwGfGGG G8GGCGGIGoGFnF8FFNFFސFZFF۴FڲFF4FFF(FFҎFތFFFɀFDFtF(F’FΘFrF$FFVFGG G G GGbFFF$F@FPF^F0FFFLFFFFRFzFDFF\FF.FFtFFFFFF~FFRF*FFF.FFF6F"FFRFFTFFFFFF@FlFTFrF\FFߚFxFFFžFF F8FFִFFDF>FGFfF&FFGGFG FFFPFDG GG G WG&G%G2}GGGG}GGGG%<G#_G>GGG&GGCG<G3G GG zGGG)KG.G4DG$*GG G?GiG"G.jG@GGVGDG%LGSGLGGG GGDG FF؂F0FF"FFFFFTFvFߦFF^FѤFFԘFNFFFźFvF8FFF*FfF0FƦFƆFvGGGGG FvFFF FdFBF>FFFFbFNFFRFʔF<FGgG{G2GHGZGNGAGAG=G%HGGwGGGFF~FZF,F0FF FF|F>FFFF*F~FFFFFFF@FF8FӘFF^G=GsG G F.GGrGFFFGFGGrFbFF0FFGAGgG )GG aFFhFF܄F<FFFJFGFGpGMGnG GWG kGGeGGG GzG9G @GFFFFDGPGGGG4G OG6GGuGlG DG GGGGG(OG76G3[G.G9G6UG.;G2oG1ZGG&0G#GuGG G GrFFFGG G G GDG,JG@GFGM9GW2G1GGGGGGGF\FG'GFFFG~GcGGG3GG GXG FFrFRFFHFRFFVFBFBFF`FHF˪F^FخFFFFGFFF$FFxFFĪFԴFG GGG%MG GG>FFFFHFFF^FFvFF0FF̐FFF*F8FFߚFFF֒FFF0FFfFFͰFdF(FFFȮFFFFnFtF߮FF FXFٞFFF>FF@FjFFFݖFF FTGGxGfGGGzG 7FFFFFF҈F F.FF&F0F,FFFXFFFVFNF FFzFG GGGGQGLFFFFFFpFFFjFFFF2FF"FlFFFFFFPG F0FF$FFF"G=G GTGG GGGG BG GG*GHG*3GQGG~GG-G FF,F@FFԤF\FތFӔFFFFFFFpFϚF FFFFFFF0FFžFfFÈFpFTFbFFdF>FFjFFfFF̦FۚFFȊF FF<FF F<FFFFFF8FF F*FwFzF}FFFFFF|FsFtpFjFl Fm<FoPFFFrF>FFFFdFFFFFFFFvFhFúFJF FFFFFFFFF`FxFFFTFFFRFBF֪FFTFF2F.F̨FFF(F2FFFFzFFRFF$F͒FؚFFDFF FFjFFFF0FFFJFFFFFFFFFFzFF:FFFFxF&FFxFFFF&FFFLFF|FjFFΔFFFxF,FF$FF0FF|FdFFF2FFRFFuFfFg@FkFlFj@FtFF}FuF_F^TFRFSF\0FhtFtFFzF~F|FzFF FFFF0F|FFt8FmFfXFqF{FFFFFPFFFVFFF}FFqFiFh\FwxFzFFFpFkFstFFFTFzFFy4FFFzFfFe4FmFtFvF FFL,FL,FG(FGlFEtF@F4F=FJpFHFIFO@FLXFQFYFTF`FbFUFDFGFQXFOFPpFR$FPtF]|FihFXFDFFFCFW4FNFP4FH8FJFA`FDFMFIFQTFYFL FPFQ Fb\FyFFF<FFFXFFFvFxFkHFsFoFFfFs`Ft,F"FyF|Fx,FhFwFuDFhFhFkFF}lFZFxFuFFzF}TFFy<FuLFwFFFx(FF`F4FF,F@FFFF|FzFh0FjFFFsFKFDF=FEHFWFVFdFtTFy@FnFf0FixF]F_tFcFhFcFrFm\FjFzFsFsFhFZ|FYFaFTFNFNFZ|FXF`Fk(FgF[FW|F]FcFf|FuF>FFF|F~FjFYdF\,FjFrFuTF_XFl(FpFFFFFFFFlF}pFl F^FNFCFHF9F=dFCFSFvFoFs<FRF4|F&\F*F*F2F6@F14F6FA0FbF]xFUFMFDFLF'FFEEEPE֨EEF4EEEFF FFFF0FFFF F PF FFHFxF lF FFxFFFHFF F F\F!F,F'FHFFF#F"FF4F@F=PFPFDFHF5FCF](FH8F,F!F HFFDE`EEEEF\FFFE(EEEE`FFlFFFPFF FFTEEXEEE0EEEEEEEExEEE0E0EEEE@EEhEFE EXExEPEExEEXEE`EEExEEEEhE8E̘FEEEEEEE0E(EDDDqDDD DDD DDD DDDDD@DDD D@DD`DDDD@DDDDD@DDDD`DDDDDD DD@DDDD DDDDDD`DE@EPD`DހD D DDD`E E EEE#EEE E@E0E EEpEEEPEE`E pE DD`D DޠDԠD֠DޠDڠDEDEEpE0EEPE EE @EEEEEEEEE@E$E$`EE E@EE"E(E<EJ0EP0EB@ED`E6E'E1pE3PE8pE0E7E9EGEH E=E2`E>0E@E2E @E/E1E-E8E>0E;E?pEGELETEZEc`EaEk@Ea EqErEv0EypEtpEv`Ek@E|EyEEPEEEEEtEzEsE~pEo0Et EEEhEE ExE0EEEEEEPE8EEEv@EE}E E8E|E{ EHEEHEHEEEEEpEE@EhExEXEEEEhEEXEEHEE8E0EEEExEEHEEXEE0EPEE`E0EPEXE@E EEEpEPE(EEEبExE@EиEE EEɨEEEEEEEEӠEHE EEXEEEEHEEEEE0EEPE8E͐E@EEE0E EPEFFhFF FLF8FEEFE@EEF\FxF4FFF F*F.F.F)F)F ,FF FEpEpEEEEEEFFFF <F F FFF0FF FExEEEEEExFXFPFEEEEpEFE`EEEPFF8F F F FFXF"PFFF$LF+F-F3FBFC(F0F"|FFF$F/F)@F/F.lF!pFFF,F=F>F?HFAFHLFOFYFVlFbHF]FVHFPFLFSFUF_F`FTFWFX`FaFmdFkFsFvFxFhLFWFVFIxFA@F2TF&DF"F"xF"tF#F+F F (F F&F1lF5F:FFF[FeFbFSpFHFOdFMFRFGF@FE0FM,FVFNFIFJFSFPFOFOFJLFGFEFJFNFVdF^FVFR4FmFo<FxFFwFiXFk,FkFpFrlF\Fg FeFi0FnFtFoFxTF{F{FzFsFk FaFYFZF\FiFpdF8FF>FFFF.FFFFF$FFFFF8F.FF,FRFFFjFy4FoFcFl8FxFzF{HFFHFF0FFFF~FyFvFmHFotFlHF_PFaFaxF\F\8F]FUFaFsFFnF{PFzFrFdHFgFlFn\Fh\Fa|FYpFTXFV@FRFO@FTFVF_`FlFrFlFgTF{FFFFFF:FFFFRF&FFRFF&FxFFFFFFF>FFF(FnF|FFxFFFF4FrFZFFFvF FFFRF(FRFPFxF FFFFFFfF@F:FFZFF:F*F:F\FFFFFFFv@FhLFlFkFkFk$Fi,FFXF^FFFFFzFfF*FtFRFF&FFFF>FF|FnFnFFFF`FPFF>F4FFTFFFFFVFFFFHFpFFFlFFrFFFFLFFFF8FjFײFjF՘FFԘFFGGG$GG GYGG GTGGFGFFFĨFpFhFFFFHFtFHFVFF~FzFFrFFFFzFFnF F6FFdFGG OGEFPF^GGG9GqG GFFF<FHFbFFFFFFFFxFnFFFFFHF*FFF6FjFFjFFF FFF FFFFFFRFFFbFFFFȔF8F.FۊFF(F0F|F:FŨFFpFFFFF&FFFF"FXF\FF|GGJG GG(G G OGFNFFFFJFFݴFFFTFԐF@F<FF>F:FFGG GF6FHFFJF<FvFFjFF^FFGYG GxG `GGGOFFFGFGGWFFFFFFF֤FӆFFTFhFF FFFǠFpFfFFhFBFtF\FњF F8FÂFFFpFF:F FF^FXG+G tGpG`G=FF^FZF6FdFFdFPFFhF:FFFpFFJF@FFrFF^FF8FFHF$FFFFjFF`FFLFjFFFF$FxF2FF.FFFFFɺF@FvF̈FFFF FFDF<F&FFɬFFFFfFFFbFFFF^FzFF~FxFFVGGG G GGTGG}G_GGGSGGGGG2GG#GG GGGGG:GLG GQG{G6GGgGG#G*G'G%G+ G:<G3G!$GGGGG GpG GFF>FNFbFFhF^FFXFFF؆F@FXFFFFFF@F@FfF~FjFF0FFFFhF&FFFFJGFF|FXFFlFbFFFFFF(F FF:FF*FGGBG,SGKG?uG*G1G/G)GYGFG WFF(FvF~F:FFF FFFTFlFF4FFFFFF՚FFFF̾FRFƾFܶFFFFGnF F6FFVFFF FFBFG9FF*F`FF֮F^FG8GG nFFfFFNF٬FFF2FFFFF>FFGGGGBG FG4GGG FFFFݪFޜF(FFFFFF(GXGGxG GGF.GdGG0G[G.G-G%G&G+G(G'G+G;G!GBGGGhG DGGFFFFFG ,GG"G'G(GKcGRG&G^G LG ?GG+G GFFFFVFFFFG2GGG GFFtGFVFFіFʞFŞFFFFFFF`FRFFFF&F~FTFFF FF$F:FvFͰFfFFrGjGBGAG!$G FFFݐFҔFBF FFZFF@FF`FFFFF&FFӪFDFFFFڼFFFzFFFF$FF:FFFFNFtFFƄF|FFF܈F߬FF(F2FFhFpFFFF$FFDFF FFGGUGFFFtFFFtF^FFG+GGF:FtFFvFFFF.F,FFFG GFFFFF4F6FXFFFFhFDF"FFDFF\FhFFFĄFFFF&F(GFF,FtFF@FFGFGGG zGG9GG`G!G#9G GF^GFdGGFrFFFFZFԜFFF˾F|FF|FvFFLFFFFFFFFFFxFFFNFF`FFFFF̀FFFFFFFFPFnFFDFFFtFFF F^FVFbFFFfFFs0FpdFrF}FFFzFvFr FnFj@F`FcFfFlFv FFlFFhFFlF`FFPFFhFFF FBFFFF>FFF:FFFFFFFFF FFFFFFFFоFFFӌF,FF²FFlFBFFӚFFbF\FFFFJF2FFFFFFFFFFJFFxF8FFFFFtF*FFzFF~FFF8F FFFzFzFFFpFFF:F4FF FpFDFlFFFFFFFF`FF$FF8FJFFF`Fx FjFgFj4FgFxF}DF2FF|FmFU4FQ,FSFP\F\Fi`FFhFFFbFFF(FNFfFHFFFTFwFlXFl|FFyFsFFFFFsTFu<F|$FuFpFthFgXF^FYF_ FrpFxFFFu8FbFhF|FyFFJFwFyFyFr<FnFiFw,FHFFFFx4FTFFF=F3F=F?HFFLFR(FbtFQdFG\FHFMF_FkF}$FiFiFX0FQFHtFT,FSFK@FHFYtFilFUFGFBF>F=FHFLFV<FT|FGlFNFCFEFJFQ<FQTFRFNFk,FFHF8FHFF:FF>FFFF|FtFF"FF{F{Fy FrFFF<F|,FqXFqtFl0FrFuFm`FjFp,FyFoFtFx@FLFn8Ff\FpFnF{FFvFn8F| FFFF:FbFXFFNFwFkFFwFhF\,FPFIFBFYFbFpFwFxTFmFk@FiFeFlPFfTFrFwHFF0FFTF^FkFkFiF[4FcF_pFcLFOFX<FXFqtFvFupF`FOFVFSFoFFFFFFFFFFkPFcFgFd\FUFfFFFxFFzFF^F>FFsFjFShFO0FJ\FOFSF]4FvPFsF^FTFW(FIF4F0F1lF*F+F0F@HFJFfFXHFiFQ|FLFAFFE EHE EEEFFFFFtF 0FF F%FDFFFxFFFPFF lF F FF<E0FEEF\EEFFFtF4F&<F\F%hF+F)F&dF(F. F5<F=tFH0FFF6F4F>F<F,LF-@F!FFlFEEEEFFF<FFLEEEEߠEExEF FF,FF9PFXF-F FxEܸE@EEEEưEEEE`E EPEpEEHEExEEπEExFEEΘE(ExEpEȸE@EɰE@EEEEEEEExE°EpFF/F4FdEEEPEEHEPE8Dn@Dn@Dv@DuDD`D{D D@DD DD@DDDD D@DDDDD DDDD`DDDDDDD@DDDD`D DD`DDD`D DDDÀDD D D@D@E EEE PD@DD`DDDDEEE @DEEEEE EEE EpE@EEE PE PEE DEDD DD׀DD DEEEpEEpE@E@EEEpE EE`EEEpEEEEE#E%EEEEE#E90EB0EHE9pE<E70E,E*E. E0E.@E1E<@EEESPEGE9E9E.E5E( E/0E60E3@E8E>E<`EFEB0EREO`EVPEf`Ee@EsEpElpEm EyExEEuEhEmEyPEu@EzEtEvEz0EpEy0E^Ep@EppEsEyE(EHEEEEE@EEE8E`EEEExEEhElEh@EiEtEyPEz Eu E~E~EHE EE8EEEpEEEEEE(E EE`ExEEXEEXEE@EPEE0EEEEHEE`EEpEEEExEEEEE@EpEEExEEEEEEEEEEEEE@EE@EEƠE(E EEՐEEExE8EEhEEEEPE`ExEXEӐE`E`EhEpEhEEEHEFF F E8ExEExEEPEFF$F(FF,F'`F&\F#FHF"F"XFFEEEEEE(EEEE0ExEEFF FF |FHFF FpEhEEEEEEEExE EpE8E@EpEEEEEEHEEF,FF FpF4FFDF#F$0F$dF/F0F7F/F/F$@FFFFF$F.F2 F/8FFF F%F+<F3F;TFDFMxFOFQFSFTFJXFFF;FBFGXFMFLF?FCFB,FPF[FfFdFkpFh F]4FQFIFDF;8F3 F(F<FF$F!F"FTF$F,F!dF%F-F1`FHFTFVXFZFUFJ8FBxFG$FF$F?F6F6\F?F@FJDF>F>F3pF9FC\F>HF9F8F7lF@FDFLdFWFIxFD8FRFoHFwlFvFpFm\F[Fc8Fc4FeXFZFXLFP8FPDFUFWF^PFhPFsF`(Fn<Fn\Fh,FP FMFOFLFRFaFj<FFDFFFFpFFFFFFFFF^Fz4F*FF~Fy0FuF|TFqFXFSFUF_tFplFpFklFxF|FF,FF~Fh0Fb8Fj,FjXFdFfFcFbFphF`F`xFa8Fd FaFcFv\F}Fs FgFjF`tFhFlDFcF\8FYF`F[,F[FSFPFKFQF[FmFilFiFiFxF.FBFFFFFF\FFFFDFFFFFFFTFFdFF:F FFFFF6FTFF^FF0FPFXFFF$FFFF:FFFzF"FFxF4FvFFFFFFjFtFF:FRFF>FFFF FFF|FqFe$F`F_F[XF`FrFtF(FxF}FFvFxFFwF~FFFFF2F|FF^FFFFFFxFwFFFFFF\F\FFFFFFF0FFFFFFvFFFFjFF0FFFtFFÔF$FήF:FFؖFGKGG G GG GFFFFFF~FԺFDFhFFFFxFFFFjF2F|FBFFͶFpFFDFxFtFF8FZFjFߚFF޶FFBFZGvFfFFF:F GGGMF*FF^FDFͲFFFDFFVFJFFFFrF"FtF\FzFFJFXFFF`FHF2FFF FFFF(FFFLFFFFFFFĘFxFղF.FFFFFFFrFFF*FF\FFZFFFFdFF6FGGXGGG+GG SGGG,FFNFѺF0FjFFFFFFZFFjFF\FͰFFxGCGF0FfFFǸFĸF¼FڀF՘FF|FRFdFF@FGGGsGPGFF2FFFFFFXFFڊFИFZFȀFŔFFLF:FFFFfFF(F˜FVFϦFFlFhFFFFFPF\FFVFFFFRFFFGZGFDGGGF2FTFސFpFцFFjFBF\FFFFFFFFF8FFlFFFdFFFFxFFFFFF^F FFFFFFTFFPFF FF`F@FFF$FFzF^F FFNF$F.F(FFFFzF^FVFTF4FFF"FF~FFPFغFGGGG~G G ;GfGFFJGqFGG GF6FjF4GG FFFFF,F&FFGGtGCG.GGGGGG<GGG"G GqGG GGG GwG dFFF8FF FHFFPFFXF6FضFFFFFFFFF^FFFFFbF0FFFFFJFDFׄF|FFvFFF6FFF.FFHFDFFFFFBF@FFF*GGG/>G+G(GfG3GCGGFFHFFFԤFRF܊FFFΐFTF"F>FFF(F2FFFFFFFƮFFxFŴFhFɎFFVFFFFtFFF F׈FڂFTFFFFRFFFF:FɎFFF@G G F&FFF"F4FZF^FFFFFFF\FFFhFFFGGFPFpFVFLFFF͊FFրFzFݢF^FfFF"FG4FFFFpFFG G GG GGGGyG*G GGGGGG2GG+GGFFF\FBGG4G}GBGG#G7G!GG G GGGMF FlFF6FFFFFzF GGNFFFFFrF0FF|FFF$FFFlFFFbFFFFtFFԨFFhFFFHFވFXFȆFFNF|FFjFG<G G{FFFFjFFFFFFLFFF<FF$FFFFFɶF"F߈FF΢F"FFپFHF:FFFFFFFFF"FFFFdFFFhFFFŠFFFzFF|FfFFF2FFrFFnFF FfGFFFFFlFFFpFnF.F:FGnGFFPFFFtFF@FxFFF`FFF<G?FFhFFF F޸FFFFFFF}FTFF6F6FTFFHFF<FޖFF֦FFFFrFfF<FѢFٴFF*FLFHGGG=GGG*G FF FFFFF:FbF$FLFF̮FFbF FFfFF FFvFFFFFRFvFFF*F\F^FfFFFF<FFzFRFJFXFDFFHFF2F FFFtFnFRFFFFLFfFhFFF{HF}<F}PFk@FcFbFeFjFpFrFrxFh0FaF`pFhF`FbF`F^Fi|FkTFw|F| F}DFF F~DFFF$FFFFdFbFjFF0FbFFFFFFF FFFnFFFFFVFF4FFLFFԜFܢFFFЪFFBFFjFFFFvF8FFFΠFzF͒FFFFFFFFF`FVF|FF$F4FF,FF$FXFF,FFFFFFFF>FFFnFFF>FFF4FzFjFF\FFJF&FdFFF@FFFFnFFFF>FFFmFkFmFk`FqFtFFFRF*FuFUXFUXFXTFZFm|FnF6FFFF,FDFxFFFxF}8F0Fz,FPFZFtFkFr4F|XFv$FnFwF|XFyFm`Fc8FqpFxFlFexFZF_xFbhFjdF`FuHFrFrFg@FZFYdFndFcFvFz FsFhFeFg(FhFiFp`FlFFFFFkFa|FEhFDF;F<\FC(FS8FaFZPFSFOFQFaFpFHFFFodFjdF\FZPFVFMFOFW,Fb\FVtFNFIFGFD F=HF@FFFOlFTFQFJFMFE\F?FSFOFThFeFF<FF&FVFF2FfFF\F FFFFhFF~FFvFhFt<F FFFg|FmFiFuF}FqFfFchFm|FqhFdFdF`FjFaFOF^PFlFoFaxF_PFsFxFfFF4FFFZF<FyDFoFtTFbLF[hFYFTFJFHFZ<Fe|F4Fy8FiFtFrFiFl|FmFcFt F(FpFFyFt(Fq8Fp,FtFeFv\F_dFgPFhFgFjhFyTFsFBFvFu<F^FTFW`FlXFBFHFFFfFFXFFp<Fl8FYFUFjhFk|FoFFFTFF^F>FxFxF}F^FNDFEF>XFN,Fl\F{|FyFf FiFYFRFZF\XFIF=F7@F4F;FJ<F^LFktFa<FZ,F<F9F3F#$FtF E0EEEFF tFF FF`FF(TF1F2@F"F( F#FFF|FFFEFFFFE@EEXFF E`F FlF"TF2F.pF+8F1PF7`F6F0F;F;FKtFNFHF?F7F*FF#F!F# F!$FFPF @F F FF @FFF)FFLFEEPEEPEFE@FLF*<F3FfFwFHF FxEEEEXEE`EEEרE8EhEE`EE0EE(EE@E@EhEHE@E`EEE0EEѸEEEEEXE0EXEEpEEE F(F>F)XFEEшEƨEEhExED{D{DDzD@D`DDDDD`DDDDDDDD`D`D D DD`DD@DDDD DDD`D`DDDDDD@DD DDDDD DD DDD D`EPE EpE EDDDDDʀD D EEDDEE!EDE EpEE`EPEEEEpEEDD@DD DπDD@DD@EEEEE@E E EED`EEEE`EEEE%EEEPEEPEEE EpE" E:EF E=E1E0E+`E,E2`E1E6E9`E;E?EGPEIELEC@E1E-`E%E'E-@E0 E=0E:@E=EBEEENEHEOEdEkpEbEmEvE{@E|0EhE~Eh`EhEh EoEkEjEl`EgPEfErEx`EnpE]EpEoEeEwE|@EEEEEEEPEHEE(EEE@Ep`EeEmEj@ElEd EzPEwEoEq ElE{PE}EEhEEEpExEz`EyE~pEE EhEEEEEEhEEHEEEPEE EhE EEXEPEEEXE`EEEEEEEEEEEXEEEEEEEEXE(E`EHEEEEEE EˆEΠE8EEEExExEEEHEEEE`EE(EEhEPEEEڰE`EEhEEHEFFEE@EEEEE@F(F lFxF0FF @FFFFTF$F $EEhEܸEE(EװELjE`E8EhEEEEpFF0FFhFFFpE8E`EEEEEܸE0EE@EEPEEE0EE EE@EEhEEF$FF FF F F%F F$xF/TF-F.F'F$ FFHFhF <FF,FIF=XF(FFFFF#F$ F'F5FIFOFJFHFC,FFFEhFAHF4F9F2 F5F-\F/F6@F@FCLFRTFOF[(F`,FVFMpF?F9,F1F*xF F4FFF(F$FlFFXFF!8F(F/lF:FG FQ FW FQ\FF F<F2<F2(F-8F+,F&F6F4F;F5F-F0$F.(F1F/F3F2(F-\F0F7LFCFP FRxFBXFCFS<FlFlFl FlF[FUFWFS8FVFMF>HFCDFCFEFH8FMFWFU@FT4F]0FXFEF;F6F=FB8FFFSXFgFuXFFFFFFF&F~lF|FFDFFjFgLFwFnFoFoFl FlFlFSFLxFH0FTFZ8FeFhpFl|FltF~FFVF}dFnXFjFftFrFfFYTFcFh<FnFjFYFVF_hFNxFTFWFfFiFfDFc Fc FgFl$FbFZ$F`PF^FZFTFV8FUFMFGPFO<F\PF`FbdFtTFvFzFFFFF FF&FFBFJFFJFF FFFVFFFFFFzFFFlFFFFF|FJFFFFNFFFrFFFFXFF>F0FFbF<FFFFFFbF"F FF^FFFFw F}FtFuFtFFFq`FdFXFRFTpF]HFgFyFxTFFzFmtFyFqFjFqFy@F>F|FFFFFxFFFFwFmFiFiXFiFuFu0FxxF{ F4FFF@FFFFFVFFFFPFF:FPFFF>FFFNFFFFLFFrF2FFFFPFGGEGBGF|FFjFFҖF$FFFF FFfF(FFF*FFFTFFF FfFDF&FF>FFFFNFPF̬FѺFFFFhFfFFdFԶFFFFFFFFF FJFjFFFFFF0FFFFFBFFBFFVF"FŐFFFFrF>F F.FFFFFF~FFFFFxFvF>FFF"FBFFFFF,FFF@FFFVFFFFFFFFFxFFFFFTFF,GF*FdFvF&FxFrFͨFLF|FFbFF>FF8FF$FBFhFFFFFFFPF(FǸFZFFдFFF.FʼF(FtFGbFFF FFFFFFFF"FFpF6FFFtFVF"FFFFNFǠFFFF4F.FͨFƐFFF FƪFfF`FFzFFlFFސF0FxF"FpFlFjFtFzGG{FFF*FFpFlF<FbF|FFF^FFF$FFfF<FFFF FFFF&FFjFFF(F FF FFFFFFjF2FFFVFpFFF@FFFFFFFFFFFFhFF F̌F̢FFTFF~FFF(FFFFݾFFbF<FF2F@FFhG:GFFF~FvF8FFFRFՆFFFFFԀFXFFF׊FҌFnFFFFGNG ,GGrGGGDGGGG G GG dGG GG5F`FFF,FfFFZFLFFΰFFFrFFFFFF"FFF.FRFvF0F"F FFF\FhFFTFFFɢFڎF*FƞFFFFdF@FFF8FlFFFFzFF̼FFGGcG:G/FFDG2FFVFTFFFTF(FFFĄFF0FFF|FFFFbFFFZFFpFRF<FFFFFFFF$F*FRFFzFFbFFFvF̒FɞFdFFFFFF6F.FzFڸFBGGVFF FӘF FXF6FF`F<GFFFިFFjFJFbFFbFnFFFtFTFvFFFRF8FZFFBF(FFZFFvFxFFF>FFܴFF6FFGG GF@FGGcG G GG G GG @G CGG GGFFfFRFVFG1G:G GG%4G!G>GGGFpF>FFFFRF8FFFFF׺FJFFzFFF8FF$FF(FhFFF:FFFzF FFpFFF@FFhFJFšFxFLFFvFvFPFFFЂFFגFF^GGFFFF`FfFFF~F(FBFFFFF"FFFFtF:FnFFˠF,FӄFF؄F.FFFFFFF"FFlFFFFFFFHFF²FFFFF8F"FFFFRFFBFF\FFךFFFfFFhFFxFFFF.FTFڞFƮF\FۄFFF8FFFFDFF`FFFFHFFFFFpFbFFFFF`FFFxFtFFFFFFFF"FNFFF:FFɮF<FFˈFFFFFfF4F&FdGFLG0F|GF FFNF~FnFFFFFFF>FFFhFׄFͪFFtFFF>FF.FF.FFFFF,FjF0FF~FFFF FFFШFкFbFBFFFpFFFF`FFFFFFF>FFdFF}@FnFvXFlF`FY0FX(Ff\Fe|FlFeFkFpFbtFY|F\<FWF_4FYF],F\DF_TFcFiFo FpFw$FoFqhFsFZF>FNF*FVFLFrFFFFFbFFF,FFjFFFFFF>FFFFFĴFFRFFښFFτF@FFF FFFpFѰFF`FFtFPF$FǶF¶FlFF.FF>F|FRFFFFFFFFFFFFFtF~FFXFZFFrF FFFFFF^FFFFFFFZFhFFvF,FFFFFFF\FFFLFFFFLFFtFgFsFn$FsFFFfF@F}DFs0F[4FSFdHFjFFFFF{FF~\F{TFuFvFFFhF"FtFfFFzFFF(F}FrFlHFd|FiTFcFkFq|FbFOFKdFFFSF^FjFqFj|Ff FTFSFMFRxF[FZ0FbF^FVF[FP,FU0F^FrFvFFFFrFFc\F^ FJ(F@dFEFJFUFWFU$F`FadF``FmPFslF|FwFtFo8FmF{FaFXHFY,FWFZFYFUFS,FHFQFIF4F>HFDFGpFLFOFFHFCFI|FF<FIFH|FTFlF~,FFPFTFFFFFFFFHFRF&FFFFzF~FnFlFs$F}FFkFgFi Fp@FzFnFfFjF_`Fi\FWFV4FdFg`F\(FVF\Fb`Fd|FjF_FuFnFv|FFF\FFFF~Fs$Fn F`FYFWF`FfLFZF]Fb$Fy$FrFzF}FjFr|Fn(FiFgFFFFhFFFrFpFVFx,F{|FFdXFfFpF}FFFFzdFkDF^F`F^,Fo,FqFFsFeFaFgDFlF|lFhFfFjFotFmFw8FFFFxFFz4F~FyFmF_HFW FI\FMhFOFPlF[FgF{Fs8FrLFl<FpF{F0F~FwFcFQFJ(FU(FbFuFilFjFN|FGF4F(F&FFF$FF FF|FDFFFF'TF6FEFD<F<F>$F/,F" FFDFFF FFF FFEE8EhFFFtFFF1F=pFKFWF^FU|FLlFG8F_hF`@FWFhpFmFQpF[F<0F!FXFF&F.pFF4FFF|FF44F2\F>FAF1F.`F"FxF0F$FF `FFFFDLF\LFjLFEF=F `F |FF(EE0EXEE`FEEE`EEExEEEhEEPE(EEXE@EEӀEXEpE(FEEPEExEEEE`EXE`EEFFDF FxE`EpEEШEEȐEDDD{D@DDD@DDDD`DDDD@DD DD DD@D@D D@DDDDDDDD D DDDD DDDDD`D`DƀD`D`D D`D`DDD@DD@E PEE E E0DDDD`D΀DހEEE E EPEEEDE`EPEE@E@E EEEEE DD@DޠDD`DD DEEPE EE`DEE EDE`DD`EEEEE$E*E%EEE E`EE`EEE*E= E;E7pE/pE+E2E5E7E:PECPE8EEEOEIEJE8E,E(E+PE1E1`E5@ECpEDEHEFEWPE_@EHEVEMEe`EhEnEvPExEtE}PEE|Ek@Ec@EnEkEdE]E_ EZE]EkEmEcpEf0EopElE{Ey`EEPEEhE`EHEEXE`EE(EEEy@EhE^PEcEnEdEuEhEtPEdEnEo EtpEE@EEE0E0E{@EyE}`EEEEE EE(EE0EhE8EEEEE0EEEE8EpEHEEEEEEE8EEE0EHEEEEEEXEEEEE(E@EE`EhEEEEEpEHEE EE@EEEEhE0EEEEEEEEEEĸEʈE(E@E E0EEhE@E8EhEEExEXEExEF$FFFF8FlF $FFFFlFxFEEE0E(EE0EEEhE@EEE8EEFEPE0EEEE`EpEEEӘEE EˈEEEhEHEhEHEPEEEEڸEEEHE E8E E8EEFFFpF#dF.(F20F-xF!FF FFFHF FF3F#|FFF FFFFFHF&F<,FDF@FCFBhFBFE`F;LF1F,TF#F"F& F' F+F6hF@PF>FI`FKFMtFPHF?F:|F+|F#FF@F<F F F <F xF FFF0F!FF%`F3FBTFJXFUFWFLF84F,F'F$dFF F@F',F'F*F&F%F(tF#FF"F&F(F)lF(F9DFK\FXFIF@F@TFPF_8F^dFcFhFYFP(FKFJXFFF7hF-F0,F0\F5|F4 F@DF;F@HFGF;FGF9F(PF,xF0PF3dFAFNF]FiTFvFFFF(FxFaFhFoFt8FnFmFbHFc|FfFa4FfFcF[F^FaFNDFBFGFN<FYHF_FkdFk FfFm|FmFZFV(FZ8F[dFfF`FVF] F_Fh`F_8FTFOFTFMF?FAXFM$FZlF^F]FZHFTF\F\FYtFS8FV Fg F]FQFVFJ0FHFGFHFTFaFrFy,FspF FF~FrFF:FFFFbFFF|HF"F>FFF`F6FFFFfF(F@FFF4FFFFvF@F2FFFFF$F$FnF~FFrFDFFFF,F|4F0F F|F{F FFFFFFFrFoFxHFwFjFkFpFwFHFlFhPFP|FL FJ,FQFa|FgFsFv\FxFl4FmF`FYF^\FkF~FpFFlFDFtFk|FdFcPFg8FfFYFYFUFTF\F]FaFgFyFF}dF~Fy@FFFpFFFFFF FF:FFFFFxFFxFFFFnFFhF F\FFFFFnFF$F@FF FFBFxF6FɠFFnF2FF^F~FFFF~FFFFFXFȺFFFFFFFFLjFFɄFԈFpFHFFFNFFľF̨FΜFFʢF`FהFȒFFDFFVF FFFFFFzFhF\FFFJF8FFFFhF~FFFF F@FFFF>FtFFzFFF>FZFFFÐFFF>FF`G GFFؠFFFFFFzFFZFFvFF@FF2FFFFFٔFFrF$FlFxF$F˜FFF2FFF$FFF՜FFFvFFFXFFмF0FlFFFFF(FFrF~FFΎF~FFFjFFF>FFؼFFʠFF$FþFDFZFӸFFˮFFVFtFdFFFFF,F.F(FFFĢFFFάFFFFfFFFFFNFFtFǀFΔFFvFהF޲FzFGjGGZGBFFFFǸFFFBF"FFFFFFF FF0F|FFF}8F:F"F|F"FFvFfFFFpFF|FF6FFF>FFFF~FFF FFXFFFF@FrFFF\F|FFFFFFFF2F:FֆFzFrFNFrFxFFFܚF^FҔFFFFFٞFFvFӄFXFFjFϴFFвF2FJFFܚFFFdFFFFFFƊFDF4FFFFF׌F٨FrFF:GGyGTGGG ZG GGwGwGG GGGGFFFŔFBFFF$FRFFFFPFF*FTFFFFF~FFF(FZF(FFFF:FF4FF~FFFDFFFF,FJFF^FLFFF^FfF FFFFF,F&FGGFFFFFFF FFҮFF FFFFFFFFPFFFFFbFxFbFFF0FFRFFFF\F@FFFJFFF8FFZFFɮFFȚFȄF2FbF.FF0F̈́FdFF,FFF<FNFF޺FfFTFFFFF\F FFF@FFnF4FǎFvFFPFʞFpFF\F0F۠F$FF*FFԦFPF6F>FFBFRFFPFܦF٬FF4F6FFF8FFXFFFHFтF(FfFFVFF GFfFG XGGGF|GFFfFFG%G =GGlG GcFFFFFhFѸFrFFFތF֐FdF֐FFдF݊FF*FFFFFFDFFnFFFFFFF4F\FFF@FFFFnFFFF:FFDFFF,FFFFԬF@F F,FFFƬF@F8FFFNFFhFFFFFBFFBFFFFRF´FFFFDFLFLFFFFzFFFFrFxF*FFFFFLFFFFFjFF,F<F|FFFnFFlFFFFF2FFFܘFjFњFvFBF0FtF2FFF FFF&FFFFF~FFxFFF:FFF FFZFFזFFFתFFFF`FFFyFtFr4FxFzFlFFF FFFFHFFFFFFFFFXFnFŸFŖFF,FFFFXF FF0FTF6FFFF2F̄FFFFFXFFFFFFFFFHFFFFFFfFF(FFpFRFFpFFFhFFFZFFpFFFBFFFFFFF:FFFFrF\F@FFDFHFFyFn Ff\FiFZFT,FSF^FhFZF[F]FfFV(FMFNFT FU\FWF`FWF]FbFfhF^F[F`FbTFcDFgPFixFyFFJF^F6FFFBFbFDF~FpFFFFF^F2F~FF0FFFFxFfFFFFFF4F>FFF FFF0FFFdFHFvFFrFZFۨFǚF&FF`F$F6FFFFbFZFrFFFFFtFzFrFxFvFF<FFFNFFVFFFFFFFJF~FF@FFvF`FBFFFFFRFDFFF*FFF F FFlF^FvFFFFy\FpFoFfFhFLFyxFFF(FFy@Ft4FFhF<FFFbF{FpTF|dFlF}FFZFVFFFPF|FfF@FtFF<FFfFiFcFjF^Ff$FYXFTFS(FMFVFatFkFmF_dFKFMFBXFKFMFL`FP<FUFCFKFTFNFJDFMHFfFFv(FFFyFc\FzFaFRFQLFRxFPFXF`FeXFcF\FbFhFsFyFm FwFk8Fs<FoFdFe(FcpFfF{8FqPFgDFPTFFFLFFFAHFBHFExFShFShFQPFGFD8FKFEFD@FCFQ0F{FFFhFFFFFF^FF`FFXFFF`FVFF8FnFlFkpFcFgFgFb<FkFnFnFgF[F^F]Ff\FYLFMHFNDF]F\HF[F[F\FbFpF{FFjFFFhF$FhF|F~`FFF~HFcF[FgxFrFtFlFjlFw$FFDFFFsFr\FehF,F<F~tFF|4FF FzHFF~F~PFFPFx@FtxFsF}hFF2FvFF`FlFwFF{FnFnFkFY FPFUFXF`Fl,Fv(FlFzxFz$FuFFFFF~FFqFvFs FFlDFlhFVdFfF[FtFFspFxFFvF:FFFdFFRF2FFyHF{FfFoFytFsFqF[dFLFEF@F,F+FhFxFFFFFF$F)pF1FEF]FTFX|FGlFGF4F)FF`FFFtF@FFFF,E@FtF (FF\F#8F6FOF^FuTFyFF0FtFkFmFhFwlFFF`FtF>LF(tF+F.HF0$F3F*F+F! FF*F4lFIF^HFWXFOFNF=(F0F.pF,F`FF8F8FF"FIdFCF6DF&F)FF@EXFEPEEFFFhEpEEE EEXE EE0EEͨEpEHE٠EʸEEhEF FFF8F@FE8E0EȠE`E(EE8ĘEݨEEFExEE0EpEPEhE(EDDDD@D@DD D`DDD DDD`D DDDDDDDDDDD DD@DD`DDDDDDDD DDD DDǠD€D@DD DDDDD@D`DEE0E 0DDD`D@D@DD`DDDD@EpE pEEED`D@EE EE E0EE EEDDD D D D`DDD@EEEpE @EED@DDDD@DED@E E`EE(E$`E"E*pE EE! EEE0EpE'E,E8E4E0E2pE4E4`E=EH`EFE?ES0EEEJECE?E3E&E2E#E3E.E9E?PEGES ES0E[`EaEUEWEZEm EnpEtpExEE~ErEwEh`E^E^0EpElEe0EYpETEd@EbE`Eh EbEiPErpEq Ev@ErExEhEEEExEEExEEEPElPE_pEaE^ Ed Ed0EcEjElEmPElEcEn@ExpEEEE EPE~`EzEEEEEEEEEEEPEPEEEEHEEPEEEEEEEEEE0EEEEE(EEEEPEEEPExEExE EXEE@EEEEEEE EXEEEXE EEEEPEEEEEEXE8E(E`EEpEEEpEˈE`EҰEEϰEEhEHEhE8EʐEE0E EFDEEFHF<FFFFFhEEEE EExE EEE`EEEEEݨEڠEߨE8EEHEE(EEEPE8EHEEpEEEpE`EEEXEEE`E¨EhEE EhE(EE0EEEPE@FHFFFFF)|F- F!FFFF@FhF 4FF4FFpFFF0FTF PFFF#F)F.(F7F0F3tF<F1$F1F*FFFFFF%F'@F0F1F5FB@FADFDF< F/,F#FTFFF FF FFF FF ,FF F!F&LF'F4(F@FGFIFH@F;F*F"F \FFFLFFFXFFF dFF FF|FF(F5F@FCFSFZXFAFBFE FPpFRFZFZFX\FNF?F:F> F0F&F!tF F'F F-(F%F(F)PF7F9F7F.<F)F" F"lF*F<FPPFRF]FnFx|FFFqFdFWFP(F[hF\4FXFXPFOFO FW@F[xFUFPFNFR FNFAFF\FK0FM\FUFQhFRFUFNFSFJtFCF?F@FCFGxFCFJFMxFXhFQF[<FMDFE@FC<F:F3F9DF?@FOFV\FP|FJHFJxFOTFX`FTF]@FYF_4FTFQFFFCdFDF?8FH\FQFbFkFqFwFXF`FFPFRFFFnF@FRF0FFFFFFBFFrFF*FfFFFFFLF>FFFFFPFNFfFFFFZFF FFFFFF~<FyFqFxFvFyFphFq|FuF(F|,FnFFzdFsFr4FmDFwFqFqFmFg,Fm0F]HFX(FI0FFFFFOFPpFYFdFcFs0FedF\(FYFUFOLFbFiFtFpF\F~\Fv\FhF^FPFSFXFNFKFDFFFIFCFKLFWxFb$FoFoLFgFgFdF|F<F2FFFFFFF|F{FFFFtF&F FFnFF(FFFFFFF|FFF F*FzFHFFFVFFhFFF|FFFFFtFF|FFlFFFF4FdF(FF.FbFdFF|FFlF|FFFFFFFFFFPF*FlFFF~FFFFF\FFFFFF\F|PFuFtPF4FFFRFF|FFVFFFZF6F<F:FfF<FTF>FFFFFFFFFFFFtFFFF F GGGIFFF6FFVFRFFFFtFpF>FFF<FFbFbF`FFІF\FǜFlFˬFFFHFFFFFlFFFۖFђFFF`FРFFFܦFҾFFF@FFvFFDFF&FȶFFF(FFFFTF8F^FFFzFƆF˜FF$FF>FƦFF0FFZF|FF FFFFFFÌFFFFFPFFJFDF0FtFFFFbFFtF|FFƼFFǪFFvF>FFGGGFHFBF̀FFF,FFFZFF.FFFFFFFFFz@FyFtFxFxFFnFFF`FFFpFFF FFpFlFFFFFLFFdF`F"FFFF\FRFF|F:FFF`F$FBFFFFfFFڜFFFFFF`FFҖF~FFFFFlFFFFF<FFfFFFƖFֺFҼFFFjFFNFFF^FFTFFFF^F|FFbF>FFHFPGGFFFF0FrG/GJGGUGaGGoG FF@FφFNFFRF FF`FFFxFHFhFJFF2FFF~FVFFFF.FVFFFhFFzFFF0FbFdFF,FFFVFJF>FFF.FFF FF\FFFFF.FŦFFRFFVF4F"FFFFpFZFFtFFFFFF0FF^FF4FFFpF*FFFF6FFFFtF~FFF|F6FFFκFzFǶFFFF˜FlFJFFDFFFFNFFFF"FF:FFF(FFFF4FFFFFFFFFNFHF|F<FFF&F²FVFӚFFԠFRFFF<F`FF˚FJFVFFFFFªFvFVFJFFFtFFFFۊFFFFF0FFќF.FFFFGpG GOGRGF|F6FlFFFG}G[FFFFFfFFFXFFFBFF2FFjFbFFFȰFFvFFFzF.FFhFF*F6F FFFFF FHFFDFtFFFFFFF^FZFZFF8FFFFFFFzF͠FfFpF FFFF FFF.FFFFFRFzFF$F.FFFFF F FbFFFFNFFF~FFXFFFFFvFFFFjFFLFFxFFF^FFHFPFFF.FFhFFFFF&FF<F8FFFFFTFDFtFF:F`FFNFFFFFFFFFFFFF`FF$FFdFFFFFFF FFF}Fv0FmFw,FFFFFFFFFFlFF>FFF4FFBFFFvFF^FFFTFF~F2FFFfFLFFFFFFpFFFFFFFfFfFpFtFFtFFF4FFLFFpFFFFpFFF|FFFF\F^FFFFFFFFfFFFF F}FFpFFFFFvFF|FpFiFdTFaF]F]DF`FjF[F`Fd|FjF[TFXFYFS8FX(FW|F[F\LFbFcF]<FXFdFYFXFZTFYFbFhFnFFF.F*FpFFF0F8F8F8FNFF,FfFF6F.FRFFFF>FFFĀFľFTFȤFFfFFFFF FFF@FFlFFbFF^FFtFFhF(FF F$FPF6FF"FFpFFFFvFoDFmFiFpF~FFFZFFZF FFLFFFFsxFwFmFzF{FxFxHFFFFPFFF@F~FdF FFF8FFF6FFFFF0FjF}FF8F}F*FFFFFJFFdFFFpFFXFFFFFFxFyLFzFFFFF&FFFFnFFvFF>FiFb4FfF^F[FQxFWFSFUF\PFaFaFqFZFUFKFHFIFNFDDFMFE0FDFL0FPFV|FTFU Fb@FfFrFFeF\pFb4FdF^FdFZFdFjFe0Ff FihFaFXFXFj4Fj FtLFmTFnFwlFlFrFuFwFsdF<FFF~hFfFPFHdFHFB(FEFLlFJFPFSFN,FQ,FQFThFV FM4FQFkhFFZFFhFrFF\FxF$FFFFFF*FFBFFFFv\FsF[FbTFfFf0FhFdFopFeFVFWXF\F`Fc0F^`FWFbTFbFaFpLFoFntFRFFFFFFvFuF FF}FFFFF{F*FF(FXFzFRFFFFFvtFlFnFF|FFLF`FF(FFFF|FF2F~FFuF{Fo FxFLFbFDF FFFFF4FbFmFa FZxFc\FvFvFtpF2FFF$F>FFFFXFFyF~$F~pFFF{4FzPFr4FyFFFF.FF8F^F F6FFFFF@FF F.FRFF$FFrFbFrpFX(FCF>LF.F xF`FFdF`FxF#F*FJFZXFeFedFi`F`FHF>@F6F FF"F!$F'lF'|F*FFFhF 0F FFF@F58FYFwFFFFjFnFZF~TFsF(FHFxFsFqFkFiFPFH8FBF@FGFOF3F*dF/\F+FF;F9F:F=tF;8F:FFDFA FE$F=F5F?<F,F&F'F&8F0HF1F?dFEFEhF;hFEFO,F<F:F5,F-F)F2F6F?F>FBPF?FAFD$FJ$FYpFXFXdFRFBF@ F>F8F:hF>FFFJF\F_FnHFtTFt(FFFF|Ft FtFyF{\FxF{FFyFxFuFsFFF2FhFFF"F6FFFF,FvFFFFFPFFxDFBFFFF FxFzFwFsFqPFehF`FfFdF`dFbFpFs`Fs FkFwXFk FiFh(FmFp(FtFiF`FSFZFTFMFI0FGFGFExFGtFRFWF^FcDFbF]FW|FP4FKFMFZ`Fd FjPFkFsFv<FcFPFCF?FCFKF?,F:F: F1F=FDFCFT<FZXFUFVF_$FQF^FmFlFqXF}(FZFJF|FrFlFgFmFwhFFFFF~FFtFF"FFFdFHFhFFxF(F<FF0FFPFVF^F@F,FFF8FFVFFF2F~FPFF"FFLFFFFXFF,FFFF2F8FFFFFF@FDFFFFZF4FFFFF F<FF{DFvFwFnFzDFs\FgFgFeF]HFeFrF~ FFlF.FF6FZF<FXFFFFFDF$F6FF<F,FnFFF@FFFFFFFF`F`FGF8FFˤFFDFF.F\FRFF@FvFFrF>FpFFZF"FFpF@FFFF~FVFFFFJF,FFШFθF̈FdFF<FF\FFʆFNJF:FlFDFFlFFFF~FlFBFFFnFFlFF:FFކFF:FFpFFF@F`FnFFFBF~FF@FvFFFFFFXFFPFhFƄFF٢FFF FFFFF8FFFFbF@FĒFF6FF̜FFFFFF~FF͌FF~FF*FFFFFfFFFFFF\FtFmFiFaFe,FjFq4FrFFF6FF6F FXFPF2FFFFFFFFF\F~FFFFF^FFFnFFFBFFFFRFFF&FF<FFFF FFFJFTFƐFF(FxFFFFtFF(FFFF@FFF<FFîFF>FFFFFFFF&FF,FF@FFFFFFFpF`FPFF*FFFߐF&FjFFFFGiG_FF<FrF(FFFFFFFFTF>FPFF"F2FHFFFLFjFjFFFvFFFFFFFFF FF8FFXFF0FFF>FFPFFFFF(F"F^FFFFFF0F̔F2FzFF`F F$FF<FF FlFF6FtFFzF0F~|FwFF$FFFFFjFĄF F$FFFFFFJF6F|FFF~FFhFXF|FF4FF^FFFFF(F@FRF$F8FFFFFVFFTFFFRFlFrFøF&FFFVFdFFFF(F(FFDFFFFàFFŘF͚FƀF.FPF<F8FFFÆFȐFF$FhF>FFxFFFFFFfFvFFFFFHFrF@FFNFVFFF FGFtF>FFFF FFF FFFF4FNF<FFF(FFªFnF͠FFHFFFFFF\FF@FFFNFXF.FFLF.FFFFPFNFFF\FFFFFtF FFFF FTFF8FFBFFFPFFXFF(FFFF&FjFrF&F~FFFFNF8F~F"FFFF~FFFFFFFFFFF0FNFFFFFFF(FFbFFHF&FpFFFFF.F2FFJF>FFFNFFFPFFFFFTFFTFhFzFFF$FFFFFfFFlFFTFFFFF<FFFFF(FF:FFFFFFlFFDFFFzFu(Fw4FFpF|FVFFFLFrF|F|FF4FFFFFF*FpFBFFF$FFFFFZF(FlFFF FFFFFFRFFFFF FF F(F`FjFFF:FFڎFƤFdFFFFFFFnFFvF.FF F\F*F*FzF\FF>FF&FpF$FFFF~F{FFdFFFFFF{0FqFrPFcTF^8FbFdFqFhFpFqFpFkXFcxFWF^Fa|FcF](F^DFcXF`FdpFbFcFg|Fc<F^8F]FbFhFjhFwF}HFyFFFFFF4F"FF8FFFF`FFXFFFFFFFnFFRFTFFvFdFlFPFFFFFF<FFFPFF FHFtFFFFFFFFäFVFFFFzFFHFFwFtDFiFlDFfFrFvLF}FFFFJFFFTF~FwFjF`Fn$FgFmFqFF FF|FF>FF(FF8F`FF\FF>FFdFF4FFxFF\FFFpFFFDFFFF<FFFFFFFFrFfFxFF*FFFF6FFFXF4FhFF~FFFFF0FzFc FcF]pFZxFZFgFoFFqFj4FbF_,FQlFKPFHxFQDFWHFQFSdFJFD(FM FW$FYFaFuDFxFgFjFmF_FUFZHFXDF^<F_FbpFgFf$FmFrFfFf FfF`FjFeFkFv<F}F{FsFvLFuFvFBFFFFtFiFaFUhFEFG\FSFLFTFP|FSXFRFUF_LF\@FahFbFeFeFpFFFFFFbF`FFFFF*FFbFFFF\F&F~FxFuFf FjtFtFmFpFl,F`FcHFmFmFkFhFmF{FBF,FF2FFFdFF<FFPFLFFFF6FFXFFFF,FF6FFFbFFFFFFqFtHF$F\FFFZF`FFF$FRF~FFFF~HFlFFr(FiFq FFFFFFF F"FF,FFoFiFjFFzFjF@F"F^FpF FZF~FFFFFFFw@FPFFFFrF(FJFFF(F,FzFF^FFFF.FFFFFFFFF~FnF}@FzdF[FLF?F*F$F!DF`FFF 8F6@FFF]hFh<Fj FpFUFBF?F2F' F&tF$F%F7F9LF(F'F F0FFFLFF.FJFcFRFFFFFF.F FFFxhFoFvFTDFMFHFLFeFX,FVFKtFD F\@FFF?`FOFg,FhFlFU8FYFIFJF?F2F=hF5FRF:`F9F3F!FF FF#DF%F FLFEF`FFdF#F"FF&@F`F FEEEEEEFHFlFxEFF'FF8F>FJF8FF HFPFExEE(EE0EÈEְEEF0F<FxF(FFE(E EDDDD`DDD@DDD DD@DDD D`D`DD@DDDDDD DDDDDDDD D@DD@D`DDDDDDD@DD`D@DDD`D@DD@D`DDD D DD D D D D D۠DDE `E E`E@EDDDD D@E E EEEE D@DDE EPD`D@DDDEEEEEE E`DDDDE0E E @EEpE`EE0EEEEEEpEEE EE+0E>E/pE, E(pE9PE>EBELEQPEYEVEYELE3E3E3E1E7`E<E:E6 ECEQEFPEIE[ESEcE`0E^pE^E]EqEwPErpEE EtEo0E`E[E]E_Ei0EePE[ESEWEWEg0EcEkpEe@E\EoEuPEEPEPEhEE|EPEz Eq0EgEvEyEnPEkPEiEcEZPEiEhEnEjEx`EjEr@EiEbE`EkEtPE}PEPEExEXEEEE`EEEEhExE EEPEEhEE8EpEEEE`EE(EEEEEEEE0E`EEEE0EE EEEEEhEE(E@EE(EEEEEhEPEEEhEEEEEEE@EEEHEEEEXEHE EEPEHEEEEEEEPEEňEʀE˸EEEEԨEExEEExEpEEEE`EEEpE`E@E͘EEHEPE8EHE0E(EèEEEøEEEEEhEEEE@E0EHE(EHEEXEEEE ExEEEEEEEEͰEEبE܈EEExEExEXE8FFFLF FFFFFLFFHFtF F FFFFtF|FEHFpFFFFF!@F,F&HF.F-F$tFF FxF F FFFF FPFFF`FFFFF LFF FFFEFFlF LFF FFdFFtF# F.|F0(F-8F(F'XF#FdFhFF TF FFF`F F 4F FFF FF'F-pF5LF8F6dFH4FFXF=TF/F$FFDF&F.F0F%@FFdFFFxFHFFFFFPFLFF&F%XFFF8F DF F@F+`F0F7HF=FN FR,FZFiF[FHF8dF1F/F4F2tF:F-,F'XF#F*$F%F'0F)F,F-F1xF)F)\F5F;F5F:tF-,F+$F)F) F F,FFF&F0F=(F;8F@DF;dFBF:F7F4`F*F*HF%0F&F,F0F2 F1F7F1FAlFGxFTPFLFDFB$FC<F4F/dF1F2DF9F=`FNF^\Fd<FcF^Fz\F}F| Fn$FtFhpFhDFf F^FjFiFhF`F[Fa0FlF|FFFFFBF>FFFFNFFFFRFFtFtFfF{4FFFF|Fw,FpTFnFiFd\FdFXDF\XF_FeFZFY(FhFtF`F`lF`TF^tFaFjFmFvPF_F^FVFQFMFLdFEFDF?F@FD0FE FQFUF[LFVF[tFFFGFBFB@FPFXFUFX Fe(FclFVFHF3F2F1F6TF5F6hF2XF2(F3<F9F<FFFCFJFQxF\F^FWHFYF^xF\tFcFmdFjFtFs(Fc<F^FrFnFnFmFjFspFtFyFwFsFv Fp Fx$FFFTFFNFFFFhFpFdFvF^FFF6FzFPFPFF~FhLFpFuFqFyFvFFFF<FFNFFFjFFFFJFFzF FFFFFFnF FFF>FVFXF|F(FF0FFjFWFNdFSFSFTFSHFL(FPFKFJFRFYFeDFqFv\FF<FFFuFu@FFFF6F~,FFFF"F|FFFF.F>FFlFFFFFFަFHFFFtFNFFFDFfFVFFF^FpFFFF&F~FTFF$FFFFNFFF"FFVFFFFFxFjF2FFTFzFFFFFLF(FϢFhF^F8FFFTFFFPFFpF FhFF`FPFFFFFFLFFFFF.F0FF`FFF`F@FF^FPFFjFF&F FFRFʌFFFlFF,FFhFFFFFF"FvFHFFFFÊF`F˴FޖFRFF>FаFπF`F"F0FFFF(FJFFFlFTFFFuFmFbFWFXF\F_pF]FZFjFw4FFF"FFFF`FFFFF.F FFFFuFsFoFrF~<F|lFFFFXFFFFbFFF^FFFFFfF׮FJFhF6FHFFFXFFFF&FtFF8FvFF@FFFFJFFFFxFFF$FF^FFFFFpFFFFFXFFFFF8FFFŞFFnF(FFȖFfFFFFFF܎FFFFFFFFrFzFF>FFXFFF:FFF6FF>FFFFDFtFNFRFFFF@FzFzhFFFFFPFF\FFpFF}FvFFFFFTFPFFFzFFF FF FHF\FFFFFFFdFFFFFFVFFFFFFrFiFvF@FFFFFFF4FF,FFFtFFNFFFFFFFBFzFFLFF8FFFFFFZF8FFfFFFFpFF"FFFFF(F6FFFFF|FFFFFlFF>F`FFFFFFFrF:FļFFrFFFFFbFrFFFF*FFF|FF@FF$FLF0FFFrFFFbFFFF"F\F^F.F*GCG kFFFF~FFGF"FFNFȂFFF\FF6F(FFFFLFFhFZFF8FFFFrF`FF@F4F&FFBFFFFHF FFDF*FTF`FFFbFFXFxF"FFFFBFF FFFVFFLFFņFFFF,FFF>FFF`FlFF*F$FF2FFFFRFFF FFFzF@FrFFvF"FFFFF0FFxFFBFnF.FFFFhFFFFFpFFF}FFxF FFF<F4FFzFFFFF&FFFFDFFZF0FFnFtFFFFFFjFdFFFFFLFF@F(FFFFFdFpFdF&FFFzFXFFF,FFFFF@FxF*FFFFFvFFFFF*FfFFFTFFFFFFjFF(FF2F\FpFFFFFFXF(FFFFF8FFFFFFFXFFFXFF&F"FFF6FF>FRFF^FFFF2FlFFFFFF2FFFFFFFnFwXFXFFrFF}8FDF~F{xFkFkTFc(FgFm<FoFpFiFrxFnlFcFh8FeFglFdFeFkFg|FmlFhFq(FtFp|Fv Fx,F}FoTFnxFiFlpFyFzFtFHFFFFFJFF>FHFFF6FFJFFFPFFFpFF˘FF"F\F߆FԐFDFFFFvFFBFFF2FnFFFF~FFfFFFFBFFFFFFFZFFFjFFFXF~FxFqFi|FhFlFFTFFF@F\FFF|xFidF`FaFiFnFsFFfFFFFF:FFHFTFBFFFFF(FFFFdFFFFFFFbF:FFzFFFF(F F>FFFHF@F2F`FFFFFF8FFFlF"FFFFFFdFFfF@FF|PFhFdF`FctFdFfFudFF}Fr,FaFR<FIlFAdFGFNdFUF_dFUFWF]$FYFeFeFuFt@F~xFFzFmFm(F\FVFWFaFm\Fp0FhFk@FttFkTFpFgFk(FuFl Fm(FvLF|F<FF|Fq4F|FF&FFF Fx`Fh<FYFRFQ FVpFY\FVLF^<F_\FfFapFo$FmFvFnFnFyFpFFFFF4FFLFF4FF0F6FFFFFFF*FFFFFFDFfFvFkFd`F_dFxFFzFxFFFFFjFF~FFFFF:FFFF FFFFFFFFFDFFFFFFFFFFFF,FF2FFfFFBFFFFFFFrFDFFFFHFnFyF4FFFFlFFRF~FFFFFnFF>FFhFF4FFF<F`FŤFFFæFFFFHF~FFFFdFXFVFF:FFFFFFFlF|FFpFFvFFFFFTFFFFu0FjF^hFCF3F3F%F%XF"F%HF)hF=FSF[Fs FiFkFXFNF>F2F1F7$F=xF=\F>F<@F3F.4F2F*@F0F=<F4 F+F9FLTFW,F6FwFyFFzFFVFFxF@FwFnF]FMFNlFAFKFHhFUF`FiFfFgFZXF_hF[@Fi`FkFZlFdFRFNF`FBF=FB$FHxFFFDtFF)\F-`F9F9F=F"FFLF F#F,F9F+F. F3(F,F)@F FE`EEE0FFFFFFFF/F+FPF@FClF.F ,FF ,F<FF0FEE@EEHEEFFDFFTF 0EEXE8EpD|@D|@D}DyDDDD`DD`D`DD@DDDDDD DDDDDD`DDD D D`D`DDD@D@DD@D@DDDD@DDDDD DDԀD`D`DDD DDDD`D@DDـDD`DЀDDD`DEEEEEDDED`EEEE E E pEE0EEpE@EDDDEPE EEEpEE@EEE0DE EEEE E EE pE EEE E@EEE0EpEEpEE2E/E/E!E+EBEGEDELE^E]EQEXE3E3E1pE8E?EIEAEFEAEKEHEH@EPELEWEZEWEaEiEt0EzEtEiExEt`EfEeE]E\EePE`@EjEgEWEVPEc EgEmEiEbE^EePEnEzEE EPEEEtE{pEnEpEfEp EnEbE[EdEhpEgPEh@El`EuExEu Eq EvEpEq@ElEoEtEEEEHEExEEEpEEEEEEHEEEEE E@EE0EpEEEEEEEExEE EHEE`E@E`EEEEEEE`EEXEEE EhE8EEEEpEEEE(ExE`EXEEEEEE0EpEPEEEhEEE E(EEEEhEEEE`EEưÈEEXExExEEҸEېE@EHEވEEE׀E@EEHEEڨEEϰEʠEEEpEEhEHExEEEØEPE(EEEEPEEEEEEE`EpEEEEE EEEEEhEEE€EȘEE`EҨEӈEEExEEXE`E0EFF F F F F\FF8EEFFF FFDFF FF EE FFFF\FFFF F"$F!PFFF F`FF \FF pFFFFFFXFFF FFTF F F4FFEFFFEPEFF FFFF,F"F"FFFF F FF dFF|FFFHFdFFF FHFF&F-F3F3@F9`F@F6F*XF$FpFFF F F TFF$FF hFFFFFFFF FFFFFLFF ,F(F FF/F/F9FDFHlFIFKFYFU4F5F,F.F'F#8F&tF'lFlFLFFFFF\F,FFFpF&F2F/XF%F&F#FFFF(F FFF"LF/(F4F9F9F8F7F+F*F(FFXFFF!F"F'F&<F-XF2F;FJdFEF?dF=F:F7F,F6 F4F3F0FAFIhFQFR\FTFYFgFhFdF_FXtFVF\0FU4FTF_Fb`FWFLF[tFb FbFpLF<FFzFFFhFtFZFVFnFF}F\F`FFnFdFjF0FTFFuF`F^F[F^ F[8FXHFILFG,FTFQFPFH$FYF`XF`F\F],FU,F[FhF`F[FZFZFUTFQFKFBF8LF=TF=F<F:F;`FALFLFOFJ FIF>F;@F;|F4HF;FEdFHTFBFKFLFDF=F,xF&TF'F*|F/F-F1PF,F)F)0F,,F1F8,F@,FJFK@FOFMFHFJ FPFU4FUF\<FrFrFeF^FgFoFnFt@F{dFzFqFoPFkFm$FbFVXFX`F`TFkFpFrhFfLFtFFFFzFF*FfFFFBFFr0FtFgFfFZFlFrFqF|F4FyFFFFNFFFFFFFFFF2FFFbFFFF~FFF(FzFuFxFmPFpFkFf0FX FJF?dF<,F@FCdF<FDF;F>F7 F8F>FDFO|FNhFZHF]`FcdFdpF^F\FdFnFhFsFnFyFyFyF|DFvFtpFxFzFyFzFFFNFFFFFrFÄFFTFFFhFfFFF*FPFFFLF,FF} FF|FTFFFFFFFF4FFFFF.FFFPFFF@FLF^FFFdF^F"F4FFFbF FFJFFFbFRFFfFFF$FbFFFFPFFFFF F*FFF"FFFrFFFF<FFFFFFF F FFtFNFǢFFFF~FFFFZFFFF$FFFFFFRFF4FnFܞFɜFFFFhFFJF8FFF@F8F:FFjF|FsFpFgFZFTFVFL0FEFIFUFaFcFvTFBFFhFhFFFFHF\F4F~F\FZFzFjF_0Fb\FhFlpFlFoFx F{FFFF@F~FF6FFFRFlFFbF$FF>FF<F`FɴFvF.FDF\FFFF>FFFF`FF8F$FFF`F\FZFF(FRF>FFF|FFFFFxFF4FFFFFRFFFPFDFǔFLFJFxFFF*FFFFF"FFȀFFZFFFFFFFFF@F(FF{PFrFqtF}FFrFFFFdF\FFF@FpFuxFuLFrFxFpFjxFsFlFxFZFstFi(Fs@FwlFu8F{FFF~F~FFFFFFFFFbFZFFFFFFfFF~FF4FJFFqFu|FuFxFh`FiFnFqDFFlF<FF~FF$FFF~FbF<FFvFFF6F FF>FxF0FFFRFRF(FFfFFFF&FFFFFFFF`FFFFFzFFvFDFlFDFFFHFFFFFFFTFFF$FFbFFfFnFFF6FJF*F~FPF4FtFF<FFFJFFdFF<FlFFFFFFFFFFtFFFFڰFFGeF2FDFԪFFFdG BFFF.FFFFF4FFFFdFXFFFFFFFdFFFFFFHF0F FFzFFbFFXFtFvFv(F.FFBFF@FFF FFF FFFFF(FlFFbFFFFFFvFFFF^FFZFF~FFPFFFFFtFZFFFF F^FhFFF0FFF2FFZFFFFFF&FFDFbFtFFFFF|F(F$FJFF.FF(F0F|FFRFFF*FfFFF,FF|F| FFF{FhFFF*FFRFFFJFFJFJFFFz FxFxFFF0FFFFF<FFFFFF|FFF>FrFtFlFDFF FFFFFFFFF\FFFFF2FFFFFFVF4FFRFFRFHF4F`FFF^FFFFtFFFFF~LFFFJFFZF.FFF&FَFrFF(FjFFrFFFTFFFF$FFFFFFRFFF F<FF~FF FXFFzFfFPFvFF^FF:FFFzFFpFjtFnFiFnFm8Fl0FwXFF~FsTFxFuFqHFk<FeFiFnFplFhFqFzF&FFFFJF~F~dFtFsFzPFlFF*FpFF^FFF&FFRFF&FFFF$F<FF>FFF.FFVFF2F8FFFFfFvFFbFFFhF FFhFFFFFFFFFxFLFFFFFFFFpFFF\FFFu$FwFkFfLFttFF4FNFFFXFFbFFFktFlPFx F~ F FFFLF~F,FBFPFFF8FTFPF\F<FFFFFFF2FtFF.FFfFFFFFǴFFFFXFF(F(F4F0FFFFFhFFF|FzFF0FFF|FdFFFFhFFFFF}FrFqFtFsFtFxFuF"FvFeFWFKdFOFIFQ4FU4FV0F[FhFnF{FBFFFFFFF}dFuFzFeFY FbDFmLFpFb8F`Fk,FrF^F^`FbFiFrFqtF~FFF&FF FFFF~FFFFFNFrFfFdF_\FeFgFqFs8FlF}`FFF|\FxF}pFDF$FFFF*FFF"F0FFF<F.FFFFΨFՊFF2FdFF6FFnFFFF~FFnFs FyFFFFFFFVF6F@FBF8FF FXFNFFFИF F^FDF8FFFFPF*FhF FFFZFFNFFFFFFFDFFFFF˪FF8FF"F6FFFF>FRFF.FRFFF@FFVFFFFFzFFxF>FFFxFjFFFtF&FF|FF$FFRFFFfFrFFFFFXF&FlFF2FFF,FTFFVF`FFFFF(FjF"FdFnFFFPF\FFFtFg$FSFDLFDF6F0F+F3TF78FBFQ`FX4FXFiFrFPFE$FJF=4FE8FIhF[xFLFKF=F8lF5F6F5pFHFD$F?tFHF<FEhF^FndF|FFFFFFTFF"F2FcFQ`FJ0F=@F:(FA\FLF^hFnLFrFx|F}F:FsF}4F}HFrFtFrF`Fo FnFjFSFFpFEF;FCFLFDFpFWFAFHF@FGFEF/LF FF F4|F7XFIFFF9|F6F#|F"8FF FEEFFFFF(FFLFF=F64FHDF7F#FFFFTF$F 0F(F EpEEEEF F.`F$FFEEEEEҨDDD`D DDDDD D@D DD@DD@DDD D@D DD@DDDDDDD`D@DD@DDD`D@D DD@DDD@DD€DDD`DDDހDDD`D DDEDDDD@D DDDDDD`EE @EEEpD`DDD`EpE `E E EE`E EpE 0EpEEDDE`EEE E EPEE E0E 0ED@E EEE E`E @EEEpE EE@EE E@EEEE EE!`E"E6E$E"E)ECEI0EXER@ENEX EL EFE4E3E4E>ENEREN`EKESEPEEEJ`EKEP EQE_EdEeEiEwEuEqEcpE_PEepEaEdEh@EdEgE^E]@EZE[@E_E]EeEk@EmpEeEj`EpEnEPEExE8EEPEtEnEkEdE]Ee@EaE[Ee0EcEdEn@EvpEzEEzEzE0EzEvEmEkPEv E`EEE EpEEHEEEEXEE EEEEEEpEEEExEEEPEXEPE(EXEEEE@EEE0E8EE`EExEE ExEE(EE(E0E@EXEE`EE0EEEEEEEE(EEpEEEE(EEEhEEHE(EEEEE0EEE`EEEXEEHEĀEpEEEEEpEE0EEEpEEԐEՈEE՘E`EXEEEEEEEEEEEEEXEEEE EhE0E@E(EEEEPEHExEEEE0EhEEEEE(EEEE`EEĀEHEӐEPEPEEXEݸE0EEEEFFFFFFlFF,F8F F F F F F FXEEHFF8F\F 0F F\FF@FF0FFF F (FFFF F F FFF FFF XFFFFFFF(EEEHEEEE0EEFFHFFxFFhF dFFTF FF F`FF FFFFFFDFFpF FFF"$F+8F30F5F9F=HF+F(FF$FdF0FFlF<FF$F F FF |F pF F F FF 8F PFDF 4FFFFFF F$F"F/F8F>pF:F<FEFJFEF2F+F#FFF F!FFFFFFFPFdFFPFF&HF$FFFF(FFFFF @FFF)dF(F4xF2F,\F0F&FF"F @FF0FF|F4FFF$F( F>HFD@FEFHFBFFF:F7F5xF6F4 F0HF6F@FEFJ\FHFChFQLFT(FWFSFFFR FJ4FNFIFSTFWpFSFYFcDFZF[FkxFFDFFFFFFhFuF~FzFjXFuHFhF`F`HFTF[FXTFktFfFeFTFL8FQFOFPFJ FCF>FA0FG$FMFA FBFJ8FPHFLFDF[ FRlFZFUFMHFQFTTFLxFNDFT\F<@F=lF<F:F9PF2F1dF60F<F9,F9F6HF18F-F-F.<F.F5XF4F/tF5F<F;,F,DF'TF#F F"F%F&PF%\F&F!F"tF"F*F1F6F;FIFNDFSFGFCFC F@@FAFQhFT Fa,FYF]F^FeXFkFs8Fx@FyFp$FfF]FcPFY\FR4FNhFIFQdFXFYDFYFaFkxFkFjHFlFuFxFzXFyFsdFq8FsFqFoFeFSdFQF`FuFyFrF{@FFFF4F FFFF&F&FXF FFF(FFFFFF~F{pFF{Fu\FeF[F^PFXF[FUFQFUFEdF<\F4 F3F2F3F8,F4xF2F.F08F*pF-,F3F6lF6F@F?xFGFFFETFI FFFPF^FaFe@FgFe<FkF_FbFaFl(FeFdFPFjFFFFFFFFFFFzF@FFFBFFvFVFPFFFxFqLFeFgFlFn\FnFmFgFmFt`F<FtFFFFlF(FFFFLF>FtFFFPFlFNFFzFFFBF>FRFFFFF F0FF:F^FFF~FFFxFFlFjF~FFFNF~FFFFFFFFFFFFFFF"FpFFFFFFFFFFxFfFFFF{FFJFFDF@FFFFFFFvFFXFxFFFF2FF(FFFFFFFFF}FjLFeFZFUtFLFJFD8FEFFpFK\FXF^FZFqFFF.FFFFFdFF FzFFrpFgFcHF^FYFdFcFkFzF.F.FFFFxF2FF2FxFNFHFFFFLFFFHFtFFzFFFLFFvF FFHFFFFnFFFFFhFFFFFfFFF&FnF~FFF|FZFwFlDFpFwXFqFvFF FFFdFhFFFFFFrF٘FF"FF"FTFNJF>FF2FFF\FFFFFDFFF|Fp0FmFkFkFiF|FFFFFPF~FvFqFtFtFlFjFhTFflFkFipFplFjFiFFiFcFeFs@Fq|FzFLF~xFFFFFNFFFJFFwFFrFFtFFF{ FtF{FF4F{FuFhFbFdF_Fh8FfFYFXLFbFr0FFFFFF0FFy|FvFlTFoFxFF@F:FFF|F<F&FhFFF FFFFFFzF>FFFF4FF6FFudFmFn8FmPFfF`F_FbFf|FqFF&F^F~FFFLFlFFFF>FDFFFrFFFhFFFBFFFFLFZFFHFBFlF`FxFFFFyFzF{FyF~ FRFF.FFxFFFFFF@F`FFFFfFӦFѨF F׶FFFFFTFҊF*FĚFFFFFLFFZFFF0FF"FFHFHFFhFF~|FFzF&FvFF,FRF(F<FFy\FyFlF@FFHFfFF}tFyFzTF~@FTFFFFFFFTF FF,FTFFdF"FFDFFF<FFvFtFoFuF{FFrLFphFFbF^FFFyF~FF.F2FzFpFFF<FsFq0FvF}<FFnF2FF*FFFFF(FFFF F8F~F~FXFF0FFjFTFFFHF FpFFFy@FwFgFk,Fg|FdFpFwF|DFFbFFFFNFFFFFF(FlFvHFFFFFF@FFBFFFJF:FFFBFFFFZFF(FFJFFFF:F4FjFFFlFw|Fs<Fj FzFwF~0FyFqF{FFPFF8F(FF FF\F@FFvFFFFFFvFFvF^F`FfFFTFFbFtF*FFFFFFFFFnFFFFFFFFFFzFFFFFFFdFxFrFFFFFFVFFFF~F~Fz FoFvFtFpFjFqFqFwFqFn8Fr@FFbF8F~$FxTFtFqFq|FsFl\Fq(FzDFu@FwFFF>FFF,FF|Fy FyFxFFFzFzFVFNFFRFRFfFFF$F$FFFF<FRFFxFxF֊FFhFFF FݞFFFFFtFFF(FFF6FFFFFFhFFF$FFFFFFF.FFFFtFFFFF*FFFu$Fc\Fp<FtFFF4F&FFFF`FlFFF~FFFFF0FFF FFFtFFFFFFFRFFF*FFlF$FbFFFFFFFhFFhFעFrFFFNFFF,FȖFFFnFPFFRFFFFFFFFɊF6FXFF۶FְFκFVFFFF`FFz$F}HFvHFF|FFs(FnPFYLFQ(FLFUFPFNdF^Fb(FbFmFx8FFFDFFLFtFFF*FFoFeFg(FwPFLF_(FRFmdFotFlLFnF]FidFoFFFfFFFFFLFFFvFF|F@FFnF"FF|F{LF FHFFVFFFFrFFFFF$FJFʲFFFFFF FdFFFFFFݰF˂F|FFFTFFFFFF6FRFXFNFFF"FFLFFTFɪFTFlFFFFFFF0FtFF|FFFFFFFF|FFFtF F`FFFLFFFFFFLFFFfF F FFF*FFǤF F FFlFF.FFvFFlF6FpFF$FFF$F(FΆFϞFhFbFzFF$FFFFFBFF,F&FFFFFbFvFF FFFrFFFFFBF:F|FFFFFPFFFFFFXFFlF@FXF FF$FFu Fh$FUFHFEFCF<FAF@FX0F`FelF``FpPF[8FO FFFG4FMF\(Fa$Fh,F]FcFS\FIF?TF=|F@FRFCF9F;hF>FRFk(FFF.FF^FFFnFFFFfhF[\FLF7lF;@FCFS@F_FtF"FFbFPFF@F*FF`FF{FlF$FFtFtF`FZFRdFTFYHFTFYF[<FP8FIFA8FIPF4F#tF0F F,F/FF>@F>F:F?$F?FDhFNFSFT\FUFPFYFVLF`Fp0FvlFxFqLF|FhFy$Fk F\4FbPFaF_LFYPFS`FM FJFKFJFE,FIF\$F[pFHFL$FFFEHF@tF;F=xF9DF3F7,F<F;lF84F7F=F@F;FJFFFHFDHFDFBXF@@FHlFGFKlFFF?|FFXF@DF<8F3(F4F2F0,F3F*F(F%LFF!FlF(F"FF"F'F'F-4F%FDFhFF!FFF"FDFF`F`F%|F)F)F2DF8FCFGFCF?F<$F2F9FHpFFFS@FYFU FiF^HFj<FiFlLFdFe8F_FR4FOFG`F?FDFD`F@,FEFJFMxFZpFULFWFW4Fb8F`FdFfFhFjtFklFx8FtFqFlFVFNXF[FmXFpF{DF|4FFF4FF~FFFzFFhF:FF0F@FnF,FFF{|Fs|FoTFq`FptFk F`FgPF`pFSFRPFJFDFGFD8FAF0xF(pF.tF-TF/XF0XF(F)0F%F"hF&4FF!FhFF'0F*dF-pF/F2F/PF-xF=XFFFO FPF\FN8FPFVFWFTFYFYFVTF_Fk4FtF(FFdFFjFFFFvFFhFyXFlLFt F}F&FFFbFuFdF]FY FZF]F\FUFRF\`FiFoFz0FwFFFRF<FPF}FFFFFF<F>FFFtFBFFlF~FdFF\FFF|F$FFfF4FFJFFFFFnFF^FpFFFFv Fx0F|FsdFjFnFxF{TF0FFFFFFFFFdFDFF"FFF"FFdFFlFFF0FFy Fm|FqFw(FFFF2F F<FFFFRFFFFFFFFF.FFFFFFF{F{FtFg<FTFP FMFKFFFJ<FEFAFAFGFOPFWFfpFwXFthFFFjFF\FFF@F F|4FgF[FVFFFLFV8FaFjFpF|F|DF|FFF| FlF>F6FpF.FF`FFFFFFFbFFFF|FFFFFFFFFFBF0F FFFzF:FFF@FF"FF\F6F F2FF:FFmdFhFghF_FZFdFkFotFvFdFdF,FpF"FJFF*FF˼FF6F.FFFF|FFxFFFFF(FF~FFFuFh0F\FZdFZF[FoFzFvFJF|Fq,FhFd\F]FaFeFcF_FcFgFcFa$FXF\F[Fj\FkPFcFgLFsxFFTF.FFy<FFBFFZF\FFFwFg8FdPFfHFrFj\Fn<FkFhtFdXFdFnFpFtFoF^FTFVFTFW0FXdFXFR FTFb0Fy(F}FFFrxFdhFdFdFa8F`PF`Fl@FrFFJFFFFRF:FFFnFFrF@F FFFyFFF|4FsFs FFtF\TFQFSF[FRFN<FP$FUFV\FfFzDFFFF$FFFFFFF$F`FFFxF|FFFFdFFFFF FZFZFFBFFFFxF}F~DF}FmFiFb|FfPFnFqhFvFuPFlFlFyFFFF`FFFtFFzFjF؎FjFżF8FFF.F2FѠF$FzFFFFFFFFF(FF F`FXFzFFF~FNFv<Fz8F$FFFFjFFpFFFqF6FFFpFxFrFfFF}(FlFe<FtF~FwFFFFFfFFFF<F>FzFFrFFFFvFLFvPFnFjF]FaFlFoFeLFbFp<FyFm FqFy4FcFcFwFzFFvFzF}|FxF{FfF^4FhFphFBFFrFTF4F\FrFFzFl<FrpF{TFF*FF FF@FFFFtFvFFF`FdFFF FnF`FaFbFapFcFcXFoFwDFxFzFdFFFBF2FFF~F|<Ft$FpFoF{F\FFFFFF(FDFbFFFFFjFFFFhFPFXFF,FF$F(FF&FFFF4FsFe|FcFaFaFmFjFhF{FFFbFFNFFFF`FF4FFbF"F FTFFFF,FbFFFFDFtF}F\FFFFJFFF FFF>FFFXFpFF FF6FFFF2FFFF FFFtFF FFFF|FF:FF}hFtFlFn FuFsFuFmHFu`FFt0F}8F&FFFJF}lFyF{FyFnFk8FlFsF"FF,FFhFpFF,FFFtFF$FFw<F@F|FyFvF|F FFbFFFFFFFF FXF0FFFɔFFLFF4FFF`FZFFFFFFFFbFF`F,FFFFFFdFF>FFFFFFFFFF*FxFFFǢFFrFFJF:Fr FnFFFFFFFFHFF FbFDFF\FF&FhFFFFFFFhF8FFZFxFtF FFFFF|FFLFFFFFFֈFFFִF0FF FLFFjF@F¬FtF`FjFFFVF:FFFF*FF\FڦFߚFFFxF2FFTFFFF.FlFFFFFwFyFyFndF]HFXFNxFT<FMxFUF\F[lFjFvF8FHFfFFFFFFFTFF~Fu Fs|Fs\F|0Fl<FdFuFyFXFFv|FzFyF~FNFbFFFFFFFFFpFFFF8FF F(FFPFF2FFFVFFFFNF2FFFRFF4F>FlFHFFvFFFDFF֎FFFFfFϊF͢FF`FFrFFFTFFxFFFF.FF FF8FFFlFFFFpFJFTFRFȢFʒF0FrFFFFxF<FF<FFhF6FxFFF~FFFFFFJFFF¸FFFFFFGfFF0FFІF"F$FzFLFrFFFFFFxFFFdFLF.F FF&F@FHFZFF`FFPF`F0FFǚFFFFĞFFƺFǞFF.FFFFF"FFFFF,FtFǬF<FFFF,FFF2FFFtFnFHF2FFFF>FFfFbpF`<FJFStFT0FWtFQtF\Ft4FdF^ F\|FRFJFKHFNFVFi<FnFu,FF|DFxF]FHFEFHHFLpF>TF30F/F78FWDFe(FF F4FBFFBFFFFJFFF[FOFEPFK<FQFhFwXFFF*FFFFFF$F0FF^FF8F<FFFyFidFWXFSFUFHFOXFHF:tF,xF4F@tF$(F#pFxFF'F.4FIFLFGFCFFF7F)lF `FFFFFF) F*F5(F)LF&F!F\F#@F' FFlF FF3F2\F(F@FQXF4F)lF xFF`FF!<F+pF<F+,FEEExEED D DDDDDDDDD@D D D DDDDD@DD DDD`D@DD@D D`DD D@DDDDD`DDD`DD`DDDÀD@DDD@D DDE@DDDDD DE `DDD@DD`DEEEE DD@ED@DDDD`DD E`E E E EE@EE@E EpEEEE `E EEEEE @E E E@EPEEEE0E0EDDDE EE E EEEE`EPEPEEEEEpE`E(E40E@E\EWpEUE@E@E9 EGPE@E5E;pEREW`EOpELEYEPENET@E]@EUEXEXEUpE]EgEiEh0E]@EepE[`E^pEd0EkEkEEEoElEhEVPEe EaEbEfPEeEiEw0EzExE@EEEPEE~0Et`EEh@E_ElE[Eb EiEeEoEyEzEEEE`EE(ExEXEExEsE|0E EEEE0EEE@ExEEPEE@EEEE0E`EEE0EXEEEEEEEEEpEExE@E0E EEpE0EXEE(EEE8E EEEhEEhE@EEEEEEEhEEEE8EpEEEEEEE@EEEPE(EEEE0E@EE@EEpEEE8ExEXEXEhEEEE@E(EpEE`EEEհEØE`EøEE͈EEĈEE¸EEPEEEHE EExEEEEExEPEEEE(E(EEEE0EEE8EpEEEHEEEE(EEE E¸EǀEE@EɸEE(E`EEEEEEEE@EEPEE0FF \F XF dF F F,FEExEEHEEF0FF F |FFlF F FF HFFEExExEFF`EFFXFLEEEEEEEExE(EEEEhE(EE8E`EFPFFF F FHFFFXF FFE0FF DFF8FFEEHF4F pF F FFF)F'F2F,F)XF#DF!F$FFFFFFF FFFFF FF F`FFF FF,EEF@EFF0FF TFXFpF PF"HF dF#HF%XFF`FFFFF FF FFPEEEPEpF<EPEhFFF F lFEExEXE0EFFF tFF!FF F lF!dFF\FF F(F8F F F FFF F!F-8F>DFCFEhFKpFMF@FDF=F7hF7F F@<FHFIFF F@F?F@xF7F5TF;F3F3F18F7(F3F1F1TF6F3F:8F<FB0F;F=pF:F?4F>F<FCFLlFDlF>F<F?TF9F6F4F2$F0F+`F-XF",FF|FFFFFFFFF`FFFFFlFFF$F8FF,F(FFF&F)(F08FA8FG$F>tF7F1F(F.F5F6F<FHFRFWFPF\tFaxF[\FYTF\FYFG0F=<F8F5lF;0FBxF:F?\F@FEFTFNpFIFWXFVFXxFYFUFW|FVFbFl0Fn|FdF`FYdFLHFRF_FrF|FFFLFFNF}\Fo(F{FFFpFFFF~\FFFFFrxFjFZPFXlF\HF^FYFXFQDFNFGFIlFATFEtFCF?F6F,F(F(F%F$F#xFdFFFtFFTFFFFlF!@F#F#<F#lF(F.4F8DFBPFAFCFFFI FR FTFRFIFSlFIFHF[F\XFi(FvFtFrFr|Fe`FmFrFF,F`\Ff$F^0F\FlFwFFhFr$FpFdxFY(FRFbFcHFXPFRFT\FTtFaF_FeFw8FrFwF~FF}@Ft<FqFmFpxFoFsFz FvFFvF4FFFPFFFFF(FFJFFF&FFfFFFFFFFF8FF~FwFtFh4FdPFl@F[F[FjFd,Fn(FkFphFLFFdF"FFF FjFFF2FFFZFzFF Fv,FtFrFh8Fj$FaTFgF|FF(FF|FFFFFFFfFFFFFFFF2FrFF,FFzF{Fx4FmF^LFOFBPFAF@lFCFEFD\F? F<8F@FHxFI<FVF]FbFl F:FFLF0F}F}(F F FnF]FGFFF@TF=dFEF_@FghFqFwpFuFotF|F~PFuFnFvF~FFFFF>FF`FJFF^FFF<F(F>FFFFFFnFrFFFJFNFnF"FFF*FFF|FFFFFzFFFF{`FoFf|FZpFRFPFP|F\,FeFiFvFFFFFFFFFFFDF>F FFFFFFxFFrF(F0FFPFF|xFlFd<FVFT8FO@FK<FbFi,FjFl|Fz`F`F^$Fb F\FQFSlFTFZFYFTFVFTFHFR4FV$Fa@FrHFcFhFw FF$FJFFyFFxFuXFnFlFzFrtFlF[FUFSTFSFQFOlFOFU\FXFbdFa@FfFghFbFbxFN|FFFF FHFJFGFGFKFSLF]FeFqFkHFe\FXFQFTFYHF[FT8FPFXFiFtXF@FF FlFnFFtFwFFlFFlFFuFoFpF|FtFgFgdFiFdXFRhFIFG|FDFKF?<FEFEFSFaFo,F@FF|FpFbFF*FlFFdFxFFFFF8F&FFpFF4FFFnFZFpFFFFpFrFlFoFg8FjFgFbFiF`hFaTFcFh8Fi@Fh\FiF~XFFBFxFFFFFFFݞFnF FF$FFFFFFF^F(F FFpFFF FF FFFFFF FF.F Fu,Fp F}FFFF(FFyFFrFiFqFshFvFt$FuFkFtFvFoFdFi$FldF~4FzF{FFF,FF:FlFFjFDFFNFF0F8F6F|FnFm\FhFjFWFTFexF_`FWFYF_pFhtFVF^<FnFW F\FcFndFsFrFqtFqpFuFpLF^F[FaXFa@Fu\FF^FDFFFbF~$FztFnxFn|FsF}FFFFFFFlFFFFFFFFF&FF|FlFg@FlFmFiFaFhpFvHFlFv,FFFF8F`FF{hFqFq0FkFdFaFlFyFFFu(FwFFFTFF"F<FFJFFFnFFFF FFFLFFFF8FF}0FFs@Fn,Fa`F_FfFdFaFeFkFxF}@FFF4FJFFFFFFFFFXFFFnF@FFFnFFFvFF{F$FFFFFFTFF4FFFFF<FFvF@FF:FFFFRFFFFbFF^F*FFF4FzFDFFJF>FFzFrFwLFgFrFw FsXFsHFeFllF|F0FFtF$F>FFnFFFF(F{(FwFzDFfFFF FZFFNF:FFFFFDFFRFFFF} FxFLFDF2F"F*FFFFFFrFzFFrFtFƼFFִFbFFFzFFjFFF2FNF\FFF^F|FFBFFFFF<FFlF,FFFFFFFVF^F"FFFFFFʺFHFFPFFPFFFLFFpFhFFFFFLF0FFFFBFFdFZFjFFFFF8F@FF>FFNFNFHF,FFZFFFFFFDFhG1FlFFFF,FdFF6FöFnFFDzFFՌFF F|F FdFF<FFFFFFnFFFFFŲFFFFfF>F,FFF"FHFFxFlFdF^FXFVFXFfFaTFnF~FFF~FFFFFF F FF2FtFxHFFy,FzF&FnFFFF4FF<FFFFF\F0F`F"FϖF*FjFĂF(F؀FӨF FFF<F FhFFFBF<FXFFFFJFFFFF`FͦFFFlFRF4FGFF\FFF4FF*FjFFϨFǔF8FFFFFF*FFFFF"F,F"F϶FFFFۈFFHF͆FFFFǂFFقFFJFȨF"FFÐFdFՒFFFF6FFFFFFF0FBFFFLFF6FF6FٶFXGGOGFFFVFlFFFF2FFFFFFhFF4FF^FFPFFFFF2FJFF6FFFpFfFϰFhFɞFƮF`FlFݦF@FvFjFFFFdFlFFFFFF0F˨F"FFFFDFF0FtFFFrFFF&FFFFjF<FTF FpFdFUdFd\F\F_$FTF`Fq|FhLFk,F`dFhFalFTFVFVFrFFFFFyFiF[FVFODFCLF2F)\F&F,F?FPF} FFFF<FFFFFFtFF{XFaFR<Fb`FpFxFFFFF~FxFXFDF F,FFFFF~FFFFy`FfFe8FQxFV Fc\FCF;F:F5PF@F5pF-F*F%F)HF+F;tFKXF_FzFRDFWPF:F$FDFpFF \F,FF(F0F8 FL,F;\FE7pEEE;EEpECELE`PEIEJENEQENE`EfEdET EN@ETpE[@Ee`E]@EaE]E[E^PEiEkEmEqEEEu0EpPEhpEk@E]E`Eg`EkEj0E{pEhE8EEpEExEE0EwEEs`EoEn`Ee0EhPEkEyEpEEXEHEEEpEEEE(E@EEEvEXEE0EEEE`E EEEEpE@EEHEEhExEEEE0EHE(EEEXEEE0EEEEhEE`EEpEEEEEEXEE8EEEPEE@EE(EPEExE(EEEEEEE`EE`EHE(EEEEEEEEEEEE0EEpEEEpExEEEEE(EEEEpEhEEpEE׸E@EEhE0E0EPE8EπE8EEͰExE`EEEEŨEȨEHEEEHEEEpEE(EEEE(EPEEEEE ExEEEHE0E(E@EEHEEEEPEɘE(EHEPEEEXE EEEpEE E EEE E0EFlF tFLF F FFE E(EE`EE0F`F FdFF F @F pF F<FFpF0F(EpEExEhEEEE0E@E EEHEE@EE(EEHEHEEE0EEE`EEEHEFFTFF0F(FF FF(FFXF8F@FEF@EEEEFFF FlF"F'F*F,\F)$F%(FFF\FFFFhFFFF F F F FF <FF F$FdFFEF8F,ExE`EEEFF F8FFxF(FF#lF<FFFFdF FF dF FEE EEXEpEpEE@EEHFdF0F$EEE`E`EhEExFxF`FxFHFFdFFF FFFFF0F FFF<FTFdF%<F)F4FD FBFAF<F@4F@`F9F7F8DF9F7F1F&DF'F.F4F+PF+ F*F/$F)F+$F'dF)F. F2TF5F?FGFN<FN4FUFPFFFGFRF_FWFTFOhFMFLFHpFC<FBF@F>F9F7F/lF4lF5F9F9PF;F9FB$F9F<4F8|F1F4pF1F/F/<F+LF+F/F*4F*dF.4F3F2DF5F=4F<F9`F:F8F8$F@FJFExFDF@FHF5F0F5F)F'\F$lF*F$0FlFFFFFFF|FFPFFpF4F XF F F`FFFFF TFxFF,FF#F2F9FCF>F4F,|F!0F$F0F54F3HF<FK0FQ(FY@FUFV|FTFUFUFKF>XF7`F0\F0LF-F6dF;F;F@@FSDFVFOFOFRTFYhFTTFWFS FOPFQF\PF[F`FbFXFY,FNFNFPPFqFrFyF} FLFFF8FnFhFsFxF|F}\FF8FBFFFdF{FlFZFXFUFN FKFQ$FCFIFCTFFFAF<<F6\F8lF;F8F,F#F \FFlF8F@FTFFTF (FF F$F0FPFdFF\FFFF)F1F3F8F:pF?FFxFA$F@FF`FCF@F@XF<FDFLFY8FfFfF\FM FOFQFWF`FS|FT`FM4FHtFNFZFiFkxFaF^FVFSDFZFeFRFPHFWFV4FT8FU4FU(FZFfFa$FbFtFF|FrhFjTFf0FdF^FQPF]FmFlFt,FsFqLFsF~FF$F4FLFFF0FFBFF,FFFBFFFxpFyFvFDFxdFwFgXF`F\HFZPFaFZHF\F^FZFZF_dF_@FnTF$FF,FFF*FFFF:FFPFdFFFwFhFbF`FXF\@FWPF^LFqFFFFFJFtF*FFF$F0FFlFjFF FF:FvFF8FFFv@FfDFdF_FVLFPFB4FA|FAdF?FG$FFFCF:$F;FAlFGFJFIFSHF`hFfFoFxFn FkFh0FnFmtF`|FO\FAF;F;@F7F=FOFiFnFn\FmtFjxFpFrFk<Fk<FitFrFFFpFFF F`FhFFFFF~@FF4FFF6FF}FF:FNFF FRFFFF F\FF|F<FFFFF8FFF{Fl,FchF[F[FRFGF@`FLFVFY8Fb@F~FFFFDFvF`FF,F<F&F8FFF\F"FF~FpFiFuFFLF>FbFFyFdF\FLFK FKFD0FUFRFTF[FdHFgFSFUFULFMFIlFKFIFTFHFG4FIFGPFLXFJFVFaF`@Fb|FmHFwFuF}FzFudFkFhlFaxFSFQ8F]<F_FRFKFCFEFBFAFDFBFL$F_FiFfF`F\TFV@FL\FEF< F@(FA<F;HFEFEHFEFGlFSF`FaF^FX|FIFFFGFC FAFBFG<FN FXFgdFw8FrFlLFYFa4FlFmFsFy8FFFF~FoF`FeFk\FlFhF^LFZFRpFH FEF;F=FBF>xF:FDFPFXxFoPF:F6FFFzFFrF FFFFFFFFF|FfFFFFF"F~FrFFFZFFxFeF_F^hF]F\dFZ(FcFs0FkFdFbXFj FlFn8FlFvpFFFFFFfFFF@FhFѼFFFFڜF8FFxFFŒFxFFFFpFFRFFRF$FFFFF*FFFrFFoFnFr(F~FpFxFFNFFF}FrPFlFiFp0FsFwFw@FkFbFm\FmFk,FqFvF|FzFqFFFFxF"FF@FFF*FF,FFJFxFFFllFkFeFY(FTFWFUDFUhFRF[F^FPFL FWPFNFTFVF^F\F\(FfFpFxFx$FfF[$FZ0Fg4F| F.F0FFFFFvFdFghFlFuXFqlFzF:FFF(F^FFZFjFFFFFF FlF FvF{FxhFsFupFr@Fl<Fp|FntFkxFfFvFF*FF}FklFi0Fj0Fh`FdFa Fc FiPFm8FBFFeFktFuFPF2FLFLF|FF0FFFFFF*FFFdFFFFFFFrFFw`Fs Fp,FlF2FFFzFzF|8FF,FFFF>FFFFlFFFF^F,FFFFF6FFDFFxFpFF4FF6FF,FFFF<FFF\FFLFFFFFHFFFFFF@FFBFFFFFFRFšFF~FFFPF.F F|F~|F{TFx FzFw FvFr,FpFn0F~FFDFFFFFF~FlF0FF(F"F2FztFFFFFFFtFF\FF.FFFBFFPFFF2FFF&FFXFF^F>FF,FFdFFFFFF:FF FF FΦFμF|FFFFrFFVFߐFZF6FĶFpF@FFHFdFxF F2FFFZF|FFF`FVFFF:F~FZFЬF FƤFF FrFFFjFF|F FpF$F~FpF2FȮFFFdFFFFFXFF&FFFF$FPFFZFFvFHF$FԞFHFFhFFZFBF(FlFXFFFFxFުFpFɄFFZFFFöFîFjF˺FŮFF|FFFFFlFF*FF؞FFFFFF֚FÚFF8FFHFFFFFFF`FF~Fq FgFbFc\FcHFiFeFzFF,F"FTFFFFFFfFFFRF>FFF~FFJFFFFFF FFFBFF4FTFFFʬFԮFٖF~FFFɺF֦FŬF8FFF>FFFF"FFF6FF|F\FF6FFFF>FFBF،FfFxFݰFFG?G ;GF>FF FFFFFFLFFFPFF F~FFhFF2FFØF4FFFFFӘFzFրFBF<FvFFߪFFFFFPFFvF՘FFܸFxF8FF|FNFFFfFfFhFFhFF4FF$FFF,GG SGFbFFF8FȐFRFFFFFxFFVFFFFzFF>FFF(FFFŦFFԠFtFHFFFFŰFʴFþF.F&FLFLFfFtFvF2FFFFXF FFFɚFDFFʘFFFFZFFFlFFFFFFFFRFFFFnFrpFqFjFdF`Fb@FaFdF\FrFkhFqF$F} FwFj\FhFb8Fl FwdFzFFFyFnFbhFc FP F7(F*lF%F%F,8F5F@`FfFvFbFqFl\FF FFNFFF|FFlxFxlF|DFzFzFFFFFFlFFFbF{FrF{<FvFF*FF6FFFu<Fc<FcDFoxF`F]F`FFFDFIlFHFMFI(F=F? FQFGlFPF\FfF\|FYF3FDFF FF4F!F$|F.XFHFMLFrtFxFpDFaF7HF+F4tF,FAFdFF FFFxFj@F?DF:FBF(xF"F0\F 0FLFEEEEшEÐExDDDD@DD`DDDDD@DDDD`D@D@DDDD DDDDD`D`D`DD DDDD@DD`DʠDDDˠD@D@DD`DDDDEE EPEEDDD`DD D E`DD@DD`EEEEE pE E@E DE`D`D@EDE`DEEEPEPEEE EEE 0EEpE@EEEPE*0E E E"0E E`E PE0EE EPEE E E0EE`EEEEpE E EPEPEPEE0EEEPEE(`E,E<E@@EFECENE?E>EGECEEECPEAEH EEpEREQpEU`EOPEM ELET E^EbpEWERE=ESETEfpEd@EWEaEZ EmEsEy@EEXEXEv@EXEEqPEcEk0EaEk`EsPEy`ExEE@EPEE`EEhEEyEyEvEwErEs EyEEXEExEEhEEEE(EEEEhEE@E0EE EEEEE0EE8E(EEhE(EEEXEEHE`EEEPEEEEE(EEEEExEEEEhExEEPExE0E E EEhEEEPExEXE EhE0E EEEEEE0EpEEXEEEE`EPEEEEExEEEE@EEEE EEEEEHEEXEEEEpE`EEɘEEEEEpEوEϨE΀EEEEӐEϰEEՀE@EhEE0EEPE E(EEEE(EEEEEE EEEEEEEEEEhE EEpEEEEEpEHE(EӐE EhEEݐEE EPEExEXExEEEېEEE`EEE8FFF FFTFEE(E@EEFFFF F4F PF F F FFFFFFDEE8E8EE(EEEEXEEEpEE8EE EEpEExEEEEE`EF<EFFFF4F |FFF EEFPEpEE`E@FEEFF FF ,F FFhF-F,tF"F`FF0FxFFFFFF8F0FFtF FF F FdF FpF,FFFFFFEhEEEFlFTFFFdFFF0F!FFFFFFFHFFFExEE EEEEEEpEPEEPE EEEHEHE EHEFF FFFFF FFlFFF|EXFxFF F <FFF|F4FF+HF6F8F6F;F:4F5F5F8<F24F:F<F5F4F/DF+F0F0dF3F3DF/DF/0F0hF(F*F%@F#F)F1F@FBFL|FLFFxF:F:FDXFJFCXFGFFFCFBlF;F=F8F7`F;F<F1F+F.F,F2F-@F.hF3F8<F=F4,F3pF-@F1F0F/xF,F)F&F%tF HF!F$<F(F*F1F4F.F1(F.F,F-F?FCFFFKFB,F=lF8F4F.tF)(F',F(F%,FFFFF$FFFF @F XFF F $FF\F FFFpFF,FdF FFFTFF$F-F9F?FJLFAF20F)LF,HF,XF/F5F@FE$FXFVFSFOFR8FSF^,FT0FFF8F-F*$F)F-hF4xF:FR<FTFVFYxF`FT(FcFTFX FT\FUFZF_hFVFSLFUtFWFQFNFLFNFWFnLFFuFu8F~F:Fy$FpF^FgFuFzFvFFFFFzF FtFcFX$FLFEFG FAFHFDF;F@dFAF8F6F3F.F3F4F,FFF0FF(FFFFF FFF F F F FF FFlF0FF%F)F+F-F.$F6F7F8F:F8xF8F7$F4F4F8FDFOFMFKF<F;F6PF>FJF;pFAFAF@FCtFEFRFUFOFKPFJFO0FKFNFMFAFFFHFLFEFJXFLFU`FW<FXFaFiFslFrFlF_FcTFT\FOFTF`FddFgFoFshFx$FpFuFFFbFFFFLFbFDF8F^FF FFqFnFltFdxFlFpF`XFXFWHFOFIFO|FZFS FRlFPFLFMFYFUxF`FhFyFF~FsLFkFnF|pFFFF\FFdFfF\,FTxFNFJFLFOFXhFWlFq$F0F8FFFF\F|FFFFFFzFFxF~F6Fx|FyFthFFtFjFYFV|FXlFJF@F7F9FDFE\FG FR\FK F>FBFHFOFIFBFMFdTF^$F^FgFbXF]lFZFZF[F\FS\FBF@F;@F8F?xFQF^Fa<FcxF]FgFfFlPF]F\hFiFrFzFvF\FFFqF}F~F Fv|Fq,F@FzFFFFF^F(FyFyFFx(Fs,FFFLFFFF~FF(FxFmFtF~@FvFPFBFFj$FkFcTFaFX<FJFF FAFDFJFOhFULFjF{dFFFFpFFfFFFFVFFFv0FhFgPFaFc0FeLFgFwFFHFFFz@FjFSFDF8`F9HFBFKFPPFOFQDF\F^,FNHFIFQFG@FBFFFCPFBFDF>F=F?FFFFFF0FNFTLFVPFaFn|FmFpFnFjF[F[FSFLFG`FIFLLFDF@F=HFB0F>F7 F:F9 FEFMFWF[FVFXFLFNFDxF9F;LF?F?@F@FJ4FJHFGFTlFVF\\FNFKtF?F?F8F6F@FE,FGFHFUFZFf|Fa`F[FUFQFVFeFiFipFkFplFuTF{Ft F]F^TFeFhF`FXFPFKF9F1F/F4F;F64F@FCFQF[Ft0FF@FFFFFFFF`FFFFF FFFFF:FF2FJFF\FF$FFFFfFZxFThFU0FVFR`FXFcFgFaPFbFgFt4FpFzFFFJFrF2FydFxFFFFF.FFFƔFvFFFFFFǘFF8FbFF F4FF$F^FFFFFFF\F*FFFFFyLFtpFe@FoPFyFoFnFw FyFjFhFgFiFjFkFmlFmFsFeF\FeFjFeDFv FsFxFF{Fu\FFFFF F~FJF8FlFF"FFFFFFwHFbF[F[XFP0FcFkFY@FY@FR@FSFHFNFZxFS,FNFKFKFTFUFYXFe\FsFjFeFbxFitF|FFZFFnFFF|FcFcFb,Fe0Ff FhFudFsFFFFFFFFFlFFFF FF(F6FFxFz@F|FwFrFhtFl`FiFuF^F\FFFzFnFehFlFj8FkFgFglFkFqFrFqDF]F\`FjDFz|FFnFFFxFF&FFRFFFF,FDFDF(FZFFF2F2FFF}LF~F4FFFPFFFFFFhFFFFpFFFF FFF$FFFFFFF,FFLFFFDFfF\FF&FFF$FF FFFFFF|F.F|F@FFvFFbFvFVFFFNFFF&FFTFF˼F|F0FFFFFxFLFF\F*FF~ FxFz<F{FFFFFFFFlFFFFFtFBF FpFFhFFZFF|F F$FFFɀFFFFFZF8FFFFFTF^FFFFFFbFFFVFTF`F6FɸFFÂFpFFԈFZFFFFFFFTFFFLF.FFbFF2FؘFrFFtFFFLFFF^FFfFFFvFF2F2FÖFFFFFF\FFF4FFFFFFFFȼFzF,FF`FF FFFF^FFFF$FFFFFFFFFF̨FFƞFFƘFѦFFnF FFFFFFȀFFNFFFFǀFDFFJFFFFFFFFFF͈FFքFFкFF4F FRFFhF:FFdFFFFlF FF~FF|FFpFFyF|tFtF0FFFF FRFFFFrF6FFFFFDF"FF F FѐFF\F\FFFFFDFF"FF`F FƪFF2F&FFFrFFFFFFFF(FFFTFFFFFFRFFF^FFԒFFF|FJF$FjFGF2GG _G)FFFFFŊFdFF݌FFFFpFFFnFpFF FܮFDFF*FFFF8F٬FҎF٬FF,F:FɌFF,F(FG FFFFzF:FۜFFFFFFF$FF&F<FFlFF|FFҜFFF0FG4GG9F^G F FҺF<FXFhF&F|FFF*F6FFFtFFFF4FHFFXFFJFFF FF^FHFFDFF@FFFFFĞFĘFĞFzFĐFFF`F(FjFFFFHFfFFFFdFFVFFF6FFF$FFFFFFF FuFsLFkFlFmFiDFrFtFxF<FFFFFlFFtFntFrF{FRFFF|FuFu\F\FN\F@F0F,F#F%@F+(F7 FILFUFaFSFZF^FmFiFgPFfFmFDFz4FzFF{FTF>FFFJFFFFFFF0FFFFF FFFFF~DFxFFFq8Fp<FrxFRXFZFfFsFbFSFR<FVF`XFZFiFFFF|FH$F%XF#tF(FFF#F'F2\FGF]Ff FcFMLFZ8FEF2tF1FChFCPFNFwFFFFdFQF5(F"F1XF|FF 4FEEEEE0EֈEHE¨D D DD D DD@DDDD@DDD@DDDDD@D DD@D@D DD`D@D DDD D`DD DD@DD̀DD`DDDDȠD`DDD D`E E0EE EPEDD DD EED`DE EpEPE E `E@EE E pEDEPDEE `E@EEE EPEEEEE@E E E EpE E`E E!E/E00E'E%EE#PE@EEEE! E!E" EE@EE PEE E `E E E E EpEE"0E$E EE#E#E/PE4PE;EEEEEFEOEPEDEApEJEKEBEJEHEJ0EJPEXE^@EOPEMpEP0EREUEfE\E[ ELEJEXEaPE\EaE^EdEk E{EEyEXEEE~E{ExEiEc`EfEsEwE EEE0EEEEEEEEs0EsEpEzE`EEEXEEEEEEEE8EEEEEEXEE@EEE`EPEEEEEEPEEEEEXEEEEPE8EXEEEEE EEEEhEEEHEEEEEE`EEEhEEEEHEHEEEE8EEEEE0EEE EHEHEpEEEE(EEHE@EPE`EEhEExE`E(EE`E0EEEExEEEEEEE0EEEPEˀE@EpEE E8EEEڰEEEʈEɸEEE8EϰEEhE8EאEEEpE8ELjEE¸EEEEEHEEE E EHEEHExE8EEEExE8EhEXEhEĠEEEE`EHEEEE0E׀E EEEExEHE0EEEנE`EXE@EFpFF,F F FdEEEEHEFFFF FF F |FXFFFFdF FhEhEE`EHEEE@EHEHEEhEޘEExEEEEpEEE E@F@FEFE8EFF`FFF F FF$E8EEEEEXEEhFHE@EF\F`FFFF"F'tF,F"LFFF#F#F!F"$F" F#F FF#FF$FLFHF<F`FFF|F F TF8EFXF FtFHFXF8FFFFFlFFFFFF,FFF xFFFF FFDE(EEEE@E@EE8EEEEE`E0EEE`E F|FFFPFFFFFF FEFEEpFFF,FFFpFFTFF)F)XF5pF1F8F9F4F00F,F,F8hF3F4DF(F& F'F,F;F9F2F.F*PF+F*F& F#TF,F$TF'F0F;PFB8FA\FAF>F5@F3F=F5F:$F>F9$F1F9F9HF5|F4HF7\F7F*F)F!LF F(8F!F.F-F+F/8F)F(F0`F2F.0F)F&F&FFHFF<FF#HF'<F*F'|F(F,DF#F*F-,F:F9F>FBFEF=lF=`F6F.F+ F'F)FF$FDFFFFFF F FF FFFF F FxF<FFF F4FFtF\FlFF#F1F9FDHFDF=|F3F(<F$F,4F,4F1F6TF:FCFH FH(FCDFOFOLFTFRFEF>lF0$F+F&F*F5FEFbF^FZF\XFldFixFbF`FTFTFV FbF`FYFPFKFY(FTFIFO$FJFPF``Fx\F|pFkxFuF{FxLFoFhFi FiPF|F{dFvFF*FlFFFwFiF[FY FFFHtFBFDFBF6F>FCDFAF6F.F1F4F7F0F"FFFF F F FFF dF F FF FFF lFFFLFFFF%LF!tF&F%4F!F'F+F7F4F/F,F(F,F*F6F=F?F=F-F+hF(F+F8F1F8HF? F;F3F<@FDF?@FFF<F=8F=pF4F4FC4F7F=8F7F8pF@F?FGFRFNFGFKFLFUF]dFf0FcF\FTXFIFNFRFZlF^FoFzpFl`FhFpFoFxFF}FlFyFJFFFFLF|Fy0FsFlF[F^(FV|FY\FeHFVFLFHFGFEHFNFRFP\FEF?F=FIFMFExFKFOFZ@FkxFrFalF[(F\4F]FiFkFutFtFi4F`F]FSFG FDFCF=FL`FQpFO\FbFuFFFFFFFFXFFFFF8Fx|FvFuFhdFcFkFwFxFlFYFYFOFL$F>F<F>FDFH FMFMtFM`FBF@4FH`FK`FJFJFH\FSxFWFYFa8F[ FW<FTFTFNFSFJFG`F6F:HF7pF;FG`FUXFYF_FeFaFZ(F\F^PFYFbFodFxFFF{LFLFsFm\F{XFyFtFyFF:FFRFHFDFFF}DFuHFrFo8Fr`FF,FFFFF6FFFxFmFlFvPFfFFF}Fv0FoFatFbFUFMFFF>F?FFFQ8FXpF^pFsFtFuFFz0FFFFFnFvFiFe@F[F_ F^FS8FQFSDFb$FnlFwF}FFsFtFdFSFCPF98F:F@FDFHxFOFV0FUFTFPFEhFSFHF?FCLFDtFEFDF>F8F7LFBF@FAxFB0FFFDFOF_0FcHFfTFiF^FSLFU FMTFJ4FCFB$FBF> F?PF@F@F<F3F,tF4F5FAtFSFRFVFN<FKFEF@F6F:F@F<FI|FLFOFKFO(FQFNFOFE,FCHF6xF7F6F>FGFN$FM FKFLFUFZF`FSdFQFVdFcPFlPFhFnFp<FpFnFnHFadFbFcFg4F\FY$FSFHF?F4F5F:FDHFAFHFIFSFiFFFVFFFFdFFFPFFFFNFFvFhFFFFpFFFFbFF`FFF\FyDF{FxFYFTHFQ@FYFOFMFWFcFc<FjpFj$FuFqTFwTFFFF>FFJFF0FjFFآFˆFFFFӨFpFFFXFDFFdFFxF"F(FFFFFFF$FFF>FPFF{\FlFiFpFpFiFh FlFfFbXFV|FUPFbFcFf`F`Fa$FatF_F\FaFdFcFbFjlFpF}PF|dF|FFFFFFFFFFrFhFFFFFFFohF`FZFgFkFoHFe0F[PF`TFYFSFUFWFZFSdFLFMLFTXFUFRF\FiFqFlF`tFgF{FFFF FFFFeDF_pFXF^F`Fd0FFqXFsFFFFFPF6FF2F\FF,FFFFFjFHFFFsFoFrFw$FoF}FFF~F(FyFvhFoFsF{@FwFrFmTFvFlFd`FeF^TF]PF_XFdF|,FDFFFF4FF:FF.FFFFFFZFjFRFVFFFpFFFFFpFFFFFFFF:F~F~FjFFFzFFFFFFPFtFFFFFdFFFbFFFFNFFFFFFFFFNFFbFjF|FFF.FFHFFNFFFFFFFFFFF6FHFpFFFF$FFFF>FFFF"FFy(FyxF}0FFFFFFFFFF@FFFVFF|F.FFFFlF^F|FFF~FήFʹFdFFFFFF F0FFLF|FF2F8FFЊFFFFFFFXFF,FFFFFþFF:F&FFF8FFXFhFF0FFpFzFpFFFlF6FzF$FzFFѦFFjFjFFFXFFFFFŠF͎FFFFvFFFFnFF~FFͮFFȂF(FdF˺F|FFFFFFF\FBF,FFF8FFFFFFFnFlFlFFFLFFpFʮFRFG1GFFF|FRF^F0FɨFFF(F@FzFļFFbF͆FFFFFF FFFFдFFtFfFxF^F FFZFdFFrFfF<F|FFFFxFF^FhFFVFFFFF6FFF>FFF`F FFF~F`FFF\FFFFFFFFFFFFF FFFtFF\FȜFFFؾFXFFFFFFF&FF\F FFXFFFvFFFFBFFFvFFF2FrFʴFFТFFѺFxGG1GGGGbFF<FF FĮFfFtFDF*FTFFFF4FFFFFF F(FشFjFhF0FֲFߒFFFvFF2FޮFNFFTFFFF$FFްF̐FF0FƈFFtFFFFF0FFFbFFFxF$F2F2F<GEGGGxGFFFDFߠF6FFFF4FFFFbFFFdFFFFdFFĂFF F׾FFՖFVF̘F2FZFFF FlFvFhFFFFRFF>FFFFFFFFdF<FLF~FFhFFFĸFFFFFFFFnFFF`FFF|FHFFF}hFF.F FFFFXFVF.FtFsFqFmFFdFFbFXFFFF|FWTFFtF;F3F-F,F4F?0FJhFHFHFSF_FVFStFOF`|FxlFFFFF2FFFFFtFFF@FF2FFFFF>FFFlFF`FFFF@FwFjFr0F{F_FeXFqFv`FpFW@FW@FW@Fa\Fo|FF$FF|xFZlFf@FSF3`F%XFDF F#F&FBTFNTFRFZFbFKFA\F+F&F)4F1LF@pFNFV@Fj@FfFgFhFVlF(F(LFF EPEEFEEE0EEEEDDD@DDD D DDD`D`DDD D D@DD@D`D`DD@DDDDD DDD D D D@DDDDDDDDDɠDΠD D D@E0DDE E`E E0E EEE0EEEpDE`E`EEPEE E`EEEEEPE EEE EE0E!E pE&E#E.pE%EEEE`EEPE E E'E+pEE$E4E*E)`E-pE"pEEPEE&pE-E*E( E%`E' EE`E E EpEEEEE pE%`EE& E! EE%E0@E0EE@EKPEB@ETEPEUEIETEE0EBEIEFELENEL`EBESE_E\ET0EME`EKEZE`pEXEXEKESE[EbEoEiEp Eq E{PEExEEE0EEEE}pEmEvPEqEEXEEE`E@E0EEEExEExEE{@E|@EPEEEEEEExEHEE@EEE0EEE(EEE0EEEEEE0EE@EEEEEEEEEE8EXEEEEXEEEXEE@E EEEEEXE8EEEEEEEEEHEHEEEEEE`E`EEEEhE8EEEE8EEEpEEXEEEE E@EEEEEEEE`E EEPEEExEPE8EhExEàEE E8EXE8EE(EېE`EhEEEE@EE0E`EExEݨEE EΈEՈEۨE0EEE؈ÈEhEhEEPEEEE0EXE@EEE EEEEEEEEEEXExEEEـEEXEE E(EްEݰEhEՐEEEEXEވEE`EEpEEEE`FHF F 8F FF EEEE(EE0FF \F F8FF hFFFEpF`FFFEEEE(EEhEEE@EEE@EEEhEEE0EXEEFTFFEEhFFFdFF FxFFFEE`EE@EEEEXFFF(F4F FF@F F'F&lF&F%F(F+ F%TF&F#8F'F&F'`F)F)F)F$F$lF FxF|FFFFFF FF F`F F HF FF `F FF8F<FFlFFlFFFTFFF @F F LFFF FpFHE EEXEpEEEE0E(EFFF0F,EEEhFFxF F @FFFF$F(F(FlEEPF FFFFF$FF F pFFF#<F"(F)F3F5<F;\F. F-F1F/pF2xF2PF/PF%PF'F+F0F6F30F+HF) F(<F%xF(F&pF"F FFLF$(F*F.LF/tF6hF6hF1hF+tF$pF#F-F- F(F$F,F4HF-F/F0xF5TF-F$0FFFF F#`F(F'F(dF%F$PF$F2F-F#F"pF!F,FFFtFTFFFFdFxF!lF!F*LF5|F.F1dF0xF6FBF<0F8,F9F-$F,hF$F%F F F!FFFF4F F |FFHF FF F,F F FFF"pF dFdFF!F%FdF"F$pF(HF,F5F6F;F/,F,F/DF!FF&xF+F+dF2\F2 F9F;hF:FE FOF<FFFAF8F2F%F&F(tF:TFNFgFnpFiFaFkFjhFelF_FZFS@FRFYF^8FZFYFXtFXFU|FLLFO<FRFYtFchFuFwFi$FkFvFmFqHFmFqFm8FqFFFFTFFFF0FoFhFWFP$FJFD4F@F?F8FA8FD(FG@F@<F:F7F5F4 F3xF.LF$F"FFF F F tF FFFFF@FPFF FFF\FtFFFF0FF$F"F<F&F/F/F,F1 F,F'`F'xF4F7F8TF:F6F-F&8F*F,PF4F6 F:F6F6PF=FEFLhFF|F:F5F0HF/(F.tF7F>lF5F0F4F<F<FAFB\FFF=F>F=dFBHFL<FTFQpFO|FOFKFLFKFP0FZpFelFglFkDFg<FYFdpFkFuFtFkFfFmFwFF{F}xFsLFqFcF\`FRFJTFKXFHpFNFLF>F=FBFCFEFF$FHFCDF?F=F@FHFM FHxFGFMFR,F[,FOFKFIFPFWFWF]Ff<FhFaFSFJFEFBFCFE`FIFPFWFV(FmF|F{FFF>FFFFFF`FF~FsFnFoFeFcTF_\FiFn4FvdFpF]4FPFWFIlFFFFFFFJxFJFLdFVFRFKFCFE$F?FGDFGFLFXFUFXFXFRF[FZFV`FSFIpFI`FBF8F@<F9FFDFIDFSFMFXFVLFOFZF_F`LFcPFgFjFjFFy FuFmFiFpFn(FmpFzFFFhFFFFF`FFsFmFuFFFFpF4F6FFFFF{PFsLFfFmFyFFF>FFFqtFbhFaFTpF@(F@(F>FDFKFSFTF^|FjFdFhFqtFuFNF{FnFgFdF[F[hF]FW,FPFJFKFVF_FjFsFxF(FoFrxFiFT(FKF@LF9pF7<FBxFFFQFVFMFOFRLFJFF`FAF9F< FAFFhF?F9`F8,F9`FJFLFKFGF=@F=FGFS(FU<F`4FeFaFWFN(FKFJFDFJXFH@FGFCF9F>F8F5HF4F2F2F;FLFS$FNFO0FHFE`F;F6`F>tF>pFDxFRPFUFVFaF[0FUXFP<FPFG FFF;\F3F9,FCFDFL FRFIFKFSF[HFhFfFeFcFpF}4F}|FFFtFxFqFrFgtFbFg Fg4FdFeFeFUFCtF9F=FA|FPFMFMFNF_F{FFFFFF8F"FFFFFFFFFFFFRFFFFFbFRFFF,FlFsFiFbFm FaF[tF\FWFOFN FSFcFbFfDFepFjFqDFsF{FFFFLFFTFFFHFpFF~FFFFF<FFF^FFZFFFFF`FFFF4FvFF0FFFFNFzFj0FgFiFbFcFbFaFiFdxFYF_F`0FdFiFcLF_FbFYF_,FVFbFfF~FohFl\F|FFF6FFDFFFFFFFFFFFFHFF&FzFr4FFFF|LFxhFm<FlXF^,FWPFSF^F](F[F`tFU|FXF^pFPTFTF`FnFqFrF{F&FFFzFF:FFFuFyFl FlHFhFpFFrFgFyFFFFJFFFTFF.FFFFFFFF(FFFz(FyFF FFFFF~xFHF}F{F|FF|F{,FFFFxFvFk Fc F^FjF~|FFFFFFF0FF$FFFxFtFHFFF~F8FFF8FLFFjFF.FF,FXFvFbFFtFFF>FFF:FF~FFFFF<F FFFFdFvFFFFVFFF\FtF^F,FFFFFFFFhFFFFFFF$FFRFfFFFpFFFFFhFFNFbFFFFFF,FFFFlFFFF@FFFFFFFFNFF&FDFFFFFnF:F&FFTFPFFRFhFzFxFF.F F,FؖFTFӜFFFXFTFFFFFFHFFFpFNFFRFFFFFFFZFFƌFxFFFΜF:FF~FF:GpG GGFFFFFF`FFF FFߪFvFFFFdFZFFFFFbFFFFvFŖFFFFFFRF FªFXF FFFLFȖF<FȄFF8FFF"FFFF@FFF>FzFFjF@FZFrFVFFTFFjFF8FNF،FvFF<GF>FFFFFBFBFnF:FۖFF FvF`FFFFFFxFlFbFĜFBF͚FۖFdFBF,F(FF>FFFFFFFVFrFtF|FFF|FFRF,FFFtF8F<F FF8FF,FFjF FFFFXFBFFFFF\FʎFFFGG FFTFȨFFF F^FFFF^FF,FFFܔFFϴF4FFˈFFFFBF*FFFFFrFFFFFFFRFӬFFFrFFԂFFDFG&GEG!GPGGFFFFFFLFFFFFFF>F|FFFhF$G DFFFFHFFF<FڐFҮFˠF F(FFFNFFF2F FFbFFVFFҲFJFrF2F´F>F|FFNFF(F`FFFGG GYGGGGG QG GF*FFnF~FFBFFxFFBFFnFF^FFʚFFʦF˸FDF2FrFrFF4FFVF2FϬFвFFLjFvF.FFFFRFFҾFΒF\FɼFٜFјFHFϢFڎFFlFLFFFFBFFFrFLF6FFF*FFFFF@FFFXFF&FFF~FFF<FFFFFFxFFyFnFx8F.F,FZFFhFF4FvFF\FpFYFSFShFE\FIFOFJFSF[LFhFZFUFIDFSFp`FhFFFjFbF(FVFFFpFFFFFFFFFFFFFLFFFF.FFvF*FFFxFntFf4FjpFvFBF`FrHF,FuFRPFTFXFZF:FF^8FwHFwF]DF/pF! FhFF&F+F7XFRF;,F?F6dF;FHpF;|F0F*F,F4FOFhFvF[DFY\FZxFShF&\FF@FEFFFF,EFF8FHEEDDDD`DՀDD@D`DD`DD@DD@D`D`D@DD`D DD D D`DπDDРDDDDDDD DD D@D@DDDDDDDDE EDDEEE EE`E EEEPEE0EpE pEEEE `E E0E`E.`E"@EEEE0E @E E E#PE+E+E4 E0PE1E(E' E`EEE!E+E*PE0E*E)E"E1E-`E>E@pE8E(@E(@E-E(E1PE9EAE>E;E/E'0E`E0EpE@EE"PE&E$`E$E&@E)`E)0E%E* E-E9EJEXE`E\pEg EXELpEREIPEEEGEI`EKEOPEOEMEPEM0EYEWEYEZEYEX`EVPEP@E[EUEXEjEtEtEz EzE}EE`EPEEEEEEE{ExEEEEEEE8EEEpEEEEEEE(EHE`EE0EEEEEEEEEEXEpE@EEpEEEEEEEEEEE@EEEXEEEPEEEEXEEhEEEEpEEEEE`EEE(EEhEEXEEE@E@EEEpE8EpEEPEEE0EEEEE`EEPE`EE8E8EEEEPEE0E`EHEEEEEEEEEE@EEXEEEEEPE(EEE@E@EŸE8EExExEE E EոEӰEhE(EE٨E@EEEؘEpEވEEEEExE@EE EEԐEExEEEPEEEEE0E`EEPEE0EǠEE͠EEEĈEpEEEӸEEވEEEExEEpE EEEhEE(EEӐEEEXEpE@EE@FFFF F F F hFhEEhEEFFF \FFFF FFFFlFhFEHEEEEExE8EEE8EEEEEEEEhEE@E0EpFFLFlE@FF\E8EEFF\FE0F`E@EEEEEF0FlF `F FF<F F<FFF(F*HF*F(F*F*,F(F F#@F!@F*F-F2tF6F2F+TF#F\FFF|F$FFxFFF FXFHFF FFFF@F8F@F|FF FFF|F`FFF F F 8FFFFtFFFEEE8EEEEF(F F FHFdEEEhEFFHFF F FFFlF FE0EFpEHFFF F 4FFF$F&F!FHF!F$ F.F5$F:pF6F(F)F/F50F20F+F.<F*F+F-F*F6$F3F'F(F&F%HF#F!lF"F,FF,FF"F)F*lF1$F28F1LF(FF F$F!F!F!F#hF*\F)F&DF*F.8F-F)@FF!F"F'DF&PF%F xF*F$pF FF&\F'TF"F$`FFFFFFFFF F@FFPFF)|F/8F+tF),F+F2F7F9F=(F<,F3F+F'XF%F F$F!XFPFLFFFFF`F `F 4F F FhF F FFTF\FDF"F!F#pF$F%F lF"PF"F%F/F/F+F(F+`F%F XFxFtF#F),F*F4F2F4,F7(F:FFF?,F9FA,F6F&F%<F(F-F;DF]dFa(FnxFjdFiFlFqFl|FjF\PFTFL`FT FZFTFPFM0FQdFSFPFSlFX F^lFaXFoF|XFvFh FxFFulFmxFiFl,FxhF:FFF.FxFFBFFFm\F`(Fa4FPTFLF?FCdFFFELFAFGF:F6F2HF7hF8,F>F7F+F*F$LF<FFFFF F F lF,F|F pFF XF LFF0FFFtF(FF FF8FFF!F-F/F0F- F'XF)F/F7F;F=@F3F0 F)XF,F0F3F`F@FBFEFFFC(F>F=F;\F8FpFKFJFB F=F>LFCFJFTFSFU FR0FHF?0F?FF FKdFIFQFZF[FWFgdFrFuFFVF|FrFFFFFFFyFlXFmFcFfFa,F[FQFVFiDFkFhXFcFa8FTFQHFN,FGFNxFPFI`FJFSFT FJTF@ F<F=F@FEFHLFQFTFT\FTFSFSFZ<F\FTFTFKFEF;0F6,F8HF;0F@FLFMFK4FGFNFQF]F^F`FgFxFzF FFFzFq4FqFxpF{F}FFFRF*FvFFdFF,Ft$Fq0F,FFFFFNFFnFFFNFFLFpxFr@FxF}FFFFFsDFnFkF[FBF@FBFB8FL0FL4FNFNFYF]FZFZFclFbXFhhFdF_$FbFXF]FUFXFRFOFNFOF]FmFxF|FvFo8FjpFd$FRxF=F;pFDF@FJFUtFXFc(FZFR`FQFG<FGFA F5LF4F:F;F9F7tF:FEFIFMFEpFIFAF@,F?FLFLFM,FYtFUFKFJ$FGFM(FOFVFPFEF@F@FAFBF5F.F.\F+F1FJxFR<FGFIFITFDF=DF7F:FAFGFR$F^dF^FihF^FXF\`F\(FIF@F<F?DF:FElFU F`4FhFSFTFWFXFlFktFkFgF}FFFFF FvFxFmFlFmFrFtDFt`Fl8Fc8FQFCFCFJF[FWFVPFVFeFFFFF~FFvFFFFFJFFF4FFFFFFvFFDFFF"FhFFF~FnFnTFj4FkFqHFfF]FYFSFZFaF^FcFeFjFqFpFv@FfFFFFDFF@F@F`F6FdFFFFFnF̪FFF6FFF:FXFF0FFnFfFFNFFfF$FF@FFJFvFFhFjFhFo\FgF`F]FhFfFnHFh|FfFhlFe(FgPFhXF`dFXFZ<FdF`FbpFr8FqFs8F{PFFtFFFjFFFFFFJFFFF4FFFFF|F FFFF<FFF~pFoXFfF]Fq4FvFhF^DFeFbFcFYFfFdFF F~FFFFFF FF8F(Fn<FFFFpFFfFyFfHFxFFFFFFjFFFFFF0FhFFFnFFFFzFFFZFLFBFFFFFF2FFFDFF(FTFFyFsFpdFmFr,FvFFF&FFFFFdF(FFFLFFFFF(FFxFF~FFFF FFdFLFFFFRFZFZFF FFFF<F FFFFFF<F<FFNFbFDFFFFJFNFFFFFFF FFF,FƼF>FF0FFFFFFDFFFFFF FF*F,FFFFFFFFFzFFFFFTFF2FlFpFFlF|F6FFF>FLFFFFFFFfFFFFF@FFFڊF8FF;FǪFFFFtFFFnFF&FF̀FFFFjF$F8FrFpF~F\FݜFF<FڼFFfFҞFF2FLF\FzFFTFŚFFXF2FG G .GGOGG;G GFTF(FFZF(FF"FdG<GGF*FFF,FFFtFFHFXFF^FlFFFFFFFbFFڼFFfFFڸFFHF߆FF FF FFF FbFvFͤFF\FFFFTFFzFFFF.FFFܜF2FxF0FG%G FF FrFFFFFJFlFFFGGFFFFjFFFF(FFFRGFHFFNFVFFFFxF(FFFF*F,F FFLFF`FFbFFFF܀FFF|FRFF@FFFFFFFFFlFFFFdFFVF`FFFRGF&FFϬF F~FFFʦF”F4FׄFF4FFFܖFFxFFFÈFFFF~FƈFF&FFF FFFFFFFrFZFFFHFFЊF@FFGkGGVG*rG8GGFFTFݦFپF*FRFFFFFJFFbG G G\G G nG RGGG G&F.FFFFLF"FFFF,FF F~F׸FDFFFFLFFF`FFF F˚F FF>FĜFFFFG GbG7G$G4G)GGGGG@GF$FFFFFFݨFFFFFݜFTFFJF0FHF F̌FzFFFFbFFFhFFF FنFLFFnFpFՆF"FrFhFFFF$FFFvFF.F FFhFFÊFF*F0F؜FӔF FFFvFFFFF>FF6F8FFXF(FFFFtFPFF2FFFXF2F>FF}TFDFF4FFF|FXFFFRFFFFFfF`F\F^FX|F_FpPFpF]FSXFWFaFkFFFFFF<FjFFFFFrFcFbFfFiFv8Fz|FplF}xF*FhF:FFFHF.FFF}FaTFt8FnF~FFFFHFFFFgXFmTF[FNF\FFjFelFoFFDF5F-FFF.F+\F48F*FF!F$F30FYFO FFDF@tF:4F7FX\FXFq(FuFX4F?(FFPF F,E0F F F F F tFF,FFF FDDDD D D D@DƠDDDDDDDDD D DD`DDDDЀD D`D݀DDDD DD@DD`DD@DDD׀D DDDD DEE EpEDEPE0E E EE@E#E(E@EE EEpE#E(PE+@E+E*E#0EE&E+`EEE @EE0E`E'@E$E3E=@E@E6E6E-E EpE'E-E4PEC E7pE/@E'pE"E$0E3E90E/EAE5EF3XF7\F-F%F'lF%F.F@FQlFhFsFrFsxFg`FnFg4FeFWFZFWFQFTHFTFNLFGtFJFL|FVdFZFRF\F],FeFsFwhFmFoFyFpFgFaFhFZFHF FF,FFFFF*FwlFkF]F`FTFEFDdFFFCHF?F=LF:F9F-F9`F?F<4F9F0@F'8F"F!FFDFFF F F FtF(FPFdFHF FHFXFFhFF`FF\FLFFFFtF#F*F,F/F-F*F0F=FAFGF@\F7dF1LF2F8|F@F9FDXFK F[8FcpFVFJFI8FGLFBF=`F6F6F=F@FHF4F5F4PF5F6(F3F8F7tF4F0F=|F<F9tFC$FRFQxFNFMFI<FDFN4FLFTFYF\dFV8FQFBFTTFdFiDFeFfFlFoFjFgFdDF`FW(FIFHFAF@F6lF6F=$F< F8,F>FJ$FE`FIDFIFDF9F<F?tFCFF@FNFChF?F84F>FDF=(F8F3\F6FA@FIFMFPFPFHF< F?FFFSF\PFW$FVxF\F^F^Fw8F}FvF|FFFFxFF}PFvFkFlFh\F`F`DFXFNFPFOF[FeFeFf$Fb,F^FWFNDFVF]FdhFTFOFWFSFJ F6F:F>8F<(F<FCFG`FLFNFV8FW FLFKFRFP0FLFLFFF@hF4TF48F6F>HFDFLXFIFGFEhFG,FPlFR F[FbFrFwF|8FtFLFlFNFpF~TFFFF"F@FlFFDFBFDF{|FoFtFF~FF:F|F€FFHFFF:F,FF^FuFy,F^FF F$FFzFv8FuFhF[FFF?F=dFAFO4FGFHFKFDFHFFFHFO8FUDFdLFjXFfFYhFWFTF^FX@FYFQFeFoFuF}Ft4FrFnFidF`FR FGDF@FD,FKFUFcDFqFs4FeF\hFUFIFDXFFF<F7F6LF8F8LF9FBlFAFEFJ4FAF@FAF=F;dF9FAFIFJFIPFHFBxFFtFFFVFQFFXF?DFC(F>F9F?F0F.4F)F#F*XF<`FH4FNFGFGFBF@FAXF@FP$FLFVFcxFlFp8FmFsFz4FcFNFGFDXFHlFApFLFXdFadFpF\FZ F],FbLFgFkxFjFqTFBFFF^FFF~\FtF{F{pFwFuFtFFFFiFYpFVFTxFYPF_0Fg\FtFvFXFFF F(FFFFNFPF@F"FFLFFǶFFFF2F`FF2F4F4FFFFPFFJF{8FvhFoFoFh,FcFZFUxF_FdFhFmFnFjFo4Fr@F~,FLFFFFF`F FFFF^FRF|FFȖFޢFF FFFȶFFZFFFF؈F(FFvFFFFFFFF\F\FF|lF*FsFu Fw8FuxFnFoFgFsFgFkFlFrFsFn<Fi,FcFiFepFiF|DF}FFFVFF"FFFF4FRFlFFDFFZFFF|FFFF6FF0FXFbF FFzFF F6Fw4FqF|<FFyFkFj8FiXFkFrFFFLFJFzFrFFFF FFFFxF4FFFFFF FFp|FFF FrFFF:FdFFFzF2FLFFFFfFFFFFDFFnFFFFFFDFbFfF*FvFFF^FFF@Fx|Fy(F~FtFFFFF(FFF F*FnFF4FfFVFFFFFF.FFFFFFF6FHFFpFZFlFFFFFFFFFFTFFFFFHFfFFFpFLF0FFpFFFxFɸF6FPFFrFFFFF FFFFFFlFƬFèFFfFՄF0FFFFFFFHFFFFȒFF@FF~FBFF2FFpF"FbFFFFNFF6FFF*FFF|FfF&FFnF FFdF(FFԚFFFFFFF@FFFFJF FFF4FF6FլFǤF:FFDF FFfFFFNFG 6FFhFFFFLFLFVFFFpF̆FFˎFF(FFGQGRFpGG G|GGFFFZFF~FGGG FJFFFFFɂFFFFFFFBFFFFnF׈FԂFGmG,G F4F>FژFFښFFռFTFFFF FFFɒFjFdFFFdF FVFnFּFŶFhFFFFFFFFFݤFGqGGF&FFF&FlFFFTG GPGGlGGG8FFFF΂FFlFFFpFF$G FFFFrFԮFfFdFFDFBFFPFzFFFFFfFF(FFnF^FFFbFFFFFBFrFFFdF^FF2F FFBFFFRFҴF$FFFVFpG:FTFrF(FFFЦFFXFTFҔFF؈FLFBFFF`FɘFĪF̄FF^GiFbFFFTFàFF4FF~FFFrFբFFF*FFFVFPF۾FBFnGG&uG9G*G&GmG iFFjG FFTF^FGGFF$GGGGFG GGGWGGGxGG GVFFFtFټFNFTF.FFԚFFFFG G G -GqFFF8FFFFF֬FVFFGtG/G%fG8zG+QG67GDFGSG-qGG# GGtGGFpGG G6GAGZG FxFFhFFFF2FHF*F^F~FFƖF,FFbFFF4FZFLFFF0FpFF8FFFFFFFFlFrFFFFFF̀FvF͠F΢FFFFҸF(FFFxFFFlF8F2FFFFFFFFfFŦFFFF`FJFFHFFFFJFF<FhFFFFΆFFhF(FF.FrFFxFnFh FiF{F:FxFtFmF]FPF](Fl|F|$F{FFF:F0FFFFlF|FeF]FTFZFYFaTFgFvFFFrFbFFFzFLF}dFcFWtFbdF~LFFxFFxFNFFF|Fb|F\FU$FWFNFKLFbFf\F8FFbFTF?F,F.F) F-FFLFFF'FBhF|tF]FGFUdFUFKFbFgFFqFVPF@F)XF%F%F F F F FF DFF(FF#F'F!`FD`D`D@DD`DD`D DDǀDD D@D`D`DDDDDDD`D`D`DDDDDD@DDD`DD`D`D DDހD DEpDDD`D`DDE EEED@E pEE E!E pEEEPEE@E%E7@E9E50E8pE>E0@E)E,0E-E&EE0E!E#E/@E!E!E)pE6@E;EIPE=E@E,E"E.E8E7E=@EMEJEApE* E*pE0E>0E?EOE?E:EE0E9pEL@ENpEaEgEeEZEUE?E@0E,E/E5E20E4E4E?E0pE/ E4@E?EGE?pEOEOErE|@E8EEbE`EYENEGE?EJEY@EU0EeEeE_Ec`E^ER EUETEO`EUE[PE`Eu`EwErEEuPEq EEEEEE0EEEE EEEEEEEPEEEEXEEEExEhExEEEEEExEE(EE0ExEEEEEEEE`E EEEEEEEEEpEEEEǠEEȸE˨E`EEEExEE(E(EEEEpEEE@E0EEHEEhEpE E8E EE8E@EΘEĈE(EE ExEEHEpEEpEpEE EEPEEEEEEpEEPEEE(E8EEEEXEXEEEEpEExEPEEE8E8EhEEEEEpEEExEE8EEEE EE8EPEEEEEE`F,FEPEEEpFF8ExEE(ExEExE@E EE0E8EHEEEpE`ExE@EEEPE@EEרEܐEE`E(EpEEEEEEEEHExE@EEEE(EEEEhEEHEEEEEEHFFE0FF FF\F FEF\F HF FF F F F TF FFTFF0F hF FEEEEHEEE0EhEEEEEEE8FEExEEFPFFFFF lF FFF|EhFTEXEFEE0FHFFdEFdF F |F F FF,FlFFF)hF-F+<F/F)HF&F&FF"F%F7$F9F7F3 F6pF-F(F$F#4FFlFF `FF4FFFF FFF DF@FPF,FF FFF$FF,FF,FHF\FFF 4F F <F`FXFPFHFFE`EE EEFxF FFFF lFFDFFFFFF FF ,F F @FF$FFLF FFFFFdF<FdFFF$|F FFFdF)F)F$8FLF FF#F'F#TF!XF+LF!dF)xF'F'LF,F00F(\F&|F'F FFxFF,FFFFF!xF#F(F&lF(4F$FdFlF'|F)F) F*F#(F"F'F)F$F"xF)|F"F TF<FF%PFFFF F!(F$F$8F!lF'F!F PFF,F|FdFFFF(FFF F(hF&F*F0F*F+tF.F,F.|F/F6\F38F0F3$F0F),F(F"HF#FdFdFF`FTF\FF F F F FF xFF$FdF<FF!\F&F%F%FF4FFFFF!F!F$pF|FF F(FhF"F0HF-F*F1 F7F>FFF:F0F(F+F#0F'F*F5F:$FOFgxFoFtpFzFkFgFX\FY\FTFcF\|FPFIFUFWFKxFIFPF[\FTFSF[LFZFfFv0FuFlxFjFmpFk|FeFgFkF}FFFHFFFjFZFFzdFkFhhFgF]tFQDF@F:F@FAhF;F3F7F8F4F6F?F=F48F-(F+,F%F"LFFF(FhFF FFDFFF<FF F dFF<F|FFxFF`FDF F FFXFHFF$ F2pF.F,F7dFFFQFJtFCdF:F8F8F><F@F9FEXFRFUTFVF]XFS`FN`FHFGPF>F3(F1F:FJFO FJpF>F3 F1xF2F6F1XF/F1F2F;F3|F6F9FN F\`FMFHXFOFNFJFQLFTxFS4F^hF\FXHFHdFJTFRF_FTF^XFhDFkDFcF`FeTFYFXFLFB\FJFB\F8F2F7F9@F;F@FBFF\FCxFEHFJFDFKFLXFQhFdF`F^FV<FKFDFBF=F9`F,PF2F:FEFKFMFI$FHtF7$F;xFGFIFNFRFfFjFjFt<Fz4FypFr\FwxFFNF}4F{$F8FzHFdFnFnFcFhF_TFWdF^FiXF`|Fi0FiFmFnFi@FaTFbFVF]FZ,FcPFeFcF_lFUFHFChF=FAdF9<F<F@XFBFRFM|FZ(FZFYF[FZFSFS\FMFUFFF;lF7F:\FA<FQpFYF[<FXFQ`FPFXF\pF^FYFc0FnFFFFFF~FFvFFF>FNFFFF~FFF} FFFFF2FF0F(FFFF8FFFFdFF$FBFvFFF{@FsFn4FlFYTFQFI0FIFEFHFJF=FGFC4F=F9LF8FAFFFUFZHFNFOlFUdFM@FS F`,F_<FdFl\FkFuFrFuFrFq|FuFiFaFNFDXFP`FM F_FoFo FnFjF_FWFPFOFKdFBF:F9,F=TF>F5|F7lF;xF7$FGF?F>TF6 F=FBF?`F>tFCdFHHFKlFOFAFGFJdFG FFFF\F: F9F;pF7F4F+F%F#FF$F1F=FDFE|FCF?F@FJ(FKFNFUpF`FghFk|FxpF|FgFFeFPlFFFHFKFRFZhFZFa|FkFhdFcDFgFmFo FtFy`FF&F>FbFtF^F,FFypF}F|FFF^F8FFF{0FhdFa4FaLFkFeFbFttFwF2FFFF$FpFFF:F~F FFFFVF.F̼FzFFFpF0FFF FFF,F,FFbF:F{F}(FxFvhFvFp4FdFh4FoFuFx8F~xF,FFtFFFFFFFxFFF|FFFFF:FFFTFږFF FFFF͒F FЂFLFGFlF^FFhFFrFFFFFFFFFFF8F4F{FFFuDF*FFFFF@FoFvXFkXFm\F}FlFFrFxFXFFFjFFFFFFFFF`FtFFlFF6F`FFFFVFFFTFlFFvFF|FFFXF{<Fy<FtF{F"F8FFFFBFFFFhFFFFFFFF|FvFrFZFFxF,F<FF0FFFrFFDF:FFFPFFȸFFHFBFJFFFXFFFFDFFFFFFFFxFFFFFpFFTFFFFF8FFF>F&FFFfFTFFJFFRFFhF FFnFFF.FFFFFF~FFFrFdFFFFFFFFFFDFFFFFF~F4FvFpF$FdF.FZFdFFFF FòFFFFF>FFTFF|FFF^FFF.FݺFFTFFFpFFLFrFzF FF^FFxF`FFFFFFFVFF0F~FZFNFFFF(F~F6F&FF6FZFFFFrFPFFFjFFFFFF|G 7G GGGdFFJGFFF:F6F@FFFFЌFFFFFF`FpFFFG fFFFF"GGGG GGSG_FZFFHF FےFFFFGG ZG7GyGFG}FF^F.FlFF F@GvGFlFFF΀FjFlFF~FRFFbFFF~FFpFªF؀FFFlG G1G uFHFFFF.F FުFrFFFМFΈF&FFF\GG mGFxFFXFpF.FFFFFFnF.FFFTG/GQGFG-FFFfFjGGG bGfGkG"G"KGG G 8FF6F&F,FFpFFFfG G GG G:GFFFhF\F&FF$F8FFFF6FDFFFFFԆFFnFzFFЪFFFFXFPFFFFFHFFFFFFFfFFFFܒFXFFFFFtFFFFF2F(FFF<FFFF FҺF"FFFFFGFFbFtF(FFFֲFFHFF̼F:FjF2GF2FFF^FՂFBGGwG.G2G3G9G1GGGG%XG"HGF@FFtGGFG ^GG~GGGgGG?G"-G&'G^G/ G(GGFfFRFFnF`FvFF4FӎFxFFrFGFG GVFdFFXFFFNGFGSGG#GF>Gq*GzGGG\cGlGIGdG.jG =G sGwG"GG GGG'G"GGvGFFFTFZFجF>FnF@FBFFFFFFFFdFFtFFFFpFFFՠFɺFFȠF2F FFFFFF̈́F FFFFFFrGSF0F`FFDŽF<FxFFGFBFtFȒFzFFFźFF,FFFFFFF|FFFFFFF*F4FPFFFFFrFFFFFFFFFF:F:FFFF:Fv@F[lFOFOFL@FRFb`FsFvFFFRFFdFF^Fw\FcF\hFZF[Fq|F~FFFFFFnF|0FnFVFFmFa4Fe$FdF}FzF FFF8FFtF@FF}$FpFjxFYFhTF`Fn$F$F|F_lFtFFF;TF3,F1pF>dF,0F&F%F!F*F0FgPFj4Fc0F~FtF|F{FfFFFFUF/HF<F$FFF" FFF%tFF;F*F@F)FLFD@D@DDEE@D`D`DD DDDDDDހDDD`DD`DDDĀDDDD DԀDDDD`D`DDDՠDDDEEpE EEDD`D@E0EE pE0EPE 0EE E$`E E!EE EEE2E=EGEF@EGEG E9pE,E/E1 E0@E,E"E#@E+E/E3E8E*pE;EPENEAE/E/E,E4E@PE@PEFPEJESETEB0E,@E*E5EFEK@EPEI0ECESEIE\PEaE`PErEl`EXpEQEMEIpE<E1E8pE3 EGpE8E;E6E@EEENESEVEaEtEEE(EEyEbERERpEJEP@EJPEnEPEmEmEc@EoEk EdpEY@E]0E_ EePExEEEEHEE~E EPEPEEEEEEEEEEEEEPEEPE0EEE0EEEEHE`EhEEEEPEEEEEXE0E@E8E`EEEE8EEE(EE(E0EEEE@EhEE8E`EEEPEEHEE(EEϸEPExEEEEEXEEEpEEEE8EE E0EEE(EΰEӸEАEˈEȰEHEEHEpEPEExEE(EEEEEPEEEE@EEEEEPEHE`E0EEEEEEHEXEEXEE`EE`EEEE@EEE8EEXEEEhEEɠE8EhEEXEE EPE`E`EEFFFHF0FF|FXF F,EEEXEEEEE0EEEE8EEEHEEEEEÐEE@EEE0E(E0EEE޸E0EHEpEEEPExE8E0EE۰EEPEE߈E EEEEE EE`EFF|FFFF FFFFTFdFFtFF F tF4FPF F F pF 4FTF`FFFFE8F EFEE@EEEEEEEFFdFLFFExFF,FXF dF FXFFE@EFF$FEExEFFLFFF F FFFFFFhFFF XF/F4F.F.F3F-hF$F"F HF)$F0F;F6F58F>TF8F4F-F,F+xF'F!FFF,FFFF F hFPF <FhF$FtFFFFF!F+,F'(F F FFFPFFF FF ,FFEF`FFE`EEE@F FFFFFF LFFF FF lF xFF(F0FF FFFF\FFFFFFF4FF8FFF#FFHFHF!F"pF#F#F pFFF!FPFTF F#F*F.F)F1HF4F.F-0F.F+LF%F!lF"<F!FF8F F'F#F%F!F#F#F%F F%,F*F-F2F5F+F&F(F'F#HF#HF",F% F#F<F$FF!0FHF4FF"XF,F,F0F'F#F"F"@F|F8FF@FFTF@F#F4F"F,F0F*,F-F5\F0LF.DF/<F/LF3$F*F.F,XF-F0HF-F* F%LF"XF#`FFFFFFFFFhFF FFFxFF"DF&F*0F(F%F%F$FFHFFlF4FF0F"F FFF0F\F F(F,F+@F0F9F>F3F:@F1F.F&F'`F&F'PF1 F<FNFaFttFFFoFdFWFOxFVFVF^FSlFOFSFVDFPFQpFXFV FN0FUHFTFXFcFnFo|FuFrFkFk(F`FaFf@FyhFRFFF`FF4FF2FsFv FpFiFZFOFBTFFlF>F< F8F2F68F84F>F4F5F;F=F9F64F/F'F#FFFFF FFlFEFF FFF FFFFFF tF F F 0F F F FF"F)F+F-F6FDPFJDFIFN,FC0F=F>F>FHFJPFFFRpFhLF\F\`FV FQFGF:F8F.`F0<F3F:FDFBF?pF:,F5LF:F5PF2pF,xF,F3F5tF2F74F<FCFQFNFEFLFKFKFKFOFVFYFXFT0FPFHFJFVFXF[8FXFX F^F`FZPFUdFQFLFIF@FBPFBFAFA,F7F>F<FBDFFFEFEFMFMlFRFiFvFuHF{FqFoTFa@F\ FMF@`F>lF6LF34F4TF?FO@FI$FKFMFDF<FHxFJFLdFYF^Fa$FfFm@FlFjFf FiFs4FvFydFvFvF{Fy8Fr(FwFs(FsFhPFb,FsFrtF}FFvFwFptFsFr<FkPF^F`F[FaFsFgFb|FUFWFPFGFE FCFBFFFAFJ8FP$F`F_FotFhFc|FiF\DFXpFMlFCHF=FAFGFFF_ Fe$F`8FiFhTF_FeFbFZFVF^TFrFFF(FFFFFFFFFFFDFFFdF|F|FFFFFlFFFFXF F^FF,F\FXFFjFFNFFF*F.F^FzhFhFhLFo0FeFShFRFLFOFPPFKTFAF<F8XF5F9F8F@(FTFW(FPdFLFRFUFY4FdFq FbFbFv(FuPFs`F{Fu|FrFoFb\FhFYFSHF_Fc|FgFhFsFpTFuFgFXFRLFX`FNlFDF@FC|F@FC<F8F3F8F8FDPFHF7F4 F;F:F7|F: F?0FEFJFPLFRDFHFEFGFDFDF:F6F6\F8F0F2 F"@FFF"$F/F:\F9F<FDFBFDFLFPLF[F[Fa FlFFFFg0FgFcFPtFKPFW$F]\FhFuFeDFaFuFTFoFjFiFsFzF FFF8FFF0FVFzF~FFFFFFpF*FFFyFwFv$F@F{Fp(FjFuFxFFFVFFFTF|F.FFFFBFbF0FFFFFPF F"F:F\F6F|FZFFjFjFFFFrFytF{FF}FyFxhFFF{Fq4FxhFjtFxF}xFXFFF~FDFLFFFjFFFFFFFdFڸFFFɤF FnFFƞF2FG@G4GFFF\FFF8FFFFFFFFFpFLF.FFFF|hFhFhFF`FFfFFfF4FFx`F{FtFF F@FjFFJFpF0FFrFFFFFȄFJF$FjFFFFFFFzFFF~F`F4F,FFPFFFFFFF|F>FF0FbFĒFzFF@FF`FFFFFFTFFvFlFF^FJF<FFF~FFpFPF@FTFFFF"FFFFŢFFńFFF F͘FFFFrFFFFFnFFFFF,FFFrFFNFbFFBFFFFFȺFNFFF"FFBFBF4F|FFFTFF FFFFbF.F`FFFFpFBFFF|FF.FFFFFF4FF8F FRFDFFF(FTFFrFŰFFjF"FFFF^FF.FFFNFFTF~FFFF6FBFҜF:FFFFFJFFF^FFFFFݲFF^FʹFFFPF8FFTF:F0FFF(FF|FJFFF$FFFFFFFFLFJFzFPFF FTFFPFFFnFFNFGG GG<G)GKG GG\GfFFFFGrGGF F֎FFFfF̨FF֬F^FGgG KGKF2FGGGGmG2GGG FFF>F|FjFnFTGGG!VGCG)G}FFFLFFGFLFFGGG_FFF*FRF*FFFFFFFFHFFjFFFFGGoFG@FFFFFFFFF~GFXFFFGGG GG GFFFF҂F|FF6FF.FFռFْFGGGbG G G *GF*FVFG ,GG G1G"fG6G9G-G-GKG $FFFJFF4GGeGG qG6GG %G)G(GFF˒F°FFRF FFFFF"FFFHFFFڪFlFFFFFFFF^FFFFѲFfFՐFFPFFFlFFdFzFF>F͸FڀFFfF$FF߈FFFF^G `GG9FFF^F`FFFFJFFF@F FF\F0FTF^FFFFЮF>FߘFFFFG G0GFFPFDFF8FGG#>GGGMGWGKG+G${GFGG2G G G FFGG xGGGGG PG +GG-G5G2dGG0_G-G AGFVF\FFFnFFFHF(FrFߘFFF.GGG FFFFGGpGG cGGAGGNCGbuGGGGGGb6G=HG?GGGGJG`GG*G"G"KG KGGG+FFےF FpFيFFhF>F FFNF|FTFF,FFPF.FFFۚFrF$F>FF:FFFŒFF>FBFFFɘF,F FtF<F;FFFF&FGFFRFޘFBFFGGFFJFFFfFےF(F,FFFFdFFFrFF,FFLFxF@F FFFFvFFNFFFF0FuFtFrdF{@FFxFF$F"FFFFqFZFUFVLF^,Fw@F|F~FxFJFFdFFFFFx<Fp8FvFzFDF:FFF FbFnFF.Fh F{Fp|FjF^FhHFrFF{FFFFFFFPFFFuFa FcFj@FMFjlF{pFFjFFF:FA F5F9F9xF2F>F1F*tF#F,FDFwpFrFFFFF{FF|FVFL0FH0F;F-F%$FFFF(8F*F7F5FAFFF6FFDDDРDDD`DDDDDDD@DD@D`D@D DD DҠDDDD@DߠD`ED D`D D@D@DݠD@D`DDD`DDDEpE EEEDDEpEE#PE EE0EEE-E!pE!EEE)E4E@EN@EbE\EHEKE<E:E6E@E:`E>E8E2E?0ESE:0E5E7EBESEcE/E/`E4@E1EKEWEYPEPEOEGEOEL`E2E5`E?pEIEPER0EN EWEZE`Ef0Eg`ExE|E[E]EhENELEOE>EN0EGPEJE@E=EMEKEREZEdEwE}EPEEEEhE@E]EP`EFpEQER@EhE@EE~EErE Eu`EeEg EgEeEEEEpEpEPEhEEhEEEEE(EEEpEEEEE(EEExEEEExEE(EEE(EE EXEEEE@E@EE EHEHEE@EEPE@EEhEEEHEHEHEXEEExE`EEPEΐEHEEEhEEEEEEEEXEE0EEEEEHEEEEEE(E EEĘE֐E8EEPEEEXEEEE(EE(EXE8EEEEEE EEEƸÈE€EEEEEEEHEEEEHExE(EEE0EE8EǸEpE8EEEϨEEXEEEXEHExEҨE0EHEEE8EEPF8FF FxFFF TF8F hFFFF FE EEhEEEEEEEEEXEE(E0EEpEHEPEE0EpEPEEEEE(EExEEEE0EEEE(EEEXEE8EEEEpFxFXFEXFFFFF`F dF FpFHFFxFF F F F,F F FFFFF FhF FFhF@FFFlF 0F |F FEE`FDFdFHF@EE(EFFFFFF |FF`F @F FF F $FFF<F4EPExEFPFF 0FFF8F FFFFFF"F#F$F*F.dF6dF4F3DF9F8F+|FF+F-F2F6FEDFLFHFI|F=F5F2F/0F1F.F)hF)FF$F&F%F!$FFFF0FFFFFF HF+F/F&F$F$|F FxFF F FdFF 0FFEEFF,EEEF<F@F@FF8FFF F F FHF FTF FF<FF F F4F`FXFpFF F8FFFFFpFF4FFFFF%F" F&(F*F'F"FTFlF$F xFF|F F'F+,F0F3F:F=\F5F5PF-F3 F/F'F"F#F)(F+4F)F(F#DF"LF$8F!|F%xF+8F0F1,F3F9F5PF7F2pF-F+(F%4F" F"FhFF@F0FHF FPF0FF&F-`F-F,F)F'$FFFFF$FdF F!|F!FlF(F-F*F-F*0F*F0F2F-F.xF+F0F,F(<F'F0F6@F3F+F+F#F#F F$F%hF8F$<F%F$\F DFF|FFhF\FF"DF)F#F+DF*HF+F!F#pFFFPF FFlF!F&,F%FFXFhF F#hF F'PF*F3F4HF9F3F2xF2 F*@F&F#F`F%F2F?FOXFXxFmFbF$FwFZFWFYHFYF[DFZFNFK(FNFQFRFNFSFUDFPFPFQ<FXF`FhFsFpFnFaFgFaFfFdFllFyFFFFFDF^FFnFoDFlFdDFZF`FTFQFD8F;DF8F9F6\F7 F:F7F=<FEHFE`F@,F@F>F1F%tFTFFF`F@F8FFFF8FEFFF F@F FFFF F 0FF FPF F F`FF(F48F5lF;FGhFO8FM$FHFETF?FEFTFPFQDFWFiF]F\FXFMtFD0F<\F2XF6F3tF,F4F:pFHFOFPFC<F9F9F0F.F.F5F78F7F8F?F@hFD|FLFGFBTFKF=FBFGFMFTFVPFYFO4FKFCPFRFZFPFUFZF[ FWFQFN,FM$FIFCFBFTxFT4FSFBF=F<F:FAFKFEFEFHFPF]Fu0FzF8F@FFFFz@FXlFOHFBF=LF9F6FFFRFFFdFBFfFFFFF FFFhFdF6F FF4F:F F}FF}pFFDFtFFFFF,F<FNFFF\FF6FFúF`FtF2FˎFˎF*FF~FFvFfG hGqG FFF&FFԊFnFFF,FF0FbFFFFFFFvFXFFFVFBFvFnFFhFFF~HFFrFFNF,F4FF<FFFFFFFlFTF`FFdFȶF2F.FhFFFFF"FFFF.FFFFFnF8FFFFZF*FFF`FlFFF*FFpFFFrF FFfFRFFFFFFVFF~FFͼFրFFF؎FFʆF>FFPFFFFɶF$FF$FFFlFtFFۮFdFF FtF(FzFF|FFFlFFFHFFxFFFFF*FFFF¶F6FrFFFFFFFHFF(FFFFFFFFXFNFFFrF`FF:FѮF҆FF̎F@FF@FFFBFNFǀFFFFFbFF\F|GUGGuGGGrGFnFtFʼFpFFJFFF FF8FFFFFF(F`FG G 2GXGFGG OFFFfFFFFFFFtFFxFFFFFZFFFFFFFnFFFFlF(FFFLFFFZGOF.FZFjFFF^G G aGFGG.qG0,G(G"GGjG F2FDF:F&FGIFXFFFFFXFFxFHFG _G 8GFFjGGG%G.G8#G:G G*GgGaFFLFFFG hG GG<G&G'IFLF0FZF`FFG FG>FhG iGFFFFаFbF`F؀FFjFFFFF~FFFFFF~GF<FFFzFF&FFfFFnGG$GGG-GwGXG GG %G GG .G F.FDFF"F>FȢFFFHFdF@FGG {GGGGwGGGGGWGGG/jGEGV{G`GWrG?G<G7GGFNFGSGGG GDGQG G cGxG(oGGPFFF@FFFF F>FòFFxFFFFǀFFFFFF:FFF"FPFFFF,F.FFڤFjFF4FF FFbFήFFLFFFFF@FfFFGGBGGGG G 2GG GFFFF.FFFhFFFFFGyFhFF F~FFGTGGG`GjG@FFGFGGG'GGLGH>GFMGXG@G8G'TG6GG GGqGFFG .GG!;GoG GG}GG+3GWG G1KG/G, G$0GGFFFܬFF0FDFLFFѪFFޒFFFF<G3GGFGG GGGGG G"GGGWGnGwGGGGdG9G;G'GG+EG+WG#G#jG#RG"G(GGOGPG gFFϤFRF̴FFFFFJFFFF4FFjFFFFF~FÖFFF„FxFF<F*FFFFˊFFxFFFPFDFdFF8FFFFGF6FPFFFFG<FFFFjFxFFFFFFFFʬF:FFFFFF FFFhFrF$FFFtFF2FvxFqFlFdF]Fa FctF|DFFFF|FFFFFy<Fs4FiFlFRFF(FFFFFFFFFrFFF FPFF:FFFfFFLFuFFuPFjFbFmFtFuFnFoFhFrhF~FvHFvxFFPFxF}FzLFwFqFaFYFspFs0FzFvF]F:F4F4F8F8 F8hF$F$DFFF0FFF}<FF|FnF"FFF8FktFMTF8F#F)F,FFFtF/F-FF&F7|FAF!TF EED`D`DDD DDD`DӀDDD@DDDD@DDDD DՠDDРDDD DD DD@DD`DD@DDD DD`DDD`EPEEE0E pE EPEEEE E`EE EEE `E+E$E E+PEG0EXEH`ESEfEbENEOpER`ELEQE^E>ELELPEF`EMEOEC@EAE@EREO@EU@EAE/E1E@PEU`Ei E\EXEU`EDEIEPE3E8 ESPEP@EL@EW`EZ@EQ@E`EdEf`EiEmEyE]EXEgpEVESEPEY`EWEJEFPENPEJPEH`ERpE_pEu0EE EEEEE ExEy@E]EV0ES`E^EbErEXEEpEEEEXEyEqE}0EEEEEHEE0EpEEEEEEpE0EEHEEEEEXEXEpEEPE8EEE`E@EEE(EEXEEhEEEhEPEE0EE EEpEExEEEEEHEǐE`EưE(EEEE8E(EEEEEE EEEhEEިEרE(EpEEE EEEEXE0E˸EPEոEEE@EEӐEְE(E@EEE`EEEPEEEEEEEE@EEEEEE0EEEE`EPEEEXExEEpEXEEE@EEEE@E E(EEEȈEEبEpE E@EXEEEEπE8EEPEXEEFF,F FFF FF FF F F F`F FFpFEEEE`EEEEhE EXE0E@ExEEǨE8EPEʐEEE֘EEE`EEEEEhE EEFFTFEEEEEEhEpEF4F,FFF<FDFFF LF\FFF F FFFF|F@FlFTFFFFFFFFhFdF8FFlF <F F FtF dFFFFFFDF $F F F 0FEF4EFxFF\F F hFFFhF dFFF|F <FF 4FFFFXF FF F 8FFFF F4FPFhF)hF&hF+F0(F4,F3F-F2F>DF9,F>F5pF1F'F%\F2F6F=FG\FU FPdFWFN8F>F7F24F2LF.F+F*F&HF-pF/F0F&F$xFFFFFHF!F hFF#F)F+F*F&F&F(FFF<F dFF DFFtFFFlFF`F\EEF0FF FFFFdFF F F ,F F FFFF|FFF FFF F FFFFFFFFFPFFFFFF!F%LF&8F*F,FHF#F FFFlF$ F%4F,F7F5FDFEtFDF?FBlF>F6F.F)DF0F.PF0F-F/pF)F.xF-@F'F-F4F;F<,FCFA8FAFEF;F1F+$F( F"F$F!FFF4F 4F!F!LFDFF(tF.F1F6F/F)F F FFFF|FPF"FHF F$LF+ F)F'F)F&xF#PF&<F*PF+F)F(F*$F,F,F.|F6F3DF,F)LF(XF)hF#F(F,XF,0F0F3F5F-\F#F`FFFFF&F.$F+F2F/F#F$F @FFFPFFF`F#F+F,F&F$F"F"F%|F!F*|F0F-<F0<F6F0F.F1<F*F( FDF|F"\F/F@\FM(F_Ff@FmFtFhtFXFRFWFTtFRdFQFVFSFR8FU<FZFNFP8FTFKFEFQLFPF]Fk Fg`FjF^FaF]F`FdFmFiFzF(FFFFF<F2FjTFp FsFkFa$Fe(F^FZFJTF>tF4F6XF3$F:(F:FBF=FCxFDF=F>xF<F8dF/LF#FPFFFFFF FFF@FdF FFFF FFF<F FHF<FxFPFFFFF*0F7F;FFPFOFGDFM|FMpFFXFKFQFaXFfFh\FhFq\Fm,FchFYFSFHF=F6FE F6F0F5(F<FQFe0FRFJF=F?TF7pF4F7F>F:DF7$F5F<F;LF><FDFH0F@ FJTF<F8F;FGFUFWPFTFPFK FDFDFMFTFV`Fa4F`FYPFZFYFTFQ0FJ8FIFLFKHFM`FEF<FAPFBlF=FLFRXFEFD0FS0F\DFv@FXFFFFFFnF]FPFO`FH,FBFBF?F:FAFCPFBHFCFD0FB(FJFNPFLPFXFj<F|PF{,FsFeFeFcFhFeXFsF|8FFuFt,F}<FyFFTFFRFFFFFFPFFFFFFrFiFd FnDFqFqFFwFmF\FTFRFMhFPFXFadFb<FhFv`FDFZFFFDFFxFhF_4FZ(F\FaF_Fh FyFrFu,FhTFhTFdFiFlXFixFldF|FlFRFFrFF|FF,FNFF\FF$FFFFFw<FqpFzFF6F&F\F FFFFFFF|FPFvFF FFtFFFFFFFFfF|FytFoTFiFlPFqFqFf0F\FKFIFDFFHFE`FHFJDFGFVFODFI FWF[<FeFf8F`hFdFjXFuhF|FFo<FlFe|F_FbFZxFbF`pFeFpFmFwtFFwFg F]FVFJ(FJFHFM,FM,F@FJFGF=tF@dF@TF<FDFGF?FF`FLFB FCFEFG@FVF\TFdHFW<F\<F^lFPtFNFKFGDFM FN`FRFM`F=F3F*F0xF1xF2F= FC0FJHFJFQFRFUFaFkFv8FF~FF<FFz<F{,Fd(F_Fm@Fj|FqFy\FqFsFFFFFFF}FFFbF~F\F0FFFFFFzF~ FLFFFFFFFFyFzFFF}\Fy@FFFrF FFFF>FF FFhF FvFFЮF˲FМFxFFFBF(FLF.F`F|FFF|F<FFFF"FFFFTFFnFFFFF~FFFFFFFFPFFF$F*FnFF(FFFوF.FFFɸFFFFFHF&FFDGG PG#IGG FrFtFFFBFFJF*FոF$FjF0FvFFFFF FFFF`FhF~FZFRFFFF}FXFF`FF@FFFTFFFFDFFF:FGHF׆FϜFϜF.FȺFFFFFFvFFRFFFFFFpFFFF|FF FF0FF$F FäFFFFFlFHFVF FLF2FFFFBFzFFΆFFFF~FpFՐFFFFTFŲFF2FF͢F,FtF&F`F>FF\FFFbFFGFFRF¤FFTFjFFfF,FFFDF6F FlFFFFbFnFFFFFFFFZF0FFFFF6FXF$FFFFlFFFFFFFF\F`FFѤFǸFjFPFTF\F\FhFϢFӜF*F"FFFFGAG.GgG(oG8GG GdGxFXFF:FF>FlFFȶFպF*FF0FFFFG G-GGGGG G1GGGIFFFFF,FF(FFFFFdFF FFXFFFF@FFnFFFFFF`FF0FF.FGPGFGFF4GGGGG%G GG GG6G G AG<G 7GwG$FFRFhF\FنFךFlFZFDFFFfGG G3FlFbF"GVGG 9G.$G2GGGG FFGGFLG G3G:G@G)EG[GG FF(FXGG:GG~G GFFFFFxFFFFFߴFߐF*FDFFFFFzFzGfGXGFFFFFxF\F,FrFpFG GNG;G%G%G9GGGFG5G!GG GGZG 2FFF>F|FFެFFZFGGGG#rG$G*G*~GGGGG+ G;mG9GPGiG{Gr{GCGKG9G$)GG GjGGG GG-G GGG,GG G G FJF\FF2FBFFFFɾF~FFNFFF*GFFFʬFFF\F`FFFԠFФFԸFFFھFrFFFFFFȶFVF̘FF(G,FdFFFjFG dGGG"G%G?G%GGG GFFFFF>F2FHFVFGxF FFGG FG^G+G'GgGBG%hGBG1G%GFFBG{GG"AG qG>GEG_iG^GQGG\G/GGGGGG G GGFG GG F FGGGGXG.0G0GMjG6G!G FZF6FFrF٠FFF:F܆F0F̼F~FFFTF$FG2G|G G G ]F6GRGG GGGGGD]GCGTGeVGx!GGOGUGMG*G4MG0\G4G."GH+G'GGxGG+G GG\FؠFlFŒFFFJFF̾FFFFLFF.F<FnFFJF(F~F.FF.FFFFlFFFÜF FͰF.FFF4FFLFF>FxFF<F~FGFF FFFFxGG FFdFFFFzFFJFFFFzFZFFF F̼FFJFFPFFFFFF,FFFxFsFqFkFhFWF_(FyFFFFF(FFpFFF|FpFFFRFFFFFFFFFFF FzF:FFHFFrFF`FF Fx FxHFFk8FkFgFnF}FeFeF[FSFSFRF[FcDFk|Fq(FFtdFyFZFUPFIFO,FStFOFHF:pF0$F&F'F7F3F6F(F(F&(F$4F(FL,FfLFiFFuFFFFFk`F;F"FFFEFFFHF#FFFFFtF EEE`D D DD D@D DDπD`DD@DD DD`DDDӠDD@DD@D DD DDD`E@D@DD@DDݠD`DE D D E0EEEE*E1`E6E+EEE0E#@E#E(E2EEPE"EE@E'E!E&0E'E>Ed0EsER0EO EZ0EcEZEi@EkPESPEb`EXPEWESE_ES`EREPENpEGECE`EUEGE8@E4`E;@EOEhE^E_EQPENECEIE@EJEBEMEP0E^pEsPEf0EdPEfEgEpErEr@EmEa0EVE`EfEnEYEZEkPEipEWE[ETES@E^@EtEEPEEEE0EXEE}ElE^EcEe`EfpEi@EE8EEEEEEEEEEhEEPEEEXEhEpEEE@EEXEEE8E˨EHEE EEPEEðE(EEEPEEEEEExE EEEPE8EEǨEEpEEEEXEPE@EpE0EEEpExE E0EE8EHEEӨEHE0EEHEEEEEE E(EEpEӸÈEE`EpEEEHEXEшEEPEEE@EE EEEEE8EEE0EHEѸEHEEE8EEΐEXEXEEPEEXEƘE`EڠEӀEEXEۈE܈E0EE8EE E٨EEԸExEƠEEEEEEˆEE`E E(EXEܘE@EEE8E EEEEPEE(EF dF\FFpFPF0FF (F F F <FFFF hFFF\EEEFF@FTFhEpEEEPEE0EȈEEӈEE`EEߨEpEEE@E0EEEEXFLFFF8F8FE@EEEEHFTFpFF FFFtF xF F`F$FFFFFF|FFF(FFhF!TF"FFdFFpFHF 8FhFFFF FxFFFLFFdF FFPFF<F 8FFHFF\F`FFF\F 8F$FF @FFFFFF8FFFF F FFFdF DFF tF\F8FFFFdFpF$F.@F>$F3F:F7hF?F:F=FE FHtFEHF;F4F10F/@F/F:FDDFH,FR|FYxFTFLHFMF9@F5F5F8F.F2F5F0F8|F2@F/F&\FFF,FFPF"F(F&tF(HF+F+\F,xF(HF*F(F!F$ FFF8F F<F FF0F FFFDFFF FF|FF FFFF F dF F F@FFFFFFdFF 0FtFFF$F$ F"\F!F$F&\F'@F"FFF!lF F"0F F)@F3TF/F1TF8F.hF,4F#FF|F!F*F1LF2 FD`FGF@xFLDFN\FADF;hFFlFATF;dF5LF:F7HF;,F<F< F4F4hF3F1dF6F;FCFHFNFHFDFAhF=tF:F/F' F$F#FpF!xFF"xF F'F<FpF"(F(F2F08F6F8F-F)F!FF FFFdFFF#F%F-F)(F!F"`F%F"F%F#|F"|F$0F)F)DF)lF*F)F.F/F&F*F,F/F*F(F1pF1F=F>FDFAxF9F.F,8F"F hFDF+xF4(F7DF/F+F'F(F PF"PFFhFtFFF*pF0F0F)0F!F$F(\FF'F)F0F+8F/tF.F&F#tF%F/$F*F#F F"F1F@FKFS F[F\FaFdFaFQFFhFFFFTFMFOhFQ\FTFTDFV@FOFKFH|FCtFFDFGPFSF^FmFjTFmFqPFcDF_F[tF[FaXFoFoFxF^FFJFFFz4FzPFwFtFoFfPF_F_FVFIF;<F?lF5@F:FCFBFF`FDF>FHpF>xF?lF=|F1`F*F!lF4FF FFFFFFFhF tF FFdF F @FFFF FhF FF \FPF FFF)FDFPF^LFZFiF^dF[<FJFNF]PFbFo FhFj,FcFqFmFfF\FJF?`F@FCFAF;DF>\FCF\Fd FUFM FEFBFBF;F7F8 F7F;@F7tF7F3F9F=pFItF@FEF>F6,FF7F8FAF=FFXFGFBFJ4FIFT$FbFoTF&Fz Fo8FrXFp(FqFm\FkFuFFF&F6FFFFFFFpFFpFNFnF6FBFlFF>FFu$FlFtFllFwF~dFsFpFeFaF[TFXTFZF`FgFgFlFs F>FFFFFFlFu(FgFd(Fj`FsFlFqF>FTFrxFt\FqFeFfFj<FgFxF FdF:FFF.FlF8FFPFFFFF.F*FFPF&FF&FFtFFF F*FFFFF@F"FFFFF*FFPFPFFLFDFFF FFFzFFFsFhF]@FUFO,FM|FPFM0FNFVFT FSFWXFVFTDFcFp0FfFZFc<FlxFhFBFFvFpFp,Fb<FfF^FWF^dFjFpFlFmFxFyFgHF]FQFIFFFNPFXDF[FWFJ,FHFAFAFAFD8F?FCFJFJFVLFMFEFEFKLF^FgFnFiF`FcHFe FYFTFGFPFXFaXF^8FUFJpFAF:LF9F8FAFGdFL FJF\F\(F^FkdF|pFZFFxFxFF|FFFFqFqLF{ FFF,FFjFFFFFFF>FFFFFFJFFFzFFFFjFFFFFF:FF*FLF\F}dF|FFjF|FF6FFNFFFFF4FFFFFF҆FfFlFFxFFF4FFhFFFF8FFFFNF.F FFF.FFfFFFFFxFFF<FF:FFFFFFF8FFFFFFFvF>FFFFXFFFFDFFFGGnG# GG%GHG8FLF`FFFNFFfFFF\FF|FF&FFFFFPFFFFF`FFnF(F0FFFFF>FF,F\FFTFF߮F(F:GGGF(F׆F`FFnF*FxFFF:FpFF0F&F:FHFVFFF~FFZFĀFF>FFFvF.F(FF FFFXF^FFjF"FVF\FFȬFzFtFF:FݒFڒFLFjFF*FFFDF8FbFFFFӴFrFRFlFFfF,FںFFFzGaG GGF FѬFF*FFFFFrFZF F F6FFxFpFFȜFNFF,FFLFF(F*FFF^FlFFFpFRFF^FFFFFFfF2FFˠFF"FFFFFFFFFFHFTFFGFBFGG GG%GdG GG&UG(#GGFFhFFFFFDFِF܀F6GFG~G=F,GG=G G GLG%GGYGGGG G G G gGGGFFrFNJF*F0FFFF^FFFFpFF>FFrF$FfFFFFF͎FFFGGF@FNG 0GhG=G GGG!nG1G9GGaG GsG@G G 0GZGGG RFlFtFF\FFF̸F>FݠFBGhG G PGFFGG GGG4G6G$GG GGGG2GG GG G;6G^.G'G}GGG[G MFFG G G zGGGGFFFFFF>F6F۲F\F^F0FFF~F4FFFFGG GFFFGGFF߾FnFlG,GG:G$ZG(G&GG$G!GGGGGGG5GG GFLFFFFFFGGGZG)$G3hG> G6G(G%[G#G?GISGNGBG_Gc GvGu}GtG|GF>G-G!GGGGG G5GXGGmGG$GFF&GGFF&FF״FFrFJFFFTFNFВFrFHF(FF:FFFɄFFFBFFFdFxF,F@FنF&FF FFdF˂FFFF0FRFF\FBFLFhFFhGGGG$\G'G%G*GGG3GFFFFFbFHF.GGG G GGG LGG GG%GFGO6GSGCDG5wGG'GG=G7GaG0 GD"GWGV GDmG9GJG8EG)GGLGG(GG GGFFjGGFFxG G:G!G)GG,GFG/GGGvG(GFFFDF&FjF>FZFF\FFFFFFpFG 4GiGGGGG|GGmG[GGA9G]GOGRGw GMGIG6G3G&G#pG:G=[GFG! GQGG G FFF(FF"FFFFF`FVFF&F$FԆFFFRF>FFF|FFFPF>FFFF\FFF^FFɞFFϾFπFFFhFnFFFLFFɆFFF4FFXFfFFFF8GFFFhFzFFFF|FFFFF FG G tFLFxF|FFF(FFFFtFLFFFFFtF`FFlFlFhF`FvFxFFFF&FF,FFFFF8FFFvF F"FFFF.FFFw(FsFFFF:FFFzFFFFFF&F,FF<Ft`Fq$FppFrFlFcFRFM`FCFC FHFf8Fe`FlF`\FbTFPFIFEHFE@FJtF=<F9FFtF=\F*HF$tF7FDFE`F1F'FFhFF F8F9FGFXFXFTF[$F9F!F 0EEEEEEPF"FFFF dFF FdEEE8EDՀDՀDDDDDD`D@D DD`D@DӠD DDD܀DDEPD`DDD DD DDDDD DDDEDEEpEE EpEE E4E/pE2E;0E/E30E<E3E70EFE=E*E$ E&pE&E)E)E/@E5`EDE]0EEREMEOEdEi`Eu E@EXEsEmEkE[EDEaEbE\@ERESEU0ET0E_E@E8EBEEEB`ELpEh`E^ESEM`EGPEUETEKEPESE\EdEjE}EkErEbEoEhEk@EkErEapEsEq Ev0ErEgEc@EsEkEZE`E\Er`ErE(EEE(EEEE0E{ Eq EoExEiEv EEEEEHEEEE8EPEEE8EEEEEEPEE`EEEEE`EߘEEEE(E0EEpEEPEȸEEȨEEψEEEpEHExE0EѨE`EɠEExEEΈE΀EpE8EEEEEEEE`EE0EΈEؘE`EEE EPEEhEpEEFhFFFTEEF EHExEExEEEhE E0EE@EE FFEE`EEEXEPEEEEE0EE0EEEڸE(E٘EEEEhEE EpEE΀E(EEEEHE8EHEEEE@EEE`E0EϸEEEEhE8E`EEEE`EEpEEEE`E0EEExFFFFF FF)F(F#|FFFFXF xF FF@FFF F0FFF@EFFF FFEEEEPEEE@EE(E(EEEE8EEEE`EFFF F F FHFpFFFdF FhFFF PF$FHFFFFhF<F xFF#F(F,dF'tF!PFF F$F*<F-\F,F/ F1 F*8F&DF#(F$F"F DFHF!F",F"\F)F!FHFFF!F%F& FFFXFF8F|F F4F4FFF F `FF|FHFFTFFF tF dFFF<FFFPF hFFFFFF|F!\F&F#F F" F$`F0F6F?FEdFG,FGF=F=FDPFPFNFKFCLFA|FpFA F;F9F6lF1`F.F:TF<F7F8`F,F $FF F$F#F&(F.XF3F6F9F:F9F7F2F2F0xF*F#FFhF,FFFFxFF <F F F F dFFFdFFFFFtF PF|FLFFFFFLF#F#F#F#FFFFF F)F%F"F&lF5LF2PF3`F3hF0F0\F(F'F0XF8XF<FAF@FHdFGF?,F2F0(F'TF-F7tF>F>0F=F;FM FUhFYFIFNPFYpFFFJTFEFB F;F<FDFDFCPF<F<F:FCFGFB\FM\FSXFFPFHFFF=lF9F*F$TF$F(F,4F#FF%XF$F$F)F+|F,(F6F>FFHtF;XF3|F+8FF`F|F FTF F)4F'F(DF*F*F*F,F+dF(F%F#@F!$F F&F*F*`F+F1F'XF*@F1F-TF+4F-F3F6F8F=`FHFLFHdFEF;F2F*pF&F#F$F'F.F9F3F0F,\F%FTFHFFFLFF F.\F1F/F.TF)F&$F*F(HF#F"F*dF2F2F0F,TFF4F&DF*F&F*hF,pF5F?FDFNXFVFQFOFWFRFHxF<F=FBFHFRFRF[FZFSlFOFFF=FAFEFOLF[FY@F]FfFrFsFiFaF_8FZ|F]Fd@FpDFlFFFFHF@F}<F~Fu Fs8FgFeF^FXFYFTFQ`FCF9F:F<FBFIFKFFF@FCFFF@ F<F5DF3F4F.F%dFFFF@FF $FFF|FpF8FXFFDFFFF F F F F F FFFF5FDFfxFp Fs FxdFrFYXF\pFUlF]FdFeFf@Fc(FkF FpFlF_DFT@FDFEFVtF`F\dFJFKtFJFVFbFT4FIF@F:F5F74F3(F1`F8DF7F4F9TF7F8F=HF=F:dF8F6FFFR@FbdFkFkFsFkFchF_DF_F_Fc\FiFl\FbF^xFZFShFWPFZFQhFWF`FfFaFX$FYF_FnFpF`F}|FqpFhFm(FFFF$FF^FFFq0FKFI|FFFCF@HF<F=F@F?FCFDFJFPFSXFSF^F]PFq<FsTFzFvF{XFwFyDFuFxFwFFFFFnFFhFFFFFFXFFRF4FFFFhFtFF{@FFnFFlFF{FuFlxFbTFdFaFdDFb@F`LF|hFnFTFF&FFjFJF0FtPFlFj,FrF>F{FzFJFFFF*FwFhPFsFmFrFFFFlFFFFLF<FvF8FFFF`FfF~FFFnFF6FdFRFF<F(FF6FnFFFFFFFTFFFpFFFJFjF6FF6FFFdFFFF||FjFkFWFQFMFOFSPFYF\FVF_xFeLF^xFaFdFa8F^F]FqF FFFzFt@FnhFqLFr FqF`FbFdFd0FdtFf8FhdFj\FfhF[FXhFQ@FQFX8F[F^FY<FMFHPFKFKFJFOFN`FHFOhFUpFY\FVLFPFRlFNF^Ff$Fp F*FtFxFsFgpF_FY(F^FkXFgFcF_<FQFJHFO,FKFGFLFNXFUhF`FjFs`Fv,FqFFF|FFF&FFFtFFFFJFFF4FfFF(FFTFFVF:FRF.F6FF\FF FFFFFFjFFpF FFFfFFFFF~F\FFFFFHFFFFFFF$FFF|FF FlFFFFF°FFRFFNFnF@F&FFFtFFFHFFBFpF*FFvFF F"FLFvFjF0FFFFDFF6F FFFŒFXFFŦFFF`GF"FڬF(FFF<FFFF^FDGGG!G&GGG*GWGG^GFFtFFVFɢFFȰFɦFFvFF*FFFFZFFF"FFpFFFtF2FFFF@F"FFHFFzF`FFGGGG G:FFFFFFFF FlFFNFߔFޜGFFtFzFpFxFFF0FFںFFF,FF|FFFDFF٦F`FFF*FFFFFۺFFFFFڸFFLFFHFFFFFFFFFPF߾FڎFۊF@FFF۞FPFGhGG;G2XG%GG ;FFhFTFFFzFVFF FFFFFFFFFFFF̠FpFFFFFVFF(F"FڊF$FxF`F FFzFF&FFF֎FlFGEFFF߆FެFиFFFrF(FF FGsG 1G GGG 3GG VG(QG2G,G#GG%SGGGG PG GF4FFFPGGSG7G"G'G(GG GvGGGyGGGGBGGFG'G)8G$G'G#GaG'G!FF\F F`FʈFnFFFhF FFFFFLFբFFlFBFGFFFFFGGGAGGGGDG GWG"G.G5G@G6GG*G GwG TG G@G;GGGGFFFFVFFFGG*G.G-GGFFGG#GGGHlG=G2G(gGGsG8GCGCG,G(+G)G.KGMGvG@G GYGGNGG UGOGGG G @GG2FFFFFF6FFfFFhF٦FjFFF|FFFfFFvGF&F FzGjG FF$F*GGOG.rG(G ^G1G*AG"G1G0G!G"wG!G#dGGGG(G GGFFFXGGmGVG GfG'.G)G; GX?GU-G@G5G;GBGC GXJG\GSG`G{GGGGGJ!G4G G#oG-GGGG)G~GfGGGvFFFG}G G 6FpFF8FۂFFFFFϖFFFFLF2FFضFHFF2FNF"FφFtFFFҀFnF F.FʂFFҮFZFFF8FhFFFF0F$F*FF6FJG G6GG*:G*G.G#G*G$#G]F:FFGGGF\FGGzG G{GGsG!GGGG<GGGRGg}GKlGFG4VG-GG GwG0)GY_GhGexGTGHOG=G2G3G6GGG>G GGGG GGkG}FF F,GGG/1G=G5G-G:G+GGfGGGGGAFFFF.FpFFFFՈFFFF2FG XGGGGZGGG"G%gG/G:GTGVGWZGJG6G+lG'G,G/IG9%GG@G.tG!qGDGG$GFZFFVFFFFFFFF&F:FRFF؂F؎FFFvFF.FFZFPFFFFFFnF@FѸFTF~FF҂FF"FBF<F>FZFFJFpF\F F FFF FF FF8F\FF͔FhFFFͦFF.FF~FFF(FJG {F`FFFĸFFhF<F"FFFF|FFF8FFPFFFsHFo`FoFnFflFtFtFHFwFyHFF*F|F|$FfFF~FrF{FFnFFF$FF:FrFnFsTFFF.F\F FuFx$FFFfFZF\FrFFFFFfFtFoF_`FRhF@F6(FCFSFbFndFUFNFX`FIFG<FHFE@FOTF>F7$F$(F#F$F-dF<F:F0FFF FF FF'F3F9FJlFDFB|F-F FtEPEpEE@EEXEpFE`FF FlF pF FFEEEpDDDDD D@D`D@D@DDDD@D`DDDDDE EEDD@DD`D@DDDD DD@DEE `EPEEpE EEE%E!PE*E+E;@E8E8E>E;ECpER`EMEHpE7PE4E8 E,E1pE6@E8PEAENE[E~pEWPEWPEREOE^EpEEE0EEEgpEP@EUpEkEfE`EaEf EMEIpEI0E8E7pESEYEKPEV`Ei EZEQELPEOEUEZEc`EYEeEmEtE|ExEXEt EhEh`EiEiE~E~EypEqEyEyEEzPE} E EtEyEzE E~EEEHEEE(E@EEEE|pE}pEp E}E~ EEEEEE0EEhEE(EhEEPEEEE8EEE8EEEEEE۰EEEEE0EE`EEߘEEՀE`EE E EpEE`EE EXEנEڀEE(EEEE(E EE8EEE8ExEɐEEEEEEEEExEHEEpE(EEF ,FFF FFE EEE߀E۰EEE`EEE8EFFFTF 4F 0FEEEEEEEEEEEPEE(EEEEEހE0EpEȠEE8EHEE@EEEXEhEEEEE EEEEXEhEpEEhE EEXEEEEEEEE(EPEEEPExF`F4F4F F@FFF F/<F6TF:xF,F'F tF FFF4FF0FF F|F HF F`F\F FFF FF FdEE@EE0EpEE8EEEEEPEEFpEFFPFxFFF FFFFDF FFFF FF\FFF"F$F ,F!F'F.<F4F?dF8F9F8F6F2F2`F9TF@`FBFBF:F4F1F,F.LF(8F#F$XF#F'TF) F'dF"FFFFFFF\FHFFFF F F FF 4FFFFF&F-F/F*<F*F(F(F(F%PF(F&`F#FFFF|F|F FF&8F)DF&F$F*F*F+ F,|F6TF>FKFXF\DFKpFH@FHFMFWF_FSFIFPFOPF@F3 F0F;FGlFUFWFXFWFRFFlFKXFKF>F9@F6F>FE8FQFTFLtFE<F8F/F0F)pF.F7FDFL$FN|FG F<F7F8F8,F<@F6F-XF)@F*hF FFFFFFFF FFFFFxFFhFFFTF F FFFXFF%FF% F0F3F6<F2F*F#FF'|F+0F*4F+F1F7lFA|FShFLPF:F8F7tF4F7FF(FIhFJFP F\FQFPFHF?0F7xF3F1F6FFLFTFV(F`FL(FAF:F2 F)F%,F(F2PF3XF9F/ F*F)FFHFFF"<F#F,hF-F8F@dF:F94F3F-HF-F(0F(F-F4$F4F;F4`F&<F$F!F$F(F+F/<F5$F7tF?,FGFOFYFQFOFGFDF?F@F;`FGFSFVDFY FYFRFOFEFEFHFIFYtF^(FVFWdFaHFpFsFrpFoFb@FWFWXF^FbFtFF8FF\FtLFqFoFiFn8FaF]LFXFWF`,F\FNLFH FE FDF?$F>xFCF@8FALFEPFKFNFFF=F6hF8F,F(F$F0FFlFFFFFFFhFDFFFFFFF F |F FF FFF)F/`FG<Fg<F|FFFpFdF`dF_TFbFeHFaFcFuF~|Fw`FFjHF]$FRtFNHFHFNpFJFMFBFAxFG8FPF]dFVFQ8FCxF9F80F0F,\F*F3tF6F8F=XF;F;FAF;LF?F:F;FNpF\FfDFqFqF~F@F|dFyF~FuPFohFsFFqFcFY|F^FjFmF^$Fd@FvFNFFLFuFFF:FFF(FFFFvFF8FnFFFF~Fh`FQFFFGFCF>FBFB`F>PFA\FL\FTF[FXF[Fe\FjFsFFyFTF|Fi`FmFkFt<FFFJFF8F2F8FFFFFFF~FFFHFDFhFFFFDFDFF4FFFFFFFRF*FF{hFpFiFkFpFF\FFFFF~F(F}|FsFuFzpFFFFFF|FFFFLFyXFuFsFFFFFFFPFFFFFFFFFF"FF*F FF8FFFFFnF"FF^FFXFFHF,FFVF2FLFvFjFrFFF F\F&FFBF"FFFF^FtFFlF4Fu8FcHFU FQFUF^tFlFkDFdF[(FaFYFTFf@FdFhFdFzF{0F"F FFF~FF~FnFm@FeFiFiFbFcFcFcF\F[`FQFNFMFMFI FZFM$FNlFKFPFR\FNFNFTdFLDFVPFWlF[F[\FTFQHFSF\FlF}FLF*F{ FsFgFcFi@FotFs,FoTFtFt4FfLF[hFY8FZFVpFXFYF_FetFpFuFx,F}FrF4FF>FFlFFxF4F^FF>FFF,FF0F FFlFFFnFFFFFFFFFFFFF FXF2F"FFdFF$FFjF6FF FFjF$FF0FF@FFFFF,FDF:FFF F̴FBFFFFFxFҜFɪFJF.FFF~FF^F FFFFFFzF FFF*FDF4FFF0F.FFFF~FFFFFFĞFFzF8FFFFF\FTFfFRF¢FjFDFFÌF@GG2G8G% GGGGGG G G FFߘFՒFʞFFNFPF:FLFFFBFFFF2FFFHFǴF:FnFbFFrFFF*FF:FFLFFǴF4FG ]GGQG &G FFFJFFtFFVFFFFnG FF\GF4FFFFXFFFτFڞF@GG F^FFFFFFFvF<FFFFFLFrF:F4FxGKFFFvFFFBFbF FFvFFXGG ^GFFbFF(F(FDFFG+G"G9!GZGWG1G8G#OGF$FFFFҐFFvFFFF&FFFjFF6G 4GGGFFbFFF´FbFФF.F^FFXFؚFFjFdFDFFF.FFlGG^GvF0F.F~FxFFFF&FzGAFlGGwG!GwGG,G%#G/-G:G=G/FGTGGG"G#G(GG GG G GDG}G$GG#uG$XGG G GGGGG':G#GGGG&G1+G1PG9GLGG=GK'G/TG-G+#GKG1FNFFЖF̖FFÆFάFvFF2FF~FGG rG GG+G/G.GGG1G .G BGgGvG G G GGGJG+G8G4GQG2 G%=GGGuGGpG(G+wGiGGG G`G GGKGGGGG0G?=G4G*G;G yGGG&dGBGKGHcG=G-gG$G&GG!G0G/3G6G/xGHmGGGeGLUG G GG#G.G*G&G GVG]G G}FFFFFF"FFF FFFdFFF|FFGFTFGG%G GgG[G cGG QGyG CG3G+*G1G"G"G.GG%G.G)G+G0G)1G%GBG'G^GjGGGGGGGvGJGG8G=XG2GEuGTGalG8G8G5!G@GTaGN*GGGXG^^GGGrGqGGZGIQG15GpGHG(GGhGBGGfG'FFFFF@FGGGGFFnFFFFF,FԪFFvFF@GFF~FFFFF F|F^FPF&FFF$FFrFFFFjFF$F~GGGFFF\FٲFFGGGgGG)G-@G*G-tG*G"GeG<FpFGG GGGG!G26G!GGG!G%G+6G3G71GRDGmGwGw"GhGCwG:9G-wG/G7GWGaZGGGeGThG< G4G6G3+G'-G!,GG!qGqGEGHG6GG,GGFG GG-GHG>3G:GSGEG+G8G0GGG wGGGGGGTGGFjFlF^FӤFFvFF(FG G/G G HG nGGG&G/cG2G:GAGdBGiGGiG7G+G&fG)G9G<G6hG$GGGGGQG F6FFFrGoGGFFFFpF&F:F&FtFF@FŜFFTFFFFFF6FFFFFFÔFFfFFFF2FFFF FnFFF"FFjFFFF"FFFFFشFFjFFF^F6FbF$FPF@FFFF&FFՌFJF>FF FNFFFFHFlFFFFFlFFFFxFpFjFkXFjF[FXFgTFnFfpFlFilFiFkF{F{DFk@FgFhpFrF|FFF.FFFF6FchFlFkF`FaFg(FqF~8FFF>FFF"FF<FFuFpF{dFvF]FMxFIF;F@pFK FOFOFZ\F_F`FaFGFS FrpFC F?FFF%lFFF*F0`F*4F7F#FFFlF FF)FP`FDFGFKFN<F- FEE(EEEEEEpEHEPEF F xFEFFdE߀EҠE0DDEDDD@DDD`DD`DD@D@DDDD@D`E pEE"E@D DDDDDD@ED@DDEEE0E# E EPE@EE*E/pE,E&pE,E:E7E<E@0ECEQEnE\pESPE8pE>@EHPEH`EP@ENEKE[0E^Ei Es0EuEP ENETE[@E|EE|PEEpEEfEMEOEkE~pET0EkEv`E\ ELPE=E7ECEhEhETEbEaE`ETEOPEZpEgEqEv0EsPEEE8EpEEE|pEvEtEs EEEPEEopEEEEEEEEEEEE@E`EEEEEEE EEXEXEE8EEEE@E(EEE@ExEEXEEEE@EEπEEEEEEEEExEEFF FEXEEEEE(EEE@EEEEEE8E8EEhEpE0EEܰEEEԘEE@EhEhEEPEEEܐEEpE(EEאEE@EFF HFFF FF F HFF FEpEhExEEEEHEEPEEFF4F tF dF FlF FPFLFEEEXEEE`EEEE0E@EEEEEEEEEEEhEEEF\FFFpEEE EHEEEEE(EEXEEEEpE`EE(EpEEE`EEFFFF FhF hF0FtFFFF+F:F@F?F6<F-\F&FFpFXFFxFF LFPF F FFFxF0FXFFF FFEE0EE(EPEE(EPFFFFF(FFFFF!8F/F+F.F'FF4FF FtFFF |FF8F(F!dF'F,F.F)F.DF;\FBFL FJ(FGFM4FFFEFI\FKFNFSFGFAF?F<F34F2F2xF)F#F$F&$F'F.FFtFFF"F'8F$ FF!\FpFFPFFdFXFhFhF!F'0F-F/F3FBFCF<F5XF2F.,F0F0\F,@F*F'lF*FFF FdFF$F+(F1tF3F4F3F3F4<F5F?TF>FEFQF\F[hFTFPFQFXFSFSFUFHFJxFC`F24F4F6@FBFJFNFZFPFQFP$FIFNlFJFFFB0FOdFSF^Fn\FhFX4FQFCDF?FA`FBF@|FKFXFSFHFF6dF6F>$F>FI FDpFPFYFoFnFlFiFkFd4FNXFF,FDF>FF@FI8FMxFSFSFFFDFBFDFBFLFYtF]Fd(F`hF\FZhFUFPFG FIFSFX4F](F[FVFgFiFlFgFkFbFXFZFcF{xF\FFF^FFFuFsFfFg<Fi|FgF`FelF|dFkFcDFWFLdFRFHFF FEFFFCFEFNFMFNFE$F:lF74F38F(F'F"F"F#F#F F!\F F#F*F$F!dFFFFF4F!lFTFFFpFdFFF,F<FQFrF0FFFyFq FeF^F^FeFqFmFFFbFFtPFdF`FYFMFJ FJFMFGFEFD0FN(FR|FYPFRF@F8$F0F,F'F'lF0F<|F:F8lF=F:F:FDFB$FI FL0FThFYFnFyFFF>FFF F^FFfFNFFwFu FrFrhFwFvPFvF|$FF^F6FrFFF.FPFFF"FzFFPFFFXF$FFLF FzFc$FTFLFHLFG$FHFFFDFIFTFVFcdFhFk0FFFF\FF FFvFnFsFuF~FF,FFF FFFFxF0FvF&FF0FFzF˜F FFFF0F6FFjFFFFfFnFhFFF~FF{F`FFFFFLF4FnFjFFNFJFJFFFF~FF,FFbF>FrFFFF F^FFFFXF@FF\F6FPFFFFlFFĤFFFZF FFFFFPFFFFjF0F FFF˸F FFGFFFF֐FF~FFFDFF$FFF.FhF<F*F2Fx FnFeFiFsFFfFFmPFjFb FWFh4FtDFuFy|F|tFFFFFFvFpF^F~`Ft@FrFwFpFnLFkFeF]FbFXFZxFSFPFU4FOFKFLFFFBFKFWxFWhFV,F[FPFULFRF^FcXFeFjDFhFeFutFxxFF.FFVFtFqFq`FhFFnFF{FlFc4FXFe$FeLF^FiFn@Fw0FwDF|FFHFFFFFF@FDF FFrFzF^FF|FFFF^FFFF:FXFFZFTFFhF(FdF˺F>FFFFFFFFƾF0FFFFF FF(FPFdFF@FVFFFFFFFF͆FxFFF<FF:FFF`FJFF FVFFF,FFFlFXFF FZFФFF,F\F\FFюFFFFŨF`F̶FĚFFFFxFFFbFFFÂF&FFTGG`G G+F FtFFZFFF†FFݎF G GGGSGGGGGGGG G FF܊FFהFzFFDFGGFhFPF6G$F8FFzF^FFFF|F0FRFF"FF6FTFFFF|FG^G G G4G GFF8FFVFєFF FFFJFXG8G %GG<F.FFF"F’FɦFFFJG{GG G GG ZGGG0G GG\F2FњFFVFFFޤFGGGF<FF FDFXFVFFF|FFbGbG GGG xG^GeGFGGGG3GdmGjGzGPGH_G*`GOG FFFFبFʨFRFRFpFPFHFFFFךF@G@G#|GF\FTFF:F˨FFӸF0FF$F FFFF^FbF:FFFpFF.GG&GGbF~FLFxFF"FFG{GGG2GUG)G+G,uG-G8CG?fGCIGDGNYG2G(GG-JGC&GIaGC]G1G'RG$8GG2G0G3G+G3G/EG~G G GGG#G!G"GGKG GG.G2G?GRG`GhGbGQKGG@G,<GG GFFݠFFVFPFPF F*GG |GGG#qG.G4gG7#GCGHG5G1uG)G"G#~GG'G%SG3G$G2G6G'GG%*G/GR&GWGMG8 GXGG hG(G03G3G;G>G%G%QG#G*GGGGGJG'GG,G8fGU=GI}GC[G=G"G(G$G. GGrGGGJoGCG( G( G$G"G$}G8'G?ZG?vGLGYGGGoiG`:GfGEG*G#vG*mG/3G(qG \G GnGjGFF^FjFFFFFFF\FFFڀFFRF FtF@FFGG UGSGwGGGG8GGGGGJGG)9G?IGG'G-]G7WGAG7G;G3G0GFFDFފF&F׈FF2FFF"FFFFF~F&FTFG GG G GGGFFFFFG,GuGG$GIG+0G9G;PGAG4G'GiGiGGeG vGG#G>G1G0&G)|G$2G"G4G3GQ7GUG[,GdGiGiGGc5GRGOGG=G9G? GOGGG}GdGY4GAG8:G3G2PG,G.G%QG"uG)G.EG$GG$GG G FG ,G.G4G7GMGVGS>Go;GLjG;G;mG#,G G'GG-SG&G GG5GzFFFFRFXFF@FTFFGrG HG GG3cG/G!G9]G=G@GIGPGXlG`GWJG4G2G!GFG0 G0G0GG%GG#GvG GF FFGG|FFBFFFFFFTFVF|FξFFFFFF0FFF2FvFvFFFF FFBFFpFDFZFTFHF FFFFFFvFFFHFzFFFVFFfFǬFF FbFFFFF(F&FF.FGFFFFFFFFnFNFFbFFFvFFF&FF`FbFz$Fs,FjF\F^TFUF\xFYFVtFf|FbFd0Fd FflFjTF^4FUF`TF[F_FhFFF FFFLFFZFRFKFJFTFeFwFFpFFFFFFFF{FqFmF_ FOF;tF1F4HF2F7F6F/F8lF:0FH(FMFOLFHFXTFXHFK(FNxF? F4F5F$F58F"F50F tFFF EFTFFXF@FKFhFOF2pF HFEE0EhEEEEEhEE E@EF0EEEEHEE8EDDEDD D`DD DDD@DD`D D@D@DDDE0E EEDD DD`EDEEE @D DEE @EEE"EE'pE&E+E2E1E!E"PE,EApE<E;E9@E70EQpE_EPEUE<0EPPEaEb@Er EtEiEfPEdEiE[Ea EDEL ER@EaE8EPEEEEpESE[EUEjEiPEf`EqEnpE]EPEGECPE\EjpEgpEaEhE`EV0E_EeEiEp0EEhEEEpEpEEEEwEv0EwEEXEEE@EEExEpEEE EEEEXEXEEEEE8EEXEEhEE(EhEEEEEE(EEPEHEEEEEEE8EXEHEEE@EEEpE8E0EE`F,F F FFFE8EEFdEEEEFE8EE EըEِEԐE8EE8EEEHE EEEEߘE EEPEE(E8EEEEEE@ExEFFF`FF(FF F F (F F0FEEpEEhEHEE EHF LFF F tF FFhFFF TFF F FFF$EFLF`FFFEEEEEEEEhEӨEEE E(EEEF F F F xF8FFxFtEE ExExEExEEEEE8EEEEEEXFFF F (FF FFF FFFF%PF%$F8F?FIF9F9F+FFHFFF hF F TFFFFFFF@FhF8FFF FFEEEEFF8F`F F F FFFHF0FF$8F+F-F+F/F(F$DF,FF$FFFFFFFTF%$F4HF7F;8F4F<,FOFP|FLhF^F`FYlF\`FRFOtFNFU<FcF[DF^HFHFKF@lF>F7TF6F2F*F,F(FF&\F#F$F(F$ F#F%@F&F!DFF!FFPFFFF#\F,F6`FEXFAFDFKFSFGF@0F9xF5F88F9hF:F4F7F8F8hF2F,F%XF+F4F7F=FA,F;XF5pF3F2pF;FEF>HFKFQ\FVFeFe|F]F_ F^FZDFaF`FY FPFOFHlF>FAFJFPFRFSFXFO FTFOFOFPFLFM0FU8FcFoFz<FvFsFixF[FR`FJLF@FOFTF^FRFRFNFAFE\F<F?hF9F7HF9FFRFQDF[\FhF]PF[F\lFcFjFjdFhFp FeFUFFF>@F9F4TF=F5F9F4F7F6F<F9`F6PF74F: F:(FCFA,F>F@@F=<FR FNFPFKFP@FIFHFCFCFFFPFUF[FWF_F`FgFcFlFddFOFAF4F.tF/F+<F4,F9F=LF7`F6F/TF/(F+F+F3F=FEDFIPFO8FWF^(F\<FZFIFHFFFEF@F:FFFG\FEFG0F9|F;F1F/tF=@FH4FJFG,FGTFO(FSFZFYF[hFEF?$F?FMtF\F`HFb,FmFyHFvTFnhF``F]FQFVF^xFUF]4FsFjFrFlFsFlPFiFlFfFVF`FlFFFFfFFFFVFzFqFxFnDFlFq<FpFqFa$F`FRdFT,F\F\FRPFRFIFK<FIFGFHFF`FKFGPFGF6F1 F,F+F&(F/XF1lF28F*F)pF/F/tF*F+FDF$HF$F(F*F$F$F(HF&$F(F,F-F;(FDxF[<F FF2F.FFFk0F\4F^DFc|FkFsFzFpFfFFFZFpFcFSFNFN,FQ@FNFKFJFHFMPFLFXpFQFAF=$F/F-lF,F1F;lF6FB,FGFE|FG$FQ,FMFOFPFV@FfFFFFFFFFtFtFFFFFF^FjFpF~FFFFFFF~FFF FFFFFxFrFFjF|F@FFRFFHF8FFFsF`FUFSFMFBFLFN8FSFUFcF<FF^FF|FFTFFFFFFNFFFTFFJFHF@FFF,FFFFĦFώFײFTFFѠFFFF"F&FFFF,FFFNFFF\FFFFFF>FFFBFF4FFFFFLFFFF~FFF^FF FFZFFFdFFF<FF<FrFF&FXFF FzFRFFbFFFfFFFFdFfFF:FƸF2FȞFrF*F2FFFFٚFFGGGGOFF8F@FF*FXFXFTFFF:FRFNFFrFF"F F.FxF@F6FFF>FDFZFxFoFdLFiFo4Fz4F.FF&F6F0FFF~FF8F{FuF~F}FzdFwFFFuFmhFj`FaFdFZhFKFLpFIPF6F4@F;FGFPFYF[FZtF\FXFiDFrFw FFvFq,FuF{(FF:FxF"FFyF}|FFFRFF,Fx@FuFjFm FwFxFFFF F FFFFdFFFFjF0FZFFJFNFFF8FFLF*FF0FFFFFFFFFFːFFFڜFNFjFÈFFFFɢFzF`FFF|FPF&FFFF:FFF FlFFbFFFFFBFHF*FFLFFFFlFBFFŲFɨF:FFFFŞFфFΰFFFF٪FɨFF^FFHFdF|FF,FFBFFF^FF F6F^FFFFFFF&F6FnFFhFG uGGFbFTFFFzFӂFΘFPFGG GGG!tGGGGqG!{G#+GG F$FF,FܐF^FNF,F&FGnGG eFGFF<FFFFFFFF>F4F>F6FFFFFXFԊFF@F2GG uG@GG2GFFF\FFF*FFFG8G G GGXF4FFF6FĴFFѰFzFxGGGkG'GGSGG GGGYG FF FشFFTF6FnFGG oG LGGGGGF,FFFFFF G GoGG KG AG^GGGGG+PGF2GiGrGGG]Gm'GImGG GRFFF>FF¼FFHFFfFdFFF FG GGG 'FFFFFFHF~FZFF~FTFFFFFfFHFF.FFzF4GG GFFFFGGG KG G%GGG*G&G,G+?G9G>{GKGOGcGWGLrG7G8G7,G7PGBrGPGDG4G/G.G;GOGAG8G3G.G!G(.G*GG%tG!_GGKG"GG)G#G/qGJGG[*GgGdGt|G_,GgGa_G1G"RGG FFFF8FFGGdG !GGG,G)G,G>GLG_Gb GTG?OGiG5G=%GM[Gc'GlGAGA(G=GEmGL.G/G@GLvGB'G2G=G*oG!wGG!GG))G/G( G%G>%GcG`BG_GKG?G4G)SG-G6GE?G?GE?GPGF8G0G"PG"G*G/G8bG@GJmG`GGGGyG`GPG=GG6G1XG*G$IG7G G %GdFFNFFFFFF.F FTFFF֊FF<F̺FFFFF\GGGGGGSG GG G~G G KG CG#GDGG-'G8GDGMGkGT.GBGKG_GIG;G7G@XG4#G9G&GrGGGPGG,G@:GXG_GMG?GT4GR:GfFGwGlqGbGa,GwGGaGGtiG[G`GcGA~G, GG3GGGJG qGFFLFF:FGbG GG$G%G(GGGGF>FFFFlFGgFF FFFFFbFFFF*F.FFGPGGGG6FFGGG GGGG OG PFhFFFGG yGG#$G#G-G/wGV{GPgG-:G.^G(GGGGGG*G6G2G4G%,G/G8GAGD2GYG|GGxGeKGUGmGKGOGbGSGIGCiGcGGoGvUGGnGIG/G8G4SG:~G/\G/:G8GBG=G;G6G*G6GGGG GcG,qGAG<$GIGWGGfwGmG`G0oG(G'zG36G9G4}G)OGBGGGFFӦFFߦFJFFFF*G G nGG!(G0G.G!LG(G.G:GCG8GWGeGLGOG:3G.0G;1GIG2!G!hGGtG,xGGF*F$FFFGGQFFݨF`FF(FzFFFF@F:FFFpFLFxFFFjF{FFFtFFFFFFPFF&FTFrF&FxF^FF$FHFFBF FFvFVFJF4FF:FF2F~FjFF|FFzFlFF`FPFFFFFF4FFFFFF2FHFnFhFFFF&FlFFJFF`F{hFbF]`FVFRF\F_FRFRHF[FqFuF|FzFVFUFRFUF[tFjFzFFF"F*FFPFfFNF?F?FHF[FuFFFFJF@FFF{FtFuFmFZdFKFExF3F1F,TF$`F"xF/<F%F!F#dF4F5FNHFNF8F;FF0FXFXFZhFFF4F*F,xF F&LFF FEFpF FFtFF"F'F F4EEEEEE0EEEpEPEEhEEE EܨEՀE(EEHE@E0E E EE ED@D`DDD DΠDDD@DDDDDDEEEEDEE0E EE D E0E0DD@EpEE'PE&E+E2E;E9E1E7E+E"E&E< E:E30ED@E+pE1EFPEK@EDPEN@EQE`Eu0EoE`ExEvEm@E]EcEaEQE=PEFESEfPEsE~EEEqpEa0EbE[EbE_Ej EnEq@E~EeEXEGEREXElEfE^`EhPEw@Ej ErErE}EEEEEHE8EEE0EEEpE8E(EE8E@E(EEEEEEE8EEExEEEEExEE8E@EEEEEEEHE@EE8EE`EEEHEEEEEEEpEАE@EʸEEEEưE@EEFF F FLFFFFHEEHEFFEE FpFFEEEXEݨEEXEEE(EE(EE8EEE EEE`E@ExEExEEEE@EE0F<FLF xFF ,F#FXF FFFFFF4F `F FLFDFFFF F 4FFFFF FFF FFFF FXF@F TFFF dF FtFTE`FFEEEEEpEE0EpEEhEFF<FFhF |F FtFFFEEEEF\EFFFFxFTFFFFF FFF8F\F,FhFFF F F%F/F/F2F?`FFF@FB,F6<FpFPFFFF@FFF8FF FFF<FpF#F&`FFFF FF\FF hFLF FFLF@F$FXFF\F&F!F#F-F3<F2F6F/F&`F"lFF`FHFtFdFFF,F$F'lF,<F2F8F;FGFIFSFNF_LFpFhFgFbF_0FXFkFnFktF]FXFFTFDF=F6F=$F<F.F*F&F'F%dF*F/F3F0F)LF-F* F-PF*,F-F(F- F)F!(F$F1F@FN<FZFUFOFRFZFW4FH$FFDFFF@$F?F<,F?FGFEFDLFD|FCFCF@dFCFDFEFIFLFDxF>F(F6 F:F>FDHFM<FX\FH FH`FNLFTF^F^FYxFZFQLFYpFVFPFSF[lFclFkTFfpFlFo FoFp8FwtFpFkF\FHF>F7F64F7F7FBpF=F<,F;LF9dF8F:`F=FCFMFWXFQFUFjFrFd8FTFPFX8FUFQpFU@FM\FTFNFVFT0FHF9F0FCFJFI FPdFIFXFUFPhFV`FWFKdFL0FRF[FaXFsFoFzLFw4F{HF^F}Ft|FlFcFhFhFhFVFFF~`FLFrFo FoFj0FpDFjFrLF6FFFFFF`FZFFfFPFF8FFx0Fo,Fz,FndFZFY4Fa FetFUtFZFUF[FUFRxFQLFUF^$F` FPFA4F8F;@F7F7PF0F=DF<F=DF:$F>FBF5F1pF1(F2DF/F2F3F4$F7hF9F:FA@F<FG,FIFSFmFHF0FFF4F`Fa Fa FY F[(Fe Fm|F} FfFFvF`FBF|\Fl,FbF_Fa8F[`FaFe,FbFYF]FbFZdFWFP8FBF3F6F9F>F@XF9FJhFVFSF_HFSFThFMFX$Fh<FyFFFHFFF"FFF|FFFFFFTFNFFFFjFFvFFFhFFFFFfFFFFFFhFFFFFFF FwTFoF_FY`FXF\FUFWF\FXXFcF~F^FFF&FFpFFvFFjFFF$FFF(F\FFF2FFFFVF^FFFrFF̾FFPGBG{FFFF FFF`FFtFFF,F>FDF|FFFFF2FPFFF FFZFFFVFVFbFZF6FFbFFFFFFF`FFFfFHF4FɸFƂFFF~FdF|FЦF:FFFFFޮFFFFFFFFHFFFF2FڶFvFFFFGG G|GtGNG?G \G0GF^F̒FNFFFFFFšFFXFFFbFFFF FF>FF0FFBFPF{FxFshF~FFFFFF\FFTFF$FF{FzXFFFJFnFFyFi\FjTFlFf`Fc4FLpFKFEF9pF2dF:FHFRHFSF\F`4F]|Fq4FzFFFzFtFFtFFFFFF FhFFFFfFjFFpFFBFFtFFFFFfFFHFFF>FFFFPF(FFFFhFpFFFxFHF(FFrFFFnFF6FF^F>FLF\FFrFF(F͒FRFfFFЌFFͰFzFJFFF~FFF6FFF|FFPFFF¤FFlFFHFFFFFFFǸFƮFFFFFF&FF>FFFF&FFFFF&FxFFFFFFFFF FFZFNF8FFFF:FLFFFFVFhFFFF FNG3GGF6FF|FF8FԎFFnFGG rGGGG mGGGG"G)YGAGG IG(F"FbGMF`FF4FGG vG dGGNFFFFFFrFFFFFFFFFpFFFFȐF.FJF2FjFG FFG5G9FFFِFFFFܲFpFPG/GpGJGGFFF^F˺F8FɠFFG2GGGGG+CG!~G+G GvG$lG/G!GfGFF4F׊FɄFFGaGG#eGGGpG G F,FFxFFFGCG GG;G 3G GG GGG=G4GKgGVhGpDGGGs3GjG@dGG G FfFvFFFńFFrFɶFF6FМF.GGG GG_G&G 1FFFvFFFbFޚFGpGFFFFlFtFGGGGFF(GGGtFFGGDG GGGGG9G%(G0aG'5G3TG;kG@GPGaoGZG\xG@4G;GAGIGB>G;wGFGPGRGDG*RG5TGGRGLGEGDGLGUkG`3GTGQG8GGGPGfGeGIGTGg~GbGgGUGUG`GeGNG9G*G*G(8G%/G#nG)G0G&XG'GMG~GG]GZGGG7G3G7NGBGFGERGLGC#GEG7G7bG'vG5hG;G?lGEGIG^<GvGGGGG`GTEGBG7GJG2XG2G&GGfGG[FF8FFFFFnFhG.GG<GFFFFFF@FF~FFG G GG"G%G"{G&GG!GsG"GGfG%nGG&G/bGEGOGdGfG^zGTG^nGItGJMGPG?GIGIG$KGGGGGG[G)G9{G[.GdjGE:G1GIfG\&GaGz1Gz+GzGGGGGGG_:G_GrG>)G(G'GNGFF$GFdF<FG2F,GGGGGGGGGGGFRFXFFFF2F*FRFjFFFFFFߒFxFF F4FF\FG 7GAF~G;GGGCGGGGG"_G#GG VG FF&FGG GGmG*mG2G6GL)GKFGAG/G$G+GSGGzG$G/G/?G0G'G-G<GMGNGZ*GfGGG{CGzGmGrGXGIGGDfGWGcGvGtGGoEGuGrGgSGIfG*G'G/G7RG9SG;.GBGSlGSGVG_G?G%;GGGGGMG"GH>GJGSqGG GUGgGGf3G.NG.NG)BG9UG@GMnGGGG&G^G G2FFFFFG)G&GGG >G GGGNG,GnG"GG(G6G8|GHGP*GHGZ!GBG8G+G@"GIG/GGrGG)GFFF FpFjFFRF~FFFBFFF~FÀF(F4FFFFFFF8FFFlF}FPFFFFF*FFFFFDFFFFFFFFFNF<FFFFFFFPFF FÆFʺF^FFFFZFBFFFFFFFF|FFJFFFFFPFFFFF&FFFF*F0F`FhLFcdFZFWFdF_FKFKFXF~FuF(FFhFVFSxF[FfdFn(FFFZFFF8FFbFL@F=DF?DFFPF^Fk8FiFlFhpFVPFeFoFxF|FeHFJFE\F;F=0F,F,`F&F"HFF#FhFFF/F5F8F3F/0F=`F=FL$FEFSFA$F5xF"F.TF#FFF\E`EEhEFFEEE@EՀE˘E8EEEE EE0EE E0EEEİEEEEhEEpEpEEEEE@E@EEEEDD@DDD׀D@DDDDDDE0DEPEE E EEE*EpE E E E0EEEE&0E%E3E>EB@EME;E7E*E)E+E5EGE@0E1E8E7E@EJ@EB`EO0E_E[`En`EEpExEsEEm@Ei0EeEX`EIEJ@EF@ET Ei0EfEbE0EeEbEcEXEdEc0Em`EcEnEeExEmEUpENE_Eh`EtEgEo@EoE{0EwEvEwE8EPEEEEEEEE(E(EEEEEEEExEHEEhEE`E8EE EEhEEE0EEEEEEEE0EEEEPEEEEEEE@EE`EEEEϘEPEۘEEHEEEEEpExE8FF@F|FFF FFFpEEEF,F4EFF tFFEEEHEEEhEXEEEEXEEXE@EEHF8EEEEEpEEExE8EFPFtFxF F(F&tF'<F+F$PFFFF F4F F FFF lFF \F @F F\FFF$TF(F!TF"8F%F$FFF8F#FFFFF FF FFEEhFxEEEEE`EhEExE8EEXFF F FFlFF hF F 0FFEFEF$FF hF FFPF FFHFHF0FF,FHFFFFF(F!FF/8F*lF1F)F.F2F=F@FCF8pF&FLFFFF#LF!F" F&|F%F$FF#FF F&HF.F)XFFFF |FF F\F@FTFF8FFFtF&F'F)<F,DF)XF1F8 F=FAF>(F:F?dF0pF#FFFtF,FdFF" F$F'0F5F5FFFOFNFWF^ FcFrHFptFmPFxFq|FcFpHF}$FlPFp<FcFTFXFIFEFKFBF>dF2|F+F.,F/F7F;F7F7F3F4F7F58F5,F9LF8F1F.F-LF0F=FYF_lFeFiFcFV<FWFZ,FVFHFLFEFFFOFWF]F[hFRFN FNFPFPFHFIF]8FYFVFOhFLFHFDdFOFXF`F[(FeFkFLFFF>F~TFqxFx`F{F{ FrLFbF[F\Fb<FUFbFhFiFhPF\XFXdFblF^F_FitFzFF@FpFFlF{TFjF\FOFI FPFRFXFWFb$F\8FTFUFMFGFHFIFGFCFAlF>F?F@FDFB,F=F=$F6LF0F-,F+F+lF1F2@F.|F&FFFTF`F-F5(F:FEFL(FXxFlFFFxFw`FuFwFnFcFXFQFLFRFkF~FFFFFnFv,FxFqFtFr4Fy8FsFjF]lFdXFWFRDFIFApF?F>TF@F@FDHFM`FSFdF_FkFeLFb<FYFPTFU FO|FKFC`FH4FXhFa<F{tFjFv`FFFzFtFfFb FcXFb<F\$F^\FjlFuFpFx8FFFF`FFFFpFVFFRFNFF FFnFbFY8FI(FMFKFH(F?F>hF>(F?F@F:F<FFFOFS4F_DF\FVFSFO@FcFX(FQhFW@F\FYFYhFPFQFdFmxFxFFuFypFxFt`FnFF&Fj\FYxFNPFJFGHFFFEFDpFITFEFEFAFBpFC FBFJPFOFXFWF^(FlFvXFuTFeLF` FblFetF_LFZ4FXFPF[4FYPF_FMFHF?4F>FDFNFVFY F[FW,F\dFcFntF_FV`FbF_DFltFFF},F~FFFzFFFFF.FHFF>FFFF@F|FtLF}F|F~4F{XF<F$FFFbF4FF F~FFFFpF~FFFhFFFttFfFfFqFdFdFi<FgFixF^dF^`Fb8FitFa,FVFJ|FFF?F<F=4FDpFDFGTFM|FN FDFG0FE|FFF>pF<F<F=FAFJFQFKFP$FODFGFJFOFjF4FFFF:FFFFmF\F^F[Fq$FFF^FfFhFVFFF~PF4F}FotFuFsFqpFiFcFhF^0FWxFP$FDFFFDF>hF@F?0FHFVFVFc4FcF^F_F[Fq4FrFLFFF*FPFF^FdFF`FFFFvF8FFFxFFxFFFFFFFPFFFĖFFFΨFFFFF:FFF.FFFTFlF`FbFr FmFhxFbFaFiFsF|PF`F&F FzFFtFFFFFFdFFXF.FFhFHFF~FFFFFFFFfFFFFFGGFFF$FFpFƤF.FFFF2FF:FFFFFFFFFFFFFFFFFzF,FPFDFFF˂FFFtF*FFF<FF"FFFFFFFFFְFւFhFFF޴FܨFvFFNFBFFFFGGFFFF(FFFJFGGxG<G G'GGGGFFFFFrFʈF*F&FnFpF`FFFzFnFFFŚFȊF˰FFlFFFlF|FF^F$FFFbFFPFFnF\F*FFFFFFFVFFFFwFwFx,FyHF{4FmhFNpFLFDFBDF@FKFPFZFdTFjFrFtXFFFFFjF FFLFFFFFvFFLFFF4FrFFFFF|FFFhFFFFrFjFF FFFNFFF8F FȮFF:FF$FFĮFFHFF|F0FFFFFXFFFF*FF2FؔFF&FFFpF8F^FPFhFFFdF²FFFtFFF8FFFvFTFbFpFFrFFlFF\FFFҼFXF¦F$FFNFF FPF.FټF׊FpFjFFlFFFFFFNFLFՀFfFTFHFFGqFBFHFGG G GGG.FFFFbF<FFFFFFFFFFtFڐFǪFpFƔF6FF\FFFG GGDGyGG uG/,G0G,G!G$GeGFDFFhGG>GFG ]GG FFFFFFF(FFFFFFFFרFF|FF&FF̔FJFzFFGFFF(GQFFFFFϸFFFFdG<G G G GFHFtFFFF"FFF~G.GG($G,=G,G.sG+G&G%:G*G'PG G GFFXFF*GGG4G2BG(FG#G'G'EGG {FFFvFFLFG GOGG_GGLGGG<G*G3GBGUGiGGGiGQG=BG @GG6FFFF<FF*FF`FՊF FG^G+GG&G0G*GiGvGFxFGGG-FFGGGFF`FNG7GnG_G GGG FG4G vGMG6GGsGSG ]GqGGG" G"GhG'sG-EG4G39GEGGgG_nGoGUGYGDGFGN}GGGB=G<GCGVGF|GNG9]G2G?:GCGMGEGDGBG.G/G6.G-G+G)G&G<G4G'G&VG%G&fG2)GIGbG[G\GYG_XGIG3G,|GG GiG#GG RGGG #G*G'G2~G-bG@2GDGHmGPGPGd/GsGRGOGQQGO2GMGXG`GR;GJGkG}G{GGbtGCG<G^}GW)GGGJcG]GMGTGHG_,GhoGiGZGK)G.G1G.G'wG'GG,G0G-G09GM{GkGGmGiGmGLlG<G?GHGBG>GEGFGCG:GDG0G>G8KG=G@2GE GLGf GGGGXG_ GAfG<GGG7G)>G,G0G%PGGFFFF^FVFjGG G{GZGGMG bG@GFGGBGF^F8FGG GG-(G<GIxGEGG,GOG G@GGGG&G*GAGaWGGvGvtGjGeGgG]kGqG{>G`G^G+GGGGGG-G9uGKGDGHG<GDGaEGY+GydGGGGGGGGGnG|AGfGIG4G!G<GFRFGzFFF FFPF.FGUGGG }GGGG oGFFhFFXFF|FޮFTFFF|FݒFfF0FF$F`FFFFGGF\F4GG+G aGQGGfGGG=GGwGGF@FGbGGGG,G%G0BGBHG@|G5G6vG/G1GhGG#G1 G8VG0hG( GgG'G=KGIGEGP$GhGGxiGGjGGdGYGE&GGG_GGGGGGGcGVGLG)GG/G=G,G;GZGc!GaAGw|GdiGWGLG6G0rG'G bG.GSGGG5G8G=TGUbGQiGeGKG>G:G-wG7G=GKGCGFG8QGNGFF:GFFpG]GbGFVGRGPFpGG aG =G"GGGG"G3GCGDGMGIGBGPGPGSGNGIzG%GGGcGFzFFTF*FFFF&FFF*F&FF4FFFFF"FFdFzFFFBFFnFFF$FFFFF<FF$F͈FF^FF\FFF6FFFFlFFFFFFFFFFDFFFFԄFtF$FFFFFF$FFFFNFF\FFFFFFFNFFFFFFFFRFjF>F\FZFUFPFQlFXFM|FTDFj\FpFgFvFtFwFtFYtF\ F^FqFFFr Ft Ft Ft,FrFUFMF>XF3(FB,FHFXpFJFH$FMFNFaFlFpFvFZ|FPFIF=F28F2 F&TF!F+F0 F2@F)TF%\F*F)F/F3DF: F>F:`F@F/LF3hF0F'xF,FFFF \F FEE0EEEEEEӘExE@EبEhEExEhEEPEHE EEEEPEEEʠEɨE8EEƸEEEEEE% E$@EpEpEE@EE@EpEpDD DDD`D DDEEE 0E @E@E0E0EE/@E9@EE E E 0EEpEpEpE&PE&@E7ECETEM E3E-`E2E,E<EDEEE8E)E10E=0EKE[@EZEhEhExEEE`EnEmExEnEg0EYEWpEHEIENEWEqEfEhEhE^PEbE{PEb`EapEsEhE`PEaEupEhEk@E`EeEfEsEeErEw Ey0E}@EzPEEEExEEEPEEEEEE@EE EEEHE EHExEֈEEEEE0ExEEEEXEE EEE8EExE`ExEE`EEEEEEEEEEEE8E@E0E EEEEE@EXEFEFF FF(FF&F`FF FPF FdEEFFFFF FFFEE`EEE8E0E`EEXEE0FF`F<FDFFFTEEEXEFEEXEXEFFF!F6F7 FAlF/F,F$F8FFFHFF`F lFF<F`FFFFPFF&F$F+F/F+F*F,,F)F#F%F$F.F'FlFFhFFF tF FFEFFEEEEE@E`EhEEFLF@FF $F lF F hFxFF lF FFFFF pFhFFFLF\FFFFFFF#@FF(lF*DFF<FFF)F/<F&F'F'`F'F5dFEFEF7F/F/F"F&F+F/F/F&F,F&LF#8F$F F%TF%F)F0PF%FLFFFtF hFF FtF,F"LFF"dF&F,F+F1F0F3F8pF7F<@FNdFXpFT`FOFPF8F,F)PF#hF"lF$ F%xF FF%$F)F0hF4F?FGFSFTFkF`FclFy@FwFFFFFFFF{FgFgFVFJFGdFHHF>tFEF?4F=xFAF?F?dFD@FH\FJFGFN FBFFF?F:dF3F6F8`FAFQPF^FjFqFkFmFbF_FUFX<FTDFRXFVFRFXFcdFopFqFgFT(F]FXhFTFRFSF\0FWFeFcF_FW@FY@FVFi0Fi\F{,FF~F0F2FFFF~FxlF{FtF`F[dF`FhFfFqF@F{FzFz0Ft4FmFaFhFeFnFy`FFFFFFFj<FZpFP FKFLFRFUFYF`tFdFYFgFc F_FZDFXxFSFRFKFLFJF[@FM0FSFQ@FEF>`F:0F7(F3F7F4F70F6F18F)F! F 8F*F.F9FB|FI@FM<FcFsFF}TFvFqFmFvFx@FqXFdHF[FU F[FghFxF\FZF~FfFFFyFt|FpFrFsFoFrFdLFb\F`FTF^PF^LFWFRFLFRXFRXFW F]Fn,FiFd`FcFa|FatFO4FPFPFSdFIFOF^ FoFpFFFzFF}FNF0Fv\FmFtDFnFr8FwxF}FFlF^FFFFFFFFFF^FFRFFXFFkFfXF`FX`FVFU|FKFQ0FMFCFFFDFAFLFQFXDFj|Fq<FmF_FYF_FlFc8FdlFbxF`tFe(FeFg0FpF{F}<F@FzFFFFbFDFBFFrFmFj\F`(FYFX F\F\LFUFPTFPFQ FOdFGFLlFWDFc FdtFkTFoHF|0Fy,FpFgF_FfFgFc$FZ<F[FYFeFgXFaF]tFRFH<FIFM@FbFjFbTFYFiFF|FoFbFgFzTFF FFF FFF@FFF~F^FFFFRFHFFFFF"FF FFdFFFFF<FF*FFlFFFFFFFFFFFyLFqF<F~\Fr\FxtF|FtFl8FoFp8FgFdF^F[FOFJFIFHFMFKFMFWFS FOFWFUhFWFRFMFTFNFXFbFaF`F[4FXF[F]FjFtFtFFF`FFFFNF{PFqFhFoFFFFFFFFFFFF|FxFyF|,F~FF}F|dFlF^ FcF\PFUFPLFPDFS8FYF\tFk\FlFpFvFqFtFxFzF~F\FFdFFF<FTFFFXFRF&FjFZFδF2FFFF4FFF0FFFFFFFFFxFjFF:FFFF FFFFF,FLFu@FFFxFoFhFtFs\FyF|(F\FF@FFhF^FFFFNFFFFFFF^FlFFFhFFFjFFF"FFFԬFFFGF(FFfF٪F>FjFٜFϜFrFFFFFLFBFFFhFFFFĪFFF8FFnFFFFF@FFFFєF`FFF~F FFrFF8FrF^F&FF"F:F<FFӴFFFFF\F֪FFfFFF FFBFFG FGG dGF FGG AG dGG #GGGGGG iGF^FFHF:FFFdFF0F€FFFFPFFĶFpFɪFjF(F^FrFF FzFFF FF.FFFF>F<FFF(FFF6FFFFFFFBF}FvFwLFy<FuXF\FJlFH$FGFDFNdFWFcFqFpXFvF0FFFFNFHFFFFFnFFFjFF@FFFFFFFFbFhFFFXF$F\FFpFĔFF,FFdFF0FFF\F~FFȂFFF*FȸFF FFXFFF6F,FNFXF0FFǐF2FVFFGGFGGGGF~FRFFDF`F6FFFRFFdFLFFFFFLF8F,F0FFמFFFFFlF*F϶FFFFFFXFfFFFݘFFFpGG%GFGFGF@F܊FݴF*F`GGGJGG+GG+G+GyGDFF<FZFxFFFF՞FFF͢FFF@F<FΤF*FFӬFجFF:FFF0FxGGDG_GG GYG0jG)HG:G+G*>GG EGG:GHGwGGfGGGGVGFFFnFzF۔FFFFآF6FFF,FFFxF:FF˜FFVFŰFɄFϨFFnF FGsFFFF6F׺FFF<FXF,GG;-G=G#FGlFHFF<FBFFNFfGzG9G(G([G*@G0MG5WG&G&G$pG,G.)G01GGGFF<FG+GG$G*yGFG8kG9G42GGFFFFRFGPGSG$ G$GG0GFGG$GG!KG5 G; GF[GdGGGGLG:G"GGGFFFRFޘFFHFFGG\GG9G1+G7G8G9G zGG G<FRFFGjGG_GG :GGlGBGFG G$G+G%)GG G zGG`GGGtGGGG rG*WG3G'G5DG4GCGCGUGkGGGGvGYGMGOGP GAGJG]_GbGBGGNG>G7G<GIGKGM*G@G6nG(+G0G;G>-G7G6G8KGGG(G%G&G+tG7GQGe]Gf;GPGDcGRCGUG@G4\G GGG G G GG>GG#mG;GCrGFG,PG9vG6GCgGBGJmGZGbGZGF2GMGTGZGn|GoRGX/GYGVGqGhGrcGKGBiG@GQ;GHG<:G5G7GDG]{G?#GTG]GkLGY`GI*G.~G"G%9G)G*G5.G5HG9G99GUGvpGGoG{oGGiGL_GE"GE%GFQGF3GIxGB[GLG?fG=KG9GDG9AGGG=GR,G_GlGGG\G\G\=GHGHQGLG:UG0rG29G/>G)cG'G%GFFFGG GjG G kG(G0G,G)2G-GtGfGGXG}G*GG ;G KGG G:GA:GWG^G<GG|GGGGGsG,G-G?G^jGkbG{gGoGnGiGnGaGZuGh_GlGG=G'G!G$;GG&2G5G1GEG@GLGIGRGiGrGGGGGGGGGGiGr8GkGQG7*G GGG}GWGeGFFZF`GFTF.GXGGG G GG GVGFF2FFpFFF6FDFFF~FМF~FFڀFFFF:FF"G G dGkGfG MG fGGXGG)GGAG&JG GG`F6F4GGGFGGGG+G,aG3oG!GQG(rG&G2G)ZG+G.XG:G=G{GG 2G,G3 G:pG`yG~:GGGG}GrGrvGLGeqGXGfGGGGGG_GHG5G'hGGG(G9G>PGIGZGyG|"GGnGpGWGKG;G(G!G.rG7VG1G4/G6G5GGG;GFG$>GUG+G*zG:G=GJG6OG5G;G#GoFJF|FFFBG(GGF\GGFF&FGxGGG!G|G~G&G@\G@G7MG=xGYGZGf!GEG9GBGGGoFF|FۄFtF(FRFF"FFFϠFӀFnFNF<F2F8FFF:FxF.FFFF8FnFFjFFfFFRFFFܪFGG`FF^F$FF^FTFNF"FF"FRFFFFFFF<F2F(FRF,FFrFFFtFLFFFFFFF$FFFFxFDFF*FfFLFF(FFFFFTFFFFFfF\FKFMFIF>FDHFS`FoFm FoFhFwFF~F FyFsF4FFFlDFxFjFnFkFgpFoFRF<\FBFKFL8FaF_FS$FVPFbXFmFyFPF^FETFI,FJDF?0F4F5F-F2F7FUFHF;F?(F@@FCFCF>F>F E:E:E]`EX`EEE50E6EGEREoEEf0EEEHEXE0E~0Ef@Eq EkEpEd`EXPELER@ENE]@EYEm@EdEi@E]ETEYEpE[E[EiPE`E`Eh@EqE|EvEuEzE~pE{EsPEtExE EEEE8EEEEE(EEHEEEEE0EEEEhEEE8ExExEE(EXEEE8E`EEEEEE8EExEEEE0E@EpEE EEHEExEEEHE EEEEhEE߰EEE EFDFFFF|FF#4F#F!F FHF F,F8F4EEFTFPFFFhFpFF F@EEE`EEEPEpEEEFF F(FXF4F PFFFFF \FFEXFFFFF(F>TFCXFBF3F*@F$FF FFFFF@FFF\F#hFFF\F,F.(F34F4<FBF<F6XF<F-F-F)F,PF&DF!F FPFXFFFFFF FF\F lFFEEEXEEEF\FFdFtFFFF F F F FFLFFFPFPFHF \F!tFXFDFPF@FFF#$F'F*|F+F-F'F%FFF!F$(F,F!F#$F&F*FEFHFEF8F5TF7dF,|F-|F,F.F(F-lF*PF(F&FF)F+ F.F0F'F#FFFFFPF"8F&F1dF6,F0F2$F*dF(pF-dF8F6F6F8<F8(FGF\FYF]FWFNFNF@F1F)F!FtF&`F'lF F'`F(0F+F/FJtFSFeFhFjFnFf FklFFjFFFFJFFPFZFxFeFcFQPFKFLFQ<FYFT\FH|F?F@F=<FBFEFE4FDHFEFMFGFLF@xFBFCdFIpFNFY|FcFbFy`FwFwFlF]FVtFQFQFLTFVF^FfFkFo`FlFmFj4FXhFUFX4F^PFZF]Fn@FqLF4FwHFrFlFnFopFFFF0FFFFF|F\FpFsXFiFZLF]FcFq<FtFxXFFFtFFzFrFr8FeFgHFqFxXFFRFFFrF2F4Fm`F_F_<FXFblFbFf4FhFkDFpFqFoFoFnFkFfTFfF\FTF_FYLFVFOFRFPFG4F=pF9 F9 F:DF4@F8F4(F3F/,F5F2F7DF90FBFI`FPF[pFgF|$FFFFwFuF|FyFtFu`FmFcFkFmFvFHFNFF$FF~FkDFh@FkFe,Fq4Fr FxXFoFm0FoFjFlFgFilFcFVFYHFcFfF^XFjFkFeFeFctF`F[FNFNPFFlFA,FOF[FqFuFFBFFFhFjFpFF FFFzF&FFFtFFF:FNF6FFFFFFFBFFHF`FFTFutFwFk<FeF^FbFkFeF]|FMFRFMdFNFW<FdFsFzFvhFkFgFdFuFz@Fs FtFpDFqFF~FrF FFFFnFDFFF>FF"FVFFF|hFnFiFlFe,FYFXFSFWFZFYFXFblFo,FlFt<FqF&FFF8FwPFiHFn FpFcPFiFqFm4FiFi|FgpFd\FZF^FbHFq(F{FsFvFFFFFFFFNFFFFFFBFJFFFFFFFFFFFVFFZFFFFF8F\FFFFrFFBFFFFFF2FFpFFFLFFxFFpFFNF~FvFv\Ft0FxFutFtFpF`FfFdFW FULFXF[`FY$F]`FaFYFXFhFgF^tFbFaFdFcFfFlFxFw8FmhFfFfFiFqFvFFF F\FRFF FDFF@FFF"FFFrFFRFfFFFFFFF{dF{F<FFFwpFu Fp|FuFm|FaF\FbF`FnF{ FFFF$FFF(FFFFFFFFFFFFFfFȘFPF,F<FvFLFPFFFF*F FȈFF˘F@FFFFמF(FFFFFFFFDFvFFdFFBFFF{0F}0FFvF}FFFFFFfF:F FhFFF>FTFlFFnFFFFFFFrFFFFF@FFFF&F۪FFFXFGGNFVFVFRFFFF FXFjFFFbFF FfF*FF FӺFڈFؐFdFFFFFFF\FFFF˒FpFFF`FªFFF|FF|FFFFêFϔF*FΎFjFLFжFFNFFBFFFFʤFfFnFFF,FFGGZG 7GGGG*G GGGWG AGGNGGGnG F&F`F(FhF$F.FFFFFzFFjFTF<F^FFFFFFFFFF8FPF6FFFFFPFZF`FFFFFTF6FtF,FbFFFFFFFhFFFFFF|FdPFRFQFOFRdFfFtFFFFFF*FFFF`FFZFF`FF4FFXF FF"FFFF0FtFFbF,F$FRFFFFFFGFG2FGzFFِFFpFF\FFFF֦F"F8F>FNFFHF*FF6F&FFFFFըFF"F G GkG GSGGFFFFDFFƊFF*FJFFFFFFFjFF@FFRFhFF(FFHFFۮFFFیF4FFFDzFF FlFF`FGFG ~GGGGG>G[GFF@FFG7G GUGkGG G1 G0G1G+GGFFFLFvFvF̴FFF|FDFjF`FϐFFҒFʤFTFږFFtF(F8FF FG G GfGGNG4 G5G6G5G'QG)G&G(;G RG)GG GG?G9G !F FFFxFFF@FF F(FFF.FFzFͨFF(FFDFÔF"FFƐF˪FtGG GGGFFlFNF FڊFFrFGGG0G,G$1GG`FvFfFZFGGQFGvGG0;G1G"G,G1G-cG$JG%G0G+G8G G FFFG*G GKG-G4GLG:G:G:G)'G F,FFJFFGGrGG#G5G"!G%&GG&G%G,GMEGQgGlHGr^GiG[:Gq(G?QG/G&G G6FFFFlFFHFLGGGG GGGG`G5TG@'G6 G7G']GmG KGFFFBGdG G"G)GEGGG.G 8G G7G+vG-G5G:[G&RGkGG#GoG'G'G$@G#G)VG(G5_G1?G6G7[GE:GJpGKGb:GzGjuGx8GyGGbwG^+Gm1Gn$GWGMiGYGRiGT6GDGK0GUGSGGkG1G9G>&G<{G-G6GGGAG5G3'GAGPeGAG(G/G6IGL;GaGqGtGGG4 GGGJ#G6G/GGGGAGMG GG=GG,GGGU%GSG3YG7CG7*G1G,G?GIG[-GNEGHGVGYSGZGjGqqGc8G`GPG]GwGaBGFG@GDGCG;G(G"[G"TG6GfGHyGI)G`G`GBfG=9G;:G#G%lG*G/hG<$G@UGEaGAoGWGGGGGGGhGHpGAGDGEGE6GJGMrG>EG8qG1G;G2G8G6GGGWyGoQG{GGlGWGXhGHGF[G<G0G*G/XG0G1>G-G#@GGfGGG @GGG!G,GAGCG;G7bG+G2 G)G=GGGG MG GGGG$ZG9<GdGOGRQGGG0G$GeGG GG$@G&GBrGefGMGGWGX4GcG\GdG]{GcGnKG_G^GIG1G$G*G"G'G4xG-G=GCGPGXPGQG_GeGeGGGGGGGGGfjGhGvGPG.RGGGGYG=GOGnGGG hGGGG*G]FGBGG4G"GyG FFFFFLF\FjFpFPF2FFFіFFF>FFBFnFGG"GG GGG GG5G{GGGvG"nGGG}FF~F,GGFhFG PGG# G!G$GGG" G(GAGFG1G,G,}G#G!G>GfG-G6G_EG}VGGGGGGGd"Gj&G^CGq~GGG~oGGGGoGJXG"GGGGG$G:GY GlGGGGGGw&GcGb*GDG%G/G>G;G7G)GG5hG1@GG1GdGG%G8GJGYGBGAG'lGG[FdFF@F^FF6GeFZFF2GFF\FF:GGxGG6G%G)G9kG6G.,GPGiGSG9iGA!G:YG2GGGpFFF"F|F|FfF&FBFFZF8FF^FFFFFFFFF*F4FXFFXFFFF>FFFF@FFԬF:F~GGiG'FpFFFF4FFRFDFnFFDF2F>FF}FqFmHF{FzFFFFFFFFDF FFFFFFvFFFFFFFFF(FFFF<FFFFFF{pFoHFQ,FCFATFDF@ F=FS@FZ`F\FTFmFwLFFFXFFFLFFLFBFiFaF`lFnFnF|FkFZ<FJFRhFX@FF*FFFnFpFuFg\FHFFFPtFM4FF<F@hF9xF;|FDFQ@FbFbFhFOhFZFT<Fk,FYFPF?XFHF@dF1F.tFF FF!lF&FF-4F"F F@FEEEE EExE(EEEE¸EEEEEEEE°EEנEhEE8EE`EEpEpEEEEE1E9E?0EE'`E E@EE `EE EEDDDEEE 0EE0E1E&EEE#`E(E4E1E$E `E"E&PE80E2`E-E PE`E"E9EPE\E9E6EKEEPEEE^EQEVpEJEUEb El`EPEEEEpEEEExEE@EnEtElEU@EUEIETE^PEb`Eq0EqEi Ec EhE]E`EdE^PEcEcPEcElE}0E}Ev@EpEEEXE~EE`E@EXEEEHEEEİEExEPE`EEEE8EPEXEHE`EEEXEEEEE`EEEEE`E`E`EE0EEE EEEEEEE8EEhEEXEExEEEEHEEEňEEE݀EE׈E FF |FF)F)F#F"F"8F8FTF FFFPF <F HF@FdF FFhFF,FFFPF\E`EHEPEEEEhEXFLFFFFF F8FFF8FFtFFFLFhF FFPF0F48F>0FGFBF-$F0XF-xF*xF%4F)F*F%0F"FFFDF!PF&DF%F&F*PF8pFBF=FHLFFdFIPF:F=F0F2F*|F)F&F `F#F!pFTF\F FFF F F@F|F 8FEEXEEF$FHFFF0FFFF@FF FFFtFFF\FF$F.F)hF(pF!F FFpFF @F+F)F.dF*LF2F3,F'F!FFFF(XF3dF&HF/F6F?hFDFJtFDtF9F=tF-|F.tF+F,F1HF0hF+F*F*(F(F-|F+F1dF3F4 F0lF,XF0F*F$F(F.F1F8F>FB,FElF44F2tF4\F9F5F=FAFJFQFTF^F\FWFV0FPFBF=F.F%F#FF%F'F.lF/F.F;DFQXFUFhFsFuFwF~F{FF,FjFFxFFFFFFq\FfFbFUFO FXF_|F_FQ$FDFAFE\FHFJ0FJFSF[F]FW`FR,FMFOpFKpFNFSF^F`FcFdFv$FyFw4FqhFhF\F^F\hF[FcFzFxLFkFiHFpF~\Fm0FdlFXXF\F`xFiFFFF^FFv\FzF|(FPFFFFFFZF^FFFFqFhF[4F`FgFqFvFFNFF|F FFFF{hFDFFF FFFFFFF|FuFfFqF{FuFy0F|F{FwlFoFuFF|,FF}FvpFgXFb<FbF`FcdF^F\FVFNFCF@F<FDFIFAFAF?F?FBFEHFEFRtFU8FZhF[FjtFz(FpFFFhFFF*F*FFzDFFwF|FzFnFxFFFFjFFkDFqFgFqFl FqhF{,FtFn\FjFk0Ff Fp(FqF} FpFmFhFb4FaHFkFp<FiFgFbF]FTFRFKdFAFDFRlF`FgDFyF FTFFJFfFFFF*F\F@F4FFFFFFjFFFDFFFnFFxFFFhFFtFFFFFqFkFn F|0Fs4FkXF^pFWF\FX|F`xFa4FuF}PF6F{0FuF|HF}hF}XFFzFF{FlFFFFZFdFFF8FFFFFFFFFFFzFrFtFo<FgFaHFaFkFlFc`FixFiFzF|LFBFF|FFFFFFzFz4FyFdFdFF}F~FsDFqFpFpFyFFFFF(F$FFFFFlF F:FFFFFZFVF&FFFFDFFTFjFnFFFFFFxF`FF0FFF|FFFFFFFFVFFFxFF\FDFXF$FFPF|FFFFFw$F{pF&FtFF{FxF{FyFvF}xFvF|xFxFqFp FftFjDFpFtFlXFnFo FpDFmFoF`F^FF}F}`Ft$F{F8FjFF^F*FFFFF FF8F,FFFFFF>FFFFFDFFFFFFF`F`F4F|F>FFFRFv4FvtFFBFF|FvFJFF<F@F^FFLFFFFFFFrFfFǺFF@GG GXGFFڰFԬFFFFdFfFFnFFFFFpFpFFXF͈FFDFHFFFF^FF FdFFFFF:FFDFF:FLFRFzFFF^FFFˆF>FbFFDFhF@F0FFTFFLFFFjFFʐFFFFFFЌFFFnFGG GFFF~FFڎF*FdFPF*FG%FF4FЦFxF FϖFF FوFFF2FFFPFFFF4F¦FHFFFF"FF΢FPFFF,FFFFtF|FǎFĔFPFFvFxFFjFrF<FFF FѸFFFzFDF2FFGGG G3GLF|F G4GoGG&G" G)GGtGGHG<GyF6FXFF>FF:FrFFFFF8FFBFFFFFFFFhFF\FzFFFJFFFFFPFFFFFFFFF8FxF(FFjFHFFF&FFTFF<FnFs<FaF`8Fj<FJF$F^FFjFFF6F FFFĆFFFdF~FFF~F^FFFʰFFF4FFF0FFFF`F4FFFZFnGG QGGG >GGFFF6F0FЮFՊF FFF6FF>F:FfFFFlFFFZFȲFFFFhFGkGMGG GGG\F2FFFںFRFFF FFFF*FFF>F F\FFۮFF6FFFFFڴFFݜFxFFBFFFFFGGGGqG 7GG:G|G~G GGG F`GjGGG GGGGVGG#GG GFjF(FnFFܘF\FFtF&FFzFԊFڊFFFՌFZFپFF FFFFFfGXG GEG GGG6hG2G1G8G.fG)kG) G7G9?G/G"G'G G "G GG GCGGFxFFߪF.FF|FlFJF\FF"FlFFFFȺFĆFFFFRFFBF|GGGIFF߮FF׀FF>FFGGNG4 G+dG%GGWGG *GRG _G GGG,GtG/CG)VG+G.G4hG0G(G*!G;G/0G5G]G 8G GFGG (G-GK GD!GPiGaGG~G6G.GGCFFFFvG_G 5GmG2G4G.G!oGqG9yGH>G`GjGyGsGtGlGZ6G>'G,G)GwG GG GG GRFFnGG 0G7G KGG*;G8G,GBGHGE G&LGBG G <GFFGG G;G 2GG (GeGGGG#G2 G3>G6G5G6pG6G$fG*G.G2G) G-G7G?G,G;G;DGG6uG#G#G -GGTG G mG9GGVG+G6G9G>BGBG1G<G)G%mG)^G1G<G@G<\G3 GEhGWTGYGY?Gn5GC GI*GIGZG~}GOG=G;.GCG:G7dG&GG!G(VGKG;(GC`Gc)G]GAPG@G5XG>G0G7G:PGN*GLG;GSWGXGGumGGGGGpGxvGXGPGZGgkGRGQ2GL@GBG-G*+G"/G2G?G+XG5GFGQjGdGsG[IGNG;G;G6G/G,G'G8GG;GCG+ GG%G$GG7FFtF`F߾FFFF:FRFْF`FFPF FFFfFFFFFFFFbFvFZFRFFFFFFFLFTF˰FКFF<FF>FFF`FFFFFFFJFfFF(F~F{FshFjFsdFFFFFFFFFFF0FJFFFRFFFFPFFHFjFFFFFFFFzFFFFlFFlFaFKtFFFAFM<FMXFUTF`LFgF{,FFFFFFFFFFFyFFuFkFu`FF}FcFkF` FZ<FpFFFFRFF}F]LFKF6F@HF@FDFL`FPTFPF>FHFPTFaLFStF<`FRFf\FnFF~FFn,FD$F4F)tFFFHFHF)(F&F)F<\F5dF%xFF4FEEEEEF|EEEE EEEEE`EhEEExEEEEEhEEE(EEE@E@E&@EE/E3E- E(E+EEEPEE 0EEEDD E EE$0E`EE5 E6 E'`E"E) E1E-E4@E60E4E#E1E,E-PE,0E,E%pE.E:0E?EXEJ@EC@E>ELE9pEMPEUEKE^pEhpEtEyE0EHEpEEEEEEEEhEEE}EhEWE]EP`EWEaEm@E8EXEnEhpEd0EhEjEdEeEc`Ec@EpPE}EEEE0EEEhE E`EHEE@E`EEҘEpEPEXEEE0EEŰEEhEhEEXEEEEEEEEEXEEEEEEEXEpE0E8EE8EpEE8E0EEEEEEEEPEEEEhEEEhEEEEE@EE@EF ,FF/dF8XF;lF+FFFFFFF\F |FFpF hF dFF(FF F4FdFDF8E8ExEE`FFF$FDEEFFFFhF0FFFF F4FF FFFFdFF!F4xFD,FODFD F7F7F2F8F3F:F?F8F0F#8F dFXF HF$F!F$8F%F4FOFDFHFKFK8F?|F;FAdF@F4F6F0F,TF!pF(DF'FFFFFFhF8FFFFFhFFFtF F`FF<FF `FFF\F F\FF%lF&FFF$\F%F.F:8F/F$F&F$F&$F%F" F%F,F+F(F.TF4@F.F+F.F"dFFF'F/4F5FC4F=DF<,FChFGPF=hF<F9F0F+F.|F:4F:,F1F0F1F.xF2F4XF;F<FBFBF9\F2F2,F.F0F1F;PF? FJdFNFEFBF>FEFEF>XF@FKFYF]FS<FVFcF\FVFLFHPFBxF7F(HF!F$F\F)4F1LF7XF:pFHPFM4FjFn FFFFFlFRFHFPFFFpFF"FFF{(FoFePFf4F]Fa|F\Fe4F_FPFSFQ$FMF[FTFi(FkFjF]TFYFZFZDFQ0FMFUFXF^ F]Fi Fh@F~FFyFqFaF[8FcFiFdpFqF}|FnFgF~FxFsFlFXpF]Fd<FwFF,FFF6FFFFFVFFF^FFFrFF FFF|FkFnFxDFF0FFXFFRFXFFFF FFF$FFFFLFFFFFFFFlFFFnFFHF}FuDFzF&FF`F~FrFjFcFcFi(FhF`,FZHFW8FLFKFKFRFNFJFDFHXFI FXXFXdFZ,FWFnLFtFl0Fz0FXF FFF&FBF|FFFFFFFFHFyFxF&FTFFFFFqDFjFoFpFFwHFxFsFmFoFo$FxFJF@F@F{FpFiFm@FnFiFs8FlFiHF^F\FYFRXFQFSFalFoFsF|FFFFF|FFzFFFFFF.FFFFF<FFĄFFZFF$FFFFFFFFNF4FFF(FFfF~0FtlFx$FgF``F_FaFbFg`FnFw|FF}FxFwF\F{F4FFFFNFFF@FrFFF.FFVFFFFFF FF:F0F(F6FxhFuFtFmFlFkFeFlhFs FF FtFFFFFFFFFFhFFJF>FF FFFFF|8FFjF F`FFFFF.FFFdFF FF,FF,FFFFF\FFF.FڬFFF˦FʈFоF͔FLFFFFFFF"FFFFjFrFӶFNFfFXF0FFhFFvF,FFFFFFdFFFFF6FFFF*FjFFFFFFFpFFpF$F~XF|F~F~HFyDFFF&FNF6FFFZFFF~FF8FFFFfFF0FhFFFFF4F~FFFFɎFFF.FF\FFFFFF2FFFtFFFNFFFVF.FFFFF FF,FFFDFNFJFFF(FF4F*FF FFFѸF|F(G G.G GF~FFFNFFFF@FΖF0FlF8FF8FdF׌FFnF(FFZFFNF~FDF̈́FFFFFF:FFdF2FFFFFFFFFF$F0FׄFFTFFlFF0FFFFjFFF6F®F2FF@F@FFFF.FPF$FF\G GFF\FFzFtFFFFFfG:GFFfFLFFhFژFdF"F@FVFبFFF^F0FFרFϰFFߘFFFTFҸFфFxF FFܶFԖFFFFnjFFFF@FF̊F>FPFLFF8F|FFZFFFFFӴFGG GG>GG 'GGGGGG;G G GGGGVFFFF*F$F(FߎFGG GFfF̦FDFFF4F,FGGFGFdFܾFFpFDFFFhFFpFbFTFF"FF~FFFvFFF,F*FFnF"FFNFFFFFvFFBFx FF.FnFFFFFFbFTFFF(FbFdFFvFFFZFvFVFJFFfFFǐFvFFF:F2FzFFըF\FGF~GGaG OG'rG&GGG GFFFF՞FFBGFFF6F<FԖFńFFFTF.F.FFFGF\FGGGGG 6GG=FFFhFFLFZFFF.FFFFFFòFFbFԒFܼF8F٨FFvFF$FFζFNFھFFnFpFF<FFGGGGGGGGGG GG GcG>GG 6GKGG GXGQG"G+G.G%G0GFFFGGFFVFFBF|FbF<FrFFFFFFrFF4F4FzFFF.FG'GGGGG-G&G.AG4iG2G/G'G1G=pG+G(G G"GwG GMGGGG GF&FFFVFxFפFxFFנFFLFަFHFʆFpFF0F8FZFђF FXFFFGpFFF$F~FlFٮF|FGGG)G(GGGGfG&GG TGG GrGGG%8G%PG'&G;|GBG9G1hG9HG:QG)ZG5G G ~GGwFG 0GPG-GEGcGiwGj#GMG: G2GpGGFFFFGG)G0G?G0G% G3GLGkGwGGGGn^GfG\G2qG$GG2TG(G G'GxGF4FpGG G GG G=G6dGCGJGWGV`G_(G8G$gG^G iG GG GG GGGGtGGIGGG&G0hG9CG9+G3rG,;G5dG,G-G,GKG:G.G3G>fG1G;<G<G?GIGPGEDGCGNPGwG|GoG|XGGGGmGGmG`G^Gn=GfGG]-GmGneGc8GX+GS.GK=G:G(G-yG$G9G8G%G&G*G@JGOG*G&G/G4G=G]G4G*G)G/kG2G GIGG tGG GG GRG,G./G&0G+G09G/G#OG$G%GOG&UG0G*G2~G3G-GG"GSGRG`G_GGhGTGEGH5Ga7GFG;GHGCGCG7dG+G&GGG1G5iG=uG[G`]GN GCG@G?GB2G<G:GPGNTGNlGeG`G]UGvG}FGvXGrGpGnGi}GkGgGtGGQG>G9G% GDGG&G4G$'G;G+G?GG3GKG7G5aG;9G:LG9WG/G/G5G?GOGVGEXGA.G-0G GGG;G!G,G9G2GCGDGRzG38G0IG3{G9aG>GNGDG+G GGG)NG4G>GGpGGVGNGmGdG_GEG-G,GGGG!GK G7G:1G9GWGNG>sGBCGNbG[)G>G9iG:ZG;G9DG3-G'G,G2G?G<^GQGUlGQGWGP_GNGB(GK`GGGGGG{GyG^GKG6 G#zG}GXGyFvGG G`GG +GGGSGGG G7FFF@FGG 4G$GGFFFF8FڔF FFݪFhFߨFdFHFFF`G@GGGG8GGGeGGGG*G uGGGG GFF(GGvG-GYGEG5G GsG GGG"GGOG*GHSGUGVGOGGAGF@G&G"4G6G&bGwGG,sG?GdIGGGGGGGGlGeGGG{'GzbGvOGpAGV!G0GG9G GGGG2GPGGGGGGGGGGTQGOnGCOG7G*GGGDG'GBGGGcG G G4G:G7oGEGGG$G G QG`FzFtFJFRF FFlFxFْFFFFF G #G+G%GhG( G;.G=_G7G7G(NG2dG:{G%G*G#LG?GFTFhF6FnFzF@FFFFF`FFFFFVF>FFPFF,FFFFFbF|F~FFFFFFFFzFFPF FFFFDFF&F*FF|FlFFRF\FFFFJFVFFyFtFvFtFwFFFFFFFFFFNFҦF*FF^F̬FɜFFFF8FbFPF~FFbFFFFjF(FFFFuFoFk`FZhFWPFVFL@F]FhFjLFdFF"F>FFF|F FF~FoDFvTFFtFvFxFFFkFiFnLF_FYFSFdFF FtFFqF]8FAF7TF6F2 F8FLtFZFIHFK(FITF2F:F/F;HFCFTF|`F{FZF:F|FGF6TFFdF FtFFF@FHFFFF$FhF HEEEEFEEEPE E΀EEEEEE@EEEØE(EEEEEhE EEhEEEE@E`E#E!E=PE4E2 EPE PEE@EE E E EE DEE3E `E@EE*@EEPE1pE5E8E0E10EAE2`E>0E@0E5E,E$ E/E7EDEV@EMEHEEE=ECEH`E@EH@EMELEk E|`Ev`EHEEEEE8EtEE}EEpEEXEEPEwEbE\EcEf E|`EE E8E{@EuEt`EvEyEwEtEuE{EzEE`EpEEXE(EEEEEXEEPEϰEEEHE(EEEEExEPEEEEHEEEEpExEE8EEXEEEEEEEEEEEEEEE(EEPEhEEEEEEEXEPE0EEEpEE(E`E8EEEXEEEFFF0FB$FAF*|FF FF$FFFDF F F FF8FFF@F#\F!$FFFHF`F$FtFF FFDFEHFFFFdFFFFF\FF LFF`FFFF|FF+pF=FFFL<FM FCF6FBF@$F9FJ$FLF;|F)$F#F F8F8F!F%xF2@F;TF=FMHFAPFMFXFWFK`FLFPXFQLFE8F;DF4F0F.F,FFF FFF(FFF FF F(F FFF FxF$F4FFF tF 4F hFDF8FF(F'F$F#(F)LF$F%F4hF/F;HF2F-F,(F(F0TF+F/hF7`F8F<F?XF;F50F8F7F'F&4FF*F;FE\FHXF@F:FA@FKFLLFGF@F=lF=F; F7F9 F<F;F3F5FGFB(FA@F;FGFDFC`F;<F8F;4F5hF;DFFFN FOF[|FS`FMtFMFThFIFHFQTF\ FW|FMFGFX0FdF^ FVFEFDF>F0F*F'F-F2F5F>F@FRF[FlpF8F@FFF F6FFF(FFFFFyF|Fz0FvFkF\lF^0FjFc8F_8FUFbFcF^tFTFXFu(Fi<FiFiFmLFiFfF^FZFTLFQF\F_FgFk@FoFsFz,F{ F{tFtFlFjFipFsFoFj<FpFr(Fl(FopF|Fv$FuF|FtF{F0FNF"F(FF(FFFF6FFFZFFFFFFFFFFFTFbFFFFF@FF`F|F"FFPFFFxFF8FbFFFFFFF8FfFVFF<FF@FDF6F>F~FF\FF4FTFwFvFpFo FhXFfPFdF\dFaHF\FSFTFTFTF[FUFP<F\FZ@F`F\,FaFtXFx$F~FFFPFFF FFF~FFFJFvFFFF F},F0FF"FFF<F~DF,F}\F|tF|FF|dFF{FzdF^FFHFFFFNF<FF{Fw FlFmFmFiFmFeF^FZFf FshF4FzF~FFFFjFnF FF F(FFFFFFF$FFFFԼFF2FFFFFFFZF>F\FjF*F@FjFFFFFRFFFyFyxFjFk4F_FqdFkFsFyF@FxFy4FFHF FFFFF&FFFbFFFFFF$FFFFFFFFFFF(F}$FuFrFkFbFmFpF4FF@FFFZFFF@FFzFFFFFfFF FF`F`F*FzFLFF F*FFFFXFF,FF8FHF8F$FFNFF:F|FlF$FFFFFFFFnFBFFFbFXFXFFF<F.FF0FFFȈFΖF͒FӢFȌFFF~F$FF`FF4F|F>FrFF,FFFnF4FFFxF"FFFFFFtFFFFFFDFFFFzFjFFdFzFPFjFbFFFFF6FFhFFFF FGFFFݼFŊFF\FFTF$F̐FFنFJFFFFFFFFFF8F&FFFFFFRF|FFNFPFFFFFPFFFF4F~F FFFVFF>FF`FFVF0F.FGG G2GEFG0FFFnFzFFFXFFFZF؞FFHFòFтFvFF8F؎FؘF؜FF FHFFTFPFŤF,FF@FF"FFFNFfFFFFFʈFFxFކFNFFؚFږFFFFFFFFFFFF:FFFFFFĀFF FF>FG}FFjFFFFFFbG|GGGG FFF|FFFFFGFFْFF@FfFF:F*F|FFFF|F(F`FFFFFF FpFFxFF8FFFFFFFrF|FFBF\FF FFfFFՔFFGG GG%GGG~FDG GG#GG qGGvGG wG <F^G G FFFBF.GG :G GFZFFvFF*F$GGGGGGFF\FFFDFJFFF6FɺFNF2F4FFFFFFFFFFF`FFFFF6F F.FFFFJFF,FFDF\FF~FDFFFFFFbFFF FFFtFFFG tG)5GGFJFFЮF˸FҀFTF0F(FF*FFGGaG GhGG(G!BG#G'GG0GFXFFGG GG GGGWFFZFFFF\FGG GG GFG 1G GIGyGGGFFFF^F,F,FЂF>FF,FfF̚FFFǨFԆF FΞFFۄFGG*GdGFFTFߢFzFFFHFFFG^G tGG1G"JG!G,G!G-G&GG$G"G0G YGG G G4GGwG(\G4GHGJwG4nGGGGGG GaGFFlFbF͐FF FFFFFFBFF FGFF,FFGiGF GGG/G=G/G:G6LG1G-/G,$G56G$G"qG0GDG,DGGMG#GGGG"FGGIFFbFnF@FFFFFFFbFpFFF4FDFלF:F0FFGFjFFFFFߔFG/G GDGG#3G3GG G{GGGG$GG G GG1zG5MG5GD`GFLGR^G9IG0G8G>G3GGG G GnG GG!NG-GF`GIG`gG[GWG@G>G!,GvGF FFF GGG2GcaGSGDG@GhGtGGGGG~GuoG_G==G2G-GKGtGJ GK[G,GrGcGGGG tG GGPG5:G];GnGGq9GnXG=G7G"GGGG oGGG(G6G*:G!GJG GGG)G7qG8G5G/dG(G5G7 G7GG5G=G9G>G@GLGCGESG;G9GAG=,GFsG:GU-G{)G~GmGyGGGGvGGr GgGk9GlSGiGhGvGGz]GbG\@GQG=G@G:GG$G7G2HG/TG#G9)G4G {G,GQ8G>GAhGRG&#G6GvG3G(GGG G G.GGG GNGGG G+G/kG"G$eGGG TGGyGG-G.QG&G+G:=GCGOGFG9G9GF`GJCGYlGS;GGGCuGFG?,G1:G(cG(sG%>G&+G/CG1%G>GPGVGKGOGH!GE]GBaGSGnG{GdGGGOGOGjsGjG^GgGnGoeGxgG`G]G]#GlGvxG^GCG7G*GGGG"XGGcGG27G:G-wG"G%G0UG6[G8wG7EG6YG>1GFGXGZ,GBGAeG/G"GG(fG3G3G4G4G-G2[G:*GD%G5G3G&G-SGIGRgGJG<>G$G4G3G%G0G1GGGGXGnGbGc(Go$GkGGG8G5G,G#G#G5VG(G/G8GLiGAGO<GRGLG[?GQGJG2,G3G2sG3yG+G'G0EG@GNGQGTeGdG]GYG[ GMGR`Gv;GGGGGgsGgYGXoGFVG4/G&GGGGxGG 2G G G [G GXGVGrG*G GFxFxFLF&GGG G +FVF<FFFFFFFxFFFVFFdFFGGMGGGGEFFG 'GGGlGGG^G GGG ,GYFGG_GGGG#G3UG'RG"G)G WGGGSG$G2jGITGO?G\G]GQKG4G4(G6{G16GtF=F6F#|F',F`FFFFF F@FFFFFFFF(FFF FtFFF lFFFF0F F,F'F0F5\F2dF4F.F7F: FG4F4TF58F2<F?F:`F:F9FFFHFCF>F>PF8F<F4F*F+F*F7FE(FKFGF?F@FK0FOFLFHF?FApF F>FE$FF(FCFC0FCdFDFBF? F:F80F4 F>FLF[F[F``F^F_PF]TF`<F[HFTFSFZFYdFJF@FNXFdFgFaFQ@FIFEF:xF6F6F9F7F7FFFF FFFuFe,FhFzTFp<FllFpFfDFqHFu@F&FlF`F|F F@FdFFF*FFFhFFpFFFF̺FFܢFF"FTFtFBF,FĄFFZFFzFFFF FF2FFF6FLFF\FF F\F{ FlFl`Fq Fo$FqTF{FwFF~hFFtFFFnF0FFFzF*FHF@FFFtFFFFFFF6FFFFFHF`FFzFyFTFFjF6FF&F^FnFF0FF0FFFjF8F\FF<FDFFFDF(FFFF4FFF&FFFFFFFFXFFFϲF͜FFdFFF.FFF2F F<FF@FFF"FFFFFѾF0FFFŬF`FFtFFF FtFFJFFFpFpFFTFHFtFF(FrF*FF&FFFzFF<FF4FjFFNFF,F FFZFFFF@F FfFjF FTFXF&FFFFF(FFF&FPFNFFhFFnFGFFڦFFXFFʪFrFЮFFјFVFFTFɖFÒF6FFFXFDFFF׌FFäFàFFFF0F\FZFZFFFF¬FbFF<FFFFDF FFF>FTFFZFFFF\FRFPFFGG G:G%G G mFZFFFΚF(FFNFFF^FF(FFFTFFPFF޼FF*FDFFFFXFXFFFPFǼFѺFŊFrFPFF*FFFTFьFԺF2FFF.FFFXFFҐFBFFFF<FFFFFڌFF(FpF;FͤF@FvFTFFFFTFZFFFF*FtGG GGEG G/G CFFTFRFpF"FF FFFFBF|FGFDFFFF4FFFF2FxFF FFGlFF@FF8F$FFFG GiGpFFF,FHFFĄFȬFrFFFFG$GGG.G!GGG/GFXFGG G GkGGGNFdF6GGWFZFFGGMGG 3G F FFGGvGlG G GGGGG*G\GF,FFF>FFF۞FFԖFXFFʘF8FӢFͦFFFFFFϤFF.FFFF@F6F0FFFFF`FZFFFFɾFFXFzFF FFFFؠFFFlFF0F&F|GTGG _G#;GG IF FFݖFFFRFFFFrFFGVGGG5G G G'EGG RG$7G[GGzG<GGTGGGG)GGGFF|F؞FGG G G!GG G2G kG G6G G "G4GPGSFFfFF*F<FF FHFٮFF*FЪFƶFF`FFF(FFGFGPGKFFfFFʂF FFFFFGGGGjG "G#G1G3G1G0G/7G. G*GGG iG GIG?GuG22GCRGFG@GDGFEG6G"QGfG GgGqG~GG:GKFF&FvFFXFG+FFFFZGCG GGG G}FGGGbF G GG$G:*G!G1 G7G7G*}G0G1G /G"GAGUGUG8G)'G.G.TG"aG"GGGyG JGXG+GFF8G G!GFFF6FFF.F<FfFFGtGG RGG GBFFFGCFGG|GvGgGBG^GEG{GG{GG G GhG G G# GKGGrYG^>GNhG^GRGDGE G?G?G%G0GGG)GGOG5G3GDG@GLaGY"Gj GJG=G#GGHFxFzFF,GG#G6G\GZGWJGZGfGGGGGGGGGhGVxGSGPGSG?GRcG7G&TGfG2GGGGG G&ZGRzGmGGGsZGrGeGSG9G*GGGGG!G-G3G1TG*yG$GpGGG%G/aG5zG/G4G'G3G.G)G+G%GRLGN>GSmGIG;GZqGNGIG>KGNkGvGdGR>Gc?GGGGqGpGdOGcGtGb*Gu)GqGGGGGGdGCG]GPwG9G)}G,G@G9G, G0G/G7G=QG9G2fGAGOG"]G$G#GoGGGG GG GG)GGG GDG&5G1AGG&GKGGGGxG0G<GGGG+GKGGGFG9G?GG%G? GHGWGCGAGJG?G-G(G.`G.G1G)G4GEGLEG_GmGhxGdVG`G_]GyGG~]G|fG_lGSGQ=GlGhGjOGpGh GiGqGPGfGnRG}GrGMiG:G0G&GsGtG&GGGzGGG'yG"G#XG+*G0nG?G=G>G9GVGldGyG~G_GKG8G1G8|G8#GG;GJGSGdGm2Gn@GGnG\GY9GPG>JG/pG'GG&0G.G%G@GBG[iGSGKGAGF/GB=G6:G.G/ G:3G4G6G>*GJuGSGkG\G_GrGGy>GbGgwGaG\;G`Gw;GGaGO&GRG>G4WG*G$G!mGGG PGG mG G G IGG-GGG OG xGrGGFGG`GFFFFFFFFӄF\F܊FFLFF>FTGGcG#GGpGFXFG G"GGAGGGwGG GBGaG YGGF`GxGGzG)VG4]G4^G"2GG GG=G UGG2GKG`GcG\GQGM|GCFG1&G'nG.G0uG G GGgG!G(G\mGGGn'GGGGGvG}GhGoGGGYFG<5G!GGG }G GGG"$G>GHGiGGGG,G}GskGgGUGTG@BG.^G4GG G>G!GG IG/GGGGG'GGG hGGGGF2GGGeG+GF~FFF܌FfFF8FrG.GG/G'G0G@GG G;G(G:GGIGGGG wG|GsGFjFFFlFFFFFŘFͰFðFF6FRFFFFFFFtFFzFF>F>FF̶FƴFF2FFFFFFF*FFFF^FF̐FnFúFʊFĨFFF8F^FFFFxFF,Fv8FhFF`FFFFbFPFFFFFF\FjFNF>FFTFF"FbFFF6F FFFFF"FFtFHFF.F~Fj(Ft@FwFgFdFgF{FnFrFF@FF`F^FbF[F[ FZFRFOFVlFOFMxFR0FPFVF\F<$F'FFF$xF/LF3FIFZFCLFGF?F7\F#F F(8F/tF:FFFGtFBTF4@F6lF,F\F!F%@F+LF<F[(F[FMFE<F. F.F(FFEHEHEE(EFF EXEEРEE@E(EXExEExEE@EEEEEEEEEE@EE@EEE EEE0EEHEEpE E E0EE@EE`EEE0EEE EEPE PE E0EE EpEE1@E%EE@E0E&E(E2E9E+EE(0E:PEKEVEFE;E8pE8E>@E=EFEh EaEPEOES`E]PEhpEUE^`EW EdEe`E{@EE@EEEEr`EmEr`EsE EEEEEEEz@EzpEmEkEfE|E`EE@EwEE(ExE`EEE`EEEEEE€EEEEEEEE`ExF FFFF FExE`EEEhEE EPEE0EEEpEEPEPEEEE EEXEEXEEEE@EhEEEEEEE0E8E@EEEEEEͰEȸEİEEE0EEEEEExE`EPEEF <FF&F#FxFLFEF FxFF `F0FDF F8F \FF F$F FpF`FF EFFF`F,F F FFlFxFF*F28F.F1F&FFFFFFFF4F!FF(LF5dF2DF?F@$FDFWFRFFFEFDTFL\FK@FH<F@dF,F&8F#F!$F&F3FC FG@FQxFbDFgFdF]F]FjF` F`tFSFKF<0F9HF4F& F!FF`FF!DF) F$FxFpFDF!FF@F FF 8F FFF HF0FTF`F F pFFFFF(4F2pF8xF=F>F:F:HF=HFD4F?@F;pF9FBFJFJFK(FK FYFQFK0FFPFGTFE FGxF>TF7F-F/F:FBtFHFD FA(F>\FJFL\FBF9LF;F9F6F7F@4F>,FFFMFILFFFBtFDtFIFJFD8F@F>dF9`F=FMFU4FVF]|Fc8FrFrFsFqHFfFpFcDFWFUFV,FQFRpFY`FeFeFdFWFITFEF?F?FHhF> F94F:FCFVPFnTFsF{FFFF&FZFFFF{Fz@F{@FyFvpFm4FrFn FlF_FVXFSF`@FbF[,FVFeLFlF\FlFkFzFFFFFFF|FuFF| F|0FFFvFFzFxDFuFuFyFxXF}FpdFu,FvFppFp@FrFuFzFvF}F F&FvFFFFFFFFFvFFFFF.F*FF|F"FFFFFpF~FF4FFF$FFFFF`FdFFF<FDFF FFF,FF>F<FFFFFF&FFFFDFFFF| FFFFFFFrFgFkHFfFlFhhFd,F_F_PF_FhFmDFn<FcFpFtFkxFFFFF>FF"F>F0FFƂFFF.F FVF(FbFF@FFF"FFFFNFLFFFF&F F$FjF.FFFFzFBFJFFFFFVFFjF>FzLFsFsF{FuFx@FqtFttFtFxFFFBFtFpFFFFF"FFFF4FzFFFFFTGF*FGGGFPFFЪFFvFfFFFFFFFFFF6F.F~F~FFFF|XFrFoFpxFnFnlFqFyFPFFF FFFFFFFdFFFF0F*FFFFPF FvFFFFZFPFFFVF6FFFFxFFFNFnFZFFFFF*F6F(FhFFXFFjF2FFFbFDFFrF\FFxFFF6FFFFPFFF$FF FFFFFVFRFFFFRFFFFXFHF\FFHFHFFFFFݔFFF,FFFPF(F4FF՜F*F FFٔFjF,FFFFXFFFFFFFF8F\FFtFFFFFhFF4FńFDFTF FFpFFNF"FFFFFFFFhFLFFFFF(FFFFFNFŢFGGdFGPGGFFFFF|FFFFFЂF˲FFFFپF0FFFFݸFϾFF:FZFFƈFFF6FHFFÆFFFTFFFFFюFFFhFFBFFF>FxFFHF۾FFFRGGGGGG FF@FFF4F2FF0F@FVF@F\FFF\F@F<FFPFDFF*FFrF:FFFؾF߄FRFFLFFFF2F`FƸFFFۚFpGGaFF(FFF6F4FlFFdFfFèF>FøFǤFFFF FFFFrF2F׈FFFxFFFFFFG6FFGcGGGGGG GFFrF"FފFFTFF6F٤FNFFF*FFFFvFPGFFFJF&FGG GoGIGFFFGFFG GG+8GGG8GFFF`FFFFhFFGcG$GG&)GGMGGPF.FnFBFGmG FGGjFFFbF<FRFpGG G GGG@G fGUGGGGG;GGG EGGGGGFFFFFFFFޮFݴF8F$FF6FڲFFFFђF~FPF^FFFFxFFXFFFpFvFdFRFtFjFFFݼFFFǬFFnFFF¸FքFF׶FZFNF*FGGG,?G4G2iG.iGGGFFFLFdF,FG$GFHFGzG1GGG$G_G&&G)G OGGUGGG GG$G.4G2jG8zG;G(GG GVGFRGGGfGkGG @GGGDGvG GG4GHGLGGFGG FJFFDF FِFFDFFPFצFFDFδFpFjF\FFFFLFF$FʚFrF̌FFF"FF2F8G GRGG!GG-rG3G;6G>G4G7G)GDGG G jGlG/G>G<@GHhGCGO}GOGNLG?G'G"G<GFG"GGZG GWG,G GGGG;G aG GFG6GG*GUG#GGGG GDG :GGGG?G%G)G*G8.GYGGBG@G:EG4AG6GJhG[GamGEG=lG2sG5G*KGGhG G=GNGG$GGG.GG)GF.FFFGBG]FnFG8G%GG 5G GG FFFFGGGG7G0GE0GFGRGDG.G.GPGG*GGbGG$GAGz2GGGG~GqGaGP}G:-G1G)GbGqGGs*GbGq!Gs`GuGGG|^Gf{GYG)GGGbGx0GVGGG]dG^\GcG}G~GuGXjG6TG0<G9GGGGqGQGG G*G 9GG+zG.-G3GBG[G\GHtG\hGtGtGGoG^aGLDGUG?CG;GMGUGNWGQ(GYG,G,G/GG G2G1GJGcmGwGS,GOrG1!G2?G, G6GAG.G8GV3GgnG]GUGtGjoGa GUGT,GN:G@G'KGVG(G"AGG0G4]GPwGA)GEGEGDGUG.BG4G6G2,G>GTG`9G^GP GjGG}hGGGGGthGs,G[GZGrGgGM.GIGQGQlG<G(G%`G$G+G) G{GG]GpG GYG GGG @G GFBGFFG7GoG !GzFFFFFF`F6F4F4FF*FGFbGG LGG GFFFG+G G G GGG{GrG G,GGG qGFFGGG1fGG#G.GGGGGGG8GDG]<GSGGMGiGaGVGKG;G2G(G!GF"F&GG!GGsZG=GcGvGGnXGnGpGcGcLGyGwgGQ(GIG%wGG iG6G GGG)QGNGihGGlGGtGoGSG[jGViGXG9G-G-G GGGGVGyG-GG G* G,G#|G G#G"CGG G!G)G`G\GFGGG~FFFFFNFFFGGOGGG;G/9G'iG(G(9G/GJG"?G%G nGFrFBF,F|FHFFFFpFF8FVFF6F2FF FFFFFFFFFƆFFhFFFF4FFFF~FlF`FF(FJF֮FFNFFF6FѺFۘF¦FlF:FFFjFFFFFzFFFyFFxFFFF&F4FFFFFFF"FDFjFXFLFFFFtFFPFFF},FzlFFFFxFtFFsFktFcFdFeFmFFFFeFbFbFcFd(FOFJtFQFLHF]FQFBF9(F8F?|F:F@F2 F3$F(F FF8FFF&F.xF1|F) F%F3XF&FFxF*F&0F/F9F:F(F,F4@F,LF!FhFF4F-F=LFBF; F7F2DF1FDFhEE`EE(EEFF`E0EEEÐE EHE0EPEEEE(EEXEEEExEE EEEEEEEEExEE@EEEEED@EpE 0EEEE EDE E`EE$PEEEPEE`E"EpE$E!`E E!EEE$E1E4 E)E$E E2EV`EdEJ E9E=PE6E4ELEa@EQE_E`EMpEQEX E\`EaEN@E`EmEgEnEx@EE0EEE0E|pEnEEEE`EEEEs@E@EXE|0Ey`E}EkE`EEE{EEEpEEEEEEEpEE(ExEEEEEPEpEEEHFPF F%FF FE0EEPEѸEEEEE`E8EEE0EExEExEE EE(EEEEǰEEˆEEE8EE(E(EEEEEEEEpEǘEPE(EEEEEhEExExEEhEpE@EEאEHE F<FFFFF EpEFF FdF FFF xF8FFFF,FhFFF FEFFpFFFFdFFF F$F<F;xFB<F.F'FFF$FFFFFF<F#F1`F0F8FCTFB<FMhFMFLFKFFF@FM@FRFKF>@F.F*F'F'F#@F2,F<FK<Fd FtdFh$F[FXFeF]$F[0FXFK4F1F3hF.F$FF pF FF (F"xF)FF!F)0F$FFF FF\F FpF FFpFFdFF F PFF F$(F.@F5hFC FKDFB\F>FEF>FAFBXF<FDFBFSFSFRFSF\FbFaFKFKlFHFGFDF@F;F4F8F:FHFHFEF=F<FC8F>`F7|F.PF3F8F<F<F8FBFE<FPpFIPFCDFG<FLFT$FNFExFBpFTLFT<FZF[FV(F\FqFFFXFmFlPFwFxFkFaFRFSFUFPXFWFXF`0FWFPFJ|FMFEFH$FMFM8FA4F@FJFaFoF~FzFFF(FF>FFrFFFFVFwTFtFllFpdFpFmFmPFb8F\FZFYFWFU4F]lF`(FnFmFq8FFF.FfFvF FFFFF{lF|FtF}F{xFF{FuPFqFuFF~DFzDFuTFsF|HF~,F~Fv\FyFyFwF Fw<FyFFlF"FvF FFFjFFFtFFFFF|F.FFFdFF~FRFFFF,F$FFF\FFDFFnFXF2FF FFNFFFFFbFFF8FFF FFFF|FFtFFtFFFFy8F|F{FF@F8FF|FzPFu8FtFzFn@FiFkFnXFqFyFyFxFspFyFzFFFFFFFFTFFF@F$FFFFFZFFFNFFFFfFFFFFFpFFFFFF4F"FFFFFFFTFF2FFFFFnFBF}FF@FF>FFF^FFFF&FF6FFFtFFFFFFPFFF׬FFFG G2G>GGjFFFLFFDFFJFTFFF8FFFFFjFhFFFFF.FFFwFxFqFk FiF~TF0FF\F~FFF:FxFBFFFFFLFFFFFFFFFF,FFFFFF~FjFjFvFHF F~FFFFRF.FF F0FFFFFFFNFhF`FF2FFFF|FFZFFFFHFFFFFtF F*FDFHFFFFFFFRFFFF؀FFFFFGoFFFF۸FbF2FzFJFFLF`FF4FtFFFFFFF FFBFFFFF.FFFF0FrFFF6FPFF4FFtFDFFHFnFFhFFFFFPFFFF"FFFF0FFFFFF\FFFF<FXFڴFPG -GG FFFhFF:F6FFFFFFF FNFFFՎFVFbFG]G)FFFF~F FFF˚FBFFFFFF6FݒFNFGFFFrFFHFF0FRFF"FFFlFGGG,GGG<GtGFFFTFFhFXFFFNFFFFF$FF:GFvFFrFTGFtGG GCFbFFFzF0F~FFdFdF.F޼FFG G yGWG~GG 7GGGtFFFFߚFHFF<FF4FFFGGGFFXFFFFDG&FFF"FGFFGG GGGuGG G ZGFFF@FFXFFFFFFRFpFFFGF&FFF"FކFFFhG-GG(G*G|G GGFGG kGG GXGGCGGIGzF>FFʦFÜFF FdFGJG4G5G'G=G9G#GG %G GkGGGG FGFFFFXFFFFGG GsGGG G G GGRG"GGGGG%G!GGGGFF>FFF,FlFFnF|F$F*FF(FtFFxF܀FFFFTF\FGQF.FFFFXFLFbFѦFnFƌFȠFҶFjFFFFِFbFЪFFFF4FFFFGyGGGG$G4iGCGM1G4G$[GGGGGGFFBFF<FFG,GOG GG(G!G+G&G/G,AG0G)G GGyG(FG0G/GFGBGGG3GGGG`FGGGGGGHG UG hGG G KGGFGGFGG G1FFFFFFFFFF֐FFFZF4FrF2G F FLF΂FFFžFFF~FF.FߎFFGGGGGG'G9G2G-G(G(GGGG.G#G8GMGLG\XGTGSGlGKGDG(mG$GG GGNGGGFGG%G)G(G% G%gG%GGMGG)UG.G'G(lG%G+(G'G'G%G#OG2GGGGG,G.{G0G5xGIGNGMGKGQ<GI8GRGaGpGcKGEGAG0G*EG GG GUG?GDGG G aG GtG9G FFFFBGGGGG"G 9G,GmGG BG*G.GGfFGG HGG"G4G9HGBGYG?G#.GGGG GGGG.G]pGGGGGG{GhGaGGG*G1 G-G(G#gGYG(GJGG(G9GGGAGDGNGJG=GB~G7GhGG FF4GGG[G3}Gh-GneGj%GfG{lGGGGGGGGGGGgZGWWG^GdG?G2G2 G; G3PG72G8G5G/G?GK$GGGUG{SGGyJGzG}GWG@%G4G+G*G$nG)G'}G0dG=G<G=BG9G7G)G#G#G)G G*^G3G)zG GxG!G(GG,GIuG4GLGkHGmGkGjG_GrGgBGM GLGHGNaG`GTcGBGPG^GnGaGR0GcdGxcGmGpGhVGnGrGGGGG|6GfGa_GIGIGUGQ>GXG[_GWdGYGRGBG;kG=G72G-lG-GGG GOGlGGGGGGG?GG G&G,FGGG=GBGG GFBG G G 6GGGzG!G$G*)G2~G3G9/GBGEGQGVGU9GUGFyG]G8G3G%2G"G- G/G7GI0GT#GRRG^G^Gg:GsMGkLGf%GoGu GGG}5GGGGGjGn"G[GKGHGQGj@GnGjGYGE?G=G/zG"GG"*G+G*G%SGGGGGG!9G&G5"GX;GcGZ%GW&GjGsG|GyGG~/GjIG[GHGUG]GUGP G`GUGMG3G'5G'NG&G5wG0MG?Ga\Gf<GDIG<0G7G.G,KG4G:G1G30GCGSGPGSGfGn"G[GOGZ\GUGTQG)GgGGmGGZG+G>G1G@3GBG?GLqG6ZG7G;G>GG{GbqGw`GttG[GdGpGw2G~GGGGqGfGXGWGGW$GBSGDGB:GH1G<G7\G0G3G;bG5G+=G0GG0GGG G>GGXGGGGmG.G GG {GFFFNF݂F؄FhFFΪFFFFFGGG GFGVG FFFG^GGG G GJGGG/GBGGG [F FFnGFG7GkGG&GPGG ;GFBFxG zG%G?GFUGchGXwGdGl0GLGTGRDG4G'G#GFFbFFGIGG rG4~G3)GY3G]GeGlGfGv2GGsgGqGLG8cG*iG{GG G(G'yGG<G\GH2G/G@ GNGWG9G3[G0G1}G-G&G8gG'GG3GG{G)G5G9G: G5G-G'G*4G)GGG GFjFFTF0GGGGGFFЪFpFPFF<FFPGGGG9G&UGGG,GG*nG!&GGIGF$FlFF<FtFF΄F"F8F8FFF^F>FJF<FlFbF8FFFFF:FFFFFעF8FFFFFFtFFFF|F(FFFF*FVF*FFFŦFFFFXF&FFFFFwFnFh@FbXFoFF<FFFFF0FFF4FFFFFF<F.FFF4FFy F~xFFFFrFSFaFlLF]FUFWF]$F`F\FaF\FaPFFpFNFjFeFgF`FNF?FCdFPlFPFPFdFcFIF5F8F9F6F4tF(F/F#F%@F4FFpFFFF"tF$F\FF F FDF#F)F.F3 F1LF2F3|F*pF5F6PF&\F$FF pF@0F<8F1F+F-F#0F EEEEE0E0EFEEEEEpEEEEEHEEEE@EEpE EEEEEEEpEXEEEE(EEEE(EE0DDEPDEE PEED D@DE0E@EE%EEE&E0E E`E+E'EE0EEE EE*E&E(0E E`E2EHE[0ENEP`ECECEIEVE_ExEXEb@EHEJPEREXEQPEI EXEgEPE}`EpE0E0EEEPEXEEmE{Eu0EEhEExEo EvE0E~EEXEpEEE8EXEEEEEE`E`ExEEE EEPEEE E0EEEEE`EFFF0F E8EEEʨEEEEEEEXEE`EEEEEE0E0EEEEEE(EEExE EEEhEHEE`EE EhExEEE8EԐE(EրEҘEEHEEEEEE EEEEנE8EXEF0F$FF @F<EFxFHF<F,FFhFFFFDFFFFEEFFHFF@F TFFFdEFFF\F@F1hFS,FExF<8F4`F+dFFFFFF tF%F)hF(F)(F4 F?FFFIFJFH4FM@FTHFQ,FK4FAFGdFF F>F>$F*F*F)F!F+F;FLF_FsFm<F[FTF`FTF[dFRFKdFBF2`F/F(FLF$F$(F(FF"F*F0F @F&FFF F |F FDFFXF FFPFFtF FFFF"4F&F3F@FK\FSFQ`FO,FQDFPFApFJFG(FK|FAFMFYF]FYF^F`FmFdFdF_(FKFKFGF@F<F?F;F>FGpFH FBF><F9F=F:F5F1xF5\F9 FFFCFOFWF]hF`TFQFMXFM|FXFXFTFVPFf FiFddFbFe(FkPFnF&FFNF(FvFp4FFFoFf8F_FdF[F`F\(F]$FWHFWF\FXFQ`FP8FX|FXFSFJFMFTF]4FnFuFqFFbFF>F{LFFFFF~F}LFyFqLFspFmFs8FuFf FYFXFYF[LFc(FgFsFoHFvFFF*F F6F\FFF`FFF~F~F(FxFuFt|Fz4FzF|F~FFwFzF{`FF*F0FFyFtF~LFFFdFpFFFPFLF F~FFFFF FFFFVF.FFF|FFFF&FF:FFF.FF.FFF:FFFFFFFFFzF&FFFFFFFFFFxFlFFFLFVFFFzFy(F{FjF8FFxFlFFF~FFyFz FtF F4FwFF~FF:FlF FlFFF0FJFVFݸFF&FFbFFFFFHFVFF\FTFFZFF"FFFФF`FFFFPFF:F,FFFFFFFFHFFFFBFFPFFFDFFFFF F6FFFFDFhFFF"FzFǂFFˊF̞FF.FFFFzFGG GGlGbG G GPGCFNF&FִFFFFF(FɈF.FFF&FDFLFFvFnFVFrFpF4FwFqTFdFmDFzdFpFTFF|FFTFFFF(FnFFJF~FFFF6FFFxFzFFFF&FFFBFLFFF2F&FFFTFFDFFLFFFF8FFFFF$FFhFFFFFxF6FFFF<FbF\FfFFFBFFFF FBFlGFFFFFFrF͈FخFbFFFXF0FGGG RFFFPFFFΠFFFFFFF2FƶF6FԴF$FGIGFFڊFzF̴FBFFFFTFfF FFFdFF@FFF~FFNFF>FRFFF8FFDFFFbF<FF0FjFFFFFFFF$FFJFFjFFFlFFGG(G4FFtFF^FFXFrFF$F|FFFxFFŢFfF`FXG"GFG BFFFFPF>F"FvFFŠFFtF˲FhFFzFPFF6FFF8FFDF FלF2FGGFFG G GGGHGGGOGSGGGF"FGGGJFFFnFڰFҒF.FTFGsGGFGFGYGG'GGGAGKGyGFFpFߞFFNF$GrGGxGGG!)G GG G GGoGGFFBFFHFvFۦFFFGGG GFFGqFFGGGGGGGG GuGGG+G:bG:G"`GGGG pG 4GFFFHFFtGGFF2FjFGoG5GfFfFFF*FݒFFF8G4G8GJKG1G/pG" GGG6GG G G!uG%G'G =G =G,G3F$FظFˆF6FfFlGG%G-GIGH4GO|GKG+G >G GGG G GiG G GF"FDGFFGGGAGnGG GGGG{GG/G%&G&GG6GGOGG!G#NGG +G G GG sGF^FFFF؄FиFF\FFFFfFFF.FFGGzF6F\FjFFFF<FDFFFFFF\F\FFPFpF2FҘFFǔFjFZF FG GgG*eG&G&[G.G;GHG\GUYG9G$GG BGGGF\F6F&GGG G#GGoGGnG&G1GPG6VG0G.G!GGUG1wG8JG2G= GeG@G>G'nGrGXGFGIG6GGGG"G(sG5DGGrGZG~G GG G G GFGuGGGFFFFZFVF(FԐF\F̐FFF՞FFڠFGGFF(FFFRFFFF FFFFG 2GGG GG"7G3G*G#G!G#G {GGGG.GKGZG`GdGxGe GqGM[G8G,GG&GG%GG8G8GhG\G%eG*G+G.G+GMGGG$G-G6G?G1G5G?UG@kG@G=vG.pGGGG?G)G/G54G3G:GFG@GNCGMGEGPGlGgGP GC{GJG:sG4G%%G>GMG.GG!|GG/G+G1GGGGGF6FGGGPGGGGGG"GGGG@GGUG G IGWG!cG/;G6G:8GQOGC(G-uGGAGYGG"G$G5G3GgGGGGGwGt GzGeMGXG6G*GG'[G"G)GeGG_G4G,pG/RG5tG:G;GMG;zG5G+oG#GGG GFFGG /G"wG5$GbG|GnGGGGGGGGGGGGGl}GkGgGrGK9G4G2G4G8G:BG;G6qG8KG6yG=GBGMGkGGmGhGfGFG3G26G$LG"G"G09G)G5]G>G8G6G2nG;G,$G$G!gG(eG%G)G/XG.G'HG!G)YG+GCGEG?eGKGZGkGe*Gh+Gi#Gm/GtGaG]GQGBGJGFZGEMGJ\GKGVcGXGH0GLG]G]GbG\GgGzGGGGG|GeGzG^GHGEGTbGnyG~_GsnGQdGLMGHG?-GLGDG1EG%&GeG 6G G JGG nGGGGGG]GG GG GGGGGGGoFG G G GG GGqGG"G)zG'9G5*GNaGPGLGOnGNGU.GSNGVG5G(G :G8G,nG+uG7G>GEGNGGWGa[Ge8GlmGQGX GUGqG{G|GZ,GXGiGyGrGa'GzXGsGU,GOGU1G^Gk#GjG^GAFG:G0G8G9WG*G!\GGGG!GG9GG!nG$OG,aG>GDIGWGN=G_G~GGG}=Gf|GpG\GRGGPHGgGGSGfGNGPGIG8!G,nG+|G<G(G.GLjG^G5G9G<G3G3G4G0G'{G,GEG?G=QGPsGOqG^gGSGZIGN.GMG>G6VGLGGGGLG+G9G-G)$GFEGI\G;G,GApGBGD GJGcGsG_}GnGGyGmfGGGGGG_GT%GRGi'G9 G(G<G0dG6&G;%G;;G5G@4G>G;G4G5~G$GGG G2GkFFFGvGQG tFDFG AG`G FFpFFFpF`F$FF6F`FFFzF(GG$G GFBFRFFFDFFFdFGGGG G_GG"G(GjGFFHFFGG ]GG G5GFGF\G#G G!G._GIGc GkGpGWGK#G=qG;cG5GG DG FF@FF4GFFTG-GG#GL?G] G]G]GRGm GgGUG7G<G&GGG GG*GQG(~G)/G0=G(G9GG"AGGG^GG!G#G0PG5GHGA?G//G'VG'&G9G1G+G8G-GBG-G.G%G G !FtFFVFFF(GG:G~G FF،FFŚFFϚF԰F F@FdG 2GGGqGTGGoG+G%GqGGFFߨFFFΚFFF`FFZFF6FFFF~FpF8FFFTFtFFFDFDF‚F6F0FFFFF0FzF>FF4F(FFFlF4FFHFFrFFF>FvFFFF F&F|Fm$Fb\F_FYFZF^FcFkFdxFeFvF F FFFFBFFpF`FFFF FvFFxdFlFu<FwF|$FrFtF\FMLFU$FYLFX`F_FU$FGFTF\FaxFhDF}lFFFFFrFXFVF;F=FHhFHFHFAFCLF<F0xF:F7F-tF)$F),FpFFFF0F F FFFdF F`FlEFFF*4F. FF&F#FFF0F"`FF8F#FF+F:F-,F)F$ FF E0EXEEEEPEE0EEpEEEhEE EHEEEE(EEEE0EE EEEEE EHEEE`EEEE0EpE`ExEEHDDDD`DDEE DD`D߀EpEE%`E!E"EE#EPEEEpE$E pE0EEpEPE E"E$E EpE0E'E>`EApEY0EC0EMEXEL0EX EqEmEiEWES`ENEOE^EMENEFELEYEs E|@EuEEEEE EPEpExE{E{PEE0EEE~0EvEEHEhEEHEEEz@E8EEEEE@E(EpEEEEhEEPE`EEEEEEhEEPEXFFF EE EͰEɀEE(EEE@EEE(EEPEhEXEEXEHE8EpE0EEEE@EEEE8EEE8EEEEEEPEXEE EEHEEEEEјEEEEPEhEpEEĘEEEEEFFF FEEF\E FFFhFFXFFEFFFtFXE@E EpEF(FlFEE@EEXFF FF%F2@FJF@XF28F8F0F$F FTF4FlF,4F+,F%DF*lF3tF@FGFMFEFN FDFSFQ\FJxFEF@F9F>F>F:LF2PF2F%F)\F' F6FPF[FdFfFc$FQFLLFIFEF@FKFCF3F)\F'F-F"F \FFFFF(F FFFFF xFpFF FF0F F F F FFFF F)F6FCFSFSFXFWFVF\FRFUFPFFFK FJFW<F`FbDFkFcFg@FzpF0Fo FeFRlFHFIHFDFIFCF<FAhFD FO(FAF; F4F7,F6 F5\F4TF;FL8FPF[F\F^pFc,FZFXHFOXFYFaF_FXFn\FlFmFjFidFtF}FxFFFF{F{LFFFFy8FtFm(FtFflFeFZFOFQFVFXFTFOHFR|FZF[FM FM FLpFRF`HFhFmF|F4FFFvFzDFDFFFFF}FyFqFe0FcFmFrFqFgFW@FXF^F[FhFv,FyF:FdF~FFFFFFFF*FFzF(F}HF|dFu<FqFtFvFw\F F|FndFzFFF@FFLF8FzFtF|FlFFFFjFFF$FFF(F:FFFFpFFF"FFFFFFXFF`FnFFTFFFFRFFHFFFFPFFFFvFFFF4FFFXFFF@FFF`FFFFFFFFxF}FFtFF(FFTFlFFFFFFFF4FFFXFF2FjFFF2FXFFxFFFFFlFFFrFFF,F~FVFFFFzFFBFFȼFLFFFFFFF^F*F F\F0FFFFRFFFrF`FFF<FF$FFHFVFFFPFFFFlFFrFFFǔFΪF~FFxF̒F"FvFFFFDGbG GG%G!GkG G GGF:F2FFFnFƢFPF˘FFnFnFxFvFBFFFfFFF&FFyhFsFt4Fq|Fr\FF$FF(FLFFFZFFFpFhFFFFFFFFFjFFFFFxFFFFFFXFFFFPF`FFFFFFnFFFF,FFFFFFFPFĪF.FFFBFFF FHFF&FF@FRFǶFRFFRFFjGGGFFFގFF(F@FFnFFFFZFGGSGFFFFF8FG 6FFPFFFFˌF FPF܌FdF4G JFFF؂FFF$FœFFFFFzFdFFFFFFF>FnF$FʈFzF,FF@F̼FFNFFFFFFFFLFVFFF.FF(FFFFFFFpFF2GGGUF8FTF&F،FF˴FFjFFFFFVFxFZFFFƐF՚FG0GG GFFF8FF@FtFFFFFFXFچFFFF`FFFF$F^GFGZGG GG:GJGG TGG %GGGGGG FGaF*FG9GfGjF6FFXFFFFF GG G G _G ]GGG&VG*G G GGG+GGIFxFFF`GGGG GRG'PG0G5G.0GXG GG zG GFFFF۠FFF>FFF@GGGF6GGGG G GG %G G?GaGG kGGG4KG9GEG1>G*G,G GG'GGGOGvG"GVGKGFGTG4G1G<GGBG?FdFFߪFFFGGG1GIG8LG(GG G,GDwG5G#G#AGG(GG0G)G=GuGGFXFϊFF`FGcGfG0GHGS8GHGTG7#G4G)G*MG'?GbGGG+G GGiGFFGGG GGGGGGGG]GGhGG*zG9G(NGG<GVG G'G2G$GG "GGGGGGFFJFF FF@FFvFzGFFFFGG?GxGFF&GGGFFFF۴FFFFFDF4FHFFzFFrFFFDGGGG+Gy4GIG.GA+GbGeEGvGl)G='G%(GXGG YG wGxFGGG GGG+GYGWGG G%G3G@GJG7G1G.WG!4G.G&8G6lG:GIFGGGwG_!G2G&G GGG G#CG+G6GLGV GGG6|G'G#G!ZGG{GG GGJGsG yG1GGFFFF۲FFF֞FF\FFF|FFlGGFF̠F@FFјFjF΀FFF FFFGG GG$GYGG#G GGGXG(GGrGG7GHGdBGrG|6GvGeGqGMG46G/GGGGGLGGGpGAG!DG3G4zG1G9iG6G2|G+'G5uG.G3G?G>"G?GMGYGW`GGG/MG&GG|G'G+=G.]G*G.G0dGEIGFGH@GLGN&GZG`GffGSrG7G@GDG<5G9G1GaG$G;GCKG@G>zGAnG>G=G0G*G%GGGFGG 8G GG LGiGCG#WG)G!GmGFGGGSGGGrG=G(G4+G1G:G8G,GGGGG&GGeG,eGJGtG}^GGG|GGivGGZG3G*xG*(G!GGQGG]GG$`G$G)G+G'TG-\G.G%GGGGXG GFFGG GUGEGcGGg(GdGzGGGGGGGGGGGmG[GbGsGSGD\GCG9GHGKGBG<G>G3HG0G9GHLG\GiGo`G_G\\GIG:<G*=GGrG#XG,yG%G0nG?@G8\G0BG/AG;G/\G)G.G.QG-G0G+rGAG@G7G>WG6GL5GGG8nG;GWGZG^G\G_VGi}GqGaGX$G=#G2G8*G5nG8 G6GD^GGNGXGNG>GKOGY-G[|GX]G[GkGGGGGukGqGG{GU<GOG]GxGGGGugGTG4G;G@$G+bG1G GFGG!GGGGrGzG GnGG GG#G!G%GOG(GoGGG2GzGpG9GG7G GBGGGG!G*|GEQGIG<GC.GE)G\=GTG>G:G#G%G$/G$G)aG?GIOGGvGDGI:GKQGXUGRQG;G5:G@GhGnGacGBGEG]GnDGuGsGoGpGZGUG_GiGg!GXGEG70G6 G35G,G,OG,G#AGGGLG%~GG!GQG#G$G5G6G;pGVNGYGd0GrGGGzGkcGtrGc`GKnGEGSGcGcGaGOGIG<G80G3G%G+G%G.G@gG^G/GG!G'G;G6G<G%lG7G$G6fG3pG7WGNGCGZGYwG\GPGIZG6G#G%G.G!G.G:G$%G%GG+G,GCG9G"G-;GHGOG\GhGGuJGkGbGz\GgGGmG{GGuGQGL`GSG>kG(@G&G,G'fG5G$G3G>0GEGBGKGHG2G1NG!oGG*GGFdGEFF\GaGG IFGGGyFFZFvFFRFhFFFF6G"GG^FF^FGFF^F(F^F߼F$FFGG ZGGGG |GGjG GG FFFFFGrGrGGGGzFTFNF4G#G/G3GHGQLGjGgG`G1G:FG7lG4nGHGoFFF FdFzFlFTF:FFGG1PG4G-(G;GKG_G[=G<G?SG*G#tGzG|GG GJGG'TGG GG!aG7G GF>G#GGJGG&yG-VG1G?G&GIGG(G$ G QG:G4ZG*G:G-G*G'GHGvF.F@FFFpFHGG"FF&FF(FӈFF<FvFFFFfF6GYG=GG gGgG GGG9G4<G G =FF߄FF,F.FFrFFFFFFjFFFFZFFFFFF`FF FXFFFpFrF^FpFFFTFFFF|FJF"F$FF~FfFFLFF:FyFyFv$FmFuxFxFq`F`F]Fb|FY@FO$FHFRFMF\hFXFalFoxFbFuF{F>FJFFFFFfF:F<FypFs\FddFgF^F^Fh FV$FYFqFaFTF[hFOF^(F^LFOFMFM FeFuFwFFF̜FFFYFBF1FBF@F@`F8F(8F#F.(F-F<F*pF-F 0F&FFF F FFE(EhFF|FEEEEFFFFFF F FFPF FFFF\F;F%$F%F&F'xF(F FEEΨEEEHEŘE0EڐEEEEEEpEEEpEEEEEEEE(EhEEE@EEE EEEEEEEEEXEhE`D@D@DD٠D@D D@E EDDDD`E`EE#E)`E" EE EE 0EE0EEE EE EE%E EPE&E(E7E;E6`E80E/EKEVEXPErEEkEbE\`E@ECPE\EYEI0EAE=ECETEzE}Ex`E{ E0EEExEE|`ElE| E|EE8EEHEEpEEEPEPEPEHE@EEE`EEEEE@EEExE`E0E@EE EEEpEhEEðEE@FFFEE(EXEEEXE@E EE8EE`EHEEPEEEXEE EXEEEEpEEE8EEPEExE0EE0EE`E(EEEPEXE˰EӘEHExEEXE8EEEEE8EE(ExE˘EאEE0EEEEEE8EEEFFF 0F|FFFFxE EEFFTF\EEXE`E0E FlFDEE(EEFhFXF F(F5F7F:4F5F/<F2F-F.0F'F!F#<F1 F+F+LF,F=LFJ\FLFGFHFKFNFSFK(FI(FAF7F:pF@$F:F7F3F20F(F"F)F8FIFTFaFaFYF>F?HF?`FC,FEFJpF<F4F2xF+(F(F%F!F<FFFFF`FF F ,FF F F$F$FFF0F xFF\FDFF"F'(F8tFDFR|F\HF_FcF]0F_FfhFUFNFG0FM FR$FNFO<Fc8FdFmFkDFw FFFxF`FRlFMFHFHFHlFNFGFFFQdF@F@xF@F; F1@F30F=HFHhF[dFbF]FcFfF`Fi0FmFcFZFSF_LFndFiFrFl,FgFsF{TF|F~FFxFFF~lFytFF|F@Ft$Fd<Fi\FhLF]F[FR(FKFJxFTFMTFDFH,FMFUFZ@FYFJDFN|FLFT4FfTFlFtlFFFy0FuFF~F{(FFFtFu FjFiFpFoFsFm`FeFfFiFiLFcLFfPFvFTF>FVFBFFFFF^FzFFzFFF}FtFmFg`FbFg,FwFr4FqFyF|FFFFFFF{F{F8FFF$FFFFFF,FF(FDFFFFJFFJFbF FFpFFFFFFFFFFFVFFFlFBFF\FF6FdF F&FLFFbFF8FFF8FFFFFFFFFHFFFPF<F`F$F&FHFBFF FFTFF`FFFFFFFF~FFFF4FFF<F*FF(FjF׊F:FFFrFFFFFF FFFFFzFFPF$FFFFDFFFF@FFtFFFFFdFFFFFFF.FFFFFFFF*F FFFzF*F&F"FFZFvFFdFrFئF2F̺FFRF|FӆFFFG KG*:G$:G%rG7GVG GGFXF FxF FƎFJFFʾFzF2F|F@FFFNFFFFF:FFF{FxpFs\FFFFFFFFFFF:FlFFFF`F8FFF`FFFFFF:FFTFFFFFDFNFFFFRFFFFhF@FFFFFFFFF8FFFF,FFFLFxFFF`F(FdFFFFrF:F̔FF΢F،F GEG GGGG1FF&FFؒFߪFFlFFFF@GnGG>GGFFF^FVFFF@FF F`FDFצFrF@FG G{FFfFPFրFF.F2FFFFFdFFFFFFFXFFFVF:FGFFF.FFnFFFxFF*FF^F F~FFFFBFlF.FFFBF<FFF^F.GGFF0F8FˌFpFFjFʪFFFFBFFFFPFPFHFGGG _GF FFFΤFTF,FFтFF̶FF`F.F2FHFbFF*FFFG GGGGGoGGGGUGGGG G }GGGG GG GG!GFGNFGFlFFpFFF FGRG G pG[GGG&GG<G*^G#G"G*!G)9G"GGG*G-G~GjGG GG!G/G7VG6G/GG!yGG1G=GqFNFFBFF^FFZFFFFGG GG GGGG kG 7GGkGG GGG~GG,vGPnG\GNtG3XG&G=GSG nGMGG G 6GG AGG G4G|GGGGyG<G GnFFNFFG7G%LG!rG/<G;_G)G$G.UG-~G3vG4;G/G#GG%G=G/GGaGdGF\F0F4FFGGG0G9-G_GScG\oGDGKG?GEG9G,7GG G|G G ~GFFG!GG GGG GGG,G GG GG"GG'G)G qGGG"G#G5G-GGGG&>G;GGGTG GGFFF2FFGGGKGG xG ~GVGGG!G!FGG G$GcFGQFFFFPFGGrFF.FFFFFjFG SGG&G;G_[GWwGRGRdGbHGv_G~GpGNG9GGjGGTG@GGG GG,GCG ;G 7GG GG_G-G6GJ]GHGEOG:G1IG"G%3G@GL*GGGxGG\GGG(FG G GGG(G6 GG'GUGUeGSG7G7GCzG3~G(G,G'XG!G# G(GGvGRGFLFFFFNFXFfF4FѢFאFFFFFG'FnFF FלFF$FFG3GGG GGG pGG"G GGGG G G GsGG"1G G4^GKG`Gb!GjZGr`Gc+GeGPGJJG?G6G G G!GG 'GGGG$!G6G44G;GFJGOGFG:]G6G9G?>GJ:GKKG8GT=GhGmGfGFG>G;G;NGKG;G.G.G.G0G=G:G:G?GPGZ&GUGjiGZGKGOGBFGCFGAwG?CG4DG?G4GEGEHGOoGOGRGKGGG?G%GG^GPGnG CG2GGGJG#/G4G.GG#qG*GGGGG^G qG=GAG!G!gG4tG;G*GGSG%CG*8G#oG!G%NG(G6GIGe+GGxGcGgTGOGX2GO+GGG2=G8G0G&gG'G KG GGG'lG'vGGGGGGGG uG!G G,GG GG%G6yG_sGvGidGmUGz<GGGGGGG{GGGGwzG[GddGqdG\GlTGqpGW]GWGo GVGFUGCG?OGCGKFGFUGNNGZ}Gb|GZdGHsGF'G:G0G GFG9G#vG)G.G>G;gG/G*fG2EG1G0zG+XG6JG6G/G2G@dGV3GT,GPvGCG?=GMwGK|GE*GEGRGZ`GIGOGRG`GRGD.G3wG,iG5?G0G6~G7GNGTuGauGS\GIGIG^GcGXGNGcGGGGGGGG|AG[3GIGbHGyGGGGGGUhG<GJ[G2/G("GGTFGG\GG G lGG%GgG'GGLG+G)G1G8G&G!G GGGGG GGGXG G GGG[GG#G2_GI{G?G> G3GBG2G4G1 G&!GG@G$vG3{GOGIOGOGE-G;G;GBsG6`G-yG-HG=GV.GTGOG9G; GTuGw]GoGgGbGv0G]sG]GZ_GUG`YGQGE\G5G(G'%GWG#G%G#G"G'GuG+G.G%G"4G/0G4 G=G4G7MGCLGKGKGa%GxGqGeG^MGnGY GJaG@&GC4GDVGHG\MGLGGG9G5AG-G,G)G+/G$G1G=G GG,G-G;GIG8GvG!G-G-0G4GTGNGPFGTPGUOGFGG G vGG8F$F,FFFFFF(F>FGGG BGG PGTGG\G GFFF^FFFFFGF|G 9GFFF2F|GGG+G=]GSGHG>G6G$/G %G~GoGPFxFFjFڪF.FF2FFFBFԐF8GYG GG#aG2GN;GBYG1wGHoG/G &GGG2GGGGGGG FFF FFpFFGlG &G@G!G1G.G G GKG#G$G"G+G%G6G4G7uG,UGG GFlFpFڤFԠF>FF6FF6G!FݪF6FBFFFFnFFFnFBFBFNG FFGG?'G.GGF(FFFՠFêFFFFrFF^FFF6FF2F6FF FdFjFF"FFFFFF4FF8F4FFFFFFFFFFFFFFF<FtFvFiLFhFjF_xF`FhTFlFhXF^Fa`FY0FMTFMFMFEFF|FHDFJFTFZ(FWFZ@FZFgXFupFt,F| FFVFFFtF~F"Fc4FZXF`tF_FfFV|FVF]FSFRFXFRFaFfLFYFQ0FPFX\Fq FFFFFFxXF^F>F1F4F2F3$F4F$FFF+HF'F-lFFF F F F@FF FEhEE`FFEE0EEF0FFFFF |FF FEF<F8F F!F"F*F#lF"F'FFE8EEEE(EpEEEEŨEEEExEEEE8EEpEEEE@EEEEE EEE(EEE8EE(EEEEEEEwDDDDD`D DD`DDD`DDE EE%0E0 E8PE-E@E@E`EEE DE pEEE&EE!`EEE3E0 E=PEIE-E'`E9`EPE[PEbEEE^pEI@EN@E7EIPEKpE= ESE=EAEAER EqpE|EyEwPE|pE~EEpEEk0Ek0EgEwEE EpEEE@EEEE EXEE(EE0EEEhEEEE8EEEEE`EHEEPEHEEEEʀEpE@EF<FEE@EE0EEE8EEEEEPEE`EEEExEpE`EEEEE`E(EEEEEEEEEPEEEPEE(EŸEАEE0E8EPEEʰE8EXEEE(E(EEHEhEEpEE(EِEEpEEـE߀EEFlFF F PFF F hF(EEEhEEHFEEEEPEEEEEExEEFFXFF"F6F2F3F0F6PF@F:F/LF'TF'F'F-xF0XF0F0FDLFHFEFCdFMFXTFUFUFOFBF=`F;F/F5 FBF6F+lF'pF'XF&`F.lFFHFLF_dF],FYTFIF4XF0FDFFF;F70F?4F6hF0F+tF%F F"FFF<F LFF 4F FF FF FF F <FFFFFFFF HF+F3FAxFTXFd$FrFoFpFhFk`FcFQFYFNlFFHFQpFM`F]FkFfFc<Fi(FtFFFypFd@FZFHFHLFFFM FGFC(FAFEdF@dFAXF@F1F5F@ FMFXF\FZHFj|FopFiF]FaF]F_FcFa|FuFgFn`FFupFFTFFFF|dFxFPFF$FFxLF}Fv$FlFa4F`FbLFYFSFS<FLFIFItFEF@,FHFTF^FZFN@FH\FIFVFZFbFeFr|FxFttF|FxFxF~FFzF|FtFuLFrFfFcFeFi8FkFtTFgLFhF],FhFxFFZFfF(FrFFXFFVFzFTFFFF&FpFsdFhFhFtFhXFodFt4FvFFFzFFFF}HFzxF{FF0FFPFFFFFFFFFFxFFF$FFFFF F@F8FFfFF,FFZFFF&FF>FHFFFF FLF<FFFFF|F F:FhFpFFpFFFFFFFLF6FF"F0FFzFFFFFFFFFF8FFBF.F,FFFFLF$FFFFjFFFFhFʲFζF$F4FFxFFFjFRFFRF>FFFFFzFFFFFFbFFFF F.FFFtFFFxF0F:F FFFPFF~FF,FFF6FLFLFF:FrF$FFFLFFFF0FFzFҐFѢFFF~FF$FlF FNGG(G%G"GG!GG)G}FFF$FFFF2FFF8FFFFFFNF(FFFFFFF| FHFFBFFFFBFF FFdFFFF<FFFDFdFFXFdFFXFVFFFDFFFFF:F4F~F>FFFpFFF F*FBFFFF^FvFF"FxFFHFFZF8FFrFFFFFFfFTFFFF^FlFFFF4GGGgGGG]F*FFڜFFFfF6FJFFFFGGG G(HGOF6FFFF FFFF,FFժFFF"GGF F8F>FFתFFFFFFF`FFFFFFFFFbFFFGFFڐFFǤFF$FF\F*FNFF FFXFFFFNFFF2F0F$FF(FnFFFFFF˘FǀF:FtFFFFfFFFFʀFPFFF4F~FFGG)GG#FFFF<F2FFDFFF\FFNG"G@FFFFJFGgG dGGG+G%G%0G&)G"G PGG .G 2GG G G5GG G<GGEGGFFVGFFFFPFߊFGGGGGmGkGuGG 0G!G#G(G+wG!G&G'oG!GGGG ]GGGjGGG5G<G:G5G(G&%G&GGCGG uGmFjFFRFFFFF FPFfFTGGGGGGG"G'G G3G1GG /GGVGG]GRGmGT*GF1G(G#}G;G FG GGGG GGG G <GGG,G$G$|G+G(ZGGDGF|FFGG#G3G;G@G8*G:cG=G)fG(G.G)G.G/G7!G92G/GGQG >GFZFlF\FFzGGG0dG23GN>GVGNFG:G1G>$GAG.zG+OG!GGNGG {GGGGF*G&GG<GG GGoG NGGG#G GG8G#G!G GiGGG%GG.G/+GGG GlGGG BG 9GG G SGJGG G.GdG G G GGG G GGmG!G G G YGG G\GxGF6FFFFGFFFFFnF FFFG .GG%G;G^6GgGahGUqGZGYGzGsGZGGG-GGGG%VGrGGvGGcGGuGGG&GcG%G)G>tGQoGRGNGI_GDG0G%G<GnmGGGwdGaGLG8G'9GGGGoG%G'G7GHtG`GWEGAG:mG;GNyG-G4G,G&UG+G5G-GGGGHGF<F.FۊFߪF FnF֌F*FFTF~GvF*FFXFdFڴFdFjF\FGG'GGG GGGBGgGGGkG oGG G /G GUGG/GG/GAG]G`G\G]GLGK<GFhG9G;GGG G 5G G G=GKG FG'G0GCGHGK&GR{GaGZG=G/G:GU/GJFGMGGGPKG[GjGGgGQGUGb@GkCGT,GQG8G6G,G;UGBG4KGCbGBTG;GGGJGXGXGNGUGPGT GUGLGOGYGUhGJyGVGjGEGJGPGA7G/GGG3GGGGGG%G)G(GtGDGG XGF0GG G &G )GG)G& G"G#~G?G5G)DG"G-G0G.^G+G2G&'G.hG7GMG_>GkGCGVGMGVGUaG[;GHGAG.G(7G%UG#'G GGGGxG#GhGGGG -G GFGG G qGG GJGG)zG=BGVG[4Gz)GGGGGGGGjQGlGsGp GrGaGqVGpAGiGGj$GaGcGhGeGQGLGV~G^UGaG\GTgGLnGN4GWGHGFGKG8)G$G!GFG+G=GVgG3G3G0G*G0G1G/G5GDGB:G9-G5G2 GMGUGeGbGUGQ9G3G7G>zGL.GMGDGCLGIGEG:]G6G%G#G0G7DG61G?*GPGMdGLGCGAGFGGJGK?GQGVG^GccGqTG{GGG~CGtGk-GYGFGXGGGGGGGS@GLGUGK}G>G=GGG"GGG4G GGGLGRGGGGG#G&G GGmGfGG G /GGEGG *GGtGG<GSGG&G2GAG8G0G4G.pGG&G$G G 2GPG%*G+GFGXGMGFG<5G1TG.G)6G&~G&G-6G8GHG@`G;GL~GLGcGG{}GGbGflGf]GaG]GeGZG:xG-G.G&G"GvG%G'G)G+G& GG(MG1G0G(G1?G(G3G<G5G?G<G=BGNGc@G_MGX'G^GXGEZGPGAGB5GhGWG`gG_GPGNGJ|GBAG:G#~G"fG)G4G0G DG+G)GNGrGQG3G#GGGG:GFGHGK@GM|GKPGCG5G&GFGG?G`GG =G G MG\G GDGWGjGGG%.G8sGJ^GTTGtGGGGhGwGvGWGQGXGLtGGGIGBG2GGGG8G8nGcGnG#GE#GdGXG5GG!G)dGGF^FF*FF6FFFFGFFbGdFF*FҖFFFF&FDGGFGG GG-FFzFzFVF*FFF FϾFնFFGGNG(G 7GGG XGFTFFF߾FڒF"GG6GGGGFFFFG ?GG1?G0G(GuGAG5GFrFxF<F@F(F FFςF~FFFFF,FFFFF&GG^G'UG)G3hG>G+cG#sG( G-GGGGG jGGFFFF2FbFHFZFzFGGGG:GGgG[G kGoGG cG&G)G2iG=_G:3G(?G GGFFtFVFFFͲFhFݼFF@FFFZF@FFFFFFDF@F$FFF8FG @G7:GG FtFFvFFFFFFFFdFFF<FĐFFƜF*FFFFFFTFFFxFFFFF*FXFnFFFF$F}Fv(FFy,F{FFF`FdF FsF]4FUFQFOFWFiFkF_xFUF`DF^FQ|FXFUpFPxFD F<F=dFDtF@DFGFGF9FN,FTF_FgLFFFFF|dFsFvtF_FZ<F`F],F`8FR4FEtFJFQFQFNFXFHFPPFSFXxFUlFMFQFkFhFaHFkFkFOF@F5F1dF+F,XF+F$F8FF F&F%F(HF#FFF F dF\E FFF$EHEpEEE0EEEEHFF F F F F(FFFE@EXF FtF4FPFHFhF<FEpEߘE EEƘEEXEEE0EEE`EEExEHE8EpEEEhExEEE@EEEEHEPEEEpEE`E(EEE€E(EEEx0ErDDD`DԀD DנDD`D@D DـD EEE E0E!`EAE=EEEEE EE0E E E EEpEPEEE6`E>0EMEQpEFE0@E'E@Eu`EpEEwEbpEMEJ0EO0EF0E@pE2PE+`E= E4EG0EAEHEs EcEmPEiPEjPErEn`EEpEqEd`Ec Ew@EE`ExEpEpE EEHEEEEEE`E EExEEEE(EEXE8ExEEEHE@EE0E`EhEPEEpEE؈EFEȸEEXEEEEE E`EEEE`ExEEEEEEEEEEEEXEE@EEEEEE`EXEEEHEEPEExE EEpEӠEEPEE(E@EEɰEEEpEE8EExEEE8EȸEEEܨEExFFFPF lF FFhFEEEpEE@E(E`EEpEEEE`EEEEEHFFFxF!xF-(F0pF6lF3FAFEFBF(FFF&F)`F1F0F=xF<\FKFMFDFMFWFWFEFGFCF;F2\F/HF2F-XF 4F+F)F(F*F3FEFA,FMFMFCF;pF)F<FGFCpF1F;F=tF:F,8F$FF#FHF F F FF F <FFF F 8F(F DFXFFtFFPFFFF DF-F8F>FMFeFnFl8F|FzFgFiFa<FVFUFQtFPFVFWFh@FePFW$F]Fh8FkFFFklFaF^ FO8FDFC FGF?F@F>F<F;F7tF4XF0F4F>FTFaF\FlLFzFeF^ F\FbFa8FnxFptFqFlFpF|FzF}FyFx4FF~\Fw0F{FFFFvF~HFt FsFlFdFXF[FbFVFQ(FCFE0FOPFLFI|FK FNF\DFZtF] FWFR0F\F_FjFl$FmF} FHFnFxFzF}dFz@FFF(FxFtFrFoFiFpF{FxFzFo FhHFoHFwF{hFNFFdFFFXFFFFFF\FF$FFnTFdFc8Fj4FidFlFq FF\F8FFF|FF~FF}HFF^FFFFFFFZFnFFbFFFF:F>FjFFFFFFFFFFF"FFFnFRFFFFFFF FPFFHF"F<FF|FFF`FF"FFF>FJFzFFFFzFFFFfFhF2FFFF0FFhFFFtFFFFFFFFtFFFFnFZFFFdFHFF^FF:FF߀FF2F"FÆFLFFFPFHFJF>FFFjFvF FFFXFFFFFFzFFFFF FJFFFF*FXFFtF>FFFFFFVFhFFF F~FFFFFFFFFF&FFFVFFF,FFG GGGG!GGGPGFHFFF@FJFF$FʬFNFtF:FFFFFFFFF(FF`F,FFF>FF8FFFFXF2FF.FFF6FFVFFFjFfFFFlFDFNFFFF FF FFFtFFFFF(F FLF|FFFFFFìFfFFFFFFբF@FʦFNFPF"FFF0FFFFF`FFFFFpF0F4FFGG QGGG GFFF*F߸FFdF^G3FGGGCG G{G1GGdFFF FFFXFjFԎFFFF۴FFdG G)F8FFFF.F,FFXF(FF$FFFF6FFFFHFFFNFFFFٞFF FFFFFFZFFFlFFfFBFvF"FFFFbFjFFF<FFFӐFԜFВF֢FtFF$FFF`FFFLjFFzFFFzFhFFFFGGUGgF(FFٺF`FFdFhFLF4FFtGGG8FG`GGG mGGG+G%mG,G.|G'-G#G GG=G 2GTGGG GG(GGGGGxGGGGF:FFFTFFG,GGcGG GLGGGGGG$G(G%G"G"!GGGG GG =G 0GGG&G)G5QG7G52G-G)iG G GGGG jGtGG 0GG GFFFFF&G G;GG G GG"1G;GIGFpG[GGyGG,'G@|G[G^GsGaG@G-GG 7G<G 3G$GGGGGG&G#G G+G(G G'GG8GFGGG GxG,G0GBKGQGEG*NG)G&G4G3G0G,G0JG;4G9?G$GDGGGFvFFFGG&G!VG)^GF<GPGDG8G2G9G.jG%GG#G"vG"G%GG oG2GAGzG&G -G~G"GGGCGGGG#G%7GGG(\GGkGGGqG#GG(GGNGGGG5GlG -G G +G GGG$GGGG [GDGGG3G GG$G-kGG WGG*G:G %G.FFFFFGGG6G0F6FFFFfFFG GG3GCG[(G]GlGOIGEGQGGlG_GRG;'G)G#G#7G%G#VG%!G#GdGGG G GGG_G GG!_G?GAGY)G\G\{GQG?G3OGIGoQGGGGyGGXG=G8 G GSG pGG0G3cG=@GWG\eG[iGMJG>xG>GJGLFG=xG-G6G; G6cG*JGGEGqGJG #F4FFFtFFF,FFFFGGG sGpGTFF FFFFGTGGG.0G''G;JG3G)G$AG GG uGGG GcG ~G.GwGGnG"G2G<GRG_7GVoG;G65G4G.(G9G'GOGG GG G#G(G$G,VG3*GBGGGKGRGF*G:G2"G1GHGCG6OG:GUcGuOG~G`GfGGSwGlfG]G\4GWnGIGFG;G/?G8:G6G-0G3G,G2G8G@?GT|GRGgGi>Gl>GgG`+GXGNUG]GqGO6GQGjGVGWGYoGbGDG&EGG-G&gG$G\GG"$G^G$G!!GGTGGG8FG\GGGGGLG&>G;G9$G1G5G.G(G.G1G: G2OG1G3G=GJGTOGK)GCGI[GCGI(GFG28G=GC!G@G8G-GG!GvGCGG9G"G0kGGGFbFFVF&GG^G(GFGG GiG!YG@GHG\~GzGGGGGGGz^Gb GWGdGY6GqyG]vGUkGdGGoG}:GGqGGGoG_tGUoG\G^GOGNGKGVGNzGXG_GMG]GoGE#GJqG@MG=fG+bG'YG"qG!gGG/G7 G7G8G5G<GG GV(G[GcGUtGXGLGW&GVGVGLG1G'G%G 0G G' G+mG"{G%G&G-G.G1zG+%G4G'G6G1G7G;"GDG:+G87GDUGNGRwGX4GaeGdGPGCEG@GHGLGnGVGWGoGGS%GDGO GGG/G0G2G8>G/G-G.G1GOGWGK}GHVG=G/iG&G>G*G9GG@]GBGK(GMGDG/G7OG$IGGaG LG FxGGGFF۠F(FjGG:G%G+G6G@GSGGGG|GG|GmG\GE+G<GA(G-VG:G,GmGGG#GnGrGGG2GFG4AG"IGGJG%GFHFFF|FFFFFF<FlF4FFFFFdFиFԀFFFnFFFGGGhFFFFFxFFFNF:FFFLF޺FFFFGAF>FGFBFFPFF\FFGG G$GGKGFFFFFGOGGoG FFXFFrFFFӺFFFƪFFfFhFFdF4FFFFF̐FvFPFFG!GG%\G:GG,KGGpG(GGGGoGCF2FFF2FFFFF,FFZG ;FGzGGGG GGLGGG)gG1G4G'GGvFNFFFF^FfFͮFƨFʒF\FlFFF.FӠFRF<FFFFFlFFFF”FFGG%}FFܰFFLFFFżFF FF\F`FxFFFF~FF(FFFFF`FzFFFFFF FF$FFFFnFF>FlFyF_DF`0FqFvF|F&FVFXFvFZFSFFFEhFFxFM(FLFZF_FfFdFSFVFSDFaFOF8F0@F4\F4F6F3F6F9F@PF9FCFOFYF[FbFcF`F]FS\F]FPFDFHFKFKTFFlFOFI`FKFOFCF@F:F<F3FG0F;F.0F8F=dFBHF8F.\F7F9F7F,pF$F# F@F FFFF FF!F(F<F(FFFhE FFdEFFFFExEE`EEE(F ExFF@F FEEEEEF |FFPF(FF EE(EHE8EEEHEEEEEhEEEEXEEEPEEhEEE EEExEhEEEEEE EXEEĈEʐEŀEɸEEEXEEEDՠDՠDDȀDѠDĠDD DՀDDԀDDDEE E E EpEpE@EEE DD@D`E@EE EEE`EE#@E4pE3EWEF0E= E>0E>EVpE}EExEcPENPEJEHPEOPEA@E2E"E&PE,EF=LFB\FFxFdF̞FGGGGSG;G)G:GG@FFNFFLFRF0FF܊FڠF F̼FFFlFF FFFF2FFFFF@FFpFFFFFBFFFFFdFFFFFFLFPFFFFF FF6F"FFFFF~FNFFFFFF~FFFF6FͶFF|FFFFFFԞFFFFFJFĎFF0FFFFDFFFFFFZFϨFFϴF^F&GRGG (GGG F*FFݐFFRFF:FjG G GG]G #G)6GGzG F$FF@F2FFFFFFFFLFFFHGGGwGF0FF؂FFĔFFFFFFpFpFLFFzFFLF FĀF4FFrFFDF.FFFFF8FFtFF>FbFFFFFF F0FF*FFDFFFFtFF,FzFpFFFF F.FFFF FXFFʹF$FFF*F,FFGGGXF6FjFFPFFޘFFFPFdFG-GbG GGG GG @GeGG"G,8G5G G'G G~G G7G @GTG /GG GGaGGG GGGFGGGFFVFF F"FBFRFFxFGFFG'G G$GGGGnG!G!G$BG/G;GUGTG/GJGGGGG#G7KG2G?G>G8G$;G!GGG G)G BG3G GG$xGGGGZF<FFGDGyG&mG 9G G+'G#G>G G UGjGG G GG,G6?G;G_PG]GZ5GPpGHLG/GGG G #G GGJG(G.rG,G2G1G/G3G%GIGGKG GsG"GG UGnG,G,QG+G4G8fG9=G.JG*NG5G3TG$(G2G2G>AGCG5KG7GGGJFFF2F<GGGG@GNGBGJ(GE<G=G:(G,lG'uG+G-G6'G:G<G"|GGUGtG{GjG G GG GnFFGGG"G"kG'2GG%G(FGzGGGGG=GCGG EG >GHG"GFG 2G GIGG GdGGGiGG G G BGG GGGtGG$G,G3GGG!KG%]G%G tFBFGG7G\G;GQGuG tGlFFFFFF6F4GG$G1 GKGcGUXGE,G9G>3GLaGIGNG2G$G GGGG0G&GG zG5GGqGGvG'G!G&G(oG6pGDGJGS-GLGK'G@G=GSGrGGGGGnGHG2(G$GGG GG'G7GEZGOGS=GHG8G5G=G:G-G5~GCG7G0G GGGDGGFJFVF4FFLFFGGGGpG1G/GyGG6FlFFFG iG GGG&G2?G5#G8G(cG&ZG%GGFF4FGmFG GG G GG"G)GCOGKGEG:G3GAG7G,G%GG G gG G GGpGG%'G#G1>G=:G=GB\G6G<2G9G+G3G;G)G;GQGlGaGd&GnGRnG_KG^G\\G[G=GCG1G4G14G*G'G4G3G/G@GASGI\GSG]5G^QGg;GfGaGWGJ:GPvGmGGTGMQGlG^GNvGX%GZGLG22G.RG>AGVG<G+GG#G {G* G!G GGF GFGGGYGG lGG-G@G.G,BG1G/G0G-4G1G)/G,G6JG1GHGLGIG7G=mGCPGCGAG@hG5G;GHGJG:G2GGpGGG~G5G&G5G$ GnFFFFFZFFBFFVFGGGQG.GPaGVFGYGGGG|GzGGqkGYGOjG[G]GhGX]G_~GToGkBG{hG~.GlG|=G}GzGrG[pGUaG\QG[uGXuGMGVGXaGVGfGoGsG?G=GDG3G2G0FGFdG<G;GEoGMGQGImG:[G3G>=G>pG3G2GHGPGH9GQG_eGNGNG8:G00G*G&G4G/G&G,G-G!G/G"GG(G1^G<GFGH GEGBG8G8 G?[GAG?GGBGK.GRGNG`Gz%GyUGGGGGXGc:GrGGGGGGGGwGN?GK.GGG<~G/JG*GGG G+GGG(G#GGGGAG GGGGGXG~G-G,GGoG&9GGhG GG$G8G7G+G,G(G9MG4uG#G#GGG G G nGGGGG%G5G5G4G*OGGGGG!G G-DG.SG05G)+G6*G;DG:/G?GG5GNGOG8G5$G:G<G9G4!G*G"GyGzG;G$vG-G)G%G&1G;G4G%?G&XG.G7G(PG.G7:G7wG:G/"G,G5GD:G[ G_YGfG[GUGC G-G8HGJTG?PG>GcG^sGQGN2G2G>G6G5G<G/G=G7hG$WG(G=G^G=G/G$nG(yG$RG%G1G7G>GMGE[G?G6G-G+GGG G(GFFZGFF.FhFFߔFFGGGG"G?GZG_Gn-GrVGbFG|.GaGoGIGDG,G**G&G#G G6G?G!G GG G~G)+G0GG {GGGG G,FFF0FLFFFRF٪F*FFXF FլFFF֢F˴FоFFߌFFNFFFlF8F<FFlFծFҸFޖFnFFFFFFFdFF>FF.FFFFFFFFضFBFBFGG yG G/GF<FFFF`F(GF"FFRFJFdFFFFtF˴FFFFF,FFpFVF*F`FrFFBFFFF:GGGJGGGG%hGGGG FG=G5FFײFİFFXFF2FFpFFF,FFFFG GGnGG^GGG(lGG HGFF^FFFNJFF F@FF`FFFF:FLFFLF"FTF FFFF,FF&F2FFZG%)FNF˶FHFFFFF FFFFFHFFFFFFFlFFFFFFTFF,F8FzFFFFfFNFF F|,F~(FuFgFWxFW`F_HFqF|FFnFF.Fi|FEF;$F:F/lF5FBFNLFUtFLpF[\FMFWFLFL0FAF:F1F$$F!F&F.F*PF-PF3dF%F-F-F4F9DF8F:|FJFBF?F;|F;dFExFGFQHFIDFPFPFNFPhF?F?F5PF&tFFDF"F'8FxFxFF&F$FFFF%,F%F&xF#F!F'8FF"FFFFF FF F FdEEEhFF F0FEF(EhEpEE(EE@EEXFFFEEExEEEHFFF F hF FEEEXEEpE`EEEEEEEEE0EpEEEEE ExE(E8EPEEEEExEE(EEEhE(EEEEXEhEhEPEEEDހDހDDD D@DˀDDDDDDE0EDEDEEEPD E`DDDDEE E EE@EPE EE%E.E7pE>PECE>pECEFE\EZEgEdEY EOEKE>pEME&PE)E$E`E(pE>0E=`ECE;E=`ECEK@ECEMESEsE Eo`Et`EiEdEExEEEpE@EEHExE}pEqExEEEEEEEEEEEEEE8E~E(EE0EExEEEEE0EhEE8EPE8EEHEEE8E@EEEE0EHEEEE EXEEXEEPEE@EEpEEEEEPE`E@EPEE EEEHEEEE E(E(E E`EhE@EĨEEEE0EExEEExEEEϐEEE(EEpEPE8F FF F HFFFFEEEE(EFE8FFtF`EEhEEXE@EE`EFF <F \F(F(FFF$F(F+,FSFFFHF8FF%F.F/F'F3xF:lF=F;FGFNFO,FI F@LFBlF2F# FFF FF(F*,F.F-F/F7(F3LF=FJ4F<F:F6F/F<F;F:DF>lFBF.F (FtFHFF @FFF FPF FF (FFFFFFFPF F%F,8F#PF0xF,F* F0xF=FNFWFg,FvFpFpFsFbF^F[FZF`tFfF\dFPFNdFPFUFW0FUFYF]<FbXF]XFZ\FLFFFFFFfFFF:FFhFF\FFFFFFFXFF<FGGGGeGFFFFFFzFVFFF\FFмF,FFjF"FFxF"FFFFF\FF*FFFFFFFFFBFFFFNFFFFFFFtFFFFFFFbF(FrFZFbF@FFbF*F FFǾFƘF¢FF4F FPFF FFF\FFF^F FF$FۜFFFĖFF$FzFfFFF`FFFRFFFFFjFF$FdGG SGCGG WGFFVFDFLFFRFGG G GG 7GMG GGOG FVFxFFvFF^FFFF,FFdFFFF<GFbFFFFFzFβFdFɨFFFF"FF~FFFF(FFFZF|FF8FFFHFFFFlF(FFFFFѢFFԨFF F FF̈FłF8F`F^FČFFFFFF8F&F0FFF(FFFFZFpFFFFPFnjFF@FlFF*G_FjFFFFF&FNFF"FGGGG tG eG {GGG G[G LGG)~G,BG$G$GGGG vG VGG5GGG,5G7G GG GG6FF8FFF FFFF:F4FF&FGGG3G G1G2GaGGGZGVG$ GGGGG9FFGGGGOGG0>G8G4-G7G$;G-,G!TGGG GGG 1G"G)}G/G"G GFhF GGG GG!GGG$GoGGGGbGG GG GG3;G2RGK_GMGRKGBG5G6G42G5pG+0G!GGG]GG&G3G/G#G4+G4#G7G)EG#G]G GFGG G RGgG+GG$G#G#WG/%G&G1:G(G$dG6G6G='GHG?G!WGGG&G G|FFBGG G G/GAiG<G<9GAG7G5|G0*G)G*/G& G*G:G,G0GLGGGwGGGGFGFlGyG jGG)aG&G&G)G/G5G,GGGxGTGG"GG6GG GGWGG \GxGEGG GG FG9G GGG9GG=GG G GXG GGCG"wG%9G'GG GF`GGnGGG |G GWFFF2FzFFjFGGG,GC-GZGQGAG1G:QGF_G@G3G2GGGMG1G1G?G/DGLGG {GGGGG0GRG JG&tG,G>'GONG[G^CGiG`MGjkGG|G*GGGGGYGPSG)GGGGGG'7G5GB,GPGOG?"G3}G77G2G2'G5GAqG:PG7fG(GGGGG[G FrFtFdFFGGIGmG6GG/GVGVG "GFrFlGGGGGBG*G+:G>[G6G-CG G'5G-G%PG0GCFpF2FHGYGGGGmGxG#G6UG7G@aG8_G2G,DG-G3sG'jGGkG G G ~G G\GGG#G-_G,G,-G:GAYG;G/hG2G G"G5&G*4G@GAGOrGcWGGG_GJ}GD+GIGDG1G9G'G#G'G%|G%G%0G:G3oG7nG*G:GUGixGjGwGp/GiwGYGL^GLGl=G]GDPGVGgGTGZuG_GJGHWGH{G;1G7wG4G(GG G#G"GG G`F~F F.FFGGG KGG!HG.fGEG7MG2G2G)G'G$5G+G)G/GBG>dGLG[zGN8GIG=G-GAdGRJGLGL~G;GKGC{G9G1G%G#G`GG%G%ZG,G9XG-)GG.F0FF.FFF:FFFF2GMG.G"G< GC7GN:GpG}G}&GGmrGh>GWGNGH GHGTcG]GPG\GU[GbGxGyaGGGG|GcGWGWG[,GZGIGFbG@GH:GSG]G^G\GOqGHGRG8|G2G7PGIG?G? GFGPGRcGZvG5G4G3G3G,G.G8qGDGHnGFxGMsG@kGJG1G)G(8G$G)]G4&G.G-GG)G$G'GHG5G'G3zGHG<0G@GEGGG5G&G,ZG0G3G-1G.GDtGXG[(G_eGj?G}GGvAGi4Gc:GWbGv;GGGGGGGGwsGNFGXGC!G'G.G"mG)G#GGAG!tGwG(GGG2GG|G G GG.GG GGG%G,{G"GNG^G G G|G.G'G3uG&G$G#G0G%GG%G!G$jG8GzG G G G GG% G+G*@G&GGGvGG/G5GG)KGGG &G%G9G&1G.;G0G?tG6G&G&G5TG4G2G&lG)FG(G&G%G%G"EG)G/G5G3sG(G)GGG&G-G!G!SG%G(bG,GG'XG-XG5dGURGNGLGRGY?G?sG?>G.G:G:qG;PGGGVGgGXG5G0G1G<G8G.#G.G/GG%G2IGJ(G=bG4zG.IG;G0+G$G1fG7G4GJ,G8G5"G0YG0^G)JGG GFvGGF FFF<FFFFFFFzGGBG G9rGXGVGiGYGJGGGc*G^GI1G)%GkG/G)GjGGG GGGG"G =GYGwG 1FFF~FFfFF\F FFFFèFbFF^FFɊFDF:FԴF FFFF۞FFFFdFܜF$FJFVF FϊFFĘFFFVFpFbFF8FJFF~FFʠFBFǾFXFhFFFtFFΤFFFFGG GGFFFFhFFFFFFFF2FFFF FtF&FF@FFFF>FVFFFFFvF>FFhFFjGG FGG G[G GnF(GmFFrGF4FȀFF0FFF|F8FFFJF FʶFFlG NGHGG@G!G GhGkG>G GTFFܰFFFFآFFFFFFFFFFFF\FF.FFFFnF|FFF|F6FFǞFFFXFFFF$FF&FFrFFF{FqdF} F~FFnF*FFTFFJF2FF$FFFjFtF4F{$FrFqFb\F~FDFeTFeFSFTFfFcFahFbtF|FF~FF\F[FE F4,F0lF#|F*F.F@hF1F,F8F:FBF@F9F<@F<F:F+FFxF"F(HF(0F(F$FFFF&DF)F%F'F$F+xF)F:@F<F]Fs<FjFiHFfFW@FVF=4F/(F&FFFFFFF0F FF $F HF 0F LFFF!F&F#F%FF(,F&FPF F<FdFFF FE8E8FEEExFF|FEEEE8E`EEE0EE0EܨE`EEEXEEE(EEEFFEXEEĈEhE8EEE@EE`EE8EEEEEEEEPE EpE8EEEEhEEEHEEEhEEEEEEEEEXEEEE|DDDDD`D`D@DDD@DԠDDDD DDDD@DD`D@D DDDD`D`DD`E@EEEpEE%E"E)0EpEB@E?E7E=E7E8E"E%E"E#E.EBEA0E:E1E;pE5EC`EA0ESEhPEEmErEsEtEqPEEEEE EEXEzE0Et@EyEExEExE0EEEEEEE0EPE(E{EEE EpEpE(EEE@ExEEE(E(EEEEE@EEEEEEEEExEEEEPEEE0EEEEExEE`EE`EPE0EEE8EE@E`EEpEE EE0EEEƈEƈEEEՀEEEEpEEEE E՘E(E EPEEՐEExEEFFTF F FF FLFEpE EEEEhEEPEFEEEEEEۀEEFF FF0FFFtFFFF6F9F&F xFF(F DF" F-tF*,F'$F&F-8F9F5F:\F:PF:F1F>FIFC|FFFGF=|F/F(<FHF F`FF FhFF HF<F @F FFFFFF"LF'F%@F*@F0F+$F+ F HF|F,pF0F5TFK|FcF^FoFrF|@FlFhFlFfFiFfF]FIF@ FKFMFRFSFNFG,FV@FlFaFRpF@F=F?PFC FE4FCFIFEFGFJ4FKFL|FLFJXFK<FeFrFqFu|FxFiFfxFZF_F[Fk<Fz0FuDFFtFvpFsFhFj,FhFFFFsFlFiFnFfFg\FalF_ F^FcxFVHFhFmFmF\FaFfFfHFjFt$FpFlPFl FeFgFu FFFFFFFFwFx F~FqlFmFyFFFFvFFFFFFdF}dF~FyPF|FvFxFFFFFvFyFxFnFr<Fz F~F>FFrFfFZFQtFVFWXFYFjFiHFw4F~FFrFFF|HFF@F~FFdFZFfFBFFFFFF.FBFxFFFFxFFFF:FzFFF2FzFFFFFFF>FFFFFpFF.FF^FFFFPFFFFtFFjFǜF$F͜FFFFFFFFjF4F,F*FFbFFFFTFFFFZFF`FrFFFFF FrFFFFFFF@F$FF4FFFߖFFF2F(FF|F6FFFVFFFFFFFRFFNFFFFFFF@FFFxFFbFXFF~F F FFFFFFFF0FÜF|F(FtFFFnF<FzFFFF.F F\FFdFFFDFFFF2FFFFFGG GAF F:FF2FhFF4FFGeGiFFќF4FFvFFFFF,FFFFFtFFFFF(FFFBFF4FFFFF"F.FfFFFFFFzFvFFFFFFFVFFFFFNFÚFFzF:FrFĔF,FXFPFbF͜FFFFFFFGFFLFFFFF2FHF6FFFnFFFFFBFFFؒFF`F~GGGG GGG<FFFFJF\FzFG GG GvG G[GbG ,GGFFFԒFFFFFJFGFFFdFFHFFxF FTFFFFFFF4F¢FF(F6FtF FlFFFrFzFF FFF.F<FżFfFFVF\FFF0FFLFFFFۦFFzFLFDFbFFFFFXFrFfFFFFFNFFFFFF0FFFTFFȠFF͈FFFŐFfFJFZFvG>GdFFFFpFFRFG|GG$GGFFG;GG\FFGGG^GG" GGG1G G GGjG!G&G+G)KG+4G1G GG"G OGG+F FFFbF8FFF8FFFFXFFFrGeG GG ?G aGyGG jGeG G sG G #GF<FGGGGGG/iG4G,G*G";G!jGG G qG G aGGGG" G 'GtG FHF(FzGG GG G%GGG<GGGGGGG6GGlGG(UGBGWGSG7G+,G"G&G-G(G GG >G G&G/G9zG%GGG+CG-VG.0G-G&G(GG LGGGGG aG(G}G*GGGBG)G$G'G,8G-G+?G:G8G.G,G!7GG GCGJGGGGoGJG.9G-0G*G'~G)9G)SG&G-G.XG.iG-G1G,&GFiG1jG&LGMG GGFGrFF`FFFGAG&G*G4G)G"G-{G,G9 G-G$GGGG%G$wG"JGG`GGGGGWGGG FFVFGF$G G GGGHG GAG GGSGGGG!GGG9GoG G+GGGQGGGFFFFJFFFGLGG/G32GFGPGHG/G*G=G3$G.G,GGG%zG.VG-G,G$vG pG@GGUGMGG+GrG+G-G"HG-GAGJJGVGYGMGbXGjGw4GrGqIGyGGGwGdG`^G9G%GG ?G ]G GG4 GN$GLGTGLG8G4G8XG<G@GHcG7G8G#IG!GG:GG[G GG^FFFG KGG(nG(G(G7GEGEGGFFG GvGG G'G3G:G;ZG;BG4G*sG(G0mGG\G FVFGG.G'_G%GG6G4G)G8WG3G1zG0~G'G)G_G+RG'hG.GfGMGGOG G GnG{GIGBG$GG)G:G2GYGGG G5zG3yG1G9fGRGwGGGb3GPG< G7GBG0G9G,8GG }GG GVG1wG34G3G'G/,GUGeGGGdG^GW.GE'GKG[EG]GJ5GWGpGeGeGuG`G\G`GDGA^G1G2'G)G(nG!aGGlGFfF$FF>FFF"GGG?G&G!GGhG=BG+G&GG&G( G2G2G,G6rG<GFGQGTGKGEG6G4nGMGInG6G.hG0G9G0G4$G(G#lG%G*G9fG4G:G>G/.GoG2F*FFFFdFFFټFZFG GG!G,GBGMGzGzGkhG_GTBGRHGWGEG:3G@GDZGS@GMGUVGF GVGcGsG}GGnG_GVGREGIGYkGZ#GSYGD-G9G>qG>GSGY^GYGGG9GGG5G0G0G@rGD GCsGBGNG>GEsG2G5G8^G6aG(lG/-G1GJUG^CGXG?jG=G5mG'SG(G#[G#G*G3G6hG5G-G'5G#[GGdGG+G>G;G:0G:GDG7GGGG%G)WG+~G$8G4GHG[_G`7G[lGy`GG~CG\G]GeGkZGGGGGGGGwG^vGYGG-G+G&G$ G,UG0gG)9G"G#|GG1`G&/GGGG G 0GGJGG&]G'GG&*G%9G&SG$CG!G{GG GNG#oG<G3zG+GG G*G)GGG*GrGGGGGGGGGGGmG G\GG 7GG G G$8G1G GGsG%kGGGGG%fG G lG_G!FG"G G'G1!G0G"ZG%G.G1G2G;@GAG8JG+nGAG GG#7G\GGXGVG GGG$G%G>GMtG@RG8UG>G<G5eG*?G<G6GHGSGOrGhWGyG5G1AG.G.}G4MG$GGG G G {G;G,G01GAG7G.G%"G<G3G,mG:G**G.G9G?G;KGGGiFFFF޸F"FFВFFF¶FFɐFF@GOG@G&G.G<GFG@G9+GGGUGN0G9 G'GGG<GF6F`GFGyFnFGLG)FFDFLFF*FTFFF:FF2FFFFTFnF&FFFFFFpF|F(FհFFrFXF~FFϞFF4FF6FPF FFbF$FFFFFRF^F@F^F"FFFDFFFF8F`F4FF(FNFFhFFG tFFڈFF`F٢FFFFŒFFRFNFRFFFFFFXFFtFFF|FFFFFFFbFFhF~F4FFlFFFNFFHFFFJF~F~GF\FFFFjFFFFFFFFF:FDFF|GGG G`GGGF,GGFFrFFFFpFFFF&FFFF<FFFFFHFRFFsFwFFVFF6FFFFFVFFFFFF*FdFFF0FFFnFcFeFxFPFF{FFFFVFFFFFFFNFDFyTFyFmHFgFOFNFS4FIFQFTtFUFXFcFl\FnFj(F}FxFlFfpFZFUhF2F)FF HF!F"(FFFF! F,hF5F.HFBF>F=0F.<F FF0FdFTFFF4FF FFDFFFFPF%F-F9FYXFoLFelFn@Fb\FaF] F>xF30F%FhFFtF F FPFF F4FFhF,F`FLF FF#TF'F'F0FFFF $F HFhF HFF<FHFFEEEEFFPFEpEװEXEXEۨE8EE@E0EpEHE@EE EHEEEEEPEEEPEEhEE8EEEPEEEEEEE8EEEEEhEXE(EEE`EE8E@E`EEEEhEEEhEPEEpEE°EhE EEXEw@Eq`D D DD`D@D@DDDӀDDD`D@D D DD`DDD`D DDD`DݠD@D`D`D`ED E0E0D E EE&E'E*EBEF5F4F'XF@FFF|FdF F4FxFF FFF!F&8F$pFF \F(xF$@F(,F2DF5F.F!xFFF$F4XFCFQFZDFcFzF~FxFm,FgFg FlFaFQFK`FGFEF@FMFDFIFG@FJhFY<FhdFfF`FIFB(FCFDFKLFMFOxFR(FUFXTFNFKFDPFRFYFmdFp|FvHFw<Fx|Fu8FjF^FcF_FkhF} FzFutFvFjFjFedFeF{F.FFFxFnFn FjFcFVFRPFNFZFZF_F_Fm$FpF^Ff<FmFy F~XFy<FopFsFiFiFbFt\FFF6FFFF~Fq4FjFsFlFpF{FFFFFZFZFNFTFF}F}hFkPFpFmFpFvFy\Fu$FuF|FjFgFoFhXFkFsFF,Fw,Fq\FhFYpFRF\F_F_FldF|FFDFnFxFz8FF FFFFJFFFFF&F~FFnFFF F:FFFFF,F^FFFFFtFFFFFFFFHF$FFFFF$F@FvFPFFFFTFvFRFFFFǦFF0FЌF FFFFFF<FRFVFF,FNF$FFFFFFVF|FF8F2F\FFnF2FFXFF8FFFFLFFFFFJFBFFμFݎFFVF4F8FFZFFFFFFF2FFF(FɌF.F~FLFFF"FfFrFFF2FvF6FFFFFFFTFFFTFŶFFϞFȄFFFFdFFF`FbFFFtFrF@F"FF,FHFnF FHFϚFސFLFFFFGbGFFJF(F0FxFFFHFjFFFߖFFFǴF$FFFFZFRFFFFF,FdFFF.FpFZFFJF8FF*FF>FRFFNFLFFFFF^FFFFFFF>FFpFNFFF2FJFF FռFFFրF<F6FFF8FF*FJF@F~FFFF\F0FF@F.FFnF FFVF\FF$FFFFFlFٺFFGG G GHGGeFF.FFFGGGF2FFGGG)FBFbGG*GG FFFҺF՞FFFGGFFFFFnFF*FjFJF6FGF FFݶFvFƊFFFFHFFjFVFF8FFdFżF|FَFՆFκF.FF FF|FZFbFPFF^FFަFFFֺFFFFNFƊFFFF~FF:FF@FdFFFFFFnFÎF2FFFFPFF¾FƌFπFFӸFFFF\FFF4FFԠFFGGNGFF~F2FGGGGG,FhFFXGG#G$?GGdGGGGG.G6XG7G+G/G(G(;G'#GGG GFzFFLF.FLFͦFFЮFFՂF FFbFFFGGGG+FFGGGGG G G FFZFG5GG {GVGbG"GAGG G`GGGG GiGGGG'XG%G#GGkFFGGGkGGG!G:GGGG"F@G)G xGGGEGwGgG@GY*GWG;G&GGNGGsGG'G"G$G-|G0|G=G7G!GG"YG(G4CG.G&qGTGUGG\G*G!RG%G&G"mG nGGzGiGYGOGGG!G.0G!G&G!G$GGGGGGoFfGG}G [GXGLG(G!=GGQG"{GG#G(G<G7G>G=}G84G1G)GGG #GFFFFFFFG 3GG G*G*iG G$CG&G.6G,G! GGmG_G%G%GGHG GG4GrGGG GG rG(FFF2FGGGGG )GaGlG GGMGGG G `GGxGGGNG G PG5GzGG GfG GFJFFFG%FHGGG%G,oG.GF G2yG-G$jGGGG@GGGTG"G G*G, G?G G GRGGGGGGiG)G0GGGIGHGSGNGKBGXGdGfGjGrGzfGrGjG`GMuG6G" G4GIGFGSGG(G8GCSGMKGHGG!G>G::GHlG2G1\G<G5qG(GGGGmGGG@G GUGG7GG%G. G7QG;mG@)GI,GGF6GeGGGG wGG$G.G;/GDG>G.G2'G,G,;G&FGG GGG ~G#G.G/*G%CGGG/G-G+G$6G$GG^GG!FGG>GGG0GyGG G GGGGG*G#9G8G,GNGGG G0GBG>HGE0GdGGGGn'GUGTOGAiG?XGCG?G2GGGGG@G01G)G.G4G;GR!GbGpGuG^IGkGYjGNGPGUGaGTHG\Gh+GhDG]GtGeGOGBG@GGKvG5G$DG|GGeGG GF(FFFLFFrFGGG`GG#GGAG@G#GG"G. G-tG0G'VG0CG/QG4CGRGGGvGM*GJG=WG51G.G6uG:G40G#G.G6G/G-}G.G0 G6G>AGSnGSGWGKrG;LG#GGFNFFFFF6F FFGGGG G7GIGxGGoG[GHsGHUGFvG7G&(G*G.G=GBGKGIGNPGbKGpGG~GvGY?GNG=G;GF GSGYGKGAG?G6GDvGJ5GHGAGEGAG.G.G,G5G1XG68G6@G;LGG|G;IG&G5G=G8G*G-G3GMBGTGR+GHqGBG9G4G.GG$G,G0YG8G4,G,G%G&GGGG*GCG< GAG-aG7G7BGG$GG,qG:AG&G2jG?GNiG]G^GpGG\Gc@GYGpGGGGGGGGGwYGWGdsGUG9G(G!G0cG8cG+G$G2vG=GHRG2G#G"nGG GGdG!G)G+G7G=G/G(G-bG0G*G!G!sGGaGG)rG8G(G;G G"G+G#hG JG8G /G;G G G kGEGGG_G G~GGG GHGGG|G GGGFGG WG9GG JGGFPG,GaG#G G#G(G*G+G4G35G:G4"G'G7GJPGAG<GRGuG GYGG LG#G()G"-GG[G&G=G*)G6G0G(G2vG-{G'>G)G='G"G:4G:GTvGcGi*GCG:#GXGP3GSG6GmG,G [GvGG*pGNG'2G1G+G0fG+XG:IGBG6G2@G$G.G1G* G$GFFFF*FF*FjF(F*FjFۼFFhFF޾F.FGG xG7G'G&GGG-yG;G6GG G G GG F8FFF~F FFFF$FFF֢FƬF"FFF"FxF4FՒFͤFF F@FVFFfF>FFFdFjFBFHFъFF,FFFFFFtFFFFF>FʺFFF8FDF,F FFFLFFFZFlF\FrFjFFFFF:FFŐFͶFݦFژF$FFیFFшFǎFPF‚F¸F^FFFfF:FFBFVFhFFFFFFFFFưFJFFBFdFdFFFFFhFF:FFFƚFʪFFjF~F FРFGSGF͞FFFBFF2FFF^FFFVFFFLFG#FG G?GdGFF߈F^FzF.FFFF$FJFFFFFF.FFFF.FFF} FzF FtFmFuFFF>F<FFF FFFFJFFF\FFFFFFsFglF^FlFelFkxFrFkFrFyF}@FrFFjFF<FPFJFFrFy|FvFXFA$F: F@FD<FPF[Fh F~`FuFFyXFpFg\FV(FJFPFIF6F%@FtFDFF,FF8F FTF!F+F0F=XF@xF-F;xF18FlFFF|FE@FFDFFFPF dFPFFTFF$F5XFLFfFQFVFR0FLFAFI`FADF$`F!$F%FFFlF F hF FFFEF8FlFpF<FTFLFdFFF dF FFFFFFE@EF|EEEE`EE8EpEEEEE`EЈEEXE`EEhEEE E߸EhEPE`EFpFFEpEEXExEEHEE(EEEE@E`EEEE EXEEΠEϰEEEHEXE EEHE`EEE EE0E@EEE@EHEE@EEHEEEEDDDD`D DDD֠DDDڠD DDDDDDDDDDD`DD@DD@DDEE E`D`EDEpEEE E)0E. E>@EIPEeEpEJE7E1PEE#PE1pE&E" E E0EEEE% E2EJ0EAE)E3E3E:EDEaEzpEEEuEsEzEkEtE0EEhEEEE{ EfEePEyPEHE0E@EPEhE8EEz EEy@EtE}0EEzEvEuEEEpEEEE EpEE0EhEEEEE0EE EEEEEŸEEEEEEEEHEE8EExEEEpEEEE0EHEEEEEE(EE(EEEEEE(EИEEȠEEEEEEpEEEEؐE֨EEEEEE8EEۨE(EEXEEE EF FFFLE EEEXEhFEEEEE(EEEEE0EhEFF TF F F FdF dFF$FFFlFFHFF F8FFXF F#F+F.F2F;F<(FEdF9F0F.F#F!xF!|F+0F1F4F0F2F$HF,FlF F!F!F/F:DF8F@FLFZ4FHPF9PF5F'FF<FFF@FFFFF DFFF(TF(F%lF*F'\F$F#F*F,F'F+F,F'F#4F$F'F3FJFU8FY,FiFrhFu|Fo8FpFiFrF[FRFQFO8FIF@F?F8F4F@FGFIFWlFWxFTFIFHFJFAFGFLFWF_`FN8FL`FPFFXFBFFFM<F^HFmFm4FlFpFv(FjF_FfFpFsFwFrFz,FyFiFhDFgLF`FnFFFFvFdF\FWFTFIFEFE`FLFXFY F[Fc|Fq|FpFlFwFr FrFtdFvFe|FdF`tFeFlFF6FFFF F{FuPFjFs4FiFq,Fm(FpXF|FFLFFZFxFvFnFoLFj$FgFk FgFmxFgFfFgFnFxFjFeFmFfFcxFuFFFhFxdFkHF_FXhF[FaFcpFktFZF|F|F FFZFFF&FFNFFFFjFFFFFFFhFFtF>FFFPFFFXFXFFxF:F"F^FFFNFF"FhFFFF"FFFFZF(FFFFBFFbFFzF:FhFFȈFFĤFFFFFFDF{FFF,F$FFFF6FFHFFRFF0F~FFJF0FFF>FFNFzFFFFFFδF FFF0FâFFȊF.F~F,F0F$FF@FrFDFFFZFFNFFFFFFFFFFdFF^FFFjF^FvFFFF FFbFFFFdFІFFDFrFFFF~FFFFFFvFFbFvF FFFrF@FDFFZFبF,FF^FFFGFFFŬF„FFގF(FFFFFF4FȠFFZFFF,FFvFFJFdFFdF^FFvFFF@F|FFF FFXFFFFVFFFFFFFHFFFFFF FrFF0FF,FFFFێFTF~FFF~F.FF~FfFĞFdFFFF҈FߴFFF FF͞FBFFFFFFFFFFFFFFF\FzF&GGGHG GFF0FFFGGMGG$GCGGGXG.FFpFFFLFNFFF FdF0FG!GFG%GGFpFFݘFHFJFFLG GG!FF*FFނFvFFLFFFFVFFF.FFȔF6FѪFӖF FFF"FF0FJFHFFpFRFF;FLF&FFFXF΢FǬFFzFFFFFfFFlFFFFFvF$F4FFFF"F2FlFNFմFlFFFFFFFFFF"FߴFJFF2G G_FF6GFtFvGGF^F"GFFGG G5GG8GFGfG_G,XG: G@G;G7G; G+PG$G G GG<F4FFFֈFFrFF˼FLFFLFFFF&FFF\FFHFbF*FGGGGrG G vGFbFGGG ?GPGGGG GGGGGG GG(aG1G2G9G,gG%GGFpFFFGGEGxGG/GG tGGGZGrG }GfGGLGG(G<GQyGZsGC$G!rG \G#G'WG!GGG&GHG#oG<GHIGB1G3GG'pG.FG%kG)G+G"G&NG GG jGGG;GXG%G{G]GGGGGFG5G%AGGGG_GGG+G GGFFGGG GG$G(PG*GGGGvGvG|G-}GCIGGoGGGIGJ8G2GGG pGFFF\FtFFGGG#"G(MG+G"GGGGGgGGGGG GNGGGGG GGWGG G BGF8FF&FFGGTGGG FhFGGGNGG 7G 0G G G G KGG GG ^GGGGOGFxFF*FGmG G>GRGG#G)G7NG*/G%GGGqGGYGHGgG G>GGG!GaG GG ]G MG GGGOG+RG'G)G8DG5kG2G=8GSGGLTGIGVG]xGYGgGf?GcG_GNGPG>G GOG WGGGG#G2G4 GCG:G:1G6G9GI:GA G1:G;<G4G*9G GG|G_G GG GGFGbGTG5:G8GHG8YG?pGIG+2GPFFG hGG wG GqG<G#G63G^G?G&EG&G-eG'gG!kGBGFGlG'G[G-|G9qG0G#G&NG!G&mG,G,0G*GjG G[G>GG GGpGG 6G BGG GEGeG GGWGG,G, G-G eG GG.G:G;GHGzGGGGGYGRGCG5G6G/G-HG)G&KGG3GG"aG$G0G3PG,G>yGIkGq-GxG\GQdGMGPGOGP2GXGR GJGdFG_GVGeGqGJG;G3GJG:G%@G3GZGG8GGGFFFFFVFxFFFDF6G-G'GNGTKG5PG-G&G0G5G7G>G6G1G<GJnGLGK+GLG;G+G+G1G0G=G&G&G(G#.G&G1G>G],GRGbGqGZjGihGMG.G`G(G YGTG G[GFFFBFFTGG NG!G(lG9Gb[GY7Gh6GgGCG6G1G0~GGgG#`G/G@sGGGR8GHGTkG[GpG~GjGVGAG8?G,G8 GA&GSGGmGG;G6GIkGWqGGpGfGG G;G/G#GG0GG$rG&OG/MG+G'G$G'G!&G#5G'G/G?GIGOGEG/0G)FGdGCGG!G1G$G.G?GWoGXzGSkGTGjG\GZdGYG^GvGGGGGGGGpGX1GSGFG/G$G.G8GAG5G2LG>G>GDBG=G-G)zG GyFGGG(GSGQGKG3G7iG-G/G5G2G1G3G,G)G%\G0zG&#G G JGHGG%G F`FG G G UGGG:G)GG GGG#GOG dG\FGGG{FRFtFFxGGG GYGG%FGGGG%hG&G2G,|G1G1cG9G4G+{GG3G6G2G0GUGG$G!GG.G/HG%:G#^GGG GG&)GGGGG=GsGGfG%G2 G;LGVGbGiGWGNGf8GLGMG6jG#GGG2G GG7G"0G3G*G+`G7G@GCG5DG pGGmG1VG"GG kGFFFF,FjFFFVFNF<FɬFLjF,F.FզF~FG vGyG*xGG GG GG"G G GzFpGGFFdF|FF4FFFFFFFFxF0FFԼFžFǶFzFʔFFFFDFFFFFFFFxFFFtFF"FFPFF FFFzFɊFFFŚFFfFF>FTFF\FhFFFFFFFFVFF$FLFtFFBFF"F2F FFF\FFFFF,FFhF~FFF*FFF<FF<FF$FFRF,FFFTFFxFVFʚF*FǺF~F>FFFxF FFF`F.F8FFFFDFFFFFpFzFXF`FFF(FFVFFrF~FF*FFF(F.FhF`FFFFbFFFFјF|FFHF\FFlFFFNF|F"FF`FFFFFyFqFoFmFe|Fk\FpFF0FFFFFFFFZFFBFPF4FFFw,FsFj0FeF[LFeXFZFW(F[FWFUDF_FiFxpFnFkHFyFFFFzTF{FqxFhF`FJF9F@0FCFMF^Fp0Fu FxFs@FiFhFiFHFK4FKF;DF2F%F#FtFFFLFFXFF<FtF%`F0F8tF?F8F8F'FFF<FE`FF$EEpEEF FFF,F0F!F6xF0F7F> FKF=0F:tF.F2pF+F'XF.,F|F4FFF FF F`FEF$FEEE EE@EpFF F \FFpFFFF FLEE0E`E0EE0E8EۘE݀EEEʐE`ExEEƀEňEEXEȨE8EhEհEExEEF pFlFPFdF$EEHEEE EEEEEEE`EEEEEEEHEEE8E0E`EPEE@EHEEEEEEEEHEEPEE@E0EEEEEDDDDDDD D@DDDD`DD@EEDDD@DDDDD D@DDD@DD@EE EEEEpEEEEE*E)E90ETEhEn E@ E*E$E'E"PEEEE$E EEE`E%E(PE7E2 E-E$E3 E?`ENpE|EuEEz0EzEv`EsEkEp`EEEhEEEEpPEcEcPEvEzpEEyE|E{Ek EkEjEvEgEk EnE8EnE{ExEPEPE E`EEEE EEpEEE(EEExEEEEEHEEEEʨE8EEEE(E0EEE(EEhEEpE8EEEEEXEEE0EhEEEPEEELjEEEEEEE€EEEEEEEpEE͐E E@EpEHEE0EEEExEEE`FEE@EEpF(E@EHEEEFEE(EXE8E8EEEEEEEEE0FFHF FFFF |F F PFF FF`F\F@F FFFxFF)F)F0dF1F4\F6tF.F.F*F# F(F#8F/<F6F6F'4F!(FF8FF FhF!F/<F>FHFFFSdFMFKF.F$FPFlF dF$EFF F(FFdF`F,<F'F2F3F1F)LF(F+F*XF+ F$PF<F*F4 F.F. F)tF-F0dF>DFLFX@FcFr FgFeFhFaLF]FWFOFSFGF=F9,F:F7F8 FFF?FHFKFGFBF?,F?F=|FEFC FJFXFEDFHFEhFT FIFAFHF\FaFeLFnFsFxFpF`F[0Fd(FqFz\FxFuFtFc FXFZFY F_HFe,Fv|FfF~Fr0FZPFX`FV`FN$FBFDPFF\FYlFVF\FUFYTFhFj,Fk|FjFwFw|FsFq$FiFdFbFjhFqFw|FdFFFFFwFj\FdFeTFgdFrFwFF}8F}tFzF~FrFcFUDF`F`Fa FeFiFa<F]FgdFc<Fh`Fn,Fr<FeFkFfFjF}F~PFFRF2FxFg<F]xF_ FeFgFhFuFF^FFFFFFFFFFFFFFFFFjFFFFFFtF`F&FFDFF(FlFtFF|$F<FFFFdFFF(FFFFF F<FhFF6FFF\FFF FFVFFFFFنFFFFbFF}F{dF}FFFFFFFFXFFFFFFFFFFFF0FpF<F0FFFFFȔFTF:FFBFFFxFJFFxFFFfFFFVFFFJFFFnFFFfFFFFrF FJFjFFFFFFFVFPFFFFF,FFLF"FFTFFzFhFXFF,F@FNFF FLFFPFJFFF FFF\FfF^F,FRFFFFFG |GFlFFF:F$FF FFFtFrFFfFFFFFFFFvFFlF"FFFFFHF2F6FFF.FBFF6FF~F*F>FFVFFFF*F~FFFFHF`FFlFFFF<FFFˆFLFFLFFFbFFhFbFFFFFɄFҲF֮FF.FFlFFF2FF&FDFFìFrF&FFF@F†FbF(FȶFF"FFGTGXG G EGF8F@FF6GGmFVGGGGcFGEFFמF|FFFpFFTF.F0FGFZFGGG G GFFFLFFZFFG GGFFtF"FxF(FFFFF4FFFFFFF^FFvF>FF`FFFFFFhF@FFF`FF՜FFF~FFFȄFFFFFFF8FF FFFnF8FNF܌FӜFҶFFrFђFӶFFFFҸFLF߮FFF(FnFXFZFFFFܲFFF(GFFNFFFFGGGdG,FFnFGGGG1GG G ~GG*1G2CG8G@.G8EG2G%iGGG GF<GrFlF$F(FjFDFFFFFJFFzF܊FFؠFFFRF2FF`GG G ^GBG)GKGFGFFNGG G G uG G1GGGFLFFFG WG%`GQG>G3G?7G:G$GG FFFFGG GVGGGGGG9GEGGFG5G}G FG-G1G%G.G<$G,(G&GGGG$9GGsGGGG%OG.G':G3GG G.=G0G(G/aG'GG&G!GGMGG"WGEG)|G+G4GG8GBGG}GGGuGGyG$G G GiGZGKGpFpFFFG GG,|G).GGFG)GGdG-G( G?GKGOGSpGGGFyG&-G G hGGFFFF2FG&G G*G)mG4dG'GjGGGGNGGGGGwGmGgG_GGGGG iGG vG dGFFڔF~FFFG GQG GFFXFGLG9FnGG HGGGGGiGGGdFGBGG GF F*FFFFFDGGG3G"G$GGDGGVGFFGGG=G G G GGGGGeFGG BGGGQG$G%mG.G#G#uG+G0G5GG.GAGPGZGUKGK"G`lGPG?hG;G:<G$G G#G 3GGG:G3G7xG6G+G3BG5G(G-RG@dG6 G4G2G.GG4GG$G}GGqGG GGGG+G<1G@G9]G-\G5G6sGBG F~GOGGG^GjGGaG0 GI$G:G*,G$bG/}G,`G* GHGGZGG GvG.G=G5G+.G&1G GG!GG\G GGG SG G G GG >G GGG G ;G 7G GGQG&G8/G,GUG G LGGG2XGO GHKGzGGGG}GPGM.G7G3G+G1OG1G0G#aG#\GG#kG&G*_G%G,hG"-G)IG?MGbGg GI G<GGRGJGHJGDrGAG<,GRG[GQeGCGKGYG=nG2G)G>GC:G0qG$TG!jG G GGFFFFFTFڞFjFFFG GG3G,G*G(aG0G.^G3G;GDFGDG;G6GPG[!GP'GFG;MG/G%G$G#G2GG6GGG!G2yG-\GVGnGxGGxTGw8GpG9GGG8GGGuGGFFvFhFGG\GG]G#9G:G7G8G9G0 G%uG"G#GGGG-yG8PG>|GZGGjG]GnGu?GjGOGKMG5gG' G-hG3GDG7MG7G1G.G.GF"GCGGUG__G`GH]GVfGOGLgG>G*G G$[G5G5G!G#G)G3G=kGRkGPGhcGeGmGd[GBG@G>G3 GGGBG!G35G,G-G'G,G G&LG)%G.^G,4G8'GFG4GAG(GZGGGG&9G"G- G>?GGZGDGLGKWG\GZGI@GMGLWGcG{NGGGGGGGg2GFAGC(GGeG*G$G.G<G2G9G.G;2G;G;G0G-G% G F.FGGGGBGL~GTGD5GGG;wG=GFzG3FG.G/BG5G%G!G!G!GG3G"GwGG FDFFFpGFF<FpFG+FFbGG'G bGcGFRFFF:F*F FFRGFnF:F F~FF(GG$GCG[G$G&UG4G-G/fG.G3G"GeG>PG2`G%GGG$G2,G3G(G/PG5<G'GFGG G {GG GGG<GFG GGG$G;pGM@GbGpG_Ga|GN~GTCGaHGN G6:G GuGGGG GG+G%=G }GGG*G0xG'GGG#G1GG(GyFFFFFFFFVFF<FɢFͶFFLFʞFFFFGkGG!GGFFG!G]GlGCFF<F4FbFFF՚FۮF<FFF FF~FF^F@FłFłF|FLFFFHFɸFFFTFDFFxFFF,FFFBFF FFFF$FFjFVFذF<FFZFˤFlFFFFFVFFFFFF@FF2FFFFFFFRF8FFFFFTFFpFFFFdFhFdFtF$FFFFFFPFFF(FF*FFFVFFFF^FFF8FFF0FFFpFpFFFF&FF@FFFbF F<FHFtF^FFFFŔF^FFzFFFrFFFFFxFXFFLFFrFFFFFFdFFFFrFFF4FF&F"FRF"FFFFFlFFxFvFgFg,FfFgXFvFwFwDFF*FFF FFNF:F F2FFFjFFyFbtFW\FbF^8F^FSFI<FGFQFTtFHFGFaF\ FUxFW,FeFpF}F|Ft@FqXFx(FitF[FJxF:F?F@|FUFiPFrFmFvFhFiFhFGlFB$FBF.0F$pF* F" FLF@FFFFFFF"F3(F>F:F4XF6FGF>hF'FFFxFFxF8FE@EEEFF F F \FTFF`F" F$F7LF:F0F1F3F6F7F8F)FFF4F F FF F F FF,EEEHEEHExFFF`F!F%4F FFFlFF8EXEEEEpEhEEӸEEEXE0EEEE`EθE`EEEEEXFF0F$FF+F% F0FFE0EʠEE@EEEEEEXEEˆEEEXEEE8EEExExEEE EpEEE8EpEPEPE`EXE8EEhEhE0EEEEPE(E(DDEDDD`D@D DD DDҠDD@D`ED DDDDDؠDDD@DD@DD@D E EEEEE EE0EEEE!E E1EDpEW@ESE)EE`EE$ E EE& E@E@EE@E!E)`E7E+E&pE"E"E4E8ES E|EvE}EE0E|EqE^EsEEEEEEEg@E\ESEUE\ErEcE^`Ec@EXE`EEoEj0EbEbEepEfEjErE}EpEEhE EEEEEE~pEEpEEExEPEEEEE`EXE€EHEEE EEE8EEE E@EEEEEEpEExE0EEEEEE@EEEXEE@EEEEEEEEEE8ExE EEXEEEPE0EpE԰E`EEEXE(EEPEEEEXEEFE0EE EEPE`EEEǨEEڰEXE8EEEEEEEhFFF `FFPEFFF PF <FFlEE`F|F4F FFF$ F*F)F6F.$F0dF.tF0lF*`F"F!F$F)DF2F/F+\F&`FFF 8FFF`F tF5`F@FIFF4FNFLDF;HF*pF"pFF FdEhFFFFFF!F+ F1\F.F5F<F9F3tF,F)HF)F)F(F. F.TF/0F0<F(F"F&F8,F>,FRF]@Fd,Fj4FglFXXFWF\F[FXFTFVxF9F-\F30F7|F/F7(F;F5TF>F8<F>xF8(F:DF?@F>FFDFEFHlFJPFL8FHFM\FP FQ FNFYFaF`FsXFqFh FgFbPFeFeFm(FyFv FxdFdFZ(FIFDFHFMdFOFVFkF>FF~FiFNFJFCFEFKFRFWF[\FW FZF^hFhlF`(Fg@Fy$FoFk\FqHFsFlTFzFuFqFkFJFFFFFFnFaF^\FdFiFhFjFwFjFq,FcFlFaFPFV0FYF[FgF`(FaFZXFiFqtFj FeFfFiFg4FdFoF}F F}FxFvFsFfFbF\$Fb0FdFj4FuF~FFFZFXFFPFFFZFFFFFFFFFvFxF^FbFDFFFFFFFF:FFFF(FFtFs FrF{FwF@FFDFBFFF`FpF{F}LF$F2FFxFFHF}F@F F~FTFFFFFȖFFF^FFDFTF},F^FpFFTFFFFFF|FpFFbFvFFFfFxF4FFdFBFFFBF F`F6FFFΘF FFPFFHFF(F~F*FFFLFFFXFFF(FFFFFFFFFFFFFFF2FF$FVFF.FRFFF*FFFrFFxFʆFpFVFF~FXFFFXFFFFFFjF FFFFNFFFfF&FF|FFFFFlF^FFF^FٶFЀF\FtF8FFF.F߸FHF~FFFzFFFFRFFF.FFFFFF$FFFFtFF,FF<FFFFFXFF2FFtF^FjFFF0FhFF|F>FFFFFFFFFpF݊FFFFFԀFFFFӤFFèFȐFFFXFVFBFPFFFtFtFFJFFzFdFFFFFFTF6FtFFFFTFrF GwG ~GG,FFFGCFFGGGG FFFFܚFdF|F FöFPFF(FGFG,GJG;FvGGTG G FF F\FFGGG GG`GF"FFFFFrFF`F8FjFȀFȪFTFFzFFdFFFFLF@FFF@F&F FF FF~F|FFNFFvFF`F`FFFpFFfFF4FrFDFdF FNFBF׎FFF FFvFφFdFѶFPFFFF(FRFPFFzFLFFސFFFF6F2FFFF6FG FGDGxFGqFFG G GCGFG &GG>G!G5QGAG9G4G*FGGGG)GF$FF>FdF2FFΊFFFˢFVF˂F|FΎFѠF FFնFӔFzF\FHFG6FG G^GDG GF`FFfFGG;FGTGpGTGG GF@FF2G2G*G(+GK\G' G#G#G.G%GTGGFFF6FXGGoGG GGGF~GJGG GG%G+G,GG G,`G-GGGGG$(G(<G GGG6G(=G#eG%JG/G&G ~G$UG wG(G&G$GG"GHG?GGGGLG?G)G3G( G&G"GG dG fGGGGGGGGGG ;G FFF FG{GDGG!JGGGGFGfGG%wG9G?GPGWGNgGBG(GVGFF,FF\F,FF^FrG<GG'G*G!GaGGG$GGG##GGGGeGGG G GZGG %G7GG zGFFXFJFF FGG?FFFFhF,FFF*FGYGFFFGPG4G OGGGLGGFFFF&FܸFFFvFGGGGGGGGsG0FNF<FFFFGVG(G G fG GpFFFGG G .GGaGG%XG$GGGG GG+G:aGK3GNGEG=G=G6@G5wG@qG(G<GG iG(GG"G)&G/G(aG$GG$\G%GGG0G2*G-G-eG(G G:G?GG!GG.GG jGG GGSG |G7G@5G6[G*6G"GGGGG GGGnGG GG00G8G@"G1gG)G)<G1G*G#BG G.GGGGG(G&GGG<G?G{GG G(F*GGG G GGGGXG GFG6GGG G>GG G&GWGGGbG <G0G<GPGXGGGGGLGEaGCGFG;sG9kG4G5GAG)G#aG!G&G'fG$G#G7G"G:ZGO5GSG: G)G:PGLGGVG@G.G*PG;GL=GIG:~G6yGL[G;G6KG.ZG.G,tG*!GG"GkGUG bGVF"FFrFFFFFHFFFGGG9G)G,G)G&pG*GIGaGSGAsG@5G.G?G?G6G4G,G#GGGxGGG GFGGEG 9G*GGGYJGhPGGfGzG^G:1G GGGG+GTG#G QFFzFFFFG hGGG$G#GhG3G"GG"GGG 9GGMG&G1GFgGMKGgGdGXG^G`G^fGHG:5G*G#fG8G"(G1.G0kG1G7G *G%/G4G/GFGc&Gz1G_;G[GEG9G3?G'GG!jGG$tGKGG(G3eG>GGG_ GkGlGcG\ GGG6G/7G'GGG1G'}G49G)7G*G$G,KG G!G' G"GG/;G6hG,gG&G@G ^G ]G GGGLGG*G7G4G;G7G=G<G,G2oG.G=AGUGGe5Gm GGgxGr-GN"G3G5G:,G#G(G0G6G5G59G2^G5G9IG:wG3[G#wG$G @F\FRFG GG;GEG50GIGIGLGLGEeGDOG5G:G+GG!6G!UGGG&G'bGGG FFFFݺFFFpFzF4FPFhFGG FFF@FFFF*FBFrF FVGG G4GUF,FFFFG?GGG/GG$G(iG"G"`GGG(G*GGG!G$G7GCGAG:G1G&GtG?GXG G GGFFjFF:FGFFGG1)GHxGnGGf<GUsG7!GA.GIG3GGG VGOGGGGGG]GGG G[GyGG[G G 0G?GGNFFFFXFF҄FƶFtFFFF&FφF F͢FFFF.FG G-GF@F FFG]GlGFF\FF*FFFخF݆FFF.FF F݂FpFӐFFlFTFFFFFɒFhFfF FFFFFFFLFpF FFRFFʶFnFFFFF6FhFFNJFFFjFFrFFhFF}F~F}Fy8F}FFF~F{`FFFFFFFF FFFF FFF<FFFFFFF^FFFFFFFjFFFFZF.FFF>FFF~F~FFFFBFbFFFLFFFlF\F<FFFFFvFtFFtFF\F2FFRF8F<FFFRFzFFF2FFFF>FFFFF~FӾFLFFFFrFFFFVF\FFFFFFFlFFFFFVFF(FxFfF[FaFuFTF,F|FsFy\FupFFFFFFRFFFPFF\FoFYlFWFcXFsFh|FWFWFU FK`FJFAF@xFBFF`F=FEdFHFO0F[|FrFy F{8Fn8FaF^HFVFNFLFHFGFPFsFdFfFZFT`FWFBDF9F7tF*0F8F"F!F! FFFFtF,FXF(F/F2hF>F4F,<F.F:FCF9lF-F"FLF0FFdFEpFEEEHF4F FFFFFF'DF!8F(F4F?$FAFGFXFXF>8F5F;8F*FFlF4FHFF 0FXF4EEHEEEEHFFFF"xF$hF F F(F$0F$FHE8FFEEE(EXEEEEXE0EېEEhEEXEEXEEEF8FF,F!F!FPFFFxEEEِEE@EE@EEpE(EEEИEEEEPE`EE@EEEhEEEEpEEEEEE8EXEEpEEPEE0E8EE E¨EhEEEE0E @D@DDDDD DנDʠDD`DD D@DDD@D@DD`DDDD@DD@DD D@E0EEEEEpEEpE EpE&0E*E2E3E$PE,EE`EEEEE@EEE@E0E(`E$E0pE1E3E.`E6pE2E9EEEQ0EmEj`EEEEq0Ec0EYEfpEEXEExEEqE_`EU0ES`EJEIE[E[EQESEMEVPEq@Ev0E[PEZEYEmEeEiEeEmE}EEE`ExEEEpErpEwEsEuEzEpEEwEEEE8EEE˜EEE(EEHE}`EE EE8E EEEPEXEXE0ExE(EEEEEEEE EPE8EՐE(E(EEEEEhEPEEPExEExE`EEHEŠE0EEEڰEE0EԀEۘE EExEEEEhE`EEExEEE0EEEPEE ExEhEEE0E԰E8EE8E EF(FFFEhEPE(FFTF@F EEhExEFTF xFF%F.F2|F-F0F+XF&HF/hF%PFFF$(F#PF-F,F-FFFlF F8F FHFF#LF5FFFIxF@|FF+,FFF F F F,FF FFxF#F(F,F1F.TF8FAxF5F8PF20F+hF.F,F'F%F)F*F%XF!F%HF-F6(F?FWF[DFeFhF\FOFPF^`FYLFRFKF8F1F( F2F6F/|F6F4F94F7F2F8F3F2DF3F;\FH4F@|FN4FRFGFFF^$FWFQFLFY0FbFW\FXFc`F]XF`F[FaF`F[8Fn,FjF`FQFLF<(F;F><FFFRFf@Fx8FF8FLF_8FVFPF\<FGFH`FHFOFX|FXFZF]FZxF[XFfFbFi8FoFwDFmFFxFwFs@FwFFFnF}FtFhFQ4FVtFXF\FchFd8Fc`FtXFgFcxF_FaFYFQFSFYF\FYF_FexFkF}4FuFkFcF`FgFepFg`FsXFFwFwFqFoXFfF`F^DFhFtFrF|dFvFFFFnF>F`FF|FFF>FF"FFFxFzF$FFF|F4FxFJFFFFFFFF^FxTFj@F]FcFfFwFFtFFFFFFrFoFiFuFvF{`FuFyFv<FpxFs,FzF.FFFBFFFF0FFFFFBFFFFFFF$FFFfFBFxFFFzFFF@FF4FPFlFFFRFFFFFFFF6FFFF^FFF(FFFF$FFF FF|F&FFFbFF~FF&FFFFpF0FFFFFlF\FF6FF^FF`FFFnFFTFȤFnF(FFFFF$FFFFFF^FFFFF^FF&FĦFFFFFFhFFFFFFF4FvFFF֘FZF`F4FԚF2FFF͜FFFF F0FȴFFFvFjFFFFFFRFF>F>FF>FF FFFFFFFFFFNFFVFZF2FFXFFrFF¬F|FF~F@F˞FѸFFFNFF.FFhFFĸFFF&FFئF FFFFF̜FFRFFFFZF\FF F~FvFFήFvFlFFTFFFFlFvFFF FFFvFVFpFDG HGtG =GF4FpFF֮F6FF.FF¸F@GGGGG ^GGGFGG hGGXF.FjFnFۼF\FFGhG GFFpFF6FFFNF.FFxFFPFȞFɴF2FϨFVF@FrFF~F<FFFPFFżFFFF6FFZFFҪFFFFˢF@FbFHFFFFF|FFPFF̌FغFZF(FfFFJF*FFžFFFFFҦF*FVFZF(FdFDF0FFFF<G IGGG GFFFG|FFFXFGGF<GGLG G^FtG GG%7G-G3G1LG<G;G4G*GGZGWFFFFFFFFRFF̆F`FƨFƘFFF0FDŽFFzFTFFF6FG>GGGGG FFXFhFFFFFFGGxGGG8FFGjGPGGaG6 G0_GGGxG G7GFF<FFFGFGGG{FtFFFFFFGG %G G+DGGG vG&GG GoGG6G#G#GGcG#gGGiG'G(G)JG4GOGGGG"G^G6GGGG@GG&|G$G%G/G6 G0G.=GGGGGGlG G G4GGG}GG2FvFFF GG PGGGAGGG GGKGG1G8GAG?GQG>G$SGGFFF*F FFZFhFG:G G G]GGGG GGGG&G0:G$0GGG!GG GGGGG;G6G G)G,F^F\FFFtFJGGFzFFFF6F<FFFTFlFFFlF*FFGGGlGZF\FdFpFFڴFֶFFFFJFGGGG G G G G"FFFFFFpFFGGGG6FzF*G'FFGGnGGG TGsGwG G lG(G(G$DG&bG0GHGEGAG5G=G6G6G-G$G G GGJG G GG-GGG nG$ G=GG%ZG)G(uG%G( G kG4GGGG G %FGG,GSG GG#G< G2G(JGzGGGGG~GG GGGGG-G=G2{G*G,G#G/GGG}GFGG G>G$tG8)G$GG G G>G YG"FhFGjGGG#GGGGG GFFhGxGG&GMG G4GyGkGG(GG%G5G:GFGtGxGGGG_G@@G/G8G1G8TG,G*]G8G1G),GG$GG%G$GG rG%nG@GEG3qG GhG:RGAgG=VG%G!oG.mGAG?;G4G-G;G5G'GfG G$G-G!G-GGGfGFdFFFF|F2F8FGG BG"G GG1"G2RG%8G""G2wGMGZGCGJGCG0$G4iGAG4rG6G$GGG G SG9G \GEG9GG 4GVG'<G7 GKGdGfGdGg(GU(G4#G#GGGG-G"G/G F FFGdGG vGGG G&GGGgG GGGGGGGAG8GBG>GTxGAGOjGM`GKGDG4G&G GG'GG G"G-GG"G"G2G+G8GZ-G_G]"GUCGFZG0G1G.IG GQGPGXG%G,G3G;G7?GD^GiG}*GG]GE?G@G/NGGGGG>G#G*VG G(G#G"rGxGGLGGG 2GG(kG0G GvGFGGfGxG GG5G'$G$G'G&?G*zG#GGDG&GCLGeGL GGG^"G[xGcG@G'G1rG4GGG&G7GA%G>G5PG6WG8G:G%GGGFFFFG G7}G:G%G-GE}GKGMG@G?!G6xG.G&BG5G GG#GG$G"^GGGFߜFͲFzFFF~F,F*FPFƌFFŦFFFPF\FdFF FfFXFۈF~FFGG OG FFF&FpFTFFFG aGGG GG'G%G@G G jGGG5GG"aG5]G'G*G,G*G&G(G*GGG G GCFFFFF0FFFGG5,GZG~/GcGdGKG/pG8G.G!G G G G+G GGGYG _GGG)GGLGF<FFGGG?GFpFFFيFFFVFXF$FFFFPFFΚFFF>FFBGwGFZFF(FF0GJGGkGTFFFFFFҞFFFFFۖFbFFFF:FFF0FFFF FfFLFFFFFlFFF FFzFRF~FȦFLFF\FF֢F:FFFfFFFtFFPFPFF8Fq FoLFpDFuFqFsFFzpF{FF~FyF\FrF^FVFFFFFF FFbFF"FFFFFFF:FFFFFXF(FFFTFNFFFFFRFFnFFFFFFnFbFF|XFFFBFFFFjFFFF>FFFrFF>FFFFZFFBF>FFFF@FFFڨFzF˴FFFFFF`FFFVFTFfFFFFXF FXFFFFhFFFjF0FFnFxFJF|Fo@FjFh@Fu4FFFwFm\FghFh|FvFFFlFFFFFfFPFxFgFfpF^Fd<Ff,FkdFdFg,FcxF`(FUFA@FExFEFETFE FKFL$FVFUF_FeFhFeFaFVFVDFQFY FRFK\FP`FWF`\F^@FOtFGFEF=HF5|FLFGF=F;F(F FFXFF FFxF FF0FFLFF$F$tF"F%F&DF&F2FEFP<FdFt$FjF[DFOFL<FMFCFlF FFFPF F<EEEFEE0FdF (F FhFF0F*F0@F2@F1FFFFFFhFlFHEEEE(EEEEEEEEhE0EE@FFFDFxFF F DEEPE`EE EEE8EE`FE`E E8EEEE`ExEEPEEEEEE0EhEE EEEPEEEpEEE(EE E0EExEXEEPExD`D`D EpDDDDDD۠DǠD`DɀD`D DD DDDDD DDDD`D@DDD DDEEEEPEPEE EpEPE EPE+E3 E&E$PE$@E#E EEPEE"EEEEE#E3E-@E'PE7 E<E9E/@E6@E0pE;EJPEKE]Ep`EEzpEkEZE\`EfEcE|EE~E~PEx`EcEYEXpEREKETEUEPET EM EIEPEYE^E^pE^@E[E\@E` EcElEkEqEzEEHExEypEmEmErEt`Ee@EhEnPEjEo`EgEEEEEhEEEPEEHEE Eq0E|EEEE(EEExEEE EpEE0EEE@EEEEEE`E0EEEE@ExE8EEE8EEEEEEEEǐEE(EE̐EHEEE`EEE8E8EE(EHEE`E@EEXEEEҸEHEʀEEXEEEEEXEE0EE0EFDEFFEEPEFPF0FFEE@EEEHFpFF% F4F:F1`F1TF#|F\F FF(F FFF$PF&F'`F(`FTFFxFF F LFF`FF1 F>@F:F7|F(F+F' F0FlFFFF PF FFF"F(8F0DF-F2F@F5FA<F:lF4F)F&F%F!F"FF%DF!FF $F*dF/F:FGFK\FULF`lF]dFRFIFIxFIpFFF=F1dF*F#F(F.F6F3DF6F;F9F3F1F,F'xF)F1 F=0FGFIFFhFMDFH F@FLLFHFEFE F[(FMFRFZdFW<FQLFYFPFU$FPFU Fc`FWFT$FCF>F?lF5DF?FOF_hFmF~FPFF~FcFVhFZFHDF<FAF>FOFSFVFTFLFIFQF[FZ|Fp FxF{FoFq0FyFx8FqXFjFvdFsFihF^|F_PFRFFlFNFSFUFTFZFgdFkFVF[HFTFZFQFJ(FNdFVFSFWFf(Fp@FrFjLFgFYFVF^FeFlFtF{XFF0F}F Fy|FtFlFhLFqFv|FFFFDFfFFFF@FFFFFFFFFFFFFjF$FFFFFFDFFFFF&Fv FlFfHFbF[ FiFpxF|FvFF(F FlF}FlXFb<FdFgFkFiFkHFoFgPFvF|F~FF(F6FzFF FFFjFdFFzFFhFFdFVFFF\FF.FFF0FbF<FF\F FFnFFFFFF*FF FFFFFFFFFNFzFhFHFFF<FFxFFF(F,FFFFF:FfFFF2FFjFFFFpFFFFFFF"FZFFFFPFFFpF FvFҘFF$FFFFFFFFFFF.F^FF FFFFlFńFĐF‚FЀFPFFFGFFٚF"FFܰFF0FFFJFʒFƘF$F\F2F^FnF2FFF8FFFFFdžFFFFrFFF°FFFFFFFFFFFdFFXF`FdFF8FFFF2F:FFFFFFFFtFFFGFvFFF֒FXFFFjFJF8FǨF(FFFlFFFFrFFFˤFذFִFFӪFFFZFFRFfFFFъFrF"FԴFF.FvFFF8FۤFFFFGG FF\FـFpF F4FFHFFFVF*GGGG GEG FXF GGyG7GFnFFFFF&FFGMGFZFhFڀFpFFF`FFFFFFzFɞFxFVFFtFFF>FƠFF6FFF’FFHFBF,F@F0FFFȲFGG8FFFÔFBFFVF:FF$FFFFFFޢFFtFlFFnFF>FОF8F~FȆFӂFFFFψFF FbFFFG GaGDGG GFF$FVFBF,FTFFDGGGFJGDG 1G G GyGGG*G)BG3G6tG=G@5G?G$yGSGMFFtFFFFrFԾFhF4FF FFzFBFFF6FFbF̖FFšFМFވFGG*G 'GGGdF|FFF^FFFGG }G G GGFF.G GCQG0G' G:G@GGPGGG GFFF6F F|FFGGkGFFFTFG'FGGGcG%;G -GGGG5G EG GGGGGGG GG'G!+G#G!G GGKGG GG+G"ZGG{GGGGG G!wG".G)^G8lGEG3,GNGGGIGHFFfGFFbGG{G 5GFFFFFlFGuGGrG aG_GIGGG _GGG&mG+G7G.G-vG"G)FFfFFިFNFܔFFbFF.GGnGGGGG0GG LGGGGGG1G!YGpGGGGtGG GFG G6GNF\FДFͲF|FlF<G^GFF6F>F>FpFF*FՌFNFRFFFF|FFFFGwGF0FF8FFlFшFbFVFF|FFG/GGGFGFFXFDFrFvFrFFzG GIFF<FTFtFVG&FFGRG3G [GGG G \G0G2G 4GGUG$G2G9G7G=xGLGHGHkG(jG(GGGGqGGGiG9-GGG~GG$GaGG!G2G0G/ G%GGG0G^GGFG4GG GGG2G5?G'GGG G0GGG4G]GdGG GWGGPG-G*gG'OG1G1G6G3`G$GGFFGGtGGG?G HG'GGFFFG1GGGsGG G2GG QG+G-GFGG GG$GNGG^GG:GGxG#G2G1G=G[AGvGG}GGXG2xG&G+/G8G5G0 G7PGAaG9G(:G%GGGG(DGGGG.@G7G57G*GcG#G+G0jG'GjGG(lG/G"GG(G.GGGGG1GG!'G GkGGF&FF4FLFBFFFGGGGDGG&G1AG#G G)GG+G%GGG G|GGGOFFFG>GGG+G0GB G_G_"G\GKGH G,G:G!GG)kG1vG0JGFFFGGLG2GGFGGG GmG UGGCGGF@GGG%G-G5?GD]G%oG(G9G6G/iG 8GG G GGCGGaG GG vGG(wG"G)G:\GB\GBuGIG;~G#G+G&G GGGG GG-RG1G>G]uGxGGGKGAG;YG1(GGGGG%G!G'GG'GGGvGUGZG G tGGG"}GpG FFBFFFF,FfG /G GG mG GBGGGG GG0G;G6G0G4GDGI2G/GaG8G5G&GG G&/G/G=:GFG>G=#G2IG GGFFF²FF׈G,G mG,^G G#0G9yG5G0G8{G<5G/G.GG {GG LGGcG @G*GGGGFF׊FbFLFF8FFFFFFFFF6FFF6FjFӎFPF,FBFF<FGG FFFFTFxF^FF F G GGMG-G)G(GGFGG G GIGZGGG G'^G9{G'G%0G+ GGGG<G4FTFpFƮF`F*F:FFGG2GIaGcGW6GJGGG,G$GG^G G 'GGtGGGG &G tFFF0FHFVFFFFFFFFFFFFϬF4FFFJFFFfFFF@FFXFnFHF.F@FGFpFF$FFFGG G FGF4FjFFtFF8FTFFFHF*FFFF,FFZFFF"FFFFvFFFF F"F FFDFFFVFTF–FF4FvF`FFFFFFFF(F@FFBFuFcTF^F_\FfFhFoFy F}FFFFvFsF0FFFFFF4FBFFFFFfFFF@FF6FFLFF@FvF(FFRFFFFFFFF0FDFF\FFFFFzFFtFFFHFFFF FFPF"FfFBFFFFFpFFF2F F"FFFFF,FdFFF&FFFXFFFFFzF~FF2FTFFFFHFFFF>FFFhFFFFFFFlFF8FFJF8FFJFFFqFWFNF_FxFFrFFFFrFFwFt FoFrFy|FFzFoFi,FxF^FWFWF><F;\FAFDFNFRPFTFS8FZFfhFflF[F_FnHFY0F_ FZ@F]tFLLFY<FcFVFWFMFHFHF=FCFEHFFTF/F(F*F%F!8FF#F%F(8F-F5F?F>F=FCF;F;F7 F?8F;FH F:HF@XF7F&F!FFF$F5F+F"LF8F&FDF,FF&F)<F!F%0F1PF?hFDhFI`FU0FhFFFHFk`FfFXDFS$FAXF(PF\F dF |FFE`EEFEHFFF pFF FF FF04F<F5\F+F$FFTFF"pFFEEEEEFFFxFF F F\FhEFDEFXEF FxEFEEEE(EE0FFF<FF xFEEǨEEEEE(E(E(EE EE0EEE EEpEEEpEEE(EHE0E`EEEEHEPEEF0EDDDDE EDDD D`DDD@D@DDD D`D@D`D`DDDDDؠD D D@DDD D E EEE E E EEpEE"PE! E(E.0E-0EEEE0EE@EEE@EEEPE-E4E,E+E5`EAE8ExF@F=F?$FDF9F:|FE<FKtFGFIFN(FVTFTFHFGFT<FOFPlFMFPFJF@LF;F0F5FDFUFd<FlF~|F4FwFiFUFNhFHF<8F2F9FC\FN,FD0FGFHF><F@F>FJFe\FlFl`Fh\F]FiFpFghFZFZFTF`hFPFEFEF>tFAFDdFBFCDFHlFPF[FQ\FNFGFF`FIFFFGDFFFFFN0F\FpFhFdFeF^lF`Fe,FgFeFs0F|FFFFz`FrxFoFpFjDFvF~FNFFbFFF F FFFVFFFF^F²FNF FbFFFFFFDFFFFFXFXFF,F}FxFlFhDFbFbFbFmFlFmFoF},F*FFFF}FkHF``FaFhFgFj|FmFhdFnFvTF|@FwFw FuFFFFFxFFDFFFFRFF|FRFfFFfFFFFxFPFFFFlFFF|FFF0FFBFbFFF6FFFFFFFFFFFFFFFFFFbFpFFFFFzFFFFF,FvFLFFFFFFFF\FFF~FFFxFpFFF.FLFFFŔFϼFҰFDFdFFFNFFFFF4FFF0FF`F\FFFFF FȞFĤF̆F͢F@FFFFFFמF0FF:FFpFF.FpFFFАFFF˦FΤF"F*FFpFFFäF,F4FFFFŢFFFFFF FFF&FFF4FFFFF&F0FFFFFF2FFFFFFFFFF8F:FhFFF(FFFLFFzFXFxF^FtF4FDFFFFF FpF(FFF FdFFFFHF~FFnFɘF$FzFFFۢFF F6FּFFF FFFF.FFtFFFdFF>FFnFrFNFFF\GG fGFFGLG GGGG FFF|F(FtF͸FdFGFF(F FŰFdFFFNFFFFfF$FàFBFFtFؘFFbFƖFjFZFvFFFpF FFFFlF@FFGG GFFJFːF²F\F4F\FFFFjFǦF&FܢFߢFfFFFpFFFFFߊF̤FF@FĒFF F F8F"F&FFF,F2FFFFFDGFVF(F8FF0FFFFG=GdGG nG G^GGGGG,@G-IG-aG+{G8G2sG#AGG&GFFNFFFFnFVFFƄFF F4FvFFXF FFɂF̐FƠFF6F~F>GfG1GGGG6G/FFFFFGGGGtGrG GFGGG$G'GG'G6G)G%6G sGGGFHFFFF,FFݖF8FG GFFFFGNG GF<G G/G FF G G sG -G1GGdG GGGGGG%GGGPGGSFGGG G G G>GnG G.G$GG&G%G)G8G1G/GGGAG G "GF@FnFtFBFjFFFFFFNFFGCGGGYGG G G GG&GGG'G.GYG\GG^F.FݔFFմFFJFFټFFF"FFF~FFFHGGfGGGGGGGG!GiGGGHGkG"G"GGGGF$FׂFӚFFF FFFnF۴F$F,F,FFFHFFFVFFӀFlFF.FFFFFHFlFFFrFΎFΔFǘFɖFF:FNFFGFGFFFFFbFrFF4FF~G1FFJF2FFG(FZGGFG [GGGEFvGGGGG GGG5G:G6aG9G;G5G-G,G*G~G~G!GzGCGG%{G#G$3GGGCGzG;G GTGGGFGGGbG GGG2G2FZGGGGGGGGPG0GGG GGGGGGsGGG aG%G-dG GQG!G-G0G,nG-XG GFGiGG G GFFrFtFFFFFPGG aGG/G GGfGFFG GGGGGGGG GG~GGGGyG!G.GHoGZjGjGlGrGt|GKG2G0<G(G<G+G/G8$G:VG9G%G&GGGyGG{G"NG) G&KGGGTGG [G#GDG%GG_GGhGGGG GGG#G G'iGGGGG sGF,FFFݾF,FFBFLFGGG!G#G*G-XG$GG&G1}G@G4G)G5G/nGG.GG>GGGGGGdFXFFFFZFGG[G#G9iG=?G[GMGCG>G0bG#GG#OG'YG5G%GSGzFFF|FFFFFG[FBG@GGG@GFG6GGG GGG 2G::GG BGGGcG PGGFFlFGG?G_G GaGLG8GGG/G,G4GAG9eGG&G$GG GGGG*G|G)UGIGLGeG[rGnYG=G)G)GYG)GGGGG"GbGFGGGGEGGGGG~G8G G*FFFbFFF*FFFGGFF(FGFFG GG,G?GAG?G0G:\GCG"G,GZG G%G&G!G$G/-G4G2GG+G-GGF F0FFHFFΐF^GGxGIGG,G2G#G#G+G$G"G>GG G G aGGG?GGGFlFFFFFFFFFFlF FRF~FXFFFFFFVF4FvFFG|GGFRFۘFFpFzGFG%GG(G9G1G3G-;G>GFFFFFG@GGG.G.nG1iG2CG0G?bGGGvGFF FFFF|F|FNFF"GQG-GGUGIG<_G3GGnGGFF$G +GcGG \G GGFFϨF FFrFӨF<F@F̮F(FFLFhF*F$FFFFFF:FFzFF F`FNFFFĚFBFFۚFFFFZFМF*F`FFFFF<FFFFFڂF~FFF:FמF,FdFFFFFFnFFFFFFFFFzF6FFXF~FF0F@FFFFhFFӚFFF~FF\FFZFFFFF FFw`FdFTFRFUFWF\FnFFFFFwxFz<FxFt FFNFFFFZFFFFFF FLF~FF~FLFFFFFFFBF6FFF^FPF^FFFF8FhFJF6FvFF{FFFbF6F2FFFFXFFZF6FFFF.FFLF8FnFFFjFFFxFFFFF|FF؜FFظFFFpFFNF͜FΆFFFF<FFFFFzF$FFFFFFFlFFFFFPFpFF}8FFFF~FFFFqF_FGtFNFVHFnhF{FFFPF$FFuFrTFwlFlFJF4F FFr|FzFlFSFPFOhFC F6F9FDFSPFQF[FbFiFcF]FbhFmF`FbFlF`F[FbFyFjFc FRFSFTFD(FFtFIFVLFN(F8F4<F+F(F",F%F&,F'F;F5FAFJ4FFpFDFI$FNF;XFA0FLDFHFCF6F-F7F-F%F)FB FXFLFI F48F0F,FF F"DF*|F%F.FDFSFiPF]4F\FnDF FFTFF|Fn4FddFL(F)FLFF FFlF DFFEXEFFFE0EFFFPF"0F#F"@F.F2,F4F<FFF=F-FPF DF|FEE`F `FxFF(F|FxFFFF EHEEE`EFFPFE0EE8FFtFHF"pF%|FFF<E0E@E8EPEŸE0E0EƸEXEEϨEΨEpExE0E(ExEEhE EEưE(EEEEhE@EEHEʘEEF `FFDDDDDDDDD@D D`DD@DDD@DD D@D`D D`D`D܀D݀D؀D݀DDD`DD`D DDE E EEEE pE0EEE4E-E'0EEEpEE EEpEEEEEEE E%E0E9PEDE>PE3E>EHpEPER@EQEUPE_E`E\`EjE[ETEe0Ee0EqEYE]0E]pEcEU@ESETEWEWEaEV0ElE_EWEQpEBpEDEO`EPEZETEe`EZ EjEf EhEr`EhElPEhEhE]EWEM EMELEOELEUEUPEYE]EcEoE{ EEpEXEE0EEzEeEe0Ee EeEmEyE~EuE~E(EXEE8EXEEEE8EEEEEEEExEE`EHEPEEXE0EhEEPEEEEEPEEhEEhEEEE8EEhE0EEʨEʀE E0EEEEҘEEEXEE EEEEExEEE0EpEǐEPE E0EE`EXEEhE8E0EEEڀEEEE0EE0E8EF(FF$xF.F-F%F$|FFLF FFF|FxF(FF@F F LFF FF\F(FhFLFFFFFtF$FxF(FtEEPEFFFFF FF#F-F/F(F/ F7F,F)PF$F&@F*hF&FpFFF"FF&F!F$F+LF,F2F1F6F?FMFFFFDF<F2F5F=FBF)tF1\F&F&F-F-DF.F7F3xF5F5F1F8F,F!F#XF+F-<F4F3DF<0F@pF2F2F4TF3F5FBdFKF=F=FHFTFKpFETFHFJpF=F@FDFC8F<`FF7lF8LF=FNHFVFelF]HFUFNdFVFaFPFD FJ`FRhFPFF\F=F:,F7@F7LF<F7F=$F@FDDFK4F@F8F:FCpFDDFBFBFELFJ|FWHFo$FhFaFbFaFfF_FgpFp\FoFtFFwF}LFzdFulFmFvFvFw@F|FvF\Fx$FthF}LFF~FFFFFpFFFRFF|FFFFFFhFFFFFFFF|FrFo\FiFdF`4FdhFg$FiFmFgFhHFpFvHFuFF Fm$FdFd4FhFgFeFfFkFq\FpFsFoTFoFrdFr\Fz$FFFRFFFLFDF6FFFF<FFFF$FlFFFF4FFFFFTFFFFFFfFFFNFFxFFF`F&FFRFFFpFhFF FFFFDFpFFFFFF:FFFRFPFFTFFF$FFVFzFFFzFF.FFFFFFBFFFFFF FFFFFFFFFF:FFFFFtFFF&FFFxFFFFF@FTFΚFӐFFFhFFvF<FtFFFFlFpFўF>FFFظFFF*F6FFFɞFFעFFÆFFBF|FFFFFRFFFFFrFFFFFFnFFZFFFFFVFFFFFF.FFLF*FFpFFF0F6FFFFNFϼF FFFFjFtFzFFFFFRFFȲFF՞F F FF<FFFFFFFFFZFFFŢFъFNFFFFFѺFxFÆFFӎFFFݸFFF FªFFFFVFXFrFdFdFFVFG FXFDFFGFFNFFF2FFF҂F&F@FdF0FFpFpFJF FFFFFFFFF@FɒFF8FFF<FFNJF^F.FRFֆFFTFFFF˰FFFFFFFFF|FڼFFbFnFF\FLFFFFFȨFζF(FFFFFFFFɶFȼFvFFFFF0F$FvFFF2FtFG FhF:F>FGF\F$FxFXFFHF߄FFGGG;GGmG[GGGG<G+G-G 5GGG GaG GFFFFF FFԴF̀FzFǖF`FFFFFFFF|FF~FF̤FG G [GGGG +GxGFFFvF.FFFHGG GGGQF0GGGG.zG#BG%G,jG&G%GZG KGGGFFF&FF$FFFFPF`F2FGGKGFF2FG :GGF(FNGGGF\FVG 8G GPG FHGGGG$G yGFFFFFGGTG ^GGGIG YGGjG,G#G(G%9G(VG#GGsGGWG?FnF>F,FPFFFFF^FhFپFG G1GG nGGnG #GGGGG G G7G#GG gGFvFFFЦF̈́FþF¼FjFFFF߈FFFrFؘFFآFGGGGG5GG GGGGGlGG.G-;G&%G#GGFDFFFFZF6F,FFTFFFFFbFFFƌFF4FFFLFܢFF FdFFpFXFF&F F FFFTFFFژF2FxF|FFNFlFlFF~FۼFFDFF&FG(FFFjFFjFFFF\F&GGGGFFFFG>G GmGGG)G8G8`G.G:G)-G4JG&IGGMGGG1GnGG&G#GGG CGGGGxGzG GGGGGG G4FF(F>FG%GFGG#GGFFFDGG]G ,GTGGG F~G9GG/GCG.G#G2+G'"G.G1VG'GFFFGGGHGFFFFFFfFFFFGzG G G G GF,FnFRGG G GGGGGG,GRGdG;GGGtGG;GKGfGaGjLG_dGCG/8G6G*G9G0[G7<G5G4G:G@G@VG.G#GG*G'`G*G3[G4GGGGGG),GG GGvGGGGG1GGG GGXG,G!GGG3GFFF@FPF&F~FFhGjG G nG9G/G*G1G2XG eG[GWG"cG6G,G/G+G*G#G.G!GGGGG{FFFFxFFxFFFGGG#[G2GLKGF5G6G3G/G6GG$0G&G#GGGtGFFFFxFFFVGGGGGlFGFF$FF\FGGGGGBFG FFFRFXFPFFPF*FGSGG ?G6GGG GOGGG#G+G,GG;GG GlGF<FG~GwGG#G8PGFGAGO$G*RGNGGGGG GGrGGG ]G pG LG G$G GG GFFGG FF(FFDFtFFFFF&FF F`F,F(FFFFG!G$G0G*G!fG$;G'G,`GGG@G!CG`GGG7G G%kG-G GG>GRFTF:FTFpFFFńF\FzFxF"G G GmGG!G GGG G GjGFGGGG lGFFFFbFČFFFFF<FF"FFF@FFFFdF,FVFFGGFGpG dFFFЦF̺F݆F.FFGG$oG(G+}G%]G+G(G GXF^FFFFߤF\FG G GG,>G5LG4G7eG1GG G;FTFFFFhFҺFϪFFvFضFG G"}G.G)GGGG ]GGFFGNGGGSGGhFvFFFFF\FøFFF:FFdFFFFF|FFFFFFRFbF@FFFFTFBFHFVFʖFFPFfFFF>FFFFFϺFF&FFʢFFאFF>FFFF(FFFF"FvFNFLFFrFFFF,FFFFFFzFF$FFF@FFFFFdF8FFFF4FF@FFLFzFFFFmHFa`FNPFOFQlFOF`FyFFFFF{FvFwtFnFqFyFFFtFF>FFFRF:FRFF|lF}\FF"FF FFFFF}FwF|F}F|FFnFFFFLF6FFFFF~F\FFFFfFFFF.FFFFF*FFFF8F,FF6F FbF,F@FrFzF׮F^FFFF.FVFFFFFNFXFFFFFF:FNFFLFFF>FFFFFF>FzF.FFFFrFrFFF FFFFDFFF{TFv(FbFIFKFWFs FFFFFFFFxFFZFFFF\F Fm FNFMtFNFH4F<FAF;tFFFYF_FdF^FgFkFlFnFvFj@FqxFi,FpFmFu$FFFXFNFaFOFJFJFUFHF<F/F/8F3$F'dF'\F(tF7(F6F7PF<FDtFGFGFQFVFS4FW<FWpFLF8\F8`F6F1FDFD,FDTFbF|FpFgHFd(FMFCF.F*<F3F-xF7FCFSFj<F FwFpFJFRF6FFFnFyFmFIF2,FxF$F$F F FFFF(FF F`FF0F\FF F!HFFF"F)F@F7PFGlFQ`Fa0FAF1FF 0FtFF `F\F!TF*,F*F! FFFtF DF E(EEEExEhEF,F F HF`F (F$FF%8F- F%F`F0FEE`EEݠEߨEEEEPEEpEEHEېEȀEE`EhEEEސE(ExEЈEpE(EEEhEӨEEEF EHDDDDȠD@D D DߠDӠD DDˠD`DD@D@D`D`D`DDҠD@D@D DD`DDDրDEDDD`DE EE EEE EpE@EE*E; E-@E!EEEE EPEEEEPEE@E0EEE.PE=pEE0ED0E:PEC0EMEOERpEa@EbpEOpE^EZEW`EX@E] E]0EfE_PEX ENEPEY ElEZE]EV0E_EZEdpE`EkElEYEKEF`ECE<E?E[PEUEf`Eh@EgEjEgEpEkPEeE`PEcPEIEMENEK0EE@EIEREXEXETPEWE[E_0EwEyEEE`EEe0EcEbEfEg E^pEeEyEz0EpEv`EEEEXE8EEE`EEEEEhEEEHE8EE`EEEhEEE E@EEHEEEEXEEEEExE0EEEXE`EExEʈEEhE0EE`EE(EØEEEˆExExEEEEEEEE EEEEƈEE8EEΐEHEEҸE(EEـEEPEEEEE`F<FFFF'0F#F$FF`F ,FF FFF F FF<FF<EFFFF HFFF <FF (FF pFtFHEEEHEFhF\F tF FFFPF#F+F+lF%F5F.F*F$XFF)F)hF'FpFFF F$F PF#F|FF(F0DF1F,(F-F?F>F4F.F1F/F9lF:pF)tF'(FlFFF#F%F)F,F1F2F;F+FF(F"lF!F#F%F2,F8pF2F*F-$F-F.F.TF9F8XF2F;FHFAF@FI|FIFKFDF>F@FAF9F6\F8FPPF]F|DFxPFrFFsDFfF^FKPF?|F6xF2`F(F*\F,F0F0F5F9F9F6XF6PFAF>FHFW`FU|FR4FQpFQFMFC\F:F?0FBFBF;F6tF=F9F9F8F8DF2F3TF?F@F8F8F:`F>FDF9F= FI FLFZxF](FVxF\FhTFdFgFjFwlFzFtxFrHFrFwFlHFlFmFnF|FvFzFFFs<FpFkPFudFzF^F}FLFFF FXFFFFVF:FFFPFFF0F^FF~FyFp FiFhF_@Fc,F\FeF[Fe,FbxF_F`\FkFedFsFsFlFlF`,F\FZFbFeFh8F`XFcFbF_FiFpFiFaFb`FbFlF|HFxFFFxFpFXFFFFFjFFF*F\FF>FDFpFFnFFPFFVFF0FFnFjFZFFFFFF.FFbFFlFFnFJFhFFVFFFFFFFFFdFFFFFF.F FTF*FZFNFFFFFFnFFFFFnFPFFFFF:F.FFFFRFjFXFFxFXFF FFF,FF`FFFpFFF FFFǠFtFhFFFƈF:FˈFFfFFF,FFF(FF̞FjF6FF|FBFFFFFFFF6FxFFθFFàFFFnFF>FPF|FF4FxF^FFFhFF FfFFF>FFFpF0FF$FFFFFF@FF2FFFFFFF(FތFF6FFFF`FFFFFFFFhF0FF2F¤FPF~FF:F(FF FFF<FTFF6FF\FF̐FdFFLFbFުF F*FǪFFDFZF2FϸFטFjFDFFFFFFFFFF<FdFFFF~FFXFFF0FFlFvFF^F FFF^FFFȂFվFFFF4FJFFF,FF\FFTF6F€FFǞFƎFĬFTFF*F0FFϤFFF4F*F,F|FHFFFFF^FFFFڊFF FFFF:FF,FJFFF|FFFFFVF:FFJFFFFFFzFFFFXFF FFFxFF"FXFFjF:G>FFJFFFڈFrFFFFpGG TG GGtGCGkGWG!GG#GG$G G\G DGG"FFFFFPFBFFрFhFpFFF~FFTFFrFFBFF F8FF0FGOG )GlGGqG GCFFZFFFGtFGG GGzGGZG}G2GG7G!AG`G#G) GGGG\FPFFFF|FFBFՌF$F,FFFFFGyGGFFHF"G#FFFFFFDF^FGG!G GcG;F>FGkGF\GFFF0FՆFڼFF G GG GGG #G GGGG5G GGG GFFBF@FF$FFNFFZF4F`FFڼFtFG G GG,GWGGGGGG9G!CGgG G=GFFFFFZFЌFzFFFFFźF|FLFFvFFFF؜GG GGG G.GGG GGGG?G"G+FG,G0G"yGGGFF FXFDF<FFF FpF.FF~FnFFFFÖF FFF:FFF"FFjF,FXFFF2FFFDF FFFަFFFFFF(FF\FѤFبFrF<FHFFڤFFFZFFFFFBFFVFFdG GGGFF.F\FߚFGGFGnG"G+G" GG'(G!BG%GGqGGG(G,G%TG#VG$aGG<FNGGGwFFG2G G $G GG G aGGOFFFެFlFFFצF4FdFpFFpF6FZFGG 0G`GG G(GUGGG$G4G)G(G-G6CG9pG>xG.FGbFFFFFFFFF4FFFtFFFF2GIGGcG^G)FFF,FGVGG+GGG GhG#]G]G|G!fGGGG%(G=GD7GQGRGPG;KG6G6tG7G+RG2G5_G9PGCGNG=G@G-G$G#G+GSG G#G!GGGG G fG GG GFF(FGGGG GGGyG -GaGG!GGG?GG$F:FzF(FFFFPFfGLG G&G8GIG4G.^G/QG#G 1GGG%jG+6G >GyG%G&G"G#G G GGGGFFjFF޺FώFHF:FFFtGhG(G:G6G0G+ G!bGTGGG,G1"GG FjFFFFLFFGFF*FZFF.F:GFGLGyFFFFFF8FFFFF@FVF FLFjFFFLFtFFGGGGGGGG GGGG=GGIGG GFFFzGyGGG GG2`G6G0GGGwGGG]GFFGG GFG @G gG:G$GGG6FFDFFFFhF:F`FFFFFĬFpFVFFRF(F4FFFGKGG#G&GTG'dG]GG0GGsGG FGlGoGGG2GFGCG LFFFFPF`FF&FFFrFFߪFFGGGG GGFXGwG:GGGBGG rGyGlFF6FFʊFFFF,FF(FTFRFPFFF,FFFF FFFRFF*FPFG FzFפFTFϖF0FrFFG .GG~GGnG#GGDF FFF6F`FPF^GTGGUG-G/FG'G!0G GG UFFG9FFBFFؤFFHF^FƆFF(FF&GG^GG FFFFfFPFFFGGJFF.F|FFFFFF,F&FFFlFFFnF@FFTFFFFFFXFF@FRFFFFFF6F FFF8FnFźF4FFFFfF"FFrFfFFFFFpFbF֠FNFF"FFFFFF:F~FpFFFhFFFHFFFLFF4FFFdFFFFFF,FFdFFrF@FFF@FFtFFF~FmFVFKFCFLXFVFeFk|F*FFFFFPFt@FnPFgFsTF{F|FFRFF$FFFFF~FqFhFFPFtFFFFF|FwFl0Fq(FrFwFzFF}FFFFFJFFFDF(FxFFFFdFxFFFFF>F}F|FFFFF FbFFNFFFF*FŮF4F,FʨFܪFְF:FFF>FFҖFFF`FpFFF*FF>F@FFFFTF&FFzFFbF F`FFF"FFFF|<FnFFFFF>F|F|F|FxHFuF[TF^0FXFlF{PF,FFHFxFFFFHFFFF~FFlFl,F[FYFIFJFThFKFKFRHF\ FfXFmFyXFvFsFtdFFLFVFLFrFv8FpFw0FwF<FnF^FUFYFQ$FGFEF6F6F6F4F1F4$F-F.F>xFEDF9 F@PF>F>$FQFdFZFiFnFoF\F\F?FhFDFFFFFFFF>FRFjFFdFJF FjFrFFFFdF,F~FnFFrF^FFpF̈́FF:FئFFTFFF̮FnFF<FFFHFԦFFrGyFFFڌFFFdF*FFʾFHF\FjFlFzF&F<F"FFFFFHF"FFtFF FFFF|FFrFFFpFTFPFVFFFFFFF FFFFFFFF*FFFFFFXFFF^FFFF0FTF`F<FF~FFFBFF F0F@FjFȜF FF"FJF0FF&FFԬFFpFFƴFpFzFFƮFlFnFFFFFF*FFFFFVFjF^F2FۀFFFF`FFFFFF:FڲF̆FxFPFFnFF2FFBF$FVFFfFFFTFFrFFFFFFFHFPFĶFFtFpF֚FضFLFFXFF>F\FFFFFFFFFHFFFFFFlFlFFjF4FdFFRFFFFFFFFDFFPFFFFFFFF,FFTFFFFFFF^FFFrF֊FҰFVFְFږFFFG|G UGG9G2G GGG!GGGKG GFGF6FLFF8FHFFFFFzFFnFF"FF`F$FdFFFFFFFFF*FG xG GZG[GG FFFhFGPGG GFG1G G 6GG'GGGHG bGwGGG! GpGUFFFFfFޢFF$F`FFFJFFFFF.FצFdGFFFݾFjFpFpFFFFFhFF"FFFpF8FFFG FFFFFFF`FۄFFXF~GGFGGiGAGGG #GGGG G_FPFFF0FFFFFBF>FF*FtFFF&FFFGGQFGF@FlF>GGWGFFJF$FFFF@FFFdFlFFFάFBFBFbFFFF8F FʰFFpG :GG GG$GGG$G4G"NGGGG&G+G3G%GGdG:FF^FzFFFF~FFzFFFFFFFF^FF FJFFFFNFFFNFFFFFFFFF<F F~F,FFLFFFЌF>FzFЮFFӞFFFFFdFF0FFFhFF,F>GFFxFrFFZFFF̎FFFtFpFG GG"GG!uG$G!;GG GGRGGG$0G+lGG|GGXG>FGFF:FFGGG}FtGGVFFFF(FFF0FVFNFFFپFlFF4FFFF\GG|GG%G'G0G GGMG'YG2G1G2G4G?NG25G,GF FPFG2FF\FFFߠFFvFFφF̴F\FGsGWGGFdGzGbFnFFFGG)GGG 9GGXGGG'G G@GGGG'G5GJG6G-7G$G%&G2G)GFzG;GEGUGTGAG7G.@GG G!GG PGG#G GG XGG GdG GFFFF,GFGGFGGGuGVG GGGG GGmFhF2FBFFvFlFFG 0GcG(G2qG<1G3,G*G*eGG G @GGGSGG GGGwGUG|G G GG]FF޸FTF.FFÖFF:F@FhFdG=G IG$G,G#G"PG|G GpG G8GhG ,FFFJFFhFFFFFFFFFFF(F0FFFFʾFJFۈFFFFFjF FFFFްFfFֈFϦF\FFnFLFDFzFFFF4F`GFFG/G GG fG G.FFFFvFGGF G G G2GCGFvG$GXF GFFFnF|GF4FNFGBGFFFrFFޠFFF<FFFvFFFF>FFFîFFɠFBF"FΘFVFפFLFG gGG%9G"GDGFGGFGPGNGGG GmGfGGFGpGFFpF^FxFFxFF6FFFF2FذFӨFG\GFFzFFFJFXFFLGcGG(G GF*F0FFζFF$FF@FfFFFFjFFF\FFFFBFԜFFF\FFFF&GFFFŖFβFFڌFFG%G pG G UG GGFFFHFՒF$FFFHF2FFF4GGGhGG G]GG FFlF߄FFFFΘF<FF,FFF8FFnFFBFHF"FBF@FF|FڂFlFFzFߐF&FúFFúFFF(FBFfF<FFF0FF|FF\FFFtFFxFBFFF&FFFF"F FF4F@FXF(FFJFFLFF0F~FF,FFfFNFFFHFԶF͚FxFFpFLFFFFFFFFrFFTF,FFFFFvF(FdFF$F FFzFFF:FFFFXF>FF`FFFFFFFFFFvFOFOFJF>FJFVdFmDFvLFFFFFFFmFkFmFsFu4FzF~F~FFFFZF Fz(Ft$FsFtF(FFFF`FFFyPFlFeFjLFqFlFuFvPFFfFFtFFFFF}F2F}DFxFFLFFFLFFLFF F~F@F0FFFFTF0FFFF`FlF^F(F<FPFĨFӠF`FF@FFFFF2FFǮFFpF|F$FFNF6FF.FFFFF6FzF*FFFDFFlFFt`F|0FFF~FFfFxFFlFFzF{FuF}xFyxFiFjdFzF(FF}tFoPF{ FRFFjFFFjFF FdF.FFuFhFQ F[`FaFcF^tFzPF}F}PF|0FF}FFvFFFFfFFF4FFFF~FdhFStFXF`FQF>F8xF=F9F7F48F.FCFKFHFClF;tFVtFYFM@FYFpFzFv`Fz$F`FrFxFmHF{lFhFgFndFxFFFFFFFdFOXF>FGFRFRF[xF{Fz$FjFFF\F2FF<F~F>FFlFnF_FBF*F&F@FFFFFpFFXFFF,FLFF%8F5xF=FRF[F`dFn FrFrFF}4FgFYF`TF/F|FDFF)pF5FK4FKFDtFEBE=E>PE; E; E:EE`EM`EIPEE`EHEO0ET`E]@Ef`Eg`EtE~E|El0EX@EUEUEVEREOEXElEh`EoExE@EPE@EhEE@EhEEEEEEXEEEEPE EXEXEE`EE`EEEEE(EE`EXEEXEEEEEEEEEHEE ExE EE@EEEEEpE(E0E(E EEEE0EPEEEEEEE8E`EE8EHEEEE@E0EEEEEEHEpFF FFFFF$FFtF FFhFEE EE(EߐExEEExEEFF FFF\E`EEEEEE EE EF8FdF FF F F0FF#F!FFFF F FFF<FF4F FFFtFF(FFF$F F@FF!F!F#F,DF%F"F F$FFFFFxFF8FF|F&F(DF+XF$DFFFF,F,F FDFF!FFFF&F.F,F!HF,lF-F3F6F0F6F:F8F,TF"xF!F*HF+F-hF5,FKF_FeFkFk(F_FW FHFFF1DF/F-(F0F/F(HF*F+F"F+PF,<F/F+F%hF&F*F.F9HF;F6\F24F3\F2|F5dF0F$DF%F)|F6F@<F?lF8XF6F1F0F3F;PF5F0PF>F=FAFCF?FBFGxFEhFDFJFUTFVFMFPFOF` FYFiTFeFpFftFTTFSFQ\FMXFL FPXF\F^F`<Fc\FdF_FTFJFLF\ F[8FSF_FbHFl Fm0Fw|F}FFF&FxFzF{Fu`FrpFnFqFfFWFODFJFCF>FAFHFHFNFMHFT0FUFQFPFVFR FQFSFSFFFHpF@0F@FAFGFNFOFKFNFDFIF@ FI4FJFKFHFQF]PFfDFe$FgFnFwlF@F*FFF$FrFFFFFfFFrFFyFmlFfFl@Fn8F}(FRFF{F F|F{F|FnF~F>FFVF(FtFFFrFFFxF},FvFzF~FFFbFFF|FFFLFFFFLFFFFFF`FFF&FFFFFF@FFFDFFFFFFFFFtFF2F F>FFFFFFPFFFF,F>FLF*F.FFFFpFDF8FFFDFFF4F*F"F FFHFFPFNFLFFȼFHF FҔF>FFFFF8FφFBFΪFxFTFΒF(F4FF`FrFHFFFFFrFFrF FFFFFFF<FFFFFpFRFFrF6FFtFFjFJFFF FvF$FF.F&FFFFFFZFFFFFlFFFFFFɢF׾FLFF FnFF4FFضFFɨF,FpFFFF"FLFFPF:F̸FPFFFF̊F~FFJFFΈFʸFnFFFF:F`FfF\FFFFØF:FFӦFВFƬFhFאFFfFFZFFFFF>FF$FfF0FFJFFFJFDFFfFF2FbFFFFnFFFpFDFFbFŒFhFFFJF6FܘFFFjFªFˆFFvFFVFF*FFFtFFFvFFtFF~F(FFLFFFFFbF*FHFFFnF|F2FF<FFFFFFFFF&FLFFFךFFhFFްFӼFːFvF<FFXFFG GG!GG GjG :GGG1GG IGF|FFjFFF~FvFFFhFFFF*FFFFF`FFFFvFNFžFFxFFRFG(G GGuGGFlF(FFvGG:GGGGGQGFrGGGGG "GGiGG G F FFnF`FFFFTFDF"F FFjFnFXFFF\FFFFFvFFPFF.FHFFFFF޾FxFFFFFFVF4FjFޢFFF6FFFFF<FNGGOG8FFFGGcGsGG GEG_FrG;FFBFRFFFFFFFF$F܎FFݖFvFPFF8GG%GG+HF>FF0FPFFFFFFFFτFȄFF>FFZFFƮFF®FnFFF$FF\FFF F2FG G zG GGGGG/G"ZG GoGGWG,G4G)GGMGG?F<FFFFF6FFF FFFFFFFFdFFF@FlFFFFFFF:FPFF@FFnFFDFFȲFF$F&FFFFRFrFFǦFȢFFFFɞFF\F~FŦF>FJF0FFF@FFFFFFjF@FFFΆFFFGG sGGGlG GNGG#GGqGG\G"2G*G2G,SGGPGXFGGGFFFGzGGyGGFFFFȚF0FFFFFvFjFF˚FFFFئFGG GG G*GGkGG&G'tG7G<GGDGKG@aG4wG*GG*FFF~FFjFFF$FӪFF&FFhF"GwG AGbFFGG(F4FF|FߐFNGG FGkGGGGG-GSGGGGGGPG,!G?G+GtGGG-)G0G3 G-UG7GMGQG@G1G%GGGGG$G0G2G $G"FNGGiG"GGFF$FFGFFzG G <GG G DGG`FF0GGrGFxF(FFFGGFGGBG PG G%G9G5gG*G GGGDGGgGG GGGGQG G QGGFBFFF֐FxF,F\FҼFFF FȰFFFGG#GG%G+GGG (G G GGFFFFFFF,FFPFHFFFFFFFFF,FpFFRF:FѦF¤FFbFFF:FFhF@F̤FF6FNF:FFFvFFFDF8FFߪF~FրFLFRGGZG|G G nG'FxFLFVFFFFFGGMGF>F FF(F(GuFF(FNF4FFDFFܖFvFFBFF۔FPFΦFzFFߖFF$F^FаFFF FF`FF$F\FFxFFXF.FpFG GG'GGG GFNF$FF~FGtG:GLGFFFLFBFFFpF"FFFLFHF,FLF8F"FFrFθFFvFٞFٚFFӾF:F2F$FF|FF\G`FF.FBFlFrFdžFTFFrFFBFFZFF(F:FFFF|FFpFF(FFF6FF˒FFzFF$F\FFFBFGGKG$G FF|G |FF͸FF6FFаFFFBFlFFFGGG GG(DG9GG6FFFFFFF^FFF FtFF`F>FFZFNFۼFFF˘FFٜFFF0F`FFFFPFFFFFrFFFFFXFFFzFwFF FdFFzF4FFF<FFF0F"F2FFάF~FLjFFFFFFZFFF4F4FFlFzF8FFFnFFFFF$FFFxFF|F8FLFFFTFFFFFFFFwFF~F{4FFF>FVFF FRFF FtFfFF$F*F4FFFFlFYFNFIFGhFJFg(F}F F2F FFFFVFr(FlFh Fv|FiFw$FwFyF|FF}PF|F(FFtFpFy@FFF>FFFF|xFgF`FblFbFiFnFxLFhF<FF&FFFFFFXFyFFFFvF<F@FrFHFFF FjFFxFxFFzFFFFFFFFFFtFLFFFBF0FF8FڈFFF@F0FԶF$FF6FFFFFF FFFFFFFFZFFFzFFtF0F}FxLFF~F4FFFF0FuFnTFwFFFRF}8Fy(Fz$FFhF~FsHFXF.FLFdFjF2FBFFFF$FFFw8FcFk<FsFFFF~FF,FPFF\FFF@F0FlFF F0FF|FwFiFm`FcFvFxFbFCF>HF3F>F?$F@FHF_FhFZFLF[FgDFqFuFnFt4FF{dF~(FFFF4FVFFF:FFFF"FXFpFpF]FJ FTFTFsxFmF\FFzFrFztFFFFFFFFFFmFY8FDDF7F-0F*dFFFFFLFFFFF$xF)F8tFQdF[FlXF}FFttFoF@FvFWFXF@FSFg<F8,F$F$PF/\FHFWF`FiFU FSF FFEFF LF F \F F LFFFFDF"F'TF,F%|F$lFFhFF0FEXEEFFFFFFPF FFXF(EEXEEE`F FhF.<F. FdFFEEEȐE EE͠EXEҨEDDDD€D D D`DDDD DɠDD DD DנDDDDD`DDDˠDDˠDDDD EDEDEEpE EEEPE EE EPEEE0EEEpEEEE0E$`E,@E& E)@E*E$@E$E%E.`E4E;`EFEREKpEB0EP ESpEJETEQEQEa`EV0EV@EZEXE\E`EWEYETETEi`EeElEQEOPEP0ESPE^@Eg EdEa0EVEH`EWpEE`EMEO`EZPEYEdEl EgEdpEWEY EZES EGEKEIE:E9 E;E:@E<EI@EIEIENEDELEKEVpE_@E]EeEgEhEZEXEOEW EO ED@E[E[EfEh0E}EE8EPEEEhEHEEEExEEE0E@EEEEEEHEhEHE EXEpEXEpE EHEE`EEXEEEEEEE0EEEExEEEhEEEE`EEEEEEEEEEhEEEE`EEEhE`EEEE@EXE8EEEXE@EEˠEEӰEEۨEFDF\FFFLF |F DFF@FF,EEEEEHE`E@EE`EEEEFXF|EpEEEpEEEبE0EEEEHE(EEpFFFFFTF|F<FdFFFLFxFF F LFF FF ,FFF`FF0FF TF FF F0FFFF%F%F xFFF|F8F 4F8F FF0F FLF!HFF FF 8F 4FdF F\FF$FPFLFFF!|F,`F%F!4F `F"8F&F,F.F)LF-PF7 F-FFF$F"pF'F+F;PFG F\FcFaFPFG$F=F4F4`F0 F0F6F-F%F"F%,F*F)\F&lF(F&DF#4F"FF%@F"PF*F/F,xF$F#,F.F+,F# FF"\F)F5 F?(F88F4F(F)lF2\F.F.F-|F2@F4F>FBlF?<FCPF@F@F<F=F@FIFMFNFKFLFSdF[FcFn0FeFWPFOFC\FBFNdFL(FPFRhFQ\FVFX4FTxFKFGTFDFJFIFPFLFVFUFcFdF`FmFsPFlFpXFw\FlF`FiFYTFT4FLFEF=F9F8|F4F9F9XFBFAFCFKFMFNPFHxFLFQXFGFJ8FI8FEF?F:F9XFFBFlF.FrFzF@FtFBFFFFFrFFFnFpFFdFFFF>FF FFFFnFFFFFFzFFF6FF\FpFFFlFbF4FFFFFTF$FFzFbFFFF6FFFFdFFF2FDF|FFnFFFFF|FtFFFF:FFFhFFFF FFFFFF̜FFFFFFF`FFFFRFFFHFFFbFFFFFzF&F$F\FF(FFFFFzFFFdF$FNFFFFɌFFFђFFF<FdFvF:FxFJFFF|FF.FF\FFpFFFDFFFTFFlF6FFFDFFFFFFVFFBFFFFFlFF4FRFFF4FFFFF FF FF,FŎF|F2FFՐFDFJFBGGGIG FF`F FxFGFrFFFRFF&F:F<F݌FFFrFǐFLFFFFFF:FF FFFFFFF2FrF.F,FGGFFG|GFF\F&FFG)GGGpGGFFFG GkG G GGG GF4FhFFRF׀FF"FrF FFF6FZFFjF͐F(FFFF.F˨FFF F(FFFFfFF&FjFdFԾFFшFϴFZFTFrF FFFFF*FFFG +G BGGFFFFXFXFFFFFFFLFFFlFZFF&FFFxF<FFFFFƖFͰFFG%G_GGGFFJFG &G FFxFǸF΢FFzFFFFvFFFF:FRFJFFFbFF&FF^FHFFG GFFTG GG GRGGG G%GGG 7GlGGG/FFFFנF0FŊFFFFFrFtFjFtFF FFFF^FFF0FFF"F2FFFFVFTFFFFFFF&FpFF8FF.F<FŎF&FFFBFTFFFXF٘FFFBFƒFF F$FZFFvFF:FF@FޘFFvFFFF"FFGmG GGG RGmFFF"GG GGG!?G(dGOG9G FFFFFFFFNFFFFF"FdFzFFXFFFFFFFBFĂF:FTFRF(FήFF`GkGCG%LGGG YGG'eG'qG/G28G1wGMmGMG;G.GF0F0F.FFFNFFFF\FFFFFrF|FPFGG OGGFFٴFFF GG +GAG vGJGG 'GG [GGG8GGGG -GG,G%GG GkG*YG<G7G6GCgGS)G;UG@rG1LG!5GGGvGG WGGGG?FrFFjG>GFFpF2FFFLFFGFFhFGGoFFFF FFFLFF,FnF6GG!GIGG BG GMG G%GGuGGNF^GG G(FFFFG-FFF6GFFFFΊF̖F\FFF˄FRFFFF˔FGG G GG %GCGG G,G FF<FߖFFF~FF$FFF,F֬FJF̔F߸FצFӠFVFЌFJFFFFFF FFFFF<F FBFVF8FFμF F\F.FFFJF̼FޜFFZFDF FFFF2FFFPFF8FݖF׺FFPF~FάFjFBGFnFhFZFF8FFtFXF˦FpFՌF&FRFF6FȔFhFШF֚FF.FFlFFNJF6F F|FFFF$FF<FTFFF&FFzFxFtFFٲGGGGGGFFF&F@F2FhF*GFFFFFFFF`FFF`F~FFFܒF:F2FҠFFǎFFF۞FZFFFŶFFFFXFlFF.FؤF4FrFF&FtFFFZFFFF<F(FFFFdFFPFFFtFFFFbFlFF@FFF FF F‚F4FFFF.FzFGGFFמFFFpFFrFpFFTFFFFĠFFFXFFF<GAG GGFFVFFF̸F6FFFFFFFvFFF6FļFFFFbFڎFF\FF\FF8FFFǎFvFFTFrF|FFFFFFFFz|FqPFtFx0F|FhFFbFFFzFFFFFbFFFݤFF~FFF8F2FFFFpFFFFF(F`FF8FF,FFFZFFFFF`FFF0F:FNF0FDFFLFFzF{F}HFFF{<FFFFFFFFZF4FxF^FXFFFPF FtFTFtFbFPFB,F@FK8FVFiHFFF.FFFFFFFFr(FnHFqFrF|FuFvFm@Fr F|FxFjFnLFqFx$FvdFF~FF8F}FuFhF[(FYF^Fa8FeHFtTF}F"FFPFFxFFFFF`F F>FF&FFFFlF2F~FFPFFpF FJFF FFzFFF&FFF2FxF”FxFFFF|F̢FFdF†FňFF֢F6FٶFFFFFFFF8FTFF.FzFFFFFF$F~FF F,FxFFFFFz FFvFkFphFz,F}FF FFFFFFFFF"FFFF0FF FF`FFF2FFDFyF"FLFFFFF~FFFFFFHFFDFFzFFjFe|FgF~4F&F{Fb0FtF^F[PFGF>FCFRFcFhFwDFxFxFu|FuFbFF,FXF^FFqxFxFz<FFFjF6FFF{8F}F|FF|\FjlF~pFjFaFiDFqFs0FyFJFFFFpFsFwFxFFFNFFFBF~FfF[F@F<F*F-@F,FFTFFHFDFXF!F$F/FHFYFd$FxF FpTFZFsFqFYFZ@FIFHLFIF^FJ|F4 F2 F7FMFZ\FRFHF8DF8F%FF FFHFFpF$F$F& FDFHFF F%F'dF1TFFF0pF$FEEEXEEEFF |FFF&F.F)F$FFLEEE0EE0F\F3FF0F-`F(DF,FFEExEE܈EhEEE@D D DD D DDDD D D@DDDЀD`D׀DDDD`D DDDD@D̀D DрD`DD`DD@ED D`E E E EE EE`EE"EE`EE E E PEEE`E E#pE%E,E+EEpEE'E3E4`E8EHE?ET@EXEREX@EPEIpE]EQEW ET`EaEdESEYE^EaEbEe@ETEV@ETE[ETELpETELEZ0E[ES`E[@EXEFEKEKE@EO0EV@E\EX0E`EeE^E\EYEYEMEKEF0EC@E9E@E8E7E9E80EBEDEJ EJEI@EKpEGEO@EPELPEQEX EUENEWEO0ENpEZ@EPE[0Ea@E{EE0EE0EEhEEXEXEEEE8EE8EEEEE(E@EEEEEEEEEPEEEEEEEEEEE(EEXEEHEE(EEXEE`E0EEEEExEE@ExEEExE(EEEE0EEEXEpEEEE8EEExEEEE`EEhE(EhEXEEFEFhE@E(EEEE E0EEE`E8EܠEEEEE`EE8EEEEEEE EҀEE E(EԐE ExEEEHEEFFhF FF F HF F F,FF FFFFFPFFFFF(FFpF XFFF 8F4FF |FFF!FFF FFFF F`FFF@FF FLFFF FFFFFF F lFFFFFHFF#F\F"xF!F!F.F)F$F&(F(F#$FF\FF!|F$F*F:pFElF\FdFTFM0F=F7F2DF0F-F3,F-F(F%XF$DF%hF!F"@F(FF@FF`FF4FF!hF"FFxFXF FFXFHF'F)HF2<F8@F9F/F.tF/F.dF+LF,dF.F0|F;F?PFAFE8FBF@F<F= F2F>$FG FMFHFFFBFE<FXFaXFjF^FSFFFChFDFEFMFGlFBF?F;FAF?lF?xF:F8 F6F>FHFGFIFTF[$F]pFP,FSFVHFdFiFhxFSFEFFTFFFCLF:HF3HF.F,F)F*F5pF2DF58F;F@FEFILFEtFKFK(FI<FB0F=FGLF@4F;F>FExF@hF<FCFJFKFHF@DF6F2F6F;FDFBFCFF FQFUF[PFYFa|FkFx<FrF{<FFFFFF FFtFeFV4F[ FPFOFRFSFSF_pF^pFiFg$FcF^FmFxhFwF~F4FFFFFFu(FcFTF_FXF_FepFhFmF{\FwFh(FhhFd$Fn,FrDF\FFFFF{$F{tF|FFF~FFyFFRFzFFxFFFFjFFF FVFRF~FFFFFFFFPF@FFtFF FFFtFF>F0FFtF^FpFFFFFFFFFF^FRFFFPFZF0FF,FFFFFxF2FFF FFFͺFFFFF(FFFdFFlFlF0FF~FFFF*FFZF`FFFFF(FFzFF6FFFFFFFF|FF FFFvFFFFFFNFXFF\FFFFBFF|FF"FFFF&FFĈF8FzFFFxF׈FF:F.FæF<FFFFFFFFDFFFFlFFlFF2FFFӰFFҀFFJFZFFFFlF,FFFFFHFFNFhFPFFXFTFF(FFF>FFHFFFFFFF(F~FF.F6FFFFFFFF(FFjFF(F FFF.FFFF,FFFHFF|F|FFZF:F,F FF&FFFFFVFZFFXFFFFLFPFF$FFFbFF0FlFFZFNFFFFFFFFFrFF0FFFɒFLFzFPFFNFtFäFFFF~F|FFF:F6FGG FlF8FFFFFnF~F܂FìFɤFԚFtFؒFpFFπFFFFF$F FF&F@FF*FFF@FFFJF\FF֢FFFVGjGFPFFTFFFF6FjFFFFLFFxFF"F.FGTGFGFF F|FpFޤFԨFɌF^FFFFF8FFTFFFFFDFF>FF2F̎F|FTF@F`FF>FІFF,FNF,FF^FFFbFFɚFFF>FF(F F܄FFFFrG GGFFFvF\FFFFfFRFVFFFFFdFԠFԨF*FFFF2FڀFFFFFĎFrF`FڊFLGaGG bF&FHF8GG FFXFFFFFhFFFFF0FzF&F FFFFFFF`FVFlFdžFJFFFPFFGGG]G]G >G hGGG|GGGFFFFF@F~F|FFFDFFnFFFFFFFFFxFDFFF^F|FF FFFFFFFFFFbF<FFFFŜF$F.FFˢFNFXFFnFFF>FFNFFFFdFFFFΚFFFҢF FغFF;FFFFFFFRFFHFG8G GGoFFF8FF|G,GG GGG@GFFF8FFF&FFۤFlFxFFF^FRF F\FFFFFFhFF FtF@F.FFFFFҲFގFZG*GFGGG>G ]G ;G&G0G4G/AGAG>RG'GkGF.FFFFpFFFFFFjFFF6FԴFFFF2G=GGF8FFfFZF0GGGGG 6GG GG=GG.FNFFG GFGG GG 2GcG%G:gG:GBGI@GHtG4[G/wG-GGGFzF8FG G@F~FFFFޔF*GFFFFFFFDFFFFzFFTF0FFFF F&FFVFLFٔFhFhFFGFGGlF@GG GG CG!G$FFFF FHF|FFPF2GGGF&FFFԂFʰFtFFטFlF*FFþF FFFNFHFFvFzFfGF&GGGGFbFF4FFFF֌FʶFΊFڪF6F.FF0FF FFȊFFF\FFF@FZFFFFjFvFFFFǂFzFFrF2F"FŔFzFFְFFF"FJF\FjFF"FhFF٦FFBFF$FFJF&FĔFhF.FFTFFFXFbF2FFfFFFѸFdF0FF.F(F FFF"FÖF&F.FVFFFlF|F|FfFFZFFF8FFFFvF\FFHF*FpFFFF̺FG GzG:G+FFzFvF&FnFF~FF8FݜFFFF~F<FդFF F4FpFFFVFȰFҔFՊFľFĨFFFbFZFpFhFFF͌F`FҚFJF FF܀F<FF*FFF8FFFFBFLFFFFFjFFF:FbFHFFFFBFpFfFFF F FdFZFF"FFFFφFFLFF>F:FFF8FdFǎF҄F@FFFF&F~FFFFָFܚF8FF"GF,GFF*F|F~FFFFF^FnFFJFrFF2FFF4FJFFFFHFF F2FF0F@FFF|F(FZFF FFRFFFFFF~(Fy|FqFf FgLFk`FxFFpFFtFPFFF>FbF`FF@FۈFFĮFFDFFF$FF,FHFF@F`FnFFFLF2FfFFFFnFFF2FPFFFFfFHFphF{FwFthFnFlF{pF} FFFFZFFFTFXFFVF@FvFFPFTF@FF{tFFFgF\hFPFDF?F9FB<FX@Fo FFVFFzFFFFFFFF}PFFFFF}tFFv,FoxFxFlF^ FaFwFsxFFVFF0FFvFnFaLFVF\<Fc4FhFpFFFFFFFFF~FFF0FFZFՆFBFvF FFFXFFFF`FFF4FF@FFF6FFFF^FFF FFFԐF~FtFFpF؀FFFF2FFזFFFFNFVFF~FFjFNFFxF\FF\FrFpFFFhF FJF.FFF"FF~HFoFyxFyFiFxdF~lFvFTFdFFFrFtF^FF~FFFFF:FnFHF(FF4FFDF&F2FvhFF2F^FF"FFF<F~FFFFzFFFFFxFjFe|Fd$FmFhFLFuFFFuFSFEpFNFNTFg FsFFFjFF6FjFFFFyFjFuF]F~HF{FFFFFFF|HFPFk FPFYFfFnFsFFFFrFF&FFF|FkF^ FtF~F"F:FFvF{\F*FtFp<FLHFAF6F/F2F*F'0F!F<F$ F*F(F(F2FQFIFeFjFnXFy|FyFFFmFTDFUFNFXPFBF?F3F2<F3F8FBHFpE?0ELE\E\E_EREG0EP`ETEUEQE^EiPEaE[EYE[pEkEcEZ EKPEMPEQED0ECEFESESEXEKEFEMPEB0EMpENELEJEKEOE^EfEbE_pETENEJEJEE0E?PE>E=E=E@EAECE8E>EM0EJEJ`EFELEWEKEVEPPEQENEXPELPELEJPEUEUEcEe0EhEjEuEExEEEEXEE`EEEhE@EE0E0EEExEhE0EpEEEEPEEEEExE@EEExEEEEHEEEXEEE EEEEEEEEEEEPEE0EE(EEEE(EEPEEhEEEEEHEEEEEEPE0EEEE̸E0EEEHE݀E0E@EEE EE݀EE EEE(E0EEEEEEEEEڰEEEHEEEϠE0EEEEEPEθEEEEEXE EXEFEHFhFFFFFFFxEFFFE0EEEF@F TF F `FFEEFFlFFFFtFF,F8F F F FFHFdFFFFF @F F ,FFE(E EFTFFF FhF|FFFFxFF8FFFFFFFF<FFFDFF xF(F1F@FKxFNFRFRF:F/ F'FpF#tF"PF&$F)F"`F#FFFFFLFPFLFtFFtFF4FFF0F\FFFDF$F FFF&F,F8F2F,F)pF&F$F&,F$pF-F2F;tF@0F=F<4F=F6F/<F4dF:FGFD(F?HF:8F8FI(FUF] FP<FFhF=hF3\F7F>F=XF:F0$F4pF44F6F:dF1F.(F)F0F2F;DFIFGFLFMTFQFLFFFKHFTFPFLF<@F9lF5F4<F0F-F F"TF"hF%F"F'hF.F-F1`F6 F@(FBFCFBFCFCdF>FB\FK4FOFFFJFE`F?FAlFCFFHF@F=F9F/F)F+F4F0<F7F;4F?dFFFNFGFIxFN(FWFdDFeFcF}FTFPFFFzFyFqFadFTFMLFILFKhFI@FEFCFS\FTTFT FXFW FLF_FfFjhFpFsFpFjF{<F~FhTFr(FeFUFYFMFS@F]FatFmFiDFk8FXFUFWFZFdFt4F~FF~FF{`FrlFpFv(F|FZFFbFdFvFuFuF}xFFBFFjFzdFyFFFF(F FFFFjFFFFFFFFHFFLFFFFFF<FDF8FFLFF"FFFFFFF$FnFLFFߪFFFrFF:FPFFLF8FFBFF׀F֌FFFFFXFFFbFFF0FtFFFFFFF2FFFFFXFTFF*FFZFFFRFFTFFVFFFF0FFF@FzFFFjFLF@F(FvFF"FnF|0FuF} FF,FFFVFF>FFFFlFVFFFװFFӌF|FFFfFFF2F8FFFFFFF2FF<FjFFFFFhFŤFpFFDFTFHFFFFFFF,FFFFF~FFjFFFF4FFtFώF>FFF FFFFlF8FF`FFFFFRFFFFFPF$FFFFFHFF~F FFFFRF:F\FF\FFhF(FRF&FF"FF^F&F4F$FbFFHFBFFFFF F8FF FFFFFTF>F2F FFfFFF$F2F2F.FF&FjFǼFFF~FFF@FF*FFFFĮFBF:F`FHFFFbFHFFFHFHF4FFTFFJFFF̀FǼFNFFFՌFF6FbFNFF$FFFFlFFFF`FF FFFFFnFFBFRFޮF FFF~FFFF^FfFF|F܈FF0FFF<F:FFTFXF(FFFFdFFFFFF̄FF*F.FFFFFFDFFFF~FFFBF0FʌFˆFtFF4FBFF`FhFݲFѴF6F6FƂFbFF@FFFF4FFȼFvFͬFFTFFFJF>FFjF F6FFF^FFFJFfFFPFF˚FڂF٨FFǂFFFFVFFFF:FϼFδFjFFDFFBFFGFFFrFBF6FFF2FښFFzFFFlFFRFFFhFFFFFXF.FTF4F4FTFvFFƂF<FF.FPF`FnFNF@FGmGG lFGxGFFzFjFFbF`FFFF.FrFFF"FFF|FFFFLFFFFFFFHFFFFxFFF:FFFFFF^FnFBFbFFFFFF*F4F@FF8F0FFFFFLFFNFFFFFFFpFFFFFFFFFFHFF؆FvFFFFtFPFТFFۺFZFFFJGAG FFXFFքFބFFlFRFFFFFFFFJFJFFHF0FF2FFFFFFFF&FFFFXFźFҴFGG GFnGG!G0G+G4G-\G3G?0G!1GdGFFFFF"FFFFFFFVFHFFF~FfFFZF~FF@FFxFTFbFGGFFDGFFFFBGGGfFFFLF>FpGGGgGGGG*'G G2GMGCG93G'GG cGG FFF.FXGYF(F(FF,FݚF:G FFFFjFоF<FFFLFlF\FզF`FPFFߚFFF߂FȬFFFFܪFjFvFNFTFFFFFGFFG?F8FFFF(FFPF2F8FDFFFFFFLFvFpF.FʄFЊFFǔFdFFFF,FFFFzFF2FFG FRGFFFߘFFFFF^FPFFFʈFFFFFFFF,FFFFFF@FF~FhFvF$FRFFFpFFF FNFFFVFЌFFZFFFDFF4F"FrFxFFFF^FFǬFўFLFF$FdFFFFFTFFFF FF|F6FF>F|FFFxFVFFFF2F*FF$F`FF8FHFFF0F$FF~FFFFF,FFXFFFnFbF˘FRFGGGOFTFFlFۀFذF4FFG9F4FvFFFFFFFFFPF(FNFFDFpF˨FFFF@FNF>FF6FFFFFF FtFFŬFF>F^F@FpFFFFFvF.FFFFFFF<FF2F^FlFHFFFFFFFFF˺F.FμFRFHF:FFݖFFjFF4FBF(FƖFFFNFF~FFFbFF6FFFF4FFF:FFلF<FFFLFF$FFFFFF^F FFFFFFFŚFFFFFFFFdFFFFFfF\FFFFFFFFFFFFF{FtFr@FdtFc8FdFjF|FFF2FFFFRF*FFvFFFFhFF&FFFDFtFFFFFFFF*FFFFFFFF(F$FFFFFF$FFFqFxFlPFcFcFfFwpFNFFFFFFFFTFFFF FFF{8F~,FwFyFzFlF_tFRFDxFCF@XF:FGFVFsF@FF*FFFNFFFZFF*FNF$F8FFFFDFJFFFnFfFj$FkFpF}FJF<FRFFNFF{FwhFwlFXFoF|FNFFPFFFFdFFDFpFFF2FFFFF FjFF<FFFFF*FtF@FpF~FpFFFFFFFFFFňFdFݞF.FFnFFFFFFZF:FxFƴF&FFFFFpFFFFǀFFJFFFFFFFnFFLFFBF FFF$F0F|F}FFy Fz FFFxFF~FFlF FFFFFFFF:FF<FvFFFFFFdFdFvFFFbFFXFFFFFFF FnFjF"FFFv`FtlF|xF{F\FFhFeFvFaFXTF[lFa0F_FtFF@FFhFFhF<FFF|Fo FllFhDFnxFFFF"FrF}FRFsFvFgLFiF`FY FsFF@F$FrFFzFlF>F$FwFrFeFu8FF{FFvFFFLFLFoF[FBF2\F9F9F@<F7F,F,F(@F7F)xF3F1F9FTFrFtLFFZFFFFFFoFgFPFQFA|FFFFFFFFF>F.FFhFFFFRFZFpF FFPFFrF8F`FF~FFFFsFlLFjFi,Fi<FpFF\FFF>FFFİFÄFPF^FNFϸF FȚF̞FFFF<FFXF<F FF,FFFFFF:FFFfFF^FF(FFFFFFFFNFXFFFFFFFFFF"FFFFTFVFƢFFXFHFFFF,FFFFFFFFFtFFFHFFJFFFF&FF2FF@F>FF:FFdFFF&FFFFFbFLFPFFDFFFFzFFxFF|F\FFFFBFDF:FFFFJFFFFFFFHFFLFpF*FFVFZFFFFJFzFjF FFFFFFxF*F^FFFFFVFFFFFȒFИFFF\FFޚF.FFFFvFFF.F~FFϺFFfFLFЂFZFFFFJFFFFFFFfFFF4FnFFnFFŘFGGGJFFFFNFF0FFRFF"FNF@FF̀FFdF͜FFFڶFF<FȢF,FFDF FF FFFFFTFFFFF FFFFFZFhFF.FDF:FF&F,FRFӌFFFF.FF(FFFFFFFÚFFքFظFFFFFFzFtFFFGFPFFFNF(FFzFvFFFŎFFâF*F<FLFFPFӀFFdFFFnF`FJFFTFvFFFnFFFFŘFĶFPFF̄FFFFFFLFFZF(FFHFFF6FFPFF2F FFF8FF:FVFF F8FF>FFFFGFFF(FF<FFFFFFFFFFFFF*F,FF\FFTFF.FFxFVFF:FzFF*F.FFFFFNF FFF,FFrFF(FȈF FFFF FFFfFZFFFvF^FFFFFPFĬFBFFzF<FFRFF,FFFFF@FFF$FFFFFFZFFlFFFèFİFFLF*FFFFFvFFF̊F6FFТFFdFPFF2FFFFbF|FF FF,FF8FFFFFFF,FFjFFFFHF*FGFGyGG#'G'uG+G$9G#GTGG SF~FFFFFF"FFĚF<FFF`FFFF^FFlFFfFjFF0FFˤFΜFNFF*FFߢF^FLF<FFLFFXFF|FFFFpFFF:FFtF GG".G G#G)G0G:*G$G>GF&FFݪF|F FFFF\F<FИF8FjF,FrFNF*F@FFFɂF|FFF(FHFnFͤF@FFRFզFtFFFrFFFtFFBFZFZFF&FF݄FFFzFFFFF˜F~FFƐFFFdFtF0FFFdFBFbF̴FFpFFǬFøFF|FFFFtFHFFtFdFFFRF*FFFF^FNFNFFFF´FFFFFlFFFTF4FFFRFFF*FFFlFxFF"FDFF2FFFVFF0F>F$FFFF~FFPFFF`F|FfFJFFFFFFFîFFFFFFF$FFFFFFFFbFF\FLFF2FF^FFFFFFPFFdFDF~FFXF6FFFFFF`FFF<FFFFFFF@FFF~FFNFF$FtFFFfFFzFڰFdFڼFFFdFFF4FFjFFF FFFFPFFFFFFLFFFFFbFFFFF*FF<F8F:FFVF|FFFFFFF`FFFFFFFFFF.F$FFFnFFFFbFFF*FϞFZF^FBFܴFFHFǢF*FFFF(F*FFFNF`FƴFHF\FFFFFzF\FFxFFLFFPFFFFF0FFFFFFFF*FFFFzFF F*F6FxFFF0F,FFFFFFFFZF$FFFFHFbFFFFtFFFnFiFhhFfFiPFhFoFzDFFzFFFXFFFF,FVFFNFPFFpFjFF\FDFFFF8FFrFF<FFLFRF`FvPFFFTFNFFFFvFF.FFdFRF{Fh@Fq$FoFlF{FFFFF`F"FjFFFF,F}FpFFFzxFwFk Fs8F|hF{HFpFgFSlFC@F=<F9F<,FAFW FvFFF>F&F\F²FFjFF0FFF$FF$FF$FZFFFFfFFxFwFbF0FFFFFFFF FF$FbFZFFFFpFF^FFFFF`F"FFFFFTFF.F>F:FF*FjFFF0FFLFhFFFZF&F FFF8F̀FĀFFFFFFFȒFFDFbFFF(FZFŪFFFF|FFFFxFF<FFFF FFF6FFFfFpFDFJF(FF<F^FVF&FFHF0FPFFF$FF8FFFFFjFFFF@FFFFdFF8FFdFFFFFF`FFF,FFRFFFFFF.F:FFFtFFFNFFFo$FcPFbFkFqDFXFXFbFgFzPFF|F.FFXFFF4FF{FpFiHFdFdFeFpF{FxFv@FqFqLFs(FrFrFmFmFcFl8F&F FFFZFFFFFF~dFlFFxF}FBFFFFF(FFqFYFA$F=pF9FH<FKTF8F7F:F7F3HF:F4FDXFU0FFTFFvFFjFFFVFrFyFcFRFIF<F2<FBFCF;F,F FFDFF FFF$F6 F1tF9F:F24F*F#pF$F*F7 FOFSFjF^$F=TF:HF+lF0FF \FF F F!$FlF F&@F F"<F 4F |FFpFDF F FPF(PF,FIFW`FE\FHFXFAF?FHDF/F&F`F.F#pF!DDDDD@DDD DDŀD€DDD D DDD@DDDDDD`D`DDDED@D@D DD`DDD`DDE@E E EEE!EEE EE 0E E E EEEEEE"`EE"pEE(0E3 E6E90EFECE@ELEREREXEaEVPEOEJEJ`EMEPEcpEapEe0EXEVEc@EaEcEUEDEHE>`E50EDEBEG0EDPE@ED E8PEF@EPE`@EY EVER EWE^`EVEXEQEQEDEJECpE6EDEHEIEB0EAEL@E=EFEJ0EMpEQE`pEZE_PEQ`EPEUEQEDECPEHECEHES`EVEXEl`EmEpExEEEEEEEEE0EEE(EhEEExEEE(EE EEEE@EEEpEEPE@EEEEEHEEEXE@EEE(EEEEEEEEEHEXEE@EEE@ExEEPE`EE EEEEE0EHEEEEExEE(E8EEE EXEE`EEEhEE۰EֈEڐEEpEEEEEEEhEؐEEpEEEE@EΐEEިEװEEEEEEHEEEEpE`EE@EАEؘEXEEEpE0EEE(EXEEFxEE8EEPEpE`E8EEE8EEEEEEE0EE0EEEEEE@ExE`FXEhEFDFFFhFFFFFFEEEEE`EE8ExEFpFFF XFFlEFFF |F tFF F FFF FF F(F FFF!F#F&F*F-tF8F,F(FFF<FPFF<FF$FFFFFF0FF F F4FxFXFF F0FF xF F F FPFtFDF\FFF$F&F%LF `FFFF)F"F#F*F$F)LF-F1F9|F-F)F)F/F.F.F-F.F)F(LF,4F-PF(pF&F dF$DF(F%F*@F,F-F*F#F%FF*lF2F8pF5F=FEFF`F:F7lF9F6xF4tF1F,`F+F&FF`FDFFFFFtFFFFF0F&F(F)XF+F(PF*\F.F( F*xF0 F3F=F>F=LF3tF1hF(hF#PF F$FF@F$FFFFFF'F/F8FBFEFEFL<FQF^(F\F_FjlFwFFF*F|DFlF`F]FTFAXFAF=F=0F:F; F?FCFEPFE FQFX4FJFSF]FiFcFZ\F`\F`FaF_8F_FTFJFGF@F=FA`FMFQFS0FY@FVFTpFJFGFHFTdFZFgFnLFlFlLFdXFpFFtF}hFFtFk,Fr<FrFtF,F}FZFFFuFoFyFqFoFsF|F~HF~FFFHFF@FF>FFFFFFFFhFF~FF@FNFFlF"F4F&FFFFXFPF|FnFfF(FFrFFFFTF0FFFFFFFBF$F|FF.FDFF,F.FlF0FxFFFFFFFF0FFlFFFFhF(F>FFRFFtFFFFFFFFFFFFRFF|FFFFxFwFtFsFk@Fm0FlFdF]F_F[$Fe$FLFFFFDFDF@FFFFVFFFFfFF°FFFF2FFFFFvFtFFF(FZF FhF~FFFFȒF2FɀFF:F.FFF`FFF.FHFFF FFXF.FFFFF@F&FFFF FFfFFDFFFFFFFFFFFFPF*FFFPF4FF`FbF FF&FFFFFFFHFdFFFFFFFFFFdF\FtFtFFFFzDFnDFsFrFFFFFFPF6F.FFF<FlF4FVFFFFFFFFVF FFFFFFtF4FFFFFFhFFFFFFF<FFhF8FFFPF(FFFFFFF(F^F^F FF F(F8FаF<F̸FFFFFHFFfFVFbF(FFhF8FF6FFFFňFFFFvG FFF(FFFפF"FҴFnFF&FFFF FPFFńFɤFӢFrFzFFFFFFxFF4FFzF*FFFVFFFFFF>F(FZF F`FFFFFFFFFTFFZFVF FFxFFFFFF(FƾFφFFVFBFTF.FFnF\F>FGGFnFHFFvFLFFFFF FFZFFF,FF6FFTFFFrFFϢF@FPF͎FFˢFFdFؔF.F|FF FdFLFFLFFRFpFFFF`FFFFFFFFFnFrFxFFFF~F^FPFFRFlFzF2FFFϠF6FFFNFJFFF>F8FFϐFF|FFFF$FFFFFFFFFnFF$F\FFF8FFF FFFFFFFFFVF F<FF0FZF8FXFF0FF8FXFžF`FFFFFFFFvFtFFFxFFFFFFFFF(FFFFF:FF@FFFFvFۘFFFFFFTFFF@F\FFFF:F.FFDFFFF˶FڜFZFVFFFFF&FFFpFbFFFFF<FrFFLFFnF.F F<F(FF0FFDzFߺFGGGGGnG"EGGGG(GFFFhFnFJFF¨FFRFF FFF8FFXFlFՔFbF>F:F<FFF"FFhFFF~FjFЊFF*F8FπFцFFFF,FגFFFFzFF׬F6F FGG G|GbG)GGGFFFFZFFFώFF֘FFFFzF.F֐FRFFFɖFvF$FF@FFFLFhFF FxFîFF.FFFBFFFFFFFڲFF FFFFFpFFFFFF~FVFFFFFFFF(FJFFFFFFFF<F\FFF`FFFF@FzFFFFFF$GFF݀FԞFٌFFZFFβF FF>FFFFFFFFFFFFFFF FFFF*FFrFBFF F:F&FtFPFFFFFFFF(FFFFF.FFFFFFF0FFFF@F4FZFFFFFxFJFFF*FZF&FFFFFF FFFTF:FFFFFFFFFFTFFFFFFFlFFFFFF2FFrFnF\FFFFF4F2FӆFFJFF0F$FFzFFNFnF¸F8F0FԶFFZFFJFTFbFjF(FF>F^FFFFFFFFF<FZFFFFFFFFFFLFFFFFFFDFFFFHF,FpFnFFFhFFrF,FFFFjFFFFFXFfFFFFFFF`FFTFF4F FlF:FdFFFF*FF<FFFF(FNFF:F2F$F>FFnFFFFPFF<FFnFFFFFF"FFF FFxF>F FFFFF,F@F4FFFFFfFFFFXFFF F4FF2FFF}FzFnFlFtxFjFF}F|FFF<FPFFBFFZFF"FFœFHFF FFhFFFPF<FpFFFFFFvFFFzFFFF,FFFF"FFFF>FF FF6FFNFFXFFFF FFFFFFFFF~F{\FoFeFi|Fn|FqFzFtFeFFF9F;F>FFFUF`0FF(FF$FzFFF,FFFFF.FpFpF FvFFFFFFXF8FFTFBFFrFFF6FFFFrFFF FFFF:F®FFdF`FFFFxFzFFNFFFFbF:FFBFvFFxFvFF2FFFFFFfFFFFF͠F8F FFFLFߖFFFVF8F F.FLFFFFF6F2FTFFFFFFhFlFFFrFFFNFFvFFFF FFFFF8FjFFF2F0FFFBF@FFF6FF"FFFFF(FFFFFFFF FNFFFF>FF$F"FFFӠFFF6FFRFjF|FFFFVFFbFzFF FFFzFwFjFf|FaFg8FcFaFrF4FFFF^FFF8FFF FvxFhF_`F_FfHFqPFk0F{FoFe,Fn|FvFvFFF.FFFF FF(FF(FFFFF|FzFwlF{FF0F$FxFFFFFFBF]FPFGFWF\FSFYF^F]dFIFDFJFOFcFnFF2FFFFFXFdFFFpFtF[FdFV8FXFS,FPF4F&(FFFFFlFF#F&hF0F/|F0F'pF#FFF+TF7F?FCFEFTF9pF,F'LF"FFF F HFlFDF F,FFpF#TF$lF%@F$F!tF 8FdF'F$F-F=FLF<F<FGFK,F8lF0F&F+F F,FF*F(0DDD`DD D@DD@D`DDD@DŀDƠDDD DDD D@D`DDDD D DE EPDDD DDD@DD@EpEPE E EE `E `E EEEEEEE EE@E- E"E`E!@E!E#PE)E* E8@E7E>PEB`EBECEEER`ETEKEXE^0EJ0EUEFEMEN0EOEeEkETEL`EMEUpEVEVEI E;`E2E= E;@E:EGE:E6E:E=E;ECE] E] EXEMEMEK`E@ELEI EO@EIEIEBE<EAPEEpE@EAPEEPETEKEKEKELEZ@EcEbPEaE] EW0ET`EO@EBEPEB EJpEIPEPE]EZEcErE~PEEEpEEE8EEEEEEEEXEEXEE(EEEEHEEE8EPEhEPE@EpE0ExEE8EPEEpEE(EXEEEEEEEEE`EEEEEHEHE8EEXEEEPEHEEHEPEEEHEEE@EEEEE EEEExEEEEHEE ExExEE߈E0EE0EE EE0EEPEEE0EEEEHEEEEEРEExE0EʀE@EŰEEE(E8E0EEE@E̠E@EhE(EEEEEEEEEE@EPEEEEEPE݈E EE߰EE(EExEEXEEE@EEрExE`EpEEPEF|EPE EEF$FFpFdFHEEEEEEEEEEEEEpEF(ExFEEhExEE FFFFF $F XF<FF F (F F F FF(F$F\F%F%FFLFDFFFFF pFFLFF(F F$FFDF@FPFFXFFFF dF @F HFLF dF|FFF F F F F|FFFdFhF TFF<F"(F FF\F!@F"F(F/F0F+F#F pF$F'F$tF$F*F$F$F<FPF!F PFFF dF F%HF&PF)xF$F'tF'4F3F+F20F4F5F3pF8FFF;F5F1TF+tF)F'F FF<F4FF,F F F F HFF F FF$FFF!FFFF F&0F#FF#F'F.F3F5(F6F+|F&`F$tF(F0FFhF`F (F lFFFFF%XF/F7F:FHFHpFH$FNhFU@FR F[0FepFrFotFw|Fr(FeTF]FS@FPFC`F<F=8F8TF6(F5F4<F3F5TFAFJFOFPFJFPTFYFTFV,FPFSFKFFFDF?0F<F?F7F6F8F<FCFIFHFTFMdFMFELF>FHFS0FVXF_\F^4FUF_\FdDF{F,F>F FsXFrDFj FiFq`F|HFvhFq`Fu Fo<Fk FdFeFbpF\8F^FgFeFgFfFxFwFvF(FF\FF"FFFfFFjFFFFF.F*FFFFFFFFFNFlFXFFF F:FbFFFFFFFFnFFFF|FFFFFFNFF:F\FFFXFFvFtF{pFFFF||FFFFrFhFFFF FF4FFFFF$F,FFwFrFr4Fe@FvFyFxTFo|FhFkFh$Fk|F`FVF]Fe,FWFW\F[dFh(Fz4F$FF FFzF`F,FFFFFFFjFFPFFF FFBFFbFF.F4FFFFZFFFFFjFrFFF:FZFFFFFFdF FFFFFFFlFFFFFFFFF F>FFTFFFF6Fy F}FFFjF{8F<FxTF{tFFFzFuFpF0F.FFXFFFBFFtFFvFFFFXF~FFFFF6F8FFFJFFF0FF^FxFoFjFiFf<FklF}F2FFFF|FFVFFzFFFBFTFFF.FFFzFFFFFFFF0FFF(F(F F"FFRFxFFFFFFFtFF4FrF|FFF&FFrFӴFhFF̄F`FFF(FFF FFHFNFFFhFlF,FtF.FF:FF"FFFFvXF| FFFFLFFFF,F>FFGFnFVF.FFHFFFFLF.FFFFFFPFFF<FFFFFPFXFFFF2FFlFFFpF4FbFfF6FFFFFFFF(FFpFFFFFFRFFFDFFFHFFzFF FBFFF2F@F6FFFtFFF(F$FFFFFF۪FFF FFFFFFFVFF F$F|F FVFFFvF̜FFXFFFFFF0FFFFFҺFFFF̴FɲFNFFF|FFFxFFFrFFxF}pFFPFjF8FFFF"FFfFFFFF2FFFFFF FF FrFFF FvFFFvFFFFlFF|FFLF.FF&FFFFvFFFFdF(FFxFFvF FFFFFF*FFtFFFFFFVF6F|FFFFF\FXF FnFF2FFFFF:F4FpF:FTFJF>F\FFvFFFtF6FlFFZFFFF:FzFFFF FFFFFFtFFZFVFFFFFFFF8FFrFbFvFFFFF&FFLF.F FFFrFFFVFFFFVFF2F\FF,FFFxFFۤGGG+GG ;G"GGGG6G "FFFBFNFFFF FFF:FF|FFFFFFVFlFFFnF,FF@FTFF"FŊF>FrFFF4FZF~FFpFFFF~FFTFDFFjFF̆FFFFGGG GvFFFFjFFFdFzFPFFFFFfFFFFFxFFlFFDF<FnF<FFFFFFFFFFFFFFFFFFFFFNF@FpFFF"FFFFF>FFHF:FFF4FlFRFFFF`FFFFFFFFF~FFZFFFBFF8FFFRFFFߤFǂFTFZFFRF&FFhFFzFtFFFFFFFFFFFFFF`FFFFFFhF FF~F^FFFF8FFF~FFFFFFfFFF"FPFFFF|FFhFFJFFFrFtFFFFFFFFFbFFFFFFFFFFTF2FFVFDFFFFF FJF&FtFFFFF FF~F*FFFFFrFFFrFFJF,FFFFFFFXFF(FFF6FBF|FF4FFFFۚFFF8FF>F8FFF2FpF:FF$F~FFFpFFdFFFF^FFFfFFFpFPFFF<F<FzF<FF FFjFhFFFFdFFF~FhF6FFBFDFpF0FFFFJFFF FFFFFFnFVFjFPF,FFFFFFFFF(FFF~FFFFFpFfFlFbFFFpFFTFFLFFFPFFF"FFFFFώFFFFFFF|FFFpFF,FXFFF.F*FFFFFDFFFF8FZFFF0FBFFtFuhF|XF|TFF6FFFFF<FFFFHFFLFxFFpFFFFDFlFFF.FFF<FF6FFDFFZF@FvF`F F~@FFFFFFFFFFFFFF*FFFFFFPFZFFFFF4FF<FJFF>FvdFh|FoFjFoFg8F]FPxF@,F?XF<FGlFOLFZFxFF6FBF4F FFFFJFFFxF4FFFFLFFRF>FFFFF^F FFFF FFFFFlFFFFFFFvFFϨFFFFFFFFF8FFFJFFļFFvFZF FNF~FF0FFFF2F\F^FFJFVFFxFF>FєF^F(FxFfFTG FFFF\F@FJFFFFFFFXFFHFͰF|FrFŠFLFLFFøFHFF&FFFF|FF|FFF,F$FF~FFFFFFvFF8FFFZFFF\FF&FvFFFF"FFzF0FdFFNFFF.F4G GGFFnF\FؠFrFFNFHFFZFFFFF̂FXFJFzFF>F|FmFmF^PFbFjFvF:FFF.FFFPFF*FF8F\FoFiFfFsxFpFkFkFctFp`FmFr\FPFFFFFFF`F~FFFFFFzFzFw@FFFnFF&FFFF8F<Fn8FvFphFkFnhFhFntFxFF F*FrFg4F]|FcXFF,FFVF>FF*FF8FFfFFFj4FiF^FY FeFkFILF9xF/F tFFHFFhF (F(F2F,F$F"lF!F<F F&FBLFOPFQHFAFBF0F-F0F/HF)4F"FxFFFFpFFF#F;tF3F-F+F#F!FF+hF6$F@FStFBdF4F-\F'xF$F#F$HFFF%(F FFdFDDDDD@DDDD`D`DDDDDD@D D D@DDDD`D D@D E E0EDD`DDD@DD٠DEE PE EEE EEEPD`E EpE0E pEPEEEEE$E)E*E/E#E3pE2E50E9E=pE6EAER@ENEME\@EW0E`EWEUEQE^PEWEKPEUE]EiEm@E\EX@E<EFEN ER`EHE2E8ECE4E3E8E:E@E: E4E`EFpEEE?E9EJ EGEKpEMESERETEPEMEWE^E]EhEcpEa EUEKENEPpEMEHEI`EME_0EcpEmpEjEspEzEE(EEEEEEXE0EE`EHE(EE@EHEEExEEEEhEEEhEEhEEXEpExEE0EE(E8EhEEE@EEExEPE EpEE@E|E E{PEEhEXEEE(EHE@EE@EEEExEEEEEEE@EEE(EEEEEEE@EE(EEEE8EԈEEݨE@EڠEE8E԰EҐEE˨EE(EE0EE0EEEEE͘E0ExEE(EHEE`EEEEhE8ExE˨E0EE@EEEhE(EEPEEEXEEڰEE֨EE(EEHE(EEEE@E0EE@EEE`E(EE(EEEEE@E@E@E(E(EEEEEFEHEEE`EEpExEXEEXEE@EpExE0EEEEE`ExEE8E FEFFxFF FFFF,FF `FFFXF!FFFFFF F FF FpFFPF F $F hFXFFFhFFFF@F dF 8F@FFFXEEHFF FFHFPFPFF XF8F FFF(FF<FTFFFFFFFHF"F!F|FFFF!F%F#F4FxF|FPFFFF0FHFF#F"LF$tF.8F0F0F(F' F*@F8F0tF/F8F;XF6F2F%tF"F F`FHF4FF<FF$FPF$FFF<F 8FF F FF4FF(FFFFFFXFFF%F.F;F.XF'`F"lFF|F F TFFFTF4F FF|FF'F0xF:PF7F<FFPFBFB\FIFMFMFRFZF\FZF\HFNdFAF@F<|F4F0F.F&F'XF&F&F#F1F4F? FGFGFHXFJFOFKFL(FDtF<F74F4F-F/ F/F0F'dF+hF04F8PFAF=HFB|FEFCF=dF6F8F=FAFJFIFMDFZFd\FcFfFwF>F(FrFiF_(Fj FgFf`F^F^\FiF_FTXFNFKFM FOdFSFXFXF]dFZFcHFbFgtFltFnFq$Fr FsFFF{FF}`FTFF$FJFnFFFFVFF(FFFFdFBFvFFFFFFFFFvFFFFFFF.FFF\F(F^F.FFNF(FpF{$FpLFndFbF[8FkFrFpFkxFhFuFs$F{F^FFFFFF^F|FF{FyFuFkPFsFvXFo0FcF^`F^`FX F[FcFX0FXLF[FUFRFNFPXFM4FWFMFHhFKF^FcFw FFHFFFF`FFF&FFFFFFF&FnF>FFF(FF4FFF@FFFFF6FFFF.FFFFjFLFFFFF4FFF^FF6FFFFTF|FdF{F F~FFFFFFF|FF2F|$FqFr(FoFoFnFk0FfFn,FhFrFpFrFqFxxFF|TFFtFFF0FFJFFFzF4FFzF|,FxF~XFFFFDFFF<FFFFBF6Ft$FgF`FQpFOFRFXFcFFFFbF$FDFFF~FFFFFFFDFF"FFFF(FrFtFPFFFFFFFDF$FFVFFFFFFFDFFFFFnFRFFFHFF6FHFFhFFFFzFFjFFF`FӒF`F FFNF:FFFFJF~Fx4FwFqFz0FFLFFVFFFF<F`FFG;FRFFFɂFǾFFxFHFF2F4F@FF0FFFRFF>FFF|FRFFHFpFxF`FvFF FxFp8FpF{F~F~FZFFFpFFFFfFjFDFFTF FFFF$FF~FLFF&FnFF|FFbFFFF~F2F FFF҂F2F FF F8FFNFF FŒFFFFF`FHFFFFtFFFFFFFFFFlFFFVFF F&FFFtFFFFFF8FFF6FFFFFF4FFHFF|8FulFiFjFohFzFF~FZFzFJFFFF~FFFPFFFRFFFFFFF^FfF4FFFFF0FjF&FHFF,FFFFFtDF|F\FFF.FJFFF2FF FFFFFjFF|8FFrFFFTFF>FrFdF(FFFvFFFF$F"FFFFFFFFFFJFFFHFhFFFFFFF(FPFxFFZFFhF0FBFFXFF^FdFFFdFF6FFF~FVFFlFFFzF0FFFF,FF<FFFFF(FFFF$FpFPF8FFFXFF{Fv|FwFF FvFqxF}8FFF|F~FzFF|FFG,G [GFG6G OG<GG GFFFFFFFFHFFFTFBF FFFF F*FŒFFFFnFFrFFFF@FPFFʀFrFˈFBFFDFFF FxFXFvFעFFF4FF.FF~F4FF F0GZG`GFF۴FbF>FfFBFdF F(FJF&FPFfF FF FFFFFF,FFFFLFFF(FrFFjFFFnFFFF&FFFFFFFFFFNFF>FFFhF6FFFFFFFFFFLFFzFFFȤFHFFzF~FFXFhFdFFVFRFTFFFFІF~FFxFHFFFFF.F`FF|FFFFF0FFzFFFFFFFF"F|FFFFFnFFFFfF^FFFFFFRF<FNFFfFFFFFdFFFFFfFFF~FFFFFF&FVF8FFFFVFFFJFFF4FFFhFF\FFFFXFZFFFFFPFvFFFtFFfFFFFbFF}F|FxFFzF8FvFF&FrFlFfFFFFBFF FFFtFrFFFFFF0FFFFFFFɶF"FFlFFlFFFFF$FFF8F\FFFFFFFFFzF`F\FFlFFFFFF2FFFFF"FrFF0FFDFFXFnF`FFFPF$FF6FFF`FFPFF&FFTF6FFTFFFFFjF:F^F\F~FFFFLFFF$FF FFF$FFjFFFdFF"FDF.FHFFFF:FbFFFF F6F<FFFdF,FF\FFFdFFFFF F@F FVFFFFFTFFhFFFFFF>FFF@FTF}FzFlFdFBF}FFFF0FnF$FFFFlFZFFFF4F~FFFF(F FzFF(FFFfFF@FTFFFFFFFBF<FfFFFdFFFFFlFFF2FFFFFFBFF4FFRFFF:FnFFFFFFFFwFh FT`FL\FMTFGF<FQxFeHF{PFFFFlF¼FPFFFbFFFFBFBFbFF6FFFFFFFFDFF$F<FF@FFFF`FFFFFFF\F FFFFNFƦFFF2FvF4FhFFFFF<FF.F F FFF,FFFJFFvFFF´F<FˊFTFF*FF~FF<FFՌF.FBFFFFFFFvFFFNFFFHFFPF@FFFNFDF FFfFFFFTF4F^FFFFFFFFdFVFbFFFFFFFFF.FFFHFFFÖF²FFFބFFFpFFFFFtFFhFBG1G GGGG5G$G F|F@F\FFfFF*FӊFFFFFF٦FμFdF$FdFnFFFqFj<FhxFpFNF&FFFF4FFFFvFF(FvFFFrFyFvFo$FfPFaFhLFfFh\F{<FFF.FFTFFFxFưFFFFFFyF~FyFFHFFFjFFF FF|F,FFhFLFFF,FjFNFFJFyFw<FFFF$FFzFFFvFFF FF\FFzxFx(FcFtDFNFhF?F+<FdF,F<FF F!F)XF&TF&F F$F%pF-F1$F:FEFCHFA|FMF?F.F4xF=PF;F3F+lF+FlFF!F+LF(F.@F7F5TF/0F2F',F!DFF$F)`F7F3F1F"FtFFFFFFF'F'FFF`F D D DD`D DD@DDΠD DÀDDDՠDD@DDDDDנD`D@DE EE E E0E `EEE`D`DDD EPEE EEE EpEpE @E EEpE EE E pEPEEPE'E-E8E,E3E3@ECEFE6E7EAE?pE>ELEQ@EG`EUpEWETEQ@EZ EeEcE[`E_E_ES`EZpEcE_ET@E@EGPEMEFEB`E:PE:@E9E9E:`E8pE:E> E8E3EJE?E]E[ E_ EO@EFE>@EFENpEIEGECECE?EC@EQEEEPEXE]E\E^EXpES`EWE^PEgEsElpEeE\EPEFENER0EKEUEXE`Eo`ElEvEEEhEEEhEEEEEEExEEEEE(E8EHEPE`E EE EEEEHE`EEE EPEEEEEE`E0EEE`E(EpEpEhE`EEpEE| EEEE0EHE`EEEHE8EEhEHEEEEE@E(EEEEEEEE(EEPE(E8EEhEPEEpEpEEEݸEEpEPEEEʰEʰEɀEE E0EpEEpE`EEEhEE8EEɀEEEExEpE(EEpEE`E E(EPEE@E@EEEE E E8E8E݀E8EE˨EEψEԠE(EӈEpEE(EEEPEEEߐE߰EpE٘EE EEE8EEEE8EEEEEEEEE0EEEEE0EEHExEވEE`EEE8ExE0EEEhEEEE(EEFtE FFtF4F $F pF <FFFFF F F,FFF F \F HFFFFlFFF`F xF FF`F\FhF0F FFFFLE@F8EEEEEEXEFDFdF@FFDF\FF|FFDFFFHFFFPFFF0F FFFFFFFFhFF F`FF F F tFpF F0F F"<F&F,PF7F5F)PF%F$F/F2F'F+XF0tF6PF5$FFFFPF F FFF|FF4FEFFFFFF lFxFFFF`FFFFFFlFF!F*F2XF/F&F)pF'F F<F F0FFFF dFFFF(F(lF,F1 F0XF>F;F F4F1pF-$F) F"lF$F$\F&F'LF+xF.F/F4lF>F6 F3PF88F4$F.F,F-F1F2F?DFJFLFWFRFQ F_\Fw(F|FrxF_F]FZ`F[|FS0FTFO,FSFVlFJF?F@FFFHF?FEPFLFRLFKFL FKFOFSFZ\FVF[0FY|Ff|FwFoFlDFjFvFFFF~F}FlFnFZFFFFjFFFhFFFFFpFF8FFFFFFFJFFFFFFF4F~FwFF<FFvFiFWFTFRHFT|FTFaF]F[F^,F^FhFsPFq,FrFx8FvPFvFtFjDFrFiFeDF]FRF]FmFgFXtFOFMFN|FKFNFWLFOFLFGFF FPFR FCFN FDlF@DFJFN<FULFdPF|FFrFFFFtFJFFFFrFFNFFFFFFFF"F}FzFx$Fv\FzFFFF&F FFFbFFDF F$FxFFFFFy\FFFFzFRFFF4F,F*F}F|xFvFpFvFFFFFF8F FTFRF{FoFeF\DF``FcFfxFbF`F`hFcFc<FgFdlFkFtFu,F}FFFFFTFFzFF|FzFz8Fm Fn FihFo8FwF(FFFrFFFF"FFwFhXFYPFMHFKFJ8FN FMFQFa|FFF6FdF{FoFz$FhF<FFFFFF6FFNFFFFFZF^FZFFFFFFRFFF>FF$FFDFZFFFF*FFFFF8FFrFF FrFFFFF0FFFFFFPF\F<FzFFF FFHFJFxFz0Fs,FolFmHFz,FVF`F0FlFPFFhFFFPGNGOFFTFFFϾFFjFFFPFHFFFF FFF@FFHFFFxFbFFFFxtF~FvtFwlFs|FjTFjFuFF~FFFwFFdF6FFFFF~FFFpTFjdFxFFFF`F FFlFLFFFF.F^F\FFFF̶F͔FF0FǂF*FF,F"FFtFF|F>FF|FFvFFFFFF`FFHFJFFhFF2F FFFFFVFFF~FDFFzFLF6FFFFTFhFFpF,F,FFFFF>FxFlF^FbFpFp`FtFz0FyXFFFF&FFPFFFFFFFFFLFFF`FF FFF8F FHF FxFFFFFFLF@FyFtF}lFx4F{FBF*FFF2FFFtFFFF}F*FFFqFtFuFo@FmFtFvFFFFhFFF|FFJFFF0FrF`F8FFFFFBFFFFFF,FFdFjF0F^FFFFFxDFrFF2FFFFFFFF8FFFvFFnFF FFF>FPF4FPFFFtFFFvFFFFFFFFFFFuFwTFZF\FxFFzFnFc@FeFiFoFmFbFmFtF~FFBF&FFPF8FݨG nFjFFFFGGG F F.FɈFFzFFF*FFFF\F4FFDFhFFVF FFxF8FF$F$F`F>FdFHF*FdF2F$F2F^FPFFFF&FFFъFԲFFܼF(F@FFFFJFFFFGF0FPF"FFFzFFFF0FF*F8F$FFFFFnFFFFF0F FbFFFpFFFFhFFFFFvF2FFHF(FFFFFFFF"FFFdFLFF{F}pF~HFvFlFFFFFFhFFFFLFFFFFFFXFFFFXF`F<FFF~FFTF`FǬFF*FFFlFFFZFtF>FFFlFFlFLFFvFxF4FFFF}FyLFtFtFfFvFFFjF$FjFxFFF~FhFfFFrFF$FzFFtFFLF2FF`FHFFLFFFFFFFlFTFFrFrFF FFFFFFDF$FdF|FF FFFF\FFFvFF\F~FFFFFFF(FFFHFF&F(FFvFs@F8FFzFnF&FPF6FFFFFF4FFXFF$FFlFhFF|FZFF|FFFFFFFFlFF>FPFFFPFFFFFFFFF6FFZFFF|F,FzF6FRFF8FFFFFFnF&FFFFDFF.FFF0FFFFF FF:FF|FJFFFF"FFFPFFFFFjFFFFFFFFFFFFFFFFFFhF F(FFPFFFFbF8FFpFFFFFFFFFzFF̤FFFFҴFӠF<F̊FF"FFFBFFFFȦF`F0FNFFBF FFtFFFFFFbFFFFFFFZFbFRF0FvFFFFHFF FFFFFFhFFFFF"FFJF|FF8FFFF6FF FFF0FFF\FjFFnF0FFFVFFFFFF8FFzFjF"FFFFFfFF0FpFFFxFLFF`FFF,FF<F`FF*Fv0Fb<F\Fb8FT\FWFn(FXFFFFFF͜FLF͌FFFFFFFFFF2FF FtFF&FFFF FtFFFۀFFF0FFF FjFnFFF"F4FHF2FbFFFF\FFF FFFFxFF6F FFFFFBFFՌFFF2FrFFFF"FٴFBF FFܲFFFF FFFFFF2FFFFFFFFFFFFFF|F.FLFvF|G`F>FFFF>FTFF:FF0FhF FFFFFFFFFʌFhFFHF FFFF:F|FFBF6FdF4FFFF8FdFtFFZF>FԺGHG"=G(gG'GDLGFGEZGFFzHFyFFFFFFF&FFFFVFFF6F6FFbFFFFpFwPFrFrFy`FFFZFF FFF0FrF0FFFFFF@FFFFFFFFxFFFt\FFpFNFFFBF`FFFPFFF<FFFFFNFtFF"FFFXFFFFFfFyHFyFFz4F^XFFF)FF4FdF F!F*F.F-F40F3F:,F8 F6 F=FEFTF?F<@F.F1F,F5FLHFY FM`FNDFDFEF:F7FF F5F;HFJ@F7\F:F;XF5F/F+F F(dF'<F*FF$FFFpF FF"4F1F(HF, F$FF FPDDD@DƠD@D`DDDРDЀDDDϠDD`DDD@DDDD DDDEE E`E0EEE EDDD@DDE0E EEEEEPEE E `E EE EE `EEEE%E4`E,pE5E3E9EKE>ECE4 E4E=E6EEEMEEEJPEUEPEMEYEYEcEjEcE\EcEbE^EN0EP`EJEJpEG EHEFE@E:E<EE@E?E9`E2E9E<E;PE=0E@pEDEZ EUE]EIEHEGEG EKEHEM`ELELEK0EN@EREXPE`E^Eb`E`EiE[0E_EbPEeEeEpE_Ea`EY`EPEQECE\ENEPE^ EiEoE}Eu`E}EE@EEhEHEEEEEXEEEXEEhEEpEPEPEHEPEEEEPEEpE0E@EEEEEEpEE@EEXEE(EEEXEE@EEEEEEpEEE8EEEE`EEEEE@EEExE0E@EPEpEHEPE(EEXEEEEEEHEEEEEEHEpEǠEژEِEEEϰEEEEE`EPEXEEEEEE8EEEXEEEEEPEEXEEpEhEPEEEHEEHEEE`EEEܠEE0EEhEE(E`EՐEE̸EhE0E EEEPEEEhEАEEEEEhEEӨEEPEEEEE0EEhE EXEExE0EpE8EEEEpEEEhE8E0EE@EۨEEרEEE8EEEِEpEEEE(EF\F@F <F FFF ,F FFFpFFXF F FFFFFFEEEFHF4F|F F<FFF F FPFF\EEE@E@EXE@EEE`EEEEEFFFF FFPFFxFFdFdFFF FF dF |FxFF|F F`FFtFxF FHFHFlEFFF FF,FF"PF,F6$F3F3hF*F(PF'F*F(8F"pF*F)F'xFF\F FxFE EEFFFFLFEFF`FF|FFFPF hFFXFF hF F F |FFtF"F"(F#tF+F&F$LFFFF F\E E@FFF tFFxF!FF%F-F- F5PF; F>xF;XFAhFHFDFBFE0FCF>F=F0 F&PFtF FFFFF,FTFFF$F& F#F.pF8DF;hF;F6 F6,F0F$F"F"F$FFlF$XF*4F)F/pF*xF3|F1F2F,8F-F0F+F(F%F',F,F6$F9F;tFHxFFHF<FLPFZFeFiF[FNFIFE FBF=F>FEFGF=dF8F5F:dF:<F;0F;FCFL F=F9F9F7\F<FEFHFH FKFGFYFcFl F^FcFdFj<Fl Ff|Fo8FiFeFm8FTFFbF>FxFFFF6FFFF~FF.FFNFFF`FwFqFvF*F(FdFv<FkFc0FiFiFeTFe FbFjFcFP(FIFFFCTFFF@LFL4FUPFMlFM<FN FWF[0F\FeFcFYFWFVFTFOFMtFCF@TFHdF]Fa\FIF@FCPFBF@FA$FJFNTFKPFCFMhFIFJ(FCFCFCF?0FDTFNFUF\FlFwF2FFF~TFtFmFqFzFF*FFlFjFFFF,FFFvFn FkFl@FzFFFzFFFvFF FFF F6FFFvFLFulFzFsF{FpF{lFFF^FF`FyFw4FtFhFb FfFwFyF8FDFF(FDF"FsFjF`F` F[tFXF^FdhF\FZ FWFSDFO$FSFYFT@F[FiFaFkFbFzF|FtFqxFtFtFr(FrpFnFgFh,Ff FkFptFq FqFzFJF|\FFFsFkFdF[FLFDF; F6F9xF>XF?,FOFdFvFzFuFo@Fc<FjlFrTF,FFFFF:F.F^F(FvdFFFF`F<F^FFFFFFFFrFFFnFFvFFFZFFFFFhFFFFF2FBFF^FFHFjFFF4FFVFFpFF FvF^FxFdFFhFF~FtLFyFlFfFiFw F|pF FFFFFF F6FRFFFdF0FҌF*FtFfFFFFFFnFFFdFFFjFZFFFF{FztFsXFrF`FjFgFk FgF_F_PFiF|F FFF~(Fz@F|F~F~8Fz Fz@Fv@FF~FuFbF_FjFhFZFFFFVFFFFFFPFlF@FFFFFFFnFF0FFFFFDF.F~FVFFFFFxF,FFFzFFjFnFFFF,FF^FFFlFFHFFXFFF&FxFF*FF$FJFTF|FFxFnF0F FFFfFFyFiFhFaFnFbFeDFfFjF|FFF(FNFFFFF,FF~FFFJFF6FFF|FFFFF.F|FF<F4FFF{0FnFoFeXFjFmLFzF{FFFFFFFjFbFFFFxpFtFgFiFiLFsFpFjFpFqFwFFFF,FxF:FrFFFFFFFF$FFFF&FF"FFFFFF4FFFvF@FzFpFq8Fo4FzTFHFLFFFFFF|FZFdFF:FFF&FFFFZFFFFqFjxFxFFFxFFxFFFg`FbFpFt@FdFV\FXFaFwFFx,FbFYHFMFKHFV0F]F_FVF\hFiFkF{<F{XFFFFÎFF:FFFFڐFrF\FFpFF*FbFFFVFFNFlFLF<FFjFFFFF`FFF,FF|FDFFF`FFbFFFFJFFvF6FbFFF^FFPFF2FF&FòF8FFFF(F&FvFЂFF4FFlFFHF.FFFFFFF6FFFFFFFFFFlFpFFtFhFFJFzFFFFFbFFFFrFF|FFF2FzFxF}FFFjFFFoFpLFoFvFthFzpFrFpFvlFx8FF~FFFFFFPFF\F>FlF&F FFFF0FLFFHFFFFF<FFFFFFFjFFfFFFXFFF<FF|pFTF>FxFxFu<FzF|DFzFrFjFfFdpFhFvXFt FuXFPFDFdFFFFF*FFFF&FnFF F2FDFFlFzFFlFF~F~xFxFZFF|FFLFFFFFFFFF2FZFF*FFFvF\FFFFTF8FJFFFFVFFFBFFFFFFšF8FFFxFF@FFBF{F|0F~FyFF,FFBFFBF4F2FFdFFXF*FF<F&FFFFFFrFFF`FFpFFFlFlFFFFtFFFFZF<FpFFF&FF$FFFhFFFBFFFFBFFlF>FFFFTFFPFFFFFF8FrF>FF*FFF FFF<FF|FF^F(F(FFFNFFFFJFpFFrF"F8FFFF FTFFFF:FFFFFFFFpFFFFFFFFFFFtFFFFFfFFJF0FRFFFFjFFFtFF2FFF,FFFxF FrFըFʞFVFFFHFFFFF^FFFF\FnFFFBFRFxFFFLFFFFFFFlF*F.FFJFFFF,FFVF2FFFFFFFJFFF&FnFFF|FFFF*FFFFzFFNF2FFFJFF|FhFFFLFFFF"FFFFF\FFFFFFLFHFFFLFFFlFiFdFfFh\FrFFFFFRF\FFBFvFFFF:FFFFFFNFFjFFF<FFFFFFǮFF4FF\GFFFFFF FF.FF|FҨFFfF<F*F\FXF\FvFFdF`FFFF0FFŸFFFzFFF|FFZFFF^FFdFFFFFG F<FFF^FݨFFFZFPFFFFFʶFPF6F4FZFF>FF@FψFFhFFGGFÚFFFFFBFPFvF<F0F FF0FFXF\FDFFFjFFFϦFƆFVFF\FFFF&FFFFƖFFRF˂F:FF`FFFG&GG<GHG>!G$G-G(GG G5FGGG^GFFFFGGFFFFƞFFNFFFF|F"FFDFF FXF"FFFF@FPFxFFFVFFFBFFFvFFFFFFvFFF:FLFFFԊF~FFFtFHFFF.FtFF>FFFFFxFF"FHFFF^FPFFPFFFFvFFFFF,FFFlFFbFFF&FFFFFzF~XFFb@F[<FNF<F(xF$hF*F'F'PF9F8FEFAF@FETFDPF>FI,FMFRFEF.dF+F(F.,F3XFOFjdFmFeF\FOFHFBHF7F6FAFNFIFAFPF9LF2F2F&|F+F" F,@FFDFpF,FhFFDF7FG0FG<F@F1dFlFFDDDD D@D`D؀D@D̀DDD@DDDDD`DDD@D@DDDD@E0E E EEEEpEEDDD DEpEpEE EE `E#E EPEEEEEpEEEPEPE&E-0E6E4E/PE8pEGEEEFE@E9E1E9EBEFpEOPEE0ELEREL0ER0EXE^Ef0EmEe0E\E_pERpER`ENENEF@EAE=EIEDE<`E3@E5`E:`E9E0PE-`EAE?EIEKpEGEI`EMESETpEE0EQEKEJ0EPEHEMEIEOEREVEYPEf E]EipEkpEaEb E_Eb@EfE]EeEc`Ed0E`ENEJEF`EIpEOpET0E^Ec`EqpE`E EEE0EhEE0EEE0EEEEExE@EEEE8EE`E@E@EEEEEEEEEEEEExE0E8EXE8EEEEEEEEEEEpEpEXEEpE E8EXEEE`EEEEEHEEE0EEE EEEEEEEE0EEE EEEPEhE(EpE`E EhEEEEEƠEǘEHExEEEXEEEEE8ExEHEEPEE(E0EEEHEE8EEPEEبEE`EEhE(EEEXEXEEE8EEEEPEEpE@EPEpEEḚE8EʨEHEΠEEEHEE8EXE EPEӠEEEE@EExEHE`E߀EE0EHEEEhFhEEEEEE8EEEEӐEEEEXEXEPEˈEpEЀEEEEEF8EFFF0FFFFF 0FFF,FFFF F F FEEE`EFFEpFFFFFFF|FF@FF,F@EHEpEEE0E`E@EpEEEEF$E0FF4FTFFFXFFFtFHFFF FF4FXFF FDF lFF F F F (FEhE@EHEFHFF HFF0FF/F/\F/F.F'F+F F@F!F@FFFFFFE8EpEEEFFXFF(FPFFlFFFFlFFTFF 8F F F LF F F FTF F4FFFFFF@FF FpE@EEFLFF F F xFFFPF$(F+F,F0F8F5F>F8F=F6`F3F3xF3DF1F)pF" FFFxFFPF<FTF(FFFF,F!F)F3LF<|F5F64F.F+F!HFtFFF FFF",F.F0dF1F*@F,PF+F-F*F,@F$F$ FF!@F#dF*@F-F.F9TF?HF:F;FAFIFZFRFB8F<F8F3,F5F1pF5(F<F9F2`F)dF.F.TF34F7TF:F;,F=@F3F2F1LF2F30F>F:F;hF<,FDxFWlF_tFUxFYFSxFOFTTFR`FRF^F[tFUFfF{F|TFFzFTFFFFFnFxFFFFFFwFt(FlTFlFjFilFi|FoFcF^dFS`FOXFVFTFP@FFlFEFLFG F>F> FA,F@4F@FLXFYFS(FLTFLFPFQ|FQxF[HFUFR$FK4FEFALF=pF<F:xF6F>FHDFTtFGXF<F?F6F9F7LF7F8F> F>DFAHF=FFFC@F@FJFH FDFMpFTFUFUFiFo|F{Fp<FqFjFZ\FhDFnFnhFv\F|TF|FFXFRFFFFF|FoFeFbFbHFlXFlXFsFF8FnFFFFFFFfFxFFxxFvFuXFlFi FfFvFuFy F"F{\FqpFx FwxFnFl,FbF\tF\FeFoFt(FvF|FF}FvXFkF`FX`FW(F_FaFb@Fc<F\FXLFQFJlFLFO4FIFLpFPFOFWF^FjF{$FmFbFiTFbFjtFaFhFblF^ FZFYF_FhlFn(FlFv FvFltFnFhFchFZFPFKFE4F8tF4F3`F+hF6F;F?FLFZFoFo,FqFaF\FjFfFDFFjFFFFFF{FyF~FFF&FF~FFFFFPFF^FFFFF|8FzF~F{FmFi(F|FtFBFFFFFFF>F:FF6FF FNFhFFF>FFFFRFvFF|FqFkFuPFtFaF[`F\FcFiF{FmFtF|`FxFHFFJFFFFFԘF\FFFFFFVFF@F:FFsF|F}F}XFFBFF>F|FsFj(F[FYFYXFM8FQFSHFdF^F_F` FhFrTFy FFFF^Fw Fx4FFxFrFjFhpFfFkDFbFWFL8FR FVFfF4FFF$FLFF"FF,FBFlF FFFF FFFpFtFlFFfFFFFFvFFF*F$FFyFPFrFFFFxFFF FFFFvFFvFFFFFFF FFFF{lFwF}F0FFF`FFFFrFBFFF}(FstFgFcF_<FXFWFXFWF^FeFc<FzFFF~FFFFLF{FwF{xFvFXFF$F4FFF"FFFNFF FFFFVFFFmxFcF],FWF\FjFpFvpF}FFFfFFF>FhFFFtFj`FmDFiFvFsFqHFl,FqFnFitFsFndFwFwLFvPF{FyF{F|\FF}TFF(F FzFFBFFlF8F}FF6FFpFFFF0F@FF$F$FiFcFfFjFbFF2FF`FFFDF`FBF FF|FF~FFFF@F`FFv4FgFfFoFyFqFlFqFtF~FkFaFUtFU|FYXFWFO4FI|FL(FaFpF`FS`FGFG(F@FLFHFMFKFJFRFbFpFnHFwF F,FFXFdFFF*FHF:FF FײFFFFlFFF"FFNFFFFFFFFFFFF~FFJFFFFFFFFFFFTF"FFFFFlFFFFZF<FfFdFFFFFFFFFF$FFbFŤFpFFlFTF:FFF$FXFFF$FFFFFFFLFFFFFFF~FFF*FoFtFJFZFFPF.FFF@F*FFFvFxFu8F~$F{F~Fn@FaF\\F\FcFeFjlFbFbXFjFr@FuFpF4FFF6FzFBFBFFFPF6FF6FhFFFFFFFFF4FF4FʠFpFFFF<F~FF`FFTFF`FRFFF.FlF{@F}DFs`FiHFh,FtFzTFnFg FaF[Fd(FpFoPFwFFFFrF6FF.FFFF\FF2FFFF<FF{`FxFy,Fr4FyFx F~FFfFF:FXFF}FuFuFyTFjFFFF|FFFFFzFFFFFRFFFFLFFFFFvFNFF2F FFFFLFFhFFrFFF@FVF<F8FFFFFFFF|FLFRFlFLFlFFvFF&FFFFFFnFFFrF\FNFFFFFFFF,FFFFFdFF2FFnFFhFF`FF,FFF FFTF FFF FFFjFFlF\FF.FFFFRFFFF@F(FwFlFFF@FZFHFFFFFFFFFFlFFNFFF\F\F8F(F:FRFHFFFFF8FF>FFFFFDFFFF8FF4FFRFFFFFF FF~FĔFFFF<FF|FF F.FNF,FFDFPFG>GF*FFވFF8FrFBFFFjFFhFbFFFbFJF.F|FFFFF FFFFFHFFFFF^FFF&F`FFFFlFVF^FF$FFFFFFFFFFjFZFbFFF2F FFƊFFFF~FzFFfFFdF.FzF,FNFF\FFFFF6FXFHF,FFFFFFFFFF{FfFbFoTFrF{lFFpFtF\F0F,FJF~FBF$FFF,FFFnFF&F F(FFF"FFnFzFFF(FFGG aG 7G[GFFFFGkFzG;GGcFFTFȬFFFFFFF F&FFF`F&FزFFFFֲFلFFxG FFFtFFFF G G$G G lGFTFGG FzFhFFLFFnFFFFFlFFF:FڒF۾FFFFGGGGFFFF׺FdFxFHFFFF؂GGGFFFFFFìFxFvFF`FF.FFFFF2FFF|FLF^FDFF F`FvFFF׎F0G-GrGG#NG<G9.GFG%G'GRG"SG +GMGPF0GG G GFFPGGF2F*FXFFF͒FFtFFfFF F^F(FFFFFFFTF FFFFFFFFxF^FFFFnFpFFFFFzFFF,FzFF\FFFxFDFvF:FFFF8F>FFFFFrF6FF FFFBFʲFFJFNFFFFF\FFFFjFFF F͒FրFFDFFdFxF|FFFvpFWFGdF>F30F3F2F3\F8PF=FAF_FYFQF]FRFLFKFPFRFEF9 F*,F+F2`FIlF`Fm FFFgFKFIFFLF8lFEpFLFHLFLPFLF@F:FGtF;F+F'F$F`F FF FFFF*<F@F>FC<F9FFF(FDDDDDDʠDЀDDڀDD`DDD`DE D`D DDD@D٠DDDEEEE0E E 0E0E EEE0DEDEE 0EE`EE#EEE`E 0E EEEEEEEE0E7PE?0E>E<EEEKpEJECECE8E=EC@EAEL`EV ENELEYEIEJESEVEf@Er`EcEUEQEUEPEUEFPE;`E-E9`E;EBEApE7E3E> E2pE1E;E@E@EGEHEJEIEMpEWENEKEEEJ0ESpEL EU EIEWEb E]0EcpEiEhPEa0EjEmEkE[E`E`@EZpEaEcEaEdETEQ EJ@EMEJEYEZEdErExEPEEXEEEEE@EE EpEEExEEEEEEXEPExE`EEEEpEEEEEEEEEEhEPEEpExEEEEE0EpEPEEEXEXEE E EEE`EEhExEEEEEE@EEEXEE0EEE ExEhE`EhE`EE EEEEEEEE E EEEpEHEEpEE8EEEEEhEpEE8EEEEEE(EHE8E`EEEEEHEPEEE(EHEEhE8EHEE`EE EPEE@EEEEEEHEEhEpEhEEEEPEʀEˀE0E˸E@EİEEE(EРEE8EpEEEEpEEpEEEEEEpEEEE EEEEEEEPEExE֐E͘EEEE(EHE(EE@EE0FE0EEFTFFF FpF |FFF`F(F F0FxF F FFdEEHE E(EFFEFF F F FF TFF $F F F lFhEFEpEExEEhEE(E@E`EPEEFtFF 4F FF <F dF FFF FxEE`F@EFdFF4F FFFPF LF hFtEpEEFFF FFFF!F(F* F&PF&F%F"FFFFFPFF4FFpE`EpEFE FFFFF TFF F F<FDF FEPEFE0FFF(FFlF FF F F F F F<FFpFF EEEE`EFF|F F FPFFdFF'PF)F+pF/F5F5F4dF-$F,tF, F&F"lFDFFFFFF F<FFFxFFFFHF'<F,F+F*XF)LF"FLFF F(F$FFFF!F-4F(hF,F.F(`F&8F),F FLF"DFFdFFPFF(F(F,dF1HF2F/pF0F3F:<F>F9F4F*F*F(F'0F+F+F1DF+lF,F"F$F)hF-pF0hF2dF3F/F-F(F(8F,XF(F.F- F2<F8FAFJtFLFEF=F;FDFBFFFCFOPFN FS\F\FqFzF(F}FFF{hFFHF$F\FzhFLFqFsTFk\FbTFdtFaF]8FOFR FPTFSFIFKF@FF FDF?F4F,F7F;F<F;F>FEDFCFBdFGHFNdFI(FDPFLpFFFHFMFKFD FAF=TF6pF1F4F4F,F3F;lF>FBF: F0F4F0F*F,F1F1F3 F8F6pF6F2F9F;DFBFKFH4FFTFDLFKF[`FcpFfF_FZFXFXhFRFVF^F`dFbFi@F} F~DFFF{Fu$FjFaFV|FQ$FW FbFgXFqPFzxFFFFlFFFFF<FFJFxTF{4FnFjF`@FZF\FbFiFt4FvFo`FvXFdTFZF]`F]F]FYtFYFc(FiFbFh$Fk|FeFbFc<FUtFSxFY F_$FhhF[F`F^pFNtFIFHFBFLxFCxF@LF>FFdFzF.FFF.FFFFZFFJFF"FFFFFFFF FFF|FFFFF8FFF FF,FFF0FFFFhFFFtFFr FkFo Fh`Fg\Ff|FbFpFuFtFx FPFFFFNFlFyFbF^hFWFPFNFQ<FMpFP|FR$FRFOxFUdFaFxDFwFnFFF.FmFlhFrlFrPFy0F|FFFFJFFF4FF0FFF{F|FFFPFFhFaFRFVFWFdLFj0Fs|Fp F|FF8F~FFFTF<F}FuFhF^LFpFx FsFoFrTFhFnFlhFfFdFhFjFhFlHFtxFtFnFkFkFlFkFmFulF,F FFwFuFiFqF}HFFFFFRFvFFTFFyFkXFZFXFY8FoFF0FFFFFF6FF||F,FJFFFFFFZFx\FqFvFq,FaFcFhhFYFXF]<F` FaF_FPFFFG FOFGF?0F:F< FFPFQhFN$FJ|F>F>F>HF@dFBFAF=FB,FQFVhF]FeFzFy$FFlFFFPFjFlFFFFèFŀFFFFFjFLFF F6FFFFhFFFFbFFFF:FFFFFpFF\FFFFFFvFFFzFhFJF4FFFFlF,FFFFFhFFFFTFFFFFFrFRFRFFyFsFx FyFvFxFxFzFzF\FF2FFFFF0FFFF~FsFmtFmHFnpFoF}FxFs\FyFwPFF>F|F FFyDFyHFnFftFo8Fm FkFk Fg FXFSTFWFUFQF^FYFT(FZDFfFsPFpFw`FFFF"FfFFFFFFhFFFTF8FFFFrFFF$FF<FF*FFFtFrFFFF FFFBF FF`FFJFqxFj0FhFiFx`FFFFpF\F[lFbFmF}$FFFFF|8F~F}FFFFrFFzF8FFFF&F{PFuFpFmFpFx<F|Fz F~FFFsFsFrFi(Fk4FtFFFLFhFFFF&FFFjFFFFFFVFFFFFFBFFFFFFFFFFFFNFF|FBFFVFFF<FFF0FFF,FTFFFFFFFF^F,F>F<FFDF\FFFFFrFFFhF6FFF2FFFFFFFlFhFfFFFFFBFFFFF>F|FFvFFF$FFFzFFxFF0F<FFF~F FFFdFFFF2FF}|FvF~hF|LFF| FFFFxFBFTF$FpFFdFF"FxFF@FFFFFhFF"FFjFFFF*FFFFXFFF8FFFFRFFF&FFFFFFXF<FFFF"FF FFFFnF"FFFFFjFFԬFFFnFtF<FhF$FlF^FZFFF܌FF(FFbFFbFBF$FF`FFFFFFFFFFFFF^F8FdFFFPFFF^FFXFFFFFFBF>FFF.FFdFrFFFFTFLFLFFFFFFFlFXFFFrFF<FPFFVFFbFF̨FlFFLFFFFF<FRFFFFF0FsFkxFn0FyF FRFdFnFF"F"GFFFFLFFF\FF*FF*FԈFF*FÞFlFF0FfFFFFGGG5G;GG*GFGdGG<G G GGFFFFLFFFFFF4FtFBFFFpFbFJFFFF:FGG kFFF F"FFfG GGGG GGbGGGF8FtFdF@FFGFdG>GFFFFFFGFFGGJG9GoGoFF݊FJFPFFFFFFGG9GGLFFFtFF¦FFF>FF2FF(F<F&F,FǔF&F؄FtFFFFFFFF\FF*F޾FG %G_GG(KG,OG1)G$G({GGG`GaGG G&G)QG,G&G!GF@FFFFGF:FڨFNFbF(FFFF(FFDF.FFFlF\FF.FF|FFF^FLFFFNF͐FFGFF̾FFFjF FFքFTFBFFހF^FrFRFFJFFFF2FXFF:FFFLFF4F@F8F`FFpFFNFTFF6FFdF4FFF6FFFLFDFFfFHFɺFFFFNFFwF\FFuFkFRFDF9$FBFCFEPF?`FC FOtFXFoFFlFgxFVFf FTFN|FE<F=F>F>F1F8FIDFg0FjLFsDFkF]FZFRFMxFCFRlFQhF:F4F@F6F8F,F(\F,FXFF ,F F FFlFtF$lF2F3F7tF1$F'FFxF/F8DӠDӠDDD݀DD`DDDҠDD@D@E`EE0EDEEE`D`DEDEE EE E@EEEPE0E DEEPDE E`EEEE'E E"E EE0EEE E!EpE&PE&E(E0pE9E<ECEC0EJETEP0ELEF@E@pEL EPEHE^EV0EOELENPEJEEES@Eb EhpEmErPE\PEQEQ@EHECE?E< E3pE6E>0E?PE=E5E:E8PE6E3E>E8@EKEL EL@EV`EYEREMEJ0EG`EM EN`EPERE[E[EmEpEjpEjE^pEgEdEn0EkpEaEeEb@EiEa0E^E]EVE]EV0EXPEZE]ESE`EqE@EE8EEEEEE@EXEEEEEEEE EE8EExEEHEpEEPEpEEE E@EEEE`EE@EEhE0E0E@E0E EEEEEEEExEpEEPEEEExEEHEEEhEEExEEEEHEEhEEEpEPEEhEEExEExEE0EE`ExEPEEEŘEˀE`EHEE`EEE(EEEEEEE E0EXE0EEhEŀEEEEEEE(EEېEEEEHE0E(E(EEpEEE`EpE8EExE8EhEEPEE`E0EHExEEĠEƘEEEȰEǨE(EE EEΠEȈEEEExE@ExEEEE٠EE EhEEEEEEE0E`EEHE@EpE(E8EܐEؐEȨĘEExE8EhEEEEڸEXEFEFE8FFF4FDF FFFF8FF<F F (F|FFEPE8EEE0EXEPEEF0F8FF `F FFFF F $F FFEEEhEXEEE EpEEEEEEEF<FFFF F F FF FPEEhE8EEFF<FDFFF XF 8F FEEEEE8FF F tFHFPFF,F#F#0F\FF F F F F`FFFFFEEF<EFFFF HF 8F TF |FFFFlFFFFEHE@F@F(FF F $FFFFF hFFF FFFLE@EEEE`FF DF FF4FF|FdFFF%LF"F(F*F,F'F&FlFFtF LF F F FF`FF4FFFFTFFF FtFHF pFFFXFlFxF4FdFF 0F\F,FpFxF!F%$F(F( F"F FXF<FDFF$FF<FFFF"FF%xF(F"0F$F*F*DF(hF%F%F"F&F%\F+F#F*$F(FFF|F%F+F+tF0TF)F,F(F'(F'F F"F!FF F F'F2F8F@F5F3F:F=TF7F< FFPFF8FJFIFbFjFc(FsFyFuhFtFm@FmFp8FexFiFeFpFfF\FXLFPPFU,FQFIF?F;F? FDFB$F4F6DF0@F-F*F&F#F,XF5$F9F7F<F<F7TF80F:F?FFlF?F9F:F<FAF8F4\F,XF*tF'PF-$F(tF/XF1F/F.F3TF3F/$F)$F&F(F(F)4F) F*F)PF)tF/F-F5F2TF9FFFH,F<F?FBdFI0FKFSFQ0FNpFGFL\FEFJ4FRFMFU(FSFRF^FkdFnFeF^PFgFR<FLFHFLFOFa`FcdFuFwFxF}8FtFyF|FxTF~FFFhFFt<FkF`FXFRTFWtFcF^Ff0FmFhFaFbFTTFNFXFUTF]FXF\F\F_hF_FYtFTFKFKpFIFSFThFXF_`F\FV8FUFS FOFJFDPFGFAF8`F7hF<FBlFGFK|FRFYtFYFTFRF`FfFbFP FIFNFMFWFSFRFQFJFOFUDFMFNFLF?F2F8pF0HF2F)F*F*F4F7tF:F;tF@pFM\FgtFmhFt8FcFZFaFyF"FF FFFFFzhFk4Fp FsFqFlFdF~FF}FqFt0FqHFnFlFeFiFpFw`FFFqFnFg F\ F\F_FlFFtFqlFsFuF(FFF FF}FoPFw0FrFs FxFkFtF|F~FqFfF]F]PFVFEFK8FWFPFN@FNFNFNLFTF_hFcF``FlTFnXFuDFFF"F<FFF$FJFFFFFzFF|FFFwHFdFhFdFrpFfF^Fc4FdF[FPFI@F>F= F: F=F@4FCFQFUF`FaxFaFnTFlFq,FlFfFbFgFbFZF[`FRLFPFO8FEFFFDlFFF@FFFF,FFFyFsF{TF2FFFFFFFHFFFFF2FpFZFFFFF`F6FFFFFfFFF:FzFFXFTFJF^FFFdFFFFpF~FFF FFXFFFrFzFvDFkPFnFnFmFj Fo`FpFx$FFFF,F^FFZFFxdF(F,FNFuFoFtFspFlXFtFp0Fe@FsF}FFF|FTF{8FuFpFrFpFFrFpFtFi FY@FZTFVPFRpFMFLFOFHFOdFYFgtFkFoFFtF&FFrFF`FFjF FFRFFfFFbFF"FFFFF`F:FFLFfFTF,FFXFF,FFlFFF0FFFFFFrPFeFbFpPFFFFF6FsF^|FbFoLFvlFF2FRF.F FwxFwFFF,FFJFRFFLFFF`FFLF{F|FzF}FzFnFyF|FFRFxFtFrFm|FrHF|(F~F8FFFNFFvFFFjFFFTFF8FF|FFFFFF@FFFF<FFnFFJFFFFF(FhFHFFFFFTFlFFFFlF`F&FFFF\F@FlFFF0FFFyFFFFPFFFFFFFFFTFFF$FXF<FFFXFFF$FJF"FF2FFFzFFF2FFFFFFFtFlFFF F~FFJF FF`FFFhFFFVFF,FFFRF:FF6FFFFFF\FFF\FFFFFBFFFFFF$F@FFFFFFF:F$FpF"FFFFFFFFFFpFFbFFFFpFFfFFxF4FFFFFFFFFƤFFFFLFFvFJFpFϪFF*FPF FTFFDFF$F,FxFFFFFzF<F.FFnF*FFFF~F*F8FxF F@FĘFFɪFFPFF"FFFBFrFVF FFF>FFFFbF"FFF F$FFZF<F~FfFF<FFF\FF>FFFFFFFFFFFߊFFFFFFFFFBFpFFFFBFFFyFt(F|FFF8F`FFvFGG yF6FFFJFFFF^FnFFFGFFF$FZFbFӐFބGGGG#G1 G<GAG,XFjF.FG;GGMGdGGGfFFFFFfFHFFTFFFFG GFrFjFܪFFG|GGG1G%FFFFFNFFG *GGG$(GGOGwFG ?GGJFFXFlG G "G dG GGGvG *GGFpF:FGoGjG3GV1G?`GVG,G FF^FF FżFFǨF6G.G$G!G`G{GGG:FFچFF.F.FlF>FFްF"F8F F՘F.FОF˸FxFFF*F FFzFF|FڌGqG G cGGG"!G0GGGG G GIGG G$oG4G(pG-GG4GFJFFGFۼFjFۼFFDFFJFFFZFFzFFFrFF:FhFFFFFFFF(FFF|F|FFFFFFFJFnF҈FLFFFJFFFF<FF.FFHFFF~FFFF8FFFFF&FF FF$FFԶFÔFFF`FFF~FPFFFFF FFVFFFF FF6FxF,F{dFWFO8FJ\F:F=\F; FNFRFR$FW,FZF_FsFFqpFYFi4FnFrlF]FJF@F6F=@F;F?FMhF]Fu<FjLFdFm@FuFahF\8FTFNF=F6F$|F$F(F!F!xFFFF FF ,F0FF$FFLF&F%F&F,F|F"F-F1lF>TD@D@DDDD@D`D@DD DDDDE EE E 0EEEEE E EE0E EEEE0EEEE EE@EEE pEPEE@E&E#EEE@EE0E@EE"0EE E&E#E2`E4E2E<E;PEIEMETET EXEHED EL@EW`EYE_@EaEWpE[EOEKEKpEJEMpEY`Eo0EuEnEaEP`EVEIEGE?@E5E>EAE8pEDEH0EF<F7$F6F:F:F@F>HF?F9tF8FFB(F>F;F8F;F=F?FAFCFJFD(FH FPFYlF[FPFI FHFLFMFP0FGTF@F@F?tFCDFB@F<F9LF4`F-F-<F(F'XF*F%F*|F.<F4F4F0 F=FD0FTF_FiF]xFO8FPF^FpFFypF|F|FFFyFadFfFcPFa FZFUFipFwFvFdFeFbF](FcFdlFeLFhFqlFoFrFhFgxF`F^TFXF]F]TFlF}FlXFa8FbFjFstF|FqFtTFrFmFuFzFh\FdFjF{<FzFpFfLFVxFPpFSFMFBFBFF(FKhFIFJ8FG\FKpFQ`FVFXXFZTFg\FjFwDFyFwF~|FDFFFFFF2F{FrFFFFFFhFppFfHFblFc\F\FOFT(FR<FH$FE F>F9F/,F3dF8F9F=FRFZ FdF_ FkFkFfFpFhHFaF]FdFXFR@FRFFFHFFFD@FD0FEFHXFOFWF[F\|F_FrFFydFaXFXF[F_PFaF~F*FFFFx@Fy|FF|xFhF*FFF|Ft`FlFqTFl`FyFr0FsFoFvFFF(FLF4F FFF FFFFF*FFFFFxhFnFVFPFIpFFFHFLlFLFP0F^FlFg4F^FgFkFoFkFZFWFZFHFGhF9<F5F8|F@LFIpFCFD|FD@FCFEFL`FTFTFZFnF,Fj FhdFedFoFvFulFFFFFFF(FtF&FpFeFcFjFtFFFFaFLFLFMFLFS,FZPFkFtFsF}xFzHFoFrFr|F{8FkFYFVF^`FYPFW,F]pFddFgFh0F~FF}pFgFfHFeFb FS FRFVFYFT\FWFWFNFMFHFGdFSF_F\lFW@FXFQTFK8FP`FYFfFfFfFrF~FFlFzpFmFa@FWtFMFSFZFhF| FFFFFxhFm\Fg@FdFi8FctFgFfFjFmFuFy8Fe<FeHFWFWdFW<FdFjFf$FZPFM FAF:LF9$F6F5F?pFAF=F=F3$F0$F,|F+F-F,LF*F/F/$F5$F:F9`F@FPF^FxFF~FFFzF|FsF~F0F.FF6FFFFFFZFFFF|FsFpFmTFnFvF}4F,FFrFF\FVFΔFFFF`FFjF FFFFFFFFFRFF"FFjFhF0FFLF F~FFnFF0FzFFFFrFF`FFFFlF]FnFbFiLFd@FlFuFtdFpFs$Fq(F}FpFFFFFFbFFvFrFwF|PF|FyxFwFldFctFeFeFhFdPFnFopFFFFFyFqFr$FsFxFrPFpFvFkFnFFoF[ FSFFFNFMFRFWF^FjxFyFFFF4FF}FjFZFFFbFF&FF.FdFFF~FFFTFF2F FF(F8FFFVFFFFFnFFFzFFFF{4Fo<FrF|4FF4FFFF|FoFnFdFFtFFFF~Fu0FvhFF>F|FFFFFFF,FNFdFFNFFFytF{pF|F\FF^FFFFF<FFFFFF(FFVFFFF$FFF$F2FFFtF$F4F FpFFF,FFFFFF8FFFxFFZFFFFFF}F|XFRF&FFDFFF<FFFF FF:F FFFFDFFFFFvF4FFFFFFFzFFFdFFFFFFLFF:FFtFFrFFJFFFFFFFF2F F6FFFFFFFF<FXFFFFFF>F0FjFFFFFFFfFFFFtF"F8FFF2FPFzFFFJFbFzFF\FFFF*FFFFBFFDFFVF&FFFFFFFFFF~FPFLFFF^FFFFFFFF4F^FFFFFFzFfFbFFɤFHF¸FPFѸFFFF|FFNFrF̈FFG/GGGG F\FFGFzF|FFFʢFDFFFF&FFFzFF4F^F˘FFBFͬFnFFF@FFF,FFNFFFfFFjF F&FFFFFFF4FF<FFFFF FF$FFɨF(FFF`FFFFFFFFpF(FFFFFFnF4F†F"F FF6FFFFF4FF^FFFFdFGNGGFFF.FFFF~FlF<GFVFFFߚFFFF҂FGGGkG'LG9GKGJGADG JGsGAFFGGF,FGF2FvFtFzF*F@F>FxF"FʖF"FFG G G FFFFG`FF6FTFFFFۺFFbFdG G6G#zGGGGgG {GGGGG GGG'OG:G1GGGGXGiGYGFFFZGcG#G;G1G&#G7G!FxFFFFFxF6F"G G)'G+G3VGGtGGG IGFFrFDFF:F:FFvFbFZFFFfFFF,FԎFF4F4F\FpFF׌FDGG,G4GGG bGGGCG G G GfGG9hG5(G([G6G G#GF$FFjF(FF֒FFϴFlFFF.FΜFpFFFlFFnF2FFFFFFFBF,FFrFFPFF6FdFۢFLFFFhFF FՀFFF"F.FFFFܔF‚FFFFFFF~FFJFF}$FNFFF`FpFFvFĒFnF"FFF.FFFFFF FFF&FFFF FJFFFFFtFyFpFZF>F3F1LF=F;XFAdFOFZFVFZF_@Ft4F|FnlF`XFkFptFeFcFPFIF>|FEEENELEZEWE`pEWELELETETE\PEmEpEoEoE{pEPE`EEEsEspEo@E{E|Eo`EaEl`EiPE^EdPEbEbEiPEgEj0EiPEf0E@EE@EEEEEEEEE`EEEEpEEEEEEExEEE@EEHE8EHE0EHEPEE`EEPEExEEEEE0EE@ExE`EEEHE(EE(EE0E8E EE8EEEPE8EPEEPEEHEE8EE`EPEhEEE`EEEEEEEEHEE@EEHE`EEEEEEͰE@E(EEEEExEEEEEPE@EEEEEEE EE8EĘEE˜E8E0EEFF @F F8EEEpEEEEEEEEEF\EEpEE0E@E٠EEEEΐE͈EʈE͈E˸EhE`EĘEEEEEEEEEEEϨEEӠEEEE߰EEPEEE0EEEpEEpEݰEpEpEHEEEEEpEpEEEEEFpF,FFFFFF F)xF/F)F+F*F(F"FPFFFHF0EEEEEEEFFE(FF\F LF F HFFFF 0F FFFEXEEEEEEEXEEEEE`EEFFFFFF`FFFF lFEEXEE0EHF\F F0FXF FF F |F hFFFFFF`F 0F F $F F F HF F xFEFEFEE`FF 4FFFFlEFLFFlFF(FF PFXFFFFFlFFF FFF TF F FFFFDFxFF FFFFFEEFEFF0EF 8FFFtFFF\F F FFFFFFFFFF F xF PFFdF lF0FFtFlFF|FF tFHFPFFFF#FFXF F $F F hFF FFFFFpF8FFFFlFF,FFFFF(F|FFFFFFxFFFTFF8FFHF!F$F%xF!\FxF%TF$F&F$F6F5hF1 F-F*F+F(0F* F)0F'F"FFFF`FFFXFFhFFF@F!pFF&F0F8F5,F<FJFVF[F\FVFTPFTFU0FQFPFRFQFR@FK\FFFDFCFBF@F=FC4F9LF5F9<F78F7F5XF1F0hF0F,F2F6TF8<F6F4tF/F6FCFEF?FJFUFL FNFR`FPHFKFOXFXFdFlFkF_F\FgFZ8F_F_FcDF]FUF\FNFK$FNFRFH0FEFHPFI@FSFR,FPFPFH<F@$FHFT@FUF]F`FepFhFl,FYFN(FD F=FF$FEFCFIHFLtF@HF<F>`FGFHFBF8F5hF7F<0F6F0,F2F1F5F5F:LFBFCFADFKFWFXLFRFL$FMDFJ0FDFHF> F?TF>(F;@F5F6F0F)F&F'F&FF"<F'\F&FF#xF+F,TF/ F6F>FPFP$FYFO`FCFC@FHFcFwFq<FkFt4Fx<FuFmFYFWFZ\FUhFK FLF^FdlFoPFh FYFM FN FOFVF[ FhFhTFkFF$FjF],FTFODFKFRFZFklFe@F\F_FdFsFohFgFdFf<FfF]FYFYpFbFdlFhFjFkFbHFYFI(FDFEFBPFBFBFF\FCFM<FRFUFPFSdFR|FVFeFF>F~@FtFsFnFs8FyFFFFytFhFnLF"FFFnFFFaFbFa0FcF[FUFGFDdFEFBF:F:F4F3|F:DF;FBFNFOFTFZFc\FbFc(FhpFbFYFXF`F^FXFWhFLFKlFDFHFIFKxFRFWFTF[FWF^$FhFnFzFlF[FX@FQFYFhXFqFFxF~lFlFkFkFoFxFxF|F{Fx FvFlF`FfFkFkFfxF`tFeLFrF}FrLFFFF@FsFpFFFwFyPFFF>FFrFrpFc8F\FLFGFAFE\FIlFRFMtFVFcpFaFaF`hFeF[FVxFMFODFO,FBlF=F;pF2F5F7F=F>F:4F8FATF=@FHFMFIFRlF`FFLFmFh$FdFvF~ FF0FjFFFFFfF{FhFZdF[tFhdFuxF|F}Fz4F]FIFN4FIFG(FIFYtFdFwF}xF|FzFnFhFgFkFiF]F[F^`F`F[tFhFjhFu|Fo(F}F{FvFgFg0FlFjF`XFVDFH FOFO<FHFCFC8FHFGF?|FA`FLFJ@FOFPLFCXFDhFHFRFW4FeFeFiF|`F}Fp FqFdPFWFKFEFJFR\FZFb$FmlFjpFx FtFp4FfTFUF^FnTFkFflF`F]FgFgTFgFjF`F^FUF\<F`FkFeFV(FNFCF>F=|F;F6F3F3F>F8F4F+xF(4F'F$\F%F*XF'F)<F3F4TF5FAHFUFh8FFFFF8FwFlFlF}`F>FFLFzFFvFFFfF6FVFVFF|FjFkTF[F`Fh(FBFFFFFFF8FRFFF~FFFFFFFFF"F(F~FFFFFFF\F$FFbFÞF°FFFFF"FFrF,F|FFlFFzFkF]dFaFb Fi8F[xFaFhFq\FvF}FFFFF FHFF|FFnFmFsFoTFmFm FkFY<F\F]<FcFiFnPFuLFr8FnFv<F~F\FuF{FtFvFwF|XFzF{tFFxFF0FoF\TFNFQFQF]FrFpFnF}FFFFFBFFF$FFF~F FfFFFF^F~FZFF,FTFFFLFFFFFFFFF<F<FFFFFFFFFRF^FFlFFjFDFF FFNF\FF&FFtF^FFFFHFFFFFFF*FFhFF^FFFFFFFFFFFFFFFhFFPFNF F.FFdFtFJFFFFF<FFfFpFFFFFFpFFDFF"FFFF,FF`FF&FF.F.F|FjFF>FFFFFFF8F&FnFFFnF F(FFFnFlFFFFF FFZF|FFFF2FF@F^FF FJFFF2FFFNFzFTF|F~FFFfFFF FFFFNF^FFF`FHFFFFFFF"FFFFFFFFFFrFLFFFFFrFFFZFFFFFFFFF<F F>FFFF2FNFFFFXFnFbFFFFFF F F FFFFFFFfFFHFFFTFF|FFFFF4FFpF\FHFJFĶFоFF2FFFhFFfFF8F\FԨFFȶFFFbFdFҲFؾFކGpGOGGGG F(F GGGFFFFnFFFBFFF`FFFFLF>FNF\FFJFFЄF.F^FFHFFDFF4FFFFFFlFFFLFzFpFFFF2FF~FFHFFDFF*F:F˶FxFFFòFFFFFnF@F$FFFLFFFJFFFFF6FDFFJFFFFFdFF FFnFjFFFF4FGiFF$FFGFFGFrF(GFFFfFVFnFjG FGGG)2G?GaGOzGHG#GG SGGIG"FFlG G :F>FF֨FFFFF~F\FFFGFG!FF FGaGGGF"FF޸FF,FϮFڐGXGGGGGGmG$ G9GG>9GEG:tG,dG*G\TGLGqqGqOG=MGG GIG G AGFG"FNGGGaG,G$#G$GF"FxFѢFBFfFtF:FGG%+G-G7GG#G$G%G%GuGFRFFPF&F*FFRFF FzFFFXFFFTFFFNF FFF4FGGGG!GnG fG GGsG yGG [G GG&G!G+G7G G|GFtFڎFּFϔFHFζFҼFF FܖFFF(F0FԼFӲFȸFFFFrFpFFFFFF4FXFFFxFFFFՎFF"FFF\FFFF,FfGGG-FnFBFFFF\FFF4FFFXFF,FFbFĦFpFʐFnF,FvFF²F@F FFlFFF&FpFlFvFjFFFFvF$FFFFDF~Fx F\pFI|FFF>F+F+F,F4 F7FFFOPF_Fa,FiFhFmFfF_Fc8FxFzFFk8F[F\8FUFf|Fh$Fv,F<FFxFnDFF}@FaFVDFFFBF+tF&8F# F!F%F&F&F*F8\F5F9$F/F1F6F4`F5F<F:TFEPED0EHEJ E@ E>EG`ELEg ERE^ ElE[EaE\0En@EyExpEnEmEnEcEPEFEGEPEYPE\E`EpEp@E[`ERE[EQESELEGEOELEG`EAEBE?PE@E>E>EI@EOEUEV0E\E[@EYE`0EdEbPE`EUE^EfExE{EEEEXE0EuEvEqPEv@EqE~E|ExpEfEnpEaEeEdEeEkpEsEwPE{EEEE(EE0EEEPEEE`EHEEHEEEE`E EEEEE`EEEExEEXEEEEEExEEEE8EEEEEE0EPEE EpEEE@EEEEE0EEEEEExE@EEEEEEHEEE@E8E@EpEPEEEE`EE8EPEEEpE EEE0EۘEE`EڀEHE0EȨEEE`EEEEE`EE8EEEExEEPEPEhEÈEEE(EE`EEF$F @FF FFEEEݸEEpExEEEhEEEEE0EEEEE EHEEEXEE0E`EHEȠEE@EEXE۰EE EHEEE`E@EEϨEEِE@EhEEXEE@EPEEEE EۈEEE8E0EXE0EШE EEɸEEEEEEF FF F 4F F FF,F1 F%LF(|F(F/ F+<F'4FF`F EEEEHEFFFF dFFFFFlF DF F F F<FF F tFPFF8ExEE8EEEEE0EEEE EE0EFLFFE`F|FFlFLF ,F hFFdEFF`F F pFFdFFFF F LFF@F EE(E`FFXFFHF8FHFTFFFdEE8EEEEPFFHF4F XFFhEFFEFFF FFFXFF8FF@FFFxFpF0FhF4FFF(FFFHFFtFFF0FFEFEEEE`FF PF lFFF8F F FF xFFFFF8FFFF F8F F F F tFFLF(F`F`F FFLF FF8FFF"LFFhFF $F F PF pF<FFlFFF,F@FF@FhFPFFFFFFFFFFtFF,FFFtFFdFFFF#F#FF F(FHFxF)F*F,F1F;F+LF-(F&F"F'8F'0F'F*FFFFFlFpF$FF \F F FhFFFF#F$F/F1F(F3PFDlFKXFRxFJFK FDFHpFF(FBFCFCF;F?F6F:lF80F7F-F0F"HF!F!FF!FFFFFF FFFF%\F0F/`F4F1F.hF) F(F%FF FxFFLFFFlFFFFFpFF!FF!F$FFFTFF0FF|F%F"F$F+F'F((F.F/F5DF3hF4dF<F1F+lF1`F2\F3 F*4F*F)F"hF"F*F'F(8F2F-F+F*F>FAF?XFIFXFQFWFKFIpFNtFIFWFWlFaFYFVFMFRFQFLFKLFYF\ FSFJFAF>F9FFF=xF9F;dFBFQ@FZFS$FLFIFFFIHFNFRF]FeFaTFbF`8FYFRF?F>8F>FHF>DFAF>F>F=F6F:F=FA8F5F0F3F3HF0lF0F%F, F-LF&F+hF:F=PFCF@FK0FKlFPFLpFGFC|F:F:<F>F?tF:F1F.`F& F$F$F"F!TFFFFF%\F<F <F"F)F+ F1F:`F9FBFJ FH,F<F7 F;FPF\F`0FdTFdFmFgF`xFVFL$FRFMhFHFEFKFPXF]dFcFLFCPFAFHxFKFLFWFYFcFxF{(FbFYLFM4FHFV0FSFNFYFTFYF]hFj@FhFfF^FR0FYXFQFQFSFO0FSFRdFXF]DF_F`XFMFCF>F?@F@FF FDF=tF@FGPFPhF[FQFRFK(FRFeFoFF|FrFiFiFn4FfFk<FnFtdFo,FcFeFyFFFF}FzF\FTFV@F`F\LFJFCF;lFAFIFK,F;F?F6F8F@|FGFKFP(FZXFd8FgXFg0FcFbF`FWFWFYFZtF]FadFTFRFL8FPXFKHFOFWdFZFPFVFddFcFZFZHFh4FfFU$FNdFOFMFSFiFr,FyFyxFiFgFbFhdFnHFs4FqFh4FlFuFv(F]tFVHF]XFdF`FX`F_FltFwTFm@Fu$FFFF{hFxFF{FcPFiF|FF FqFcF[FeTFXFOFK\FBtF@FFLFEFEFQhF[(F^F^F\FXFPdFIFDFBFC(F<F>F>F>F70F:F:F<F)F6F4F9,F8FDFC0FOFZ\FF}FsFrFiTFr,FjdFFFF6FFFFwFy\Fp0F`FYFhDFq<F{FvDFkF\HFNFIFNhFJFPXFVxFvFF@FfFF|xFhF_HF`F[FTFXPFVXF]F]pFhFyFjPFjPFuFu@FyXFjFiFmXFmF`FSXFKFRHFQ(FGF>F;$F:F8`F9F1F=FFTFJFIFCLFAFH@FOhFWF^Fa8Fd4FmFn\FgFaF]HFMFHLFGLFFdFLFNFYFltFmPFahFkDF`F^XF`FcFuFmFrF`F\F[<FZF^,F`hFTFUFSFdLFqpFyFFsFa FCFBlF=XF7F.PF0dF3F?FBLF80F3tF)F.0F*F'F'<F%F"PF)0F2F5lF9|FOFaFyLFFNFFFXFvxFudFuHFFF~F~ FzFFF|FF FFF F}FsFgFcFZFfFFFrFFFFFF*FF>FFFFF>FFFF FFtFFFTFFFFFFJFbFFFϸFFTF>F,FF,FF>FzFFwFtFlFY@FVLFQFZF`Fc,FbFlFs\FFF~FFF$FFfFFFFo,FhFkFeTF`FghFfFbFjFqFn FfFfPFt4FtTFi`FndF~FVFytFvF:F}Fw<Fy`F$FFXFnF8FFFpFdF^F_FchFeFxPFyFtF~FFFFFTFFFF FFNF`FFDFFhFFF6FJFFFͮF4FF\FFFhFFrFFFFFXFtFF FNFFpFzFZFFF`FFFFFF2FFFF&F(FFFFFFFrF<F4FrFFFF2FLFFFFFFF FFF>FF4FF|F4FFF2FvFF<FFbFFFPFFBF(F FtFFFFBF,F0FFFvFFF4FFbFFFFFFFFFF FDFF(FFFFFFFFFFFPFFDFrFFʄF(FF2FF6F*FFFvFFFFFFFFFFFFZFτF"FFFFFFFFFFFFFFFFFFFFlFFFFЀF@FFFF*FNFFvF>FFFFÂFȨFPFFFFFF<FdFFF6F^FFF@FxF^FFFF F0FFF\FFFF|FFjF*FjF$F̚FFLFʒFFF˦FȞFfFՔF6FfFbFbFFFFF FFFjF*FFpFF6FF\FHFxFĘFTFFdFżFfFFFFFF>F>FFFʰFrFF`FGGQGMGG |GFG FGGGGGG0FF$FVFJFFFF,FlFtF(F(F,FFFFFFjFF>FFFtFzF~FFFFFFHF(FFFF"FFpF6FFFZFF8FRFDFF`FFڈFF$FFFFFFFF FxFZFۨF߂FFߞFFF0FFFF׾FFFFFFFZFFFFhFfFBF<GF$FGFnF.FGG GG !GYGGGBFFFFچF$GGG&rG);G;zG*G=IG3G,G%GG6G GFFxGG dGFGFFجFFF4FNFĚF&FFFbFDGGF*GKFfFFFFRFF FFʾFRFʴFFGGG5G JGtG%5G7G)&G5`GQGHGIGXG[GXiG_Gq.GGeyGG@GGG}GmGGG BGGGBGHG(GOG FFFٸFF FFG G fG G)G,G$'G'G%[GG#G"xGVGG?FbFFvF^FFזFܢFFנF:FFТFjFժFF<F$FFzFFɚF$FvFGGEGGlGG GGFFGGgGG:GGHG G>GFxFlFF|F®FtF‚FzFFFGGF"F|FFFؾFrFF F FFF0FLFFfFFFFFF°FFFF@FFFPF4FFFFGG FF2FFFXFDFZFFF0FLF.FPFzFFF\FVFFXFF FF΄FѪFFFFJFFFnFÚFFjFFF4FFFFF F~FzFFqFXFLPF8 F3F-F#F(LF/F|FGFT|FOlFTxFVFXFQFU F2@F!F&FTF $F:FeDDEE`EE@EEE E E EE E EE E EEEEpEpEE%`EPEpEEEPE#E(E+0E8E;EF:DF=FHFQdFOhFP(FTFOhFL,FIPFLTFW<F\\Fe|F[FXHFTFMFLF@F9F?HF7DF8@F;(F9F6F6F7dF2F7F6|F7XF.`F,dF+F%xF,DF-XF*F$xF)lF'(F/F/F8<F7\F9\F=FKFDF;$F8F7F6F<F6\FCF30F*<F$TF!FxFFF\FFF@F FFF$dF&hF)F-F1F5F=FHFMtFFF;F8`F<FJFVFSHFSFShFT0FQ@FJFL FHFB\F@F= F;|FKFLFU(FM8F@@F8F>F@FG@FOFWFXDFjFrFi,F]@FWFP|FMFOFHFEFJlFTFUF^FbF_FZhFR8FXFTFO FUxFQFQ$FVFPF[TF[XFWFIF=F8F;F;F@FExFAF>FNF_TFhFh,FUFSFRF\FgFwTFt4FhFeLFuFyFl<FoHFlFh F_\FZFWF_Fn4Fv@FF{FzlFVFTHFVFcFYFS4FHFDF@FFF>`F<`F:tF8hF7FBFFFSF[FWFaFnFk(FbFc,F`PFUFQ0FSlFYFj`FkhFjDFa8Ff\FYFY|FSFUFVpFTdFYFZF_FUFHLFU8FYFQ0FMFO,FKFOFdFgFiFgFlFfF_Fe\FgFdDFhFiFc`FiLFhFXFT0FRTFYF`F`xF\tFmlFpHFfFgFs8FFXFlFn@F|FtFeFfFrhFnTFjpFgFRFWFVPFTdFHFB FBF=F=FL`FELFGHFV(F]pFX FQ FMFLFBF@F@\F>|F<F6(F7|F8XF+F2F8F7F2F'F+F,pF.TF7FAFH@FXFlXFFuFmFaXFiFxF~FF~FFFFFFpFFl,FeFS$FZtFlFs8FiFtDFdFNFFFLFIFRXFk FFFFFFFFyhFelFYFVFVLFY4FVF[F_FlFntFf<FllF|(FvFqFnF_F_\F_FWFO@F[xFfHF\FQF=F6PF+F1 F2 F5FOFRFLFQhFKFKXFQFR FYxF]\FYFc\Ff@FpFg\F]tFUFMFMFHFD,FEFO0FYFi8FnFbF^0F\F]F[Fc`FaFUFZ0FkF[@FepFfFe(F`F]F^FcdFfFzFFF}Fp FiFSFDF<8F4$F6xF>FH FLFO8FDF9F2F1@F-F,,F-F+F1F>\FFFPF]FtF{FF"FJFFPFFpF|xFFFxFo|FnF|FpFFwFFFFlFF{dFu FgFhFFnFFVF*FFZF(FF*FFF4FPFFFxFF6FFbFzF$FFFPFFFF F`FFFdFFFFFFF F0FjFrFFz4Fo8FoF_tFZLF^F`pFe,FoFa8FktFxTFFFF*FtFFFFFpF2F(FuFqhFkF_(F_FeFwFqFs F|HFF~FtFZFNFvLFyF}PF}XFq$FnFvFwFpFF4FFFFjFFFFjFmFeFbTFmFvpFtFxFFDFF8F>F4F<F FFBFF~FFFFhFXFFJFFTFFݔFFlFjFFFFF`FFvFF&FFnFFFFF~F(FFRF(FF`FFF,F FFFF FF FFLFNFFZFFHFFxFxFFVFFFFFFF~F~FZF.FFFFF2FFF FF:FFFDF0FF*FF4FFFHF FFFFrFvFFF@FRF&FFpFnFFFFF F FF:FFFFDFdFFNF4FBFHFFF.F0F FFFvF,FFxFFFžF4FFnFFFXFLFFJF8FF*FxFӒF͘FFXFFNFF,FFBFFFF*FFVF^FFFlFFFjF~FFFF6FFFtFbFF͈F2F̔FFFF"FFFF̮FFZF:FdFװF FF2FFHFFFFFFNFFFF,FF FFFPFF4FFFFF.FFF*FFFޢFF٪FFFFӮFFFFF0FF8FF4FFF@F^F"FBF,FTF*FF\FFFFF֊F~F FFFFjFTFFFG"FFFFFGvFG 2GwG/GDGGEGFFGdGGEG*GFFFʴFFFFFFFFFFFF2FF F:FFFFFhF FF|FFFFFFFFpFFXFFTFFFFFFFƾFtFFFFFFFJFF4FȸFFFFtFRFF:FlF,FײFFؘF|FGFF~FF:FRFɌF6FFFFFNFF޲FF6FFGGG G GG GGDG1G GGG FFFF8GG G'CG/}G7G7IG2G/G+G(G'GKG;G4GGGG%FXG1G G GxGQFFrFFnFlFF~F:FFTF,FGFlFFFrGFFFӤF F FdFLFFjGG\G+GEGG G-G; G4WGMgGVGS!G\fGrGzeGt]G~;GG|GG4G RGkGG@GGG GGzG@}GQ'G-GGIFF*FGGFFGG!G GG GQGG/(G%GGGGFFF`FۂF|FFFXFFFFFFߊFdFvFG'FFFFnF*FG G5GGGwGG6GGG1FjFGG=G GGG2GFGFpFLFHFF*FFTF$FPFFFG!G FFFF4FӊFFF4F~F6FFzF FFFFFF<F8FXFFF|F^FfFvFFFlFF(GFߦFFjF̎FJFF$FFFNFF.F0FFFFFlFFFՠFtFlF4FFF:FFF(FBFFFFF~FFF:FF$FFF{FyDFo8F_FRF?F1lF)F#F&F)F3F=8FMFWPFdFq\FqFf`F_lFZFlF~Fy|FtFfTFp(F6F4FF(FFFFFFFyFFuFmFV\F@F2F)|F#,F 4FF$F0F6 F4HF:FRxFYFh`F^FuFi F|4FtFp(FAF2F,F0F0FULFQDDDEEEEEE EEEE E E EE EEEE EpEE% EEE`EE`E'0E&E4E6E7EEEKE:PE60E#E+E#E'pE6E<EAE:E(@E;pECEDEKEHEH`EHEKEaEsEsEcPEYpE]PEREPpEJ@ENEOPE[E\Eg`E]EfEoExEEEE0ErEfpE\PEjEQEhEa`EjEcPEf0EhEeE^pEcEbEgEdEkErPEbEbEVEHPEW0EREN0EP0EQEVEf0EbpEc EgEnEz`EElEfPEoEtE{pE}ExEEEEEEHEExEz EEEE~E}EEEtE~0E@EXEXEEhEEE`EEpEEpEEpEEE0EEEEpE8EXEEEhEEEE(EEHEEE0EEEpEEEEExEEEE0EEEEEEE@EEHEEpEEE(EEPEPE(EEEEExEEEEpEEEEEEEEE8EHEEEEEEˆEʀEPEE E EPEEE E EEEhEhEE0EEEhEE EEEE EEوEEEEExEEEEEE EEFF<FF F FF FEEEExEPEEEE0E0F0EFEEEPEpEEEE8EEߘEېE8EEEE׸E(EEE߰EEEXEEEE EpEEhEE0EEpEEEEҀEXEEE0E(EE0EEEEEEEEPE8EEPF ,FFLFF*F!F|FtF)F+F,F1F+F&F"F(F(dF$dFlFFpEE8EEE8F8F @FFHFFF 4F F FF F,FF F TF $F F,FFFFFFFFTFFFTFEHEF,F8FFpFFlFF F F FFF F 0F(F@F`F4FtF FFF F`FFXFFFEFFFF\FEEEEF\E8EEEE EhE(EE(FF FFF LFFHFE@EFPF4F F@FFFFF F$FF F tFFEE`FFFFFFFF,FFFXFF@FEXEXEE(EFF FFF@FlFTFFFF 4F F FF F F FLF F F FFF F dFFFFF `F FFFlFF FF<F$FF0FFFLFDFFtF,FF 4F F FFFFFLFFFFF,F FFFF& F"FFtFpF`FLF FFF%F,F#FFxFF"F)pF0F2F2F8F;pF.F(@F&F'\F,DF,DF$F%FFHFFDFFLFFFpF F FLF%F&xF$F"F(F+dF(4F)F3,F2F:F5xF3<F2F?dF9F>F>tF?tF4`F*F'F%F(F&XFFF|FFFlF \F FF F FFFxFFF#F#PF/pF8F6`F.F(PF)F"FFTFFFFF F`FHF8FF<FFFFFtF&F FxF\F`F0FF FTF#F HFFF HFFF F#PF'\F"F#F$XFxF FhF<FF8FF FFtF"F!FFTFF,F<F<FEFIhFI@FDFAXFF4FMFEFIFJFJ\FCF7F3F<(F<$FAFAFApFCF@F:F;F4F7F2F2F8FChFJFM`FRFL FQxFG@FLFOXFYFbF\FX4FOpFKFG@FI FCFAF@F3 F6F0F8(F.F4F3TF/hF,4F/F20F0F-,F(xF'F)F*F'TF(F,F,`F,(F.F3pF2xF6F;FOFK4F= F8tF2F0F4F2TF3<F2F&F!tF! FFFFFHFFFFFF%dF&|F+|F*DF/F;\FA4FH FHF?F:F4\F:FF`FIFP\FCF?FHFG FEF?F;F:LF>F7\F7LF@FDFHFFF;F24F.F5FEFJlFNFT FRFjFf F[FOFBFD|FIF>F<FE8FEpFJ`FJFYFXdFYFeF`FaFUFeHFbXFY0F\4FkFeF[FW|FU\FNFFF:F@FAFEFDFDFPF[(F`(FcFh4FYFXF\8FjtFr@FrLFkFeFmdFlTFbLFaFbFc\F`F[FTFWF`Fl|FkFlFmFe FYFUPFV(FUFYFJFSFGFCxF?F;F9F:F;FE<FJFMFWF_TFj,FdFFthFiF_FZF[FYF`FlFhFrFjXF\F^F\FTFVFa`FfF[FdFe<F[FRFLFMHFOFHFNFH|FNFSFZFT\FfLFeFcFb$FdFa F_ FjDFgFbF^dF\FOFHFS FSFUFYtF_lFW0F`FcFdFoFFFFnTFvFFpFjFm$FlFlFqlF[FIFAFMHFC4FC<F=LFDFBFCFDFAFQFNFT FIFDTFFdF@HF<F7F=,F4`F.F7pF8F,xF1TF;F:F2F*F&F&F"F+F< FIFRDF\Fp,FyFl\F^(FiFzFq8FvFv FFnFFpF F8FoLFaFW<FZFoTFm<FklF_FY0FLF?F=,FLFYFnFF|F@FFFFqFhpF^TF[FQFTPF[F`FfFdpFeF^xF\FrHFtDFgFlFeFdFdFVFMFQxFe,FY<FRFLTF>F4F*PF;FADFV FYLFbFe8Fe FXFQFIFT`FUF\FfFi0Fv,FsF_ FYFTXFMFOFSFXFWFU FgFh FmFa<F\TFXF^0F\8Fb8F\FgFnFp<FzFFxFsFfFiPFedFlFFFlFFFkFbtFXlFPFN@FJdFH@FGF@FF FIFHFKF@F=F4|F9,F8F;F?`FHFXFrF}hFxF FFFLFF(FPFFFFFRF}FpF}F|FF|F|FFFFFwFuFv FlFqpFFxF^FF|FFFFFFF"FXFjFFFdFrFFHFFXF\FTFFFpF|FFFDFrFFɚFVFFFF,FFZF<F FFFFuFlF`F[`FaxFd0Fq,FFF~FFFfF FFFFFFFFFFF|F}FoLF\FX<F`FtxFvFyHFFFZFFhFF4F"FFFnFrFsFyFF^FFFFF²FVFxFFFrFpFlFmF{Fk\FvF(FFFF$FpFjFFF,FF$FdFFFFFFFFFҮFFF,F|FFFF@FFFFfFFFnFFPFbFF&F^FFFFF&FFF|F|FFFFFFFFF,FjFFFF^FFFZFFBF<FFFF~FFF|F`FFFF(FFF F\FFlFFFJF(FVFFFrFFF@FFFFFFrFF<FFFFhFFFFlFbFFlFhF@FFF<FFjF^FF^FFFFF`F4F F"FFNFFRFFFTF"FFFF:FxF$FȮF^FFFFŦFFxFTGFFFPFFF FFFFtF0FFɊF&FFFFFnF^FFFFdFF>FӞFFFF̜FFF"FF^FFFFFF:FxFFBFF,F،FvFxFF FJFFDFF"FFFFFFFFFFFFF&FZFFFFF(FFF҈FΜF(FxFFG-GFFFFFFFFFךFF8FFʌFFhF,FF6F۾FPF"F.FFFF|FڬF,FԄFTFFFžFhFŴFF~FF8FxGG2GGyFG&GoGGGNG G mG GG_GFFFPFfFGPGF:FFFHFF:FFFFBF6FGmG;FGFjFFfF|FFFlFBFFF4FF(FFDFF@FFF:FFNFFF2F˜F\FFDFɮFF۞FpFŌFFtFpFFFvFFںFFbF\FFXFFFŪFFFFކFJFGGOF*FFFFFF8FFFFFxFFFGGGG"G VG GEG%G$YGGG!!G(dG$aGGkG>GlG_GG+G5G=yG0RG.G2G*GGGGGGGG G GEG\G .GGGkF^FvFrFݺF FӄF8FFTFFPFFFFF^FFjF*FXF֖F˜F"FFFG#GG.xG'G&G1GJG7GB|GOFGKEGH(GJ~GgGGwGGGyGGBtG+GGMGG GGG~GG.DG7WG7G-kGGFDFGSGG8FFGGmG|GfGG GeGG GGZGGFFFFtFΦFFFFFF۾FFBFݸFFGGG G\FFG G3GGG'G*2GOGGG KGVFhFFFFF4FGG0GFF$FbFfFF֢FRF6FFކFFG GG GaG }GaFbFFRFFFFZFFZF°FF^FFFFFFlFFĺFF|FLF"FFFGFFFF֞FFXFɀFHF֚FFpFDFFπFFFFF͔FF<FF4F*F6FFLFVFGFBF߂FFFbFFVFFF^FFrFzFFJF~$FFn,FaLFXFGF9F)LF'F%@F,,F/0F<FLF]FhFilFFzFdF`FdpFm|FiFeFbLFjFrFxFFF|FFlF~,FFy,Fw4FFFnFf FDF-XF(F&FFFF',F1tF/F98F?PFJ,FZXFV`Fj(FtHFLFrFaFTF<FGFH$F=FCFB D`D`D EPEEE$`E)@E`E E@EEpE E0EPE EE 0E 0EPE @EpEpE$E&EE EE E/E6E9EEE:EC0E=E9`E2E-`E.E8E<EIEKEAE=EIEF0E[`E^@EcpE^EZ0E] EhEs@EE|PEiEcElE]EHENEQEUEg@EkEkElErEE@E@E0EExEyEhPEhEpPEsEEEvPEhPEs@ElEgEkEt Ev@EoEp ExEw0EkE^Ec@EUEYE_EXE^E`EgEiEoEjEzEE0EEExE{EE8ExEEEE(E EEEPEHE(EE0EEEEEEEE`EEE0EEE`EHEEEEEEEpE8EEEPEpEEXE0EEEEE@EEEE EְE8EEXE@EEpEPEhEE(EEE0EEEXEEEEEEEEpEPEEPEEEEEE(EE`EEE@EEEEhEEE@EE(EEEEpEEEPEEEpEEEEEFFxEEEEE0EEEŨExE0EEEEEE8EЈE`EEFF FF 0FFFFFEEEEE0FF0FF`FF dEE EEEXE8FFTFFFFFlFFFE@EhEEEE0EEE(EhEE EјEհEEE(EEEEEEEEE`EHEFEEEEpEԈEϘExEEEXE0EEڈEEE(EEEEHEE`FFFlF F"HF&F+F,$F&F#F%F)0F)|F+F)LF+PF(F HF dF|F<FFFEEE`FF F4FDF0FFDFFPF F \F PF FF@F FF F FFLFLF F FFF FF lF xF`F(FFF FF<FFFFFHF HF DF FF F F F|FFF F F FFFFFTF FF DF\F F <F XF\FEEEpEhEPEpEEEExE`F0FFF 0FFFFFFFEFLF FdFFFhF!FTFFFTFF@F F F FFPFFFtFFFF HFFFF FF |EF@E EEEHF4FFxFFFFFFLFFF $F F F FF FF FlFFFF F FdF FF <FdF$F`FLFFFF(F!FF<FFFtFFFFpFHFxF \F FPFXFFFFpF<FFFFdFFFFtF!FF!F@F"F!F"F%F%\F0tF-F-8F F`FF pF+F1`F84F9F>F>F7F1F*F3hF4XF1F+F'F%F"FLFFF xF(FF F8F<F(|F'F-F/$F'F)F1F0LF.F0F/F1tF3LF1@F60F8HF7dF9F.F4F3(F)lF <F#xF#hF),F" FXFPFF F8FFF LF F |FFFFFF.F% F,FBF@LF0F(F%F#FFF8FFFFFF<FF pF(FF xF!FFF+F#FHFFPF@F@FFF F FFF<F`F0FhFFFFFFTFDFF FDFF!F(F"FF F tFlF0FxF$XF3F>FA<F<FBFAF=F?XF>pF?FE0FDF<F:F8<F7F;`F>4F?pFBLF?F>F?FBF>dF;F3F.tF4F8FB FLFX8FYFQFRhFSFNFOlFYFSFShFUFMFIFDF<FBTFDtF=F5F1hF.F0F+F+F+F'F`F&F+\F+F)F-F+HF+F-\F1F,xF-tF.F*F-$F.F.F5F9FK4FKF>0F2@F/F0F6<F,F0F1$F+tF"FFFtFFFF$FlFFF$\F*TF*F3(F4tF:F9hF<FCFDFCFCDFCHFEF?F=FEFCFDTFJ|FKFCF50F9F3|F8F9F6F2F>8F;8F:F3F1F/TF2F<F;\FEFIFI\F]F^lFV8FKFGFBFBFCF9pF9PF9F?|F?TFRFTPFTFZF^Fi\FjFqTFpFfhFlxF{0FvFrFmlF^FVXFMFBFKFIFGFM(FGFG@FS(F\FhFaF`,FYFfFiLFsF|0FFqFlFwHFoFaFdpFbFZ FaFWLFPFQFaF^FbFe`FeFhFWFSDFPFNFR FPFNFH FFF?FCFCFK|FQ`FYFXFaFuF|FZFFLFyLFnF^TFX8F^FcFkFt$F~ FrFrFaFdTF`FeXFqF{F}|FslFh,FiF^FMFNXFFFF FGFDFGFKFNFRFW@F[Fc$FZPF\ F[F[FbFnFfF^,FT\FUFJFU\FYlF`FcFUFXFU@F`XFkFfHFtF$FtFrXFtHFv0FyhFlFjFp$FwFsF`FO\FH0FEFDF>F;F@F@,FCFB4F>$FG FC FJFAFBF?F?F7$F5F5,F*F0lF4lFCFBFHxFQFBF>F3F"0F$F&F-F8\FF FLFMxFbF^F^F]dF]FlFqFyFzXFFFFF~TF}xFhFlFgxFZFhFlLFcPF^FbFQFIFChFPFbFNFF&FFFFnFtFhF_F]FS@FVFf`FmLF_dF](FfFc FY<FcFiFhXF]8FbFYLFbFVFQPFKtFe F_FXFL,FBF68F4F:FLF\`FqFhFw FsF]FVFLxFWDFY(F\@Fg$FjFqF|0Fi(F`FaF_@FYhF\F\F^FVFdFoxFkFfFsFtFdDFgDFkFfhFz(FyFvF~8F}HFxPFrFnFrxFy|FF>FFZFvFvFfF^XF\FV4FVFU\FJDFHFOFSHFOFH0FD4FCF@F?F=FDtFGFUFj@FxF|FdFFFFF FFFFF6FF:FFFFFFvF.F.F.FF<FsFqFuTF{F,F`F:FFpF0FF,FZFFFrFFlFhFDFFFF.FFF"FTF>FÈFĄF2FFFF$FFЎFFpFFFȊFFFFFF|FFrFlFmFpFhFzLFHFFTF:F FF.F^FJFTFFFF4FJFFFFFFrtFo<FpF~(F FNFFF8FFFFBFFXFFFx F<F(FFtFF4GWFFZF~FFFF`FF~F}|FxFsFvXFF,FFFFFpFFzF,FXF&FFFFFFBFnFخFFF FBFXFBFFF4FFFFlFFLFFF&FFJFFFFFFFrFFF(FFF,FrF&FFXFpFFxFLFFFFnFFFFNFFFrFRFFBF°FFF,FFxFFFFFF F&FFFDF&F*FF~FFFFFlFFfFFFXFHFFFFFFlFDFZFFpFjFxFݲFǚFF€FƶFFFF|FFŎFFFZFbFF`FFFbFFFFXFXFFFFFFFFFXFFDFbF FfFG+GGFF2F"FðF.FtF&FF FӞFF^FFbF`FrFFFFFFRFFFZFF FFFFLFFPFFFJF<F FFF6FȂFRFFF֠FFFhFFlFFFFFFF*FFF~FFFFF`FFFXFFFF4FvFFFDFG G GdG 8GFxGFFFFFGFFpFFDFFFFFFFGUGFFLFDF(FFlFF(FFF|FvF8FDFLFGGG;GOGLGG aGGG GFG GGGG GFFGYFFjF&FZGeGGUF,F<F0FшFFF$FFGG GEG GGGGGFFhFFĬFDzFƒFpFFF$FFFFFFhF:FFF:FFFиFjFF~FG F\FFNFƘF^F(F FpFNFFVFFƤF FXFF>FFĺFόFݐFFF|FDGnGFFZFF^FFdFFbF̮FFRFG G eG G[G+GGGSGG*G)zGG%6G6G3MG)G#G G6G uGsGG;G4G;pG.G6MG4G(G.G1GGGGG&G+GG4G~G<GG 'GG;GG GKG GGFJFhFBFF.F GXFFFFFF FF֪F`F@F FFGG"GGG9GNGEGJ;GDGNGU,G7GCPGcGGjG}$G|GU:G[GHG6G'^GGGGGGAG G$zG1tG$mG'G!G.G]G G yF8FFFRG7GG0F<F^FG G GG CG GGG GFnFFFFbFˀFʮFFHFRFFG`GG,GG GG *G~GGG2G!GGG"G!GGG GFF0FFFGpGGGGGGOFFxFF>FF"FʜFZFG GG tGGGGFF<F8FFFxFFFޒFHFGG G"FFFψFF؎FpFRFFFFGEGGFFNF.FFFXFtFܒFF(FxFFnF FVFFBF`FFfF(FFF͈FFF>FVF"FFFDFڲFHFFFφFFFFFFFwF F}@FtFh8FhTFY8FKF9F+F.F.F4F>FOF[(FmFjFnFpHFd FgFaF`$Fg\FcFRFUF`\FehFZFgFqFv(FrLFvFjpFlFpFtFtF``FRF?TF*8F"F|FDFFTFXFF"FHF"F/F:FD<FmFiF~FWPFMFDF?FPFC(F>F=F:DDDD D E EE0E'EEEE@E@EEE%EE EEEpEE`E-E3E1E$EE%E0E2pE7`E;0E2E1E=E7E*pE+E/EApEH`EN ETEH`EHEN@ERE`EkEkEr EoEg EuPE|EEEEjEsEi0Ef`E]@ETpETEl Eq`E8E~EEEEEEEsPE~E{@EpEkEE ExEEE}PEvPE|EtE{EEEE~0E{@EyEgEk0Ef EdEoEnEoEjEsE}E}`EsEzEEEE8EEEEEEE8E0EEhEEEEE`EE0E0EE@E8EEEExEEExEEEEExEE0EhEEEEE0EEE0E8EEEEEEEE EEEHEEEhEEEhEEE E(EpE`EEPEEE0EhEpEHEňE0EHEEEEhEEhEEPEE`E EEEpEE`ExE8E EEEEPEEEEEEEXE@EѸEHEҐEPEEHEEFFFFEEEEEHEЈEEEEEEEEEE@EEFF F(FFF (FFF F 8FFF@FFFFF 4FFF F8ExE8EFEFLF 0FFtEFtEEFEFhEEXEEE(E0E(FEhEEEHEXEXEEE0FF(FXF8EEEEEF<EEFE8EEEϠEEhEpEظEXEӠE(EEE`FXF FFTFtFF F@FFLF#F.F+TF.F*F$F'F$F+XF)0F0|F,F"FFFXFFFF F,F$FxFFFlF$F#F)F%<F!FFFFhF<FF F F pF F 8FF FFFF FFFFF lFFF(FF\FFF|F8F F 8F xF FFFF |FF F FFFFF F8F @FFFFFFlFFTF(F 8F F|FEE@EEPEEpEEEFE(FDF F FDF FFFF F (FFtFF|FhFF!F$@F"PF!FpFFFF FFF F FF F F F FLFDFF4FF HF |FFEE(F\EFF `FF FtF FFFpFtFHFtF FPF xF`F FF FF FF|F FFFFHFpFF `F8FFFFFF!tF"tF!FFF @FhF F LF `FFXFFFFFFFFFF FFFhF\FFpFF FDFF%F$HF$F6F+\F"lF(F,F.DF+F+xF$F"F(HF+F-F0F6F7F2F2F38F,F3F2F),F*F&F-F#FFhF!F FFFFFF$@F,F&F/TF'0F+(F3F0(F-F-F3TF*hF1F3F6hF8(F.hF/DF* F$F(|F#F!F"<F%F!pFFFFF ,FF0FFF FXFF!F(FF<FF#F'F4hF:(F3F3F#F#FF F! FhF%F@FpF`FF'F%XF$F!F"F!(F%F"F,F&dF$FLFF"F&$F!F!F)pF%LFFF@FPFFFFF`FFF8FF@FFHFF$F$TF# FFFFF8FF!F)F7F=F<$F<0FCFAF<8FF?4F7F5FAFN|FAF@F=F> F5F>F>TF@|FHFWFVDFNFRFF<FKFHFP4FWFLFSFPFOFIF@F>FF7LF0F6F;F54F5F0F2F6F5`F2F/XF/tF(F0dF70F=DFL,FQFU4F_F[\FMFK(FFpFCFC`F>F5F<F? FIFK`FNFPFVpFklFm$Fy FF~F|FhFF0FzlFrF` FdFShFKdFH,FMPFM|FP\FLFHFKhFUF[0FW|FeLFdF[FqDFxF"FHF(FFXFFhFX$FTtFU8FWFNFX8FcFd4FbF^F_F^hF_FUhFJ FLxFRdFWFOFLFLFGtFEFAFAF@FNFWF^(F_FnFFFFFwFuFkFb4FaDFiFuFF&F{dFxFjFdFnFuFFNFFNFvFtFsF`$FSFHFFFB,FMpFFFCpFJFLFT$FNFTFYlFZF]$F_FdFlXFgF]FU@FTFPFTLF_F\FZFW4FdF[FYFbFlFylFF}F|FjFtFFr\FfFlFvDFoF^pFM(FN\FEFAFBxF;$F=F>F?F<F<F<F>FE4FFpF7F>F6@F5F4F0F*F+F2`FIFP<FM\FZFOFB F9F1F*F%F2`F8F6FAFOFWF]F]F[F\F[Fa FgpFvPFyF}lFlFFjFkFfFf4Fi,F[FaFlxFf@F[F\`F\LFMFIdF_TFv(F^FhFFFFF6FFw<FlF\FXFZFcFiFiFd8FaFaF\F]dFgFgFYF\8F`hF]TF]`FXF]FhFcF]FKF>F8F9 FB,FWF^dFvlFFw`FodFd(F]FRLF_PF]pF^Ff<FkhFvFyFoFiFnFlFcdFWdF^8F[Fe<FF&FF}FFFx FyXFwhFxFxF}FsF}0F~FRFxtFxFFFFFFVF>F.FqFlFcXFR0FP FIFGFPFVFZDFSFW0FPFPhFGDFBFGFN4FL4FV4FbFuF{FlFFFFFFbF:FFFFFXFFFnF2FF&FFt,FFFlF~8FF\FFFFF>F`FzFFF(FFFpFFdFFpFFFFFFhF:F6FٮFFpFF"F@FҔFfF$FhF*FGlG7FF,FF&FFXFF6FFw8FuHFFFFRFFFFFF F|FXFFFFFFHFVFFjFJFvFhF"FF@FFpFFF:F|FF4FFFvFFjFdFlF~FFdFjFFFF܊FF FzFFFFF:FFF{FwFwF"FFFFLFFF"FhF`FFFF$FFъFŶF4F8F4FdFFbFӸF,FF F|FFrFFFFFFFF>FFZFdFFFFtFŸFˬF F>FF FdFFtFFnFFF&F>FFFFhFFLFFFFFFF@FFFLFFBFFFFFrFFFtFFFFʆFF<FpFئFFHF.F(FFFbFZF~FLFFFF$FF:F FXFFxFFF˪FFǦF8FFFFʘF"F FFFFFFFjFxFnFFDFF$FtF\FFvFlFF FFFxF F|F2FVFFG UGGLGGG TG}F0FFFϠF>FXF0GFFHFFFʺF<FF4F.FFFDŽFF؞FF8FGGG9G xFFF.FFFJFFFF@F̚FtFF8F܎FDFҤF F–FFFLFFFѰFںFFFFFLFFFFFFFFF0FF@FϤF,FG7GG"GmG wGG2GG NFFGGG0GF2GxFFGGGG G NG G=G FFF״FF,FҬF4FFGFG "GGG &GVGGGGG GGiGFtGFG GXG dGG FFFFFFFG GGG @GnF,F,FFFFHFG-G GGGVGGuG G*GF>F FBFFFFTFFٲF,F FFDFBFFF6F(FF&FlFDFڢFFvGGGGiG ~G%FFFFFF(FnFNFF:F:FFFFTF^F@FPFG5GFFGGGFLFFFӠFF:F̌F F<FGG G8GGGG GGG*DG'G"qG!G0NG&$GGGGSG GiGG$G6G/G-G*|G.SG.G-G,G!G#GGGGG:GiGFG}GGG mGGcGG2GBoGF>FFGFG GUG'FBFFFFlF2F<FFFGRGCG{G&G%G:G@2GPG@kGFG6sG8G9 G9 G=tGRGkoG|GsOGUmG8UG:G8G0G.8GGGGG.GG$,G,GGcGGGGuGYFFFFFFTF,FFFFF|GKGGG kGG G G GGFFFFF*FLFܪF8GCGyG|GGoGGGRG$GpGG,G9(G+G bGGGGGGGGGGFGGGGG G "GG G 5FF(FLFFОFFFGFFGG[FGGjFFFFFFFfFF^FNG #F FFF4FF6FFFF۞F GGpGGG |G!FFFHFFJF¨F6FþFzFF2FٶFFF>FFFpFFFF"FFʶFҔFF0FFNFFtFȆF<F̀FF"FҀFF FFFFPF0FwPFnFlFjFcFY FWFV FCF3F/xF9FFFQFSFflFoLF]FjFj\Fc FTdFQFaFS8FG4FBF?F?FCFBFOFWFYFXFd F\dFcFfFaF\FHFCF/\F FF F<FFF(FFFF'F8FBFQFP`FPFGF5F:HF?$F8F4 F9F;FDEEDD@EDEEEpEEE `EE E 0E%E4E+E!E!EEEE0E&E)E9E1E+pE!pE2E?E1E9EFpEBE@0E;E-@E#E-`E7EKETE_EYEUEMESEiElEq`EtEEwpEz@E0E`EzPEpE}`ExEgEzEtEl0ETE_Ei0EEEEE@EE@EE(E{ExPEEhEEE8EE0EhEEEhExEXExE(E EEv@EuEmExEt`E|E~EyEEEEE EEEEPE@E8EEXE EHEEEEE0EEE0EEEEE`EEEXE(EEE8EEEEEHEEEEExEEEE0EEHEE`EEE`EEEEE`EEHEшE܈EEEEEEEEHEEE`EhE EEEEE8E(EEEEϠEϐEHEPEEPEEEEEEEE8EHEðEPEE EÈExEEPEPEHEhEEEPEEEXE˨EEE ExE`EFFF F FF xF\E0E0EEܨEΰEEE EˈEEƀEͰE`E@EEFPFFFF"xF#F%F)F F$FlFxFFFFF(F 4FhF F hF`FFF FhFLFFFTF F E@EFLE0EEFFLFEFFxFFF$FE@EEpEPEE0FFF $F\F FTEEFFFFFFEFE@EEEE0EE۸EXEE`EFTF`F8F,F$F <F F 0F hFFFF F'F/hF0F-F'F"F"(F(<F.F+F(F$(FpFF(FFF \F FF FF FFXF)F/(F2 F08F#TF"0F4F lFF<FFFFDF hF FxF FFFFFFFF,F FF<F |FFDFXFF F@F F FFF\FtF(F FFFFFFFFFF$FF FLFFFlFpF FF F0F F |FEEEE@FTFXEFFFF xF |FtFF!FFFF F F FF`F,FF#DF)F(LF%F(F"F#,F#F$F!F#XFXF|FFFFpF4FFTFFFFFF F LFtF0E0FFF F tF FFF$F8FF"FHFFFPFF F F F`F0F<FFdF"F$F&F FPFTFF<FFFFDF@F$FF|F-F&FFFFdFF PF`FdF FHFFFFFFlF0FF <FFFFFxF F F#F#F)\F-\F*F/F4lF/HF)F*F-F,F.F+F&@F!F"F(F&F*F0F2F1F0F0F3@F4F.F,F&DF+LF,F&F @F`F#$F%F%`F!F F0F$LF$$F(XF/F.XF+F*F'0F.lF+xF.lF2F+F.pF.F0F8F,F)F$F FF" F!FFFFFFHFF FFFF`FFHFFPF F%pFF!DF,F+F0,F9F=F5hF1$F*F"F%tF'F$F$F FHFF!F%F* F-F'F$F!F'F/`F*F-F&F(DF(F.F-F&|F&F(F!FFFFFFFLFFFFF'lF#8FFFF"xF!F(XF#F$F F FtF F8FlF)F84FDTFE<FHFHFEF?DF8,F6(F6F9F7F=XFAFLFIhFKFEF?FA8FHFNFFFDFS`FLFGFBFFFE4FPFYDFZ8FW FPFTFPtFPFQ(FTFJFM\FOFF FK$FD`F=<FBFD0F8F8F0HF+F)F+F/F-F2F0F/F/0F/F6xF8tF6F4XF94F6F3F2@F+F,F-PF-hF0pF;FBXFEF@$F:F/4F*HF)PF$F$ F)F+ F&|FhFxFFFFDF8FFF F-F0F=HFUF?F;F;F= F7@F5F>FDF?F<F@FDFHFJFQFNlFNlFIF8F5F7F6F4`F2F1F-<F,F2pF2XF:F3F-@F)tF3F;pFWFXlFVFa@FZFTFI FLFHFH`F@XF<FDFGFMFUHFUFXFdFv`F|8F}FFFFFFFyFf0Ff0F_FUpFJFDFE|FHFLFUFLLFJ4FK\F[FaFmFlFgFnFuF.FPFFFLFpF]F]FUFWFZF_@FcFz0FrFfFeFdFWDF]FX|FU(FUF\F[FYpFSFMtFLFHPFB4FEFGFQFWFa|FpFwFF"FFF}\FwFiFdFe4FhFvF|FFFFFFF0FrF FFzFFFFpF_FKFL FQFNFBFE(FM0FNFQFOFQFX F\FfpFfFdFaF_F_FUFVF[0FW\FY<F_8F`F[DFX F](F]0FpFrFyFFFF0FF2FxFnPFnFm(FlFfFSFQFFFD`FCF<F6lF;(F=4FFCFEFJF?,FBPFGFFFBdF=F<F7F; FHFS FZ<F` FOFKF=F8$F/DF3|F7F@F;FDFKFXF^F]F\FRFIFExFYFsFFzFrtF}FopFdXFXlFaFaFcFaFhFd(FZF^DFQFMFTFiF{FFFFF FFFFFzFkF^F\FiFn(FsFmFwF|FsFeFcFeFaF\$FRFUFVFgFm0FeFiF\FMFE<F8F;PFH|FLF\(FoFzFx$F|pFv@FhF_FaF]F_0Fp0FsFuF{|Fo`Ft4Fy8FlFpFkFvLFtTFFFFxFFHFHFvFpFF0FXFF<FFyFFFFFFFF*FFFRFFFoFgDF\F[FGFNFVFaFeFhF\FWFQ\FStFJFPFQFWtFeDFsFvF\FFFFFFF6FFFF FF FF~FFFFF>F"FFFFFhFrFFXFNFnFFFF8FFFFFVFFFFFF(FxFFϰFBF|FFF͈FFF:FFFFF<GcGFFެFLFvFFFFFFFFF:F4FFFFFFFFRF.F&FFFF0F:FFFFFFFFBF<FFDFFFFFF>FF6FFvFFJFHFFF|F8FFFvFLFFbF$FJFFF|F2FFTF"FxFxFFFF4FNFFFfFFFFǎF2FrF8FxFlFfFFjFRFF^FF<FF|FF"F FFFtF(FDFŤFbF FFFFFFF҄FFF\FFͨFFxFFЪFpF:FFF~FFFFFFdFFȴFêFbF֠FFBFfFFFF.FFNFݪFFF|FFFLFHF F6FFG%G2G!FFFFFFLF2FrFVFFFFFFPF(FFFFFFFBFFžFTFFFżF>FTF&FlFFFFFF<FhFFFFDF>FFrF4FFÜFFFF,FFϴFFGGG@GGGDGLGGFFFFFFFFF G,GGFFJFДFF0FFFFFF*FFFdGGnGwGGG G G F,F|FFFFFFFFFFFFHFŚFFzFրFFFGYGG*G GFF$FF FFFPFdF,FF,FFղFFGGG*G G.G#>G?GGG FGG GlGUGG#GGgG GrG GG"+G+G1GGG YGF\FFFܪFF0F@GGrGG%zG%G4G9G>G&G"GG wGGeFFFFFtFGG &GFHFFFJFFtF.G GiG GGOG GGFFjGGGGsG'GBG12G'GG)oG",G FFFFF FFFіFFFF"F<FvF FF`FܚFFGLF G G|G+G&NG)G.KG*.GG _G F GF2FGGG3GnFFFFtFΐF FDGG jG G pGFGdG G ]GFF FVFF,FGFFG G GGGG/G G G$GG"G"`G)G8G2OGGGG MG hGGXG#G+G&*G4GG*MG7G#G+\G'&G"TG G-G"GG5G&GDG FG GGgGGG$jG=G$G!GeF,FFFG GuG GFlF>F4FhF*F<FFGcG+GyG$G@ GSGoG[GYG]GKG:"G4LG7.G8GNG`GcJGoG[GDGG!wGG#GDGCGoGGGG aG-:G+ G GGGGGGFFFXFRFGCFFF4FFdFFfFF`G OG mGGjG G ~G}FF\FޤFF2FԚFG,G2GG GGGG<GGGGG' G&G!GGGGGGGG GGEG vG G G GGGG+G aG CGFGRFFFFFfFFFGGGGG ;G@F>F2FդF݄FڊFFFG FFFF|F8GFFTFFFG G$GG GF*F*FJFΆFFFFFvFFFF܌F*FFFF,FFξFF"FxFFF$F:FдF FF&FFZFFFFF0FjF"FFfFFFTFvFpFYF^FcFeFaFgFvtFd@FHF<F9FBFL<FL0FTFYF[dFhFeFh@F\FUFLLF@F=F88F,F0F1pF1`F>8FHF?LF5 FAFJFUTFTFVFKFH FAF/XF$pFF,F$0F$F!hFF#dF!F(PF,,F<FDFG@FPFN(FHFBFAF6F7F:FGFKHFAE"@E"@E E0DE E`E E EEEEEE"E&E.E0E,E!EEEEE PE2E>@E=E2`E+@E3E;`E@`EAE>EAE>pEFE6pE3E-EDEKEWE]EjE\PEOEaEgpEu@ExPExpExE0EEEEPE{ EEtEqE~EE8EpPEm@EdEzpEEEEpEEHEEExEEEE`EEpEEPEPEE0E ExEXE8EPEEEEE}0EEE8EPEEE8EEEE0ExEEEEHEEPEPE(EE@EEEEEEHEEEEEEEE@ExEhEEPEE@EEEhE8EEEPEEEEEEEhEEEEEEEPEHExEEEEEEEEFEEEEEHE8E`EEPEEpEEEEEEEƘE`EԨEhEӐEEƸExEEEHEEpE(EEEEEѨE8EEŨEE0E0EEE`EEHEEhEψE(EXEܰEE EEFtF FFTFlFFFE`E8EEEٸEָEE8EظEpE٨EE0E FFpF lFHFF$F,F+F1F*F)|F&pF`FPFFlF FFdFFFtF,F0F4F0FDF FdF\F FF 0FE EEEEFFFFxF LFLFxFF8F lFDFFEXEEE(F FDFF DFFFPFFFF $FdFLF F FFEEEEߐE(E EFF\FF <FFF F<FxFF F F%F'F\F"pF,F-F5HF0F+F-F(,F. F6F4F1F'F%hFFF\F FFtFxFFF$0F-F/F4F?F;F0\F+DF%<F$F*0F"LFFFDF4F8FtFtFFFHF\FF#F@FF FlFXFFFF F FXFFFFFHFXFdFFFFFFFF,F!F#FF4FFFF$FTF"@F#$F%pF!FFF(FF F FFFEF F `F ,FFTFFPFF&DF.F.F(F FFxFF@FFxF# F+dFxF)F'F!F#F$ F$F"|F)F0F&F%F!F,F$HF FF,FF<F!|FF4F`FPF$FFF F F FdF FFF`FFFFF!FF 4FFFFxFFxFFF$FDFF&|F#TF&F-lF&FLFlF0FFFPFFFXF$F F F.F"4F FhF`FFF FFFlFFhFFlFFFFFFDFFFDFF!F%pF$F&F%pF3F<F9PF;F:F3TF2 F.F4$F,tF+F&hF%FFF"F"F%F'pF(F-lF44F4F/(F1F,F,<F.4F-F*F"F)F+F- F-F6lF2XF.F+dF3F8 F?F6F2F.F+F(F+|F*F(F)HF*F3F/F7F-`F,F*DF#FFF!F!F FF%F%FFF FFPFxF F F\F(xF1`F.LF&F%PF%TF*F4DF+F14FAF=F5F0F,F'F(8F'dF(F.<F*F FF!F(F/F2\F'4F%hF-F-F*TF*F0dF1F/F*HF,F*FF"hF HFF#F!F!FFF@F F lF$dF*tF+F-TF2F)F0F/F1F* F,F(F"F$F#FFxF%F2F7|F@dFIFEFEFC|F@F>HF5F4F6F;FCFCFNF[<FcxFWtFMHFLFJFJFOFTFZFTFXTFRFTTFWF`FqFqlFdFbFVhFTFQFR FNxFLFKFSFMFGFBlFGFG FEFIDFDF8F.F+TF2@F6F8F=F=F5F5F6F9FEFKFFF@ F<F;F=F4F.F3F,HF.F9FA0FL FBhF=F2F,F,@F&`F)F.F-F$F!F FFF FFFFF#F.F;XFMPFLFJdFB<F6FC4FFFAFI@FJ\FAFA FHhFOFLFMFO`FUFUPFMF?F:<F0F4$F6LF1F1$F/F.\F2F3xF(<F(F+F(0F3pFB\FRFXtFSFVpF_FWFSDFIFQDFLFD FKFLFOF\0FdFdFoXFnFoTF{FFFFFFFFxF8FsF`FSFOF@xFCFJdFHFIpFDFHFMFZFmFkxFglF]dF]FkF|FBFJFFTFFdFhF[F]FaFfTFmFbFF$Ft0FkFbFdF^LFeTFVF]0FeFX0FVFXTFX FL4FKFJ8FFFKFqFyFpFzHF|FnFFFw|FlFeF]F`FnXFp@F~hFXFFFFFFFF*FHFnF>FFFFeFRFT(FN\FNFCFCTFCFQLFSFTFRxF\F]FbFgFaFcFbFeF`FWFUFUFZFh@FxFfFeHFlFzpFFfFwlFRF|F(FFF4FF@FyLF~FkHFgF]|FUFJ8FH\FDF>F5PF44F8F;F@|FAFIlFKFUFMDFPlFKFQFFpFKFUXFYFGFUFhFuFstF[FRFNFCF=LFEFG`FVFSLFH FQFS`FVFYFZFItFAF=DFSdFuFfF|HFxFwPFvFb\FW4FTFZF\FdFiFbFaF\ FVFOFZTFi`Fz,FFFFBF"FFF8FFFoFgF`FdFrF(FLF@FFFpFdFclFbF[F\FcF^F_FmFmFsFjTFUFJFLPFDFEFRFbFtFFFF{hFoFdpFcpF`F`FlFyF|PFFFxFwFzF}F{F~F~FFF~F4F4FF2FF~4F~FFF0FFFFF4FFTFzFFFFFtFdFFFyFtFsFbhFWFKF]F`LFiFl<FmXFc@Fs FvF_F[pF_XF^FeHFqF~tFFvFFVFFFF*FFFF FFFTFFFVFFHFjF<FFFFFFFFHFF~FFFFFHFFFpFFZFbFFF&FFFǸFvFF FFTFF\F&FFFLFFFGFFFBFF6FFFdFF"FFFFFFRFFFFFtFFxFFFFоFdFFlFF4FFnFFFNFFFFFpFFF\FFfFFF"FlFHFFFFrFFvFӶFG=FF&FJFFFFF8FPFFFF F FfF~FF&FFFFȞFΆF0FXF@F$FFF״F֜F FF*F*FFFFF>FFFFFFFFºF:FFԌF֮F|FFFNFFF F4FHF6G2GFFbFFLF.FFFFpFFvFtF$F~FFJFFFFFZFTF$FFGGWGFFFfFFFȘFF˂FhFŴFF¢FFGG [GJGGjG@GFVFFʰFֆF FFFF4FpF$FFFF.FLFFFF,FLFrF@F8FFFFF`F,FFüFJFFˎFFȰFFnF0FfFF~F@FF˞F2FĒFlFFFĠFFۀF`G`G%GGG3G/G`GLG F"F&G:FFRFFGG GGG-FFJF FF@FǴF6FF FFNG GGGG7G}G#GGvGGGFtF,FF$F~FBGFFFFFdFvFܸFFPFGG "GjGGGGhGFVFxFϾFF6FnFF FFFF$FȺFFGGG G'WG6G1JG3G*oG!GG+G/GFFVG;G NGGGG(G4G<7G:}G>G.G*G$GGFGFFjG G&GGG&G;G3GBhGF!GMZG;G0GGG FFF>F`FF&FFG G~GGFFXFGGBG%G*GG(G#G7GAG:BGVGG _G'G?GG>DGKG%G-G2G%MG&G1G-G\F FFGGPG`F޺FFFĐFFFFFvFpFGG+GGGG[G1G9DGCAG;1G/1G7G!G-G G 4GtGYGFFGGGFFpFFZFHG GGGG&GGG DG G IG G5FxGG G ~G'GG"~GGG$G&GAGGG %GlG NG{GG1GG6wG6[G.G2G\GGG2G G8GFGGG G-G5G/G0G0G4G)PG*dG%G"GaG#G]G ^GGF`GGGG.G?G1G"GG7FfFnG 'GGsGGF6FhFzFfFzFXFFTGnGG$G:G?GhGM8G^G]:GfGq GS?GBuGJGDGGG<`GPGRGNG[G:JG GGIGG G GGGGG*mG-G G~G(GGGUGlFF|FFFFGGGFF0F FFFF.GvGGGxGG |GjFFFtFFFFdG fG)GyG 'GGGGGGfGG$NG)G"dGGG#G G#ZG2GGG@GG9GGnGG HGF(GG GMFrFFFFFFFTFlFF0FFGGGG GG G%F,FFFFFdFZFFFFGFFnF^F GGG!zG*G$G&FdFdFFF0FFDF(FFF*FFF^F.GGG8GF|FFzFfF|FFFJFFdFHFFFFFFFFF\FvFdFF\FzFv,FkFi8F`dFfHFcFiDFmFy F{xFkFlFcFFFDFAFATF>FRFgFeF^F]FQFOFBF@F9F5dF0F)F(@F"F.F14F(F%F/F>FBxFPFPFLF=F(F04F%TF"FF&,F)pFFF"F. F7F7XFA$F=<FBFVHF\FJLFNDFL8FIFGFV8FbFPFIE&E&EE EE EpEE+E"E#`E!E%EPEEE&E2E4EE@EEEE!PE,E9EAE70E.E;E6PEJELEFEIPE;EFEIE@@E<E9EHEV`EV E[E`PEWEa EeEnE|EEyEEpE@EEPEEhExExEEEE{@E~@EuEwEEEEEEEEEEE EEhEEE(E(E EEHEPEEExEPEEEEEEPEEEEEEEEXEEXEEEPE@EpEXEEHEE(EEEExEEEpEEEXEEXEE EHEEEEEE8EEXEE`EEpEPEEPEEEEEEEEEEE@E EHE EE0EEE(E(EEEFpEpEE`E`EEE8EEXEшEEXEEEEƨEEEE(EpEExEEԐE8EϐEƐEEEEE EEpEE`E8EEEE8EEEpEEҀE(EEEEhFEhFEFFFFFF,FF F|FEE8EEpEE(EXEXEEEEHFFLFFF(HF"F&F5F:F4F3hF/F*HF(4F#F!F!F'F#TFPFFFpFFFHFdFhFTFF4FFF FEE(EHE0FFxFFF$FFF|FFFF F FFFFdF$F@FDFdFF F FFFFF F FF F FEEEEEEFFF F<FFFPFFFFFFF%,F0PF0,F,F3TF;F8F; F8F3F.F30F<F>F6F.HF$@F&F+F*pF'FF|F F!F)F2DF8F5FAFAFFF@F1F1F6F1LF/ F%\FFFFFTFFFFhFF&F,F"pF$4F F'F"F 0FFF@F\F<FFFDFF|FlFFFFF@FF\FlFF0F tF$PF#FFFFTFF#F"F#F&XF FpF<FdFdFF|F dFdF FFF"LF#F!(F&F F$F/F0@F4F-$F$hF!F!F!FhF,F`F($F-F,8F$F'FDF FlF$F F F-F*PF-hF$F(F%F!F!TFF$F`F%F)F#F FTFF |F"\F FFFFFF F F(F'pF&F+F+F*F'F%F(F/F1F.lF"FdFPFFF F(lF(tF0 F0LF-XF"pF"FF FXFFFFF8FxF F!F&lF'F'F'FF FF"0F$F$F"F$,F!\F,F0FLFF|F<FFXFF F#F(F),F*F*4F,F2F1F8XF5\F5F5$F8F2F/F*,F(xF)XF%FF 4F FdF!4F%|F(F1F4(F2F7F38F2F8F7`F7tF0F3F1LF-F3F8XF<`F=PF@dF?dFFFNFLFM|FH(F<F3<F1F/F1F+dF)F-hF, F/F0\F1LF-,F(F$F#FF' F)F)8F&lF"F$F!0F$FFF F F$FHFF/xF8FE F>PF5F6F1\F5F7F0<F0F@<F>XF5F/LF* F+F-$F,F/F+F* FF*F)4F0xF0F+F'xF/F20F/F-,F+hF0F4F,F)F&F |F F!F F8F!F F F pF&TF*F6 FA(FA8FBF8F7F4XF;PF:F;F6`F2F7\F3PF.F)F1 F*DF.F78F?F>FIFFPFCxFDFCpFXFZF]F^FYF^FXPFLTFJ\FH$FRFXTFdlFrFz$FoFzFt\FtFXFFF8FFF.FFFFgFi(F`DFXXFMXFL$FNFH(FM(FKFLFMFVF_FfFjF[hF^FllF{,FF0FF~FFFrFgLF`FZFhF~FFFlFF<FHF|<FrFtFcFaFg(FjFcFZFYFP FLFDFHFOtFnLFr,F~FFFFFFFk4FbFbFf FdlFlpFFFPFFFF.FF<FpFFhF^FFF|F{FkFaFSFTpFOFHFMF]F[FUFR FV<FcF]FatFhFZF[FexF`|F[FXDFTF`Fb FiFndFhXFzFVFFtF~FF0FF$F|FFF|Fx|Fx,Fs4FkFZxFVXFPhFDFFFAF8LF:xF: F>FDFG FOFPFZFYFTFJFTFWFZF]xF`FaFe Fy FFXFu\F`FV@FYDFZFeFltFuLFn$FZ<FX0FdF^FXdFMFLPFFFHF\F FFu@FpFtFtFoFeF\FYF]FflFnHFaFa F_XFaF_dFk@Fj<FFF~FFF&FRFFFFFF>FrFo8FcLFk(FFdFFBFFF$F| Fj`Fg@FgFjFeFe8FglFmFoFsFnHF]FOFQFLFLFYhFgFsFF<FFFFF{FuFqFtFyFFFFxFxHFwFyFXFXF,FFFFFFFF@FjF FNFfFFFxF.F FF$FFFBFPFPFFFbF$FFhFrFu4FuFhPF] Fa$FiFTFFpFFFFqFjFp<FfFaXFjF(FFFFFFLFRFFFF^FFFJFVFFxFFFFjF8FbFBFFdFFF\FLFFF(F8FFFFF0F$FF~FFPFFFFTFАFFFFF FFFFF,FbFFFXFFFFfF F*FF(FvF,FFFFFFFFFlFFFTFFF~F0FFFFFFFFFFnFFFFFPF FFbFhFFFpFFdFFFFBFFFFFF~FGGFF݆FƲF,F FFpFF`FFFF<FFFFzFFFFPFFzFFFZF@F8FFڄF<FΆF:FLF>FBF$F0F FFFFFVFF FZFܶFFFFFFF~F&FFFGG yGG!FdFFFFNGFFFFTFFFVFFFlF\F܀F FGF*GiF$FG GAGG~GG#FG?GFFVFFFFG5GGRG PGGGvF܂F\FFFGFFF8FFFFʖFFFDFFFFF2FFݮFNFFF`F(FFтFŐFFpFDFXFFF<FXF0FFvFFF^F$F,FF<FFF>F FGnG G*G6nG5}G.G%bG%G'.G&=GFGG(FFGGqGGGEG GF|FFFZFdFGFXFBGoFVGGG 9G"sGG*G\GGGGFFFׄF"FުFF`FRFGGG FJFFFلFGGG GG5GG$ZG[FFFbF;FFΒFܒF2FFFˎF F~FF߲GGG$G%PG3EG5?G6G*G0GDGEGG BGYGG GPG G6G4YG8BGMG\GNGZGX!G}GNWG-4GGG_GG KG G GGG&G-]G6G:G9G4G/G)GG}GFFFzFjF~FժFڦFGGG(GGG`G>GGOG!VG(G(G8G1PG,=G9KG2(G17GGjG,RGGGP GSGJkG?PG5G;GKGCG*G<G <GGG0GiG FFFFFF8FF8FȼFFGGG GGG!1G:GQGBGeeGCGIGIG2GVGGG -GFFG]GCG IGeGGFFGG(G GFG%GGG.GGGG GG"G G+G2-G/`G-G)G9G)G%GGkGoGaGyG#jGXG0G.sG-G2G2G.VG$G$G$G8GBG GGG GG5G4G"zG01G<G-KG)G wG" GGGG>GGaGG GGKG2G3LG9G%G2GGF8GGGGGGGFFFLFFG-G <GnG0)G9.G] GMG4GAGH&G_G`hGjFGi=GSG>(GRGMGC*GCfG:GHGUG= G]GvGrGGGrGG/GG|G'G#DGGGxGG6GwGG[FFpFF0G 4GG GG G-GGG XGG GGGG"GlG+GGGG{FFFnG/F"G 'G G&G GlGGGGG>GHG KGNG)]G%@G5G#qG 2G GGNGvG"G'qG0GtGG%G GFFFGFFFFFFߊFѢFǼF@FFFFfGG?GG G'G GGdGGXF$FhFFF2FVFtFFG G GGZG SG GG,G8GG ^F&FFTFF.FFvF"FHFF(FF G GAG ^GG GF FFFFFF~FZF>FtFFFHFFTFϼFFFFHFFNFF}Fp FlpFj`FglFhFe\FaFlHFuFtLFgFyFjFPDFD,F7pF8F:0FAFW$FVFQFL F?LF=F=F:F5@F/F0F(|F)PF&XF+F*F)F F'\F+F9\FKLFEF@F=F'F(F&F F!\FF"tFF8F"F%F3F3F3TF6FDFK FcFNFLxFR(FLFBFW0Fj@FaF]EEE@EE EEE0E EEPEEE)@E-E!E$`E&E-0E0`E"EEEE&PE/E=EIEFECE5E=EEEKEP@ELEKENpEO EM0EEE>0EBESEX@EWEREZEbEfE_EsE{E}EXEE EPEEEEEEEEE}E}Ex`ExPE`E8EEEEEPE0EEEhE8ExE8EEEhEEEEEEHEEE@EEEEEE0EEpEEExEE`EEEEEEEEE EEEE(EEEEEEExEEEPEEEEEEE0EEPEEpEEˆEE8EXEEEEEpEE EEEE(E EE(ExEΘE8ExEE`EF,F<FtF(E8EEEExE EHEEhE(E0E0EEpE EPE EȨEE׀EEרEظEpEE0E8EEPEHEpEE@E԰EEݐEpEXEpEEҠE̘E@E0EXEEhE@EhEEܠEEEF0F F$FF|FFFxFFhFDFF FE@EE8EExEEhEEE@F|F4F HFFFtF.F5dF0F8dF:FF?PF9F?F>F=F> F7PF5F3TF;F>8FAFZFYFU\F]FWFf Fg(F]LFNFF8F?hF4F6F6<F1F.F.HF2|F1F.F,LF-`F(tF(F$hF%$F(F)F)@F)F(F&PFdFFFlF F FpF,F>FLxFWFIFF4FF8@F8F7FFGF=F9F6F0F5dF58F2F5FGFWF_FfFaFo`FjFZFUF[FgFjtFjFcdFrdFn|FrFF|FF{ FxFZFvFvFj(F_F\ F_F^FU FUFMFI|FSFTFZ$F^FZpFLtFK@FHFAF@FBFLFO FFFKFS FcF^ FY0FW|FV\FSFXFRFBLF<`F5XF2@F9@F8F>DFIFGxF;,F6F-F/ F4LF?F?FAFAFDtF;F2F(F,F68F2F+F'\F/FCFJ|F[lF_FfFbFWFLLFG0FP|FJFOFPFNFODFU4FYFVFUTFPLFOFOFGF8F9|F5F48F:,F9HF9FKtFCF?0F1XF/F-F)$F1F9`FAFQF` F]4F^FjHFrFc0FZFUpFWFaFoPF~pFFFFFFFFFDFfFFF`FlFFVFzFnFgF_ F[ FWFYFYFXFV FN,FRFVFd FkFmFd FdFnHFxF"FFF`FFF~ Fr0FoFrxFyF:F:FFFFFFXFzFrXFzF\FFvFt`FiFW$FS0FIFGlFNFUFqF&FFvFFF FFFyLFmHFe|FlFqFoLF}FFtFFHFFFF`FRFFnFF<FFFdFqFo$F`8FWFUFMFIFP<FZF\FWFXFcFcF`dFhF\XFgDFcFhFjF]0F\hF_(F_@FedFpFF&FFFF8F*F F\FdF2FpF^FyF|FrFyFrFcFR`FSFL8FLFA(F@F< F;pF< FIFFFMLFPFS@FW(FWFTFYHF`<FdFiFiFkhFFXFFFhFv(Fk4FrDFt FxFZFF}Fe<Fi\FlF_FXFUFQFWFTF]0F}FFt<FkFlFmF~FzFkFcFUFlhFqFnFdFc8Fc\FeFpFxFFFbFxF@FFFFbF2F0FFrFjFvDF@FF^FFFFFFFrFpFtFmFn0FkFiFeFqFlXFhFZ(FR`FT8FPFSF^ F}F<FBFF6FbFbFXFjFFF(FZFFXFxF|F|FFFFFFFbFBFtFFFXF<F:FFFFHF\FFFFFFFF@FFFFFF:F&FFyFFFu`FtFyFFHFFjFFF F}F}Fz,FwF|<FF FFLFF>FvF4F FF>FFFøFTFўFFFFFFXFF:FFJFF2FFF<F.F@FF FNFFFFFFpFFF^FvFFF FF@FFGG GFFGFBFXF,FFFFF*FՖF*FFFFFFFFFF(F FvFFF|FF4FFҜFvFFF0FոFʘFFFpFF$FF<FFFFF~FF^F FFF FjFFFFnF<F0F*FFfFGF,FGGFrF~F~FFtFŖFFFF&FF@FFF`FFFFFF~F&F|FF\F2FTF8FFFFيFFܘF F¢FFBF`FFьFFGGGzGFFzFFF0FFFHFFFFGG G#G G (GoG GGGGGG xGFFFF FF~FvF:F GGIGGG GG GG GG FGGwGG:G"F8F2F݆FF@FGhG[GGGG /FFFZFXFGGGGF\F4FF\FʠFF FFFFFFF4GG"FFHFFdF8FFFPFpFFFԤF"FӚFjFF(FӪFRFF GGeGF2FܸFF<F*GGG9G? GG<G8G7G1G@4G1G G vG G G G G mGaGGGhGGFfFxFFFG;GG GGGsGG$GGG#G.bG)G=G>G!UGGF:FFF*F>FLGG ,GGGVG GFLFG G /G"GIG#G#YGG#GF*FFFXF8F@GoG JGFFFFFxFٶF|G&GGG.,G:G8fG>G=GEG6IG+.G%HG GNGG>GfG,G<]GNGXG^GoGXGgGu3GhGCG8FG+aG&G"G*G$GtGG!xG&FG(G%G+HG-2G2$G2 G=-GCG5G$GG GFRFܐFFPFFF,GSGGG4GNGgG GgGTGG#G9fG1GW;GEG5G9rG5G%G.NGOGIGQaGPcGIPGIG\G^GBmG<G5AGGG GGuGFhF"FFxFF<FTFҨFѨFGGGgGGG/G'GEGQoGNG^0GIGTGF5G<G<G5GG GrFFGG 2GtGGG&GF6FGGFPFG G GG&G#GGGG]G'`G+G8G@GGIGJG?G?IG7G*=GGGG*GGG(G-)G&G/GEG>MGCG>sGH(GDG(G!RGG%GkG 1GGG%HGPG"NG3+G2G+G+GwGGGKGG G:GG GG GGG&GG)GJGGjG qGGG GGGGpG|GSG GGG%mG$GG/G7qG?G,[G3 GKGP1GH GHGFDGU7GT3G7G/GLdG4G1gG/G1G:GG G GGG G8G 5G4GA#G3G#GGlGwGG F$F FFFtFJGG!G _G'GG GKG GGGuGGG&uG7G8GG)G'GGjFtGG GG SGG%qGG6GGG G G GGG G!G; G2G) GsGGGGGG-G$GG GFvFFFF\FvFnFLF*FvFFJFFFʾFF"FFGQG_GWGGGGG&3G)GGFF<FF|FԦFjFGGQGG$G+[G!^G#'G*GEcG+G FFF\F6FFFFFFF.GGGTGvGG\GF~FFFFFnFFrFFF*FFFFFFDF\FFFFFFvFwFcFeFa@Fi FlFaFiFhLFkFnxF~FiLFcF[FMF<F.F0HF/F=F=lF<FFD@FDFHFKFDLFB0FEFFFEXFHFF,F=F<F-F+DF/F2xF/F/F.HFFFFXFFpF $F DFpFFxFFFF"F F'F&TF!F pF(FF\FF<FF FFXF(FF#FF"FFtFTFpFF%|F&F,F!<FFxF\FF F8FF,FdF"lF <F%F$F%F!F"F# F%LF(F,F1xF9F:FA8FAF>F@dFB F:F3F+F/LF4xF< F9F;F5F5F.F3F14F.TF.xF3F2F@FFFGFKFKFJFBFC\FGHFGF?F;F;FF=F@<F;LFGFMDFJ$F=F;F5F5F5hFAF(F8F6F3F:F9 F5F.F,F/F.F7F7(F2F-F3`F2 F3F4dF,F%hF*TFFF LF F@F F2FPFTPFVFR4FK\F>,F?F8F;F68F0F0HF/F3F:FEF>FAF<|FEFF4F:F:(F<FC@F;F>0FEFCF<F=F8DF8F7F;F=F7F9F3F1LF/F'PF((F,(F.$F(F-PF0<F4F?FIFPlF[FX8FLFS FK(FQFPF]FRpFOtFLFK$FHFMFGPFHPFD$F@F>FHF@F>DFBF@F;F4tF7F34F9F88FHF^HFpFzTFxDFqFx<FoFb$F`FlTFyPFoFl8FvFFF|F:FFFFFFFxFmFiFpFyFsFr`FeFWPF\F_ F]pF] F[FWF] FXFOFLFFFOFQ`FPFOF]Fi Fq|Fo$FgFcF^@FcLF[FI0F?FAF8F4TF8F6<FB|FLLF=dF5F1FF6F3F/F/F1FD|FJFPHFX$FgFtFfFxFmFa8FgFiF0FFFlFF>FFJFFvF0FF6FF0FFFZFFFFsFtFgFhlFu<FaF_F[PFSFSF]FfFiFlXFFFFFFF8FF0FFXFF<F4FxFVFDF*FFlFFFF^FFFF&FFvdFwFhF]FMFKFPF^FhFhF(F<FFFF8FFFrFqFyF2FFFFFnFFFFlFFFFFF>FHFjF"FFFjFcF\\FUFPFXFdFFFF~F~,Fr8FuPFq$Fp FrFyFh FtFFyF{FoFoF}FFzFrFbF0FRF6FTFlF|FZFFHFyF|tFvF|FkFbFUFZ FXTFLFCFB<FCFD FDlFOxFPFLFVFYFPF^8FTF\(FahF_F_FrF|8FdFFFFFxFFFFFFTFF|F{lF}FnFqFhFePFmxFj$FiF{tFFHFwFuFtFFFFvFpFiFpFuTFkFiFhFlFs|F`FFFVFFlFTF:FFF@FFFFFF}FZFFFFFF4FFFFF6FtFpFoFpFrFx FlFj`FdFZ,FWFQ FS FaFl\FFFFFF.FnF,FFF"FFFjFFF&FFRFTFFNF@F`FFFFFFFFFFvFZFFfF>FxFFtFFFFFĖFFFFF<FLFTFF^FF|0F~|FFrFvFFšFFFBFTFFFFFFFF6FXF FFFFFƬFFԄFFF`FڶFFhFƐFF\FFFF:FF`F|FHFɞFɞFȬF6FČF0FFFFFFjFF6FFJFFFFF\FFFTG6G 7GFFFHFF8FFެFFشFFrFՈFTF@FFFFXFFFbFFF^FFFFƶF<FݺFFxFF҂F.F.FF׬FFRFFFFFvFFFVFF>FFFFNFF.FɄFĊF4F FFlF\F,FF^GGFGG GDFF6F F6FFfFFF^FFF~FFvFFlFFFFG AGGGIFxFFF2FFF|FFfFPFlFFDFfFFhFF4GG ?GF"FDFGF$FFFFFGGGQGGGjGGGG:GG GcG3G3G'G$GqG AG9G GG GFPFGG GGG GG)GGGG GzG+KG(G)G#GGGFF6F"FpG%GGGbG6GFFfFGGGGdG^G,F&GG&GFvFFFF0FFG G GG GGGF`FVF.FpFBFFFpFF8FFFBF<FVFvF*GGGGLGjGG9FFGG G! G,GPGQGKGNtGBG5G5ZGdGfGUGGGtG GGGGGcGFJGPGG G!GLGGGGGGyGG aGG-G.5G4G<`GLG-jG=GGFFFLF(FGGG~G#vG%GGGFzGGGG6GVGMIG9G1&GGGGBG#GG"GOGS$G.GG{FFFFGG GG&G?GLG[ GTQGUGQGEtGGG2G.G-G_G*G@-GZ GdqGGsUGGw#GfGiGmGVGGGZGN2G8GBMG65G1 G&OGGyG+1G*G*G/G4G8KGDGEGA)G4G$ GWG GFFFZFؒF0FFFFGF:G.G GdG#rG#G"G%2G1GOBG5G(G1GG?G=G7GMDGJ#G_NGsGoGf=GyGeGOGB4G6G)qGG?GHG9G JG;FF2FFBFFFF@FG3G(GG)G,G+!GCGUGQoGZLGNGqGPwGDG>GOG;GGFGFGGYGGG FGGFFLFFFFG HGvGxGG GGG<G)GAGkGs.GkGbVG_wG{GSGBOG1G'G wG G'G$4G1G(G1RG<G:GDGHGLGHGOGCgG/GtGGtG GGlG.GGpG/-G4GG"UGGG eGGGGGKGG%GGGG-5GGGyFPGGFGG G<G&G:G5G/VG'G%GG!G,pGG5G$G-8G(G&vG9G7;GG'GH:GMG<GSG;G$AG12G=`G)cGG#G%G,6G'GXGFFGCG~G7GmG*G*GGG\GGFFFJGF$FFF0GGGGGG*+GYGZGGG %GG*G3\G3G*AG!G#dGGsGGGgG0GSG`G #G tGGG GGGUGPG7GGG5GKGEG(cGMGGGrGjG&xG'G GGFFF*FF߾FF FnFFFFhFnFXFFRFӼFF"GGlGG GnGGG$G$G+GvGGGEGG F.G GG ZGG4G'BG*~G*G&lG.GtG QF<FFFF:FFFFFFGG.GGGHFFLFF~FFHF@F"FFFF<FF FFzF<FFF>FFF$FFFwFvFjFaFWF_LF\FZF^DF\F[FWF_FaF\ FVFP@FKF:<F1F*F(F#LF#lF*LF+F)PF'F(|F%F F&F+$F2|F.F0F%F`F FF!F$F)F,F.F)F: F+FFFF$F'F"F4FFFLFF FF/F2@F(\F/F5F3F2F@FRFMFXPFdEPEPEPEE EEE EEE#`EEEPE"E4pE-E%E-E&E+pE#E PEE#E.PE?pEMpEVEREX`EV0EP EOEbPETE[EW`EOESPEK`EUEPESEXPEjE\E\pEV ES`E_EmElEs E|EExEEE8EE8EEExE EEEE}EpEwEEEEEEEEEpE@E(EEEHEEEEEEExEEEpEpEE ExE(EEEE0E@EEEEEEEEEPEpEHEE EEHE8EPEHExEEE@E(EExE@EEEƈE8EEE(E@EԐE8EEѨEθEXE EИEEEEƸEE`EEEEEXEEEEEhEF8F F(FF8FFdF FF\EPEEEEPE(EFFEEEPEEEՐEPE8EHEEEExEE(EE EE`EPEEEEpEEE`EExEE(ExEEpEEE@FF F DFFF FFF\F\FF @F F XF LFF F F F @FF FFFF F\F F FxFFFF$,F&F7<F<FGFO FPFHFLFQlFLFP8FHFLFXFUFOFQFYF\FP4FK0F=F?F;F;0F:F.F*LF+F$ F(FFF F F F F$F tFFLFF#`F,F/F-F" F@FF`F`FF#F%xF#XF FF(FFtFDFFFFFF0F<@F7F6F5F)hF&FFhFFFFDF$|F#$F(F'F%F0F)DF*0F.F0TF6|F2F< FBF?F<F4F6F?$F6F7xF6F0F8FExFLFJFFF>F4\F8FHFEFIFFFRTFEFBdFN FU$FNFH|FC FFFIFHFJdFFFKFELF;FFHFX,FYFU FWF]$FnFhFc(FaFU4FOXFHFIFEFHF;F8dF3F6F1pF*F*F.F3F5F<(F7F;FYFsdFyDFlF[@FVXFO`FHFIFKFWFUFOxFQPFI(FGFNDFVFRFKFP8FM|FL@FKF=4F0F.F0F,xF*F2F8F<F5(F6F5F<0F=F8F8F6F4pF40F2lF1F3F5F1|F)8F&|F+F0TF'F%F#F+F.F1F2F;F7 F9F:0F;dF;F/dF. F0F'F)<F#F+F5F?\FDF<F=F6F0 F0LF6dF: F:F;F6|F,F.F/PF2F4dF. F)XF*F.pF3XF7FGFBF<F3pF84F3F1F04F5LF+F&F F!F(0F3tF8F68F.F2FBhFKdF@4F=F?F<(FBTFBF>HF;F?,F>0F:F3F+LF4F4F0F,F%F'$F,F0pF3\FA F=FJFULFSFYF\FS8FRFLFIFSFRdFVtFYpF]TFbFdFr<FoFvFFwF} FpFeFWFKF?F=`F<FG8FHLFE<F>F=F9F?(FBF?<F>F80F=F6DF;4F?F;F6xF4F-F)HF!FF|FXF!F9FA<FTF]F^FYpFXFFF?TF8|F4LF2F1F2F7F@FL\FMFFtFILFMFLFLFLFQTFT FW\FKFQXFOFJFFF>F?dF=FAF<FDFIF8F6@F8<F5F4F8dF8F<F:8F9HF<FGxFN,FUFeFgFZFWXFUDFUFfTFkFlFa$FStFYFXFTFOFOLFR FH0FG FK@FExFA4FG0FEhFA F: F?F;F<FC FOF]FFFFF|FF FyFsF~F|FLFHF0FFFFFFFvF$FFFFbF2FFFFupFb F^FeFjFitFjFo FxFvFghFSFYFYF^Fh`Fb4Ff|Fv FdFwFr`FoFelFjFlF]\FK,FGFE4FBFCFG F;FA\FBF=DF2tFAFXFR FUFQFTHF[FPFQFF$F@FGFGPFNFOFJdFUF`FcFj,FgFflFa(FchF[hFY4FQFNF[FZLFZF\FWtFa8FSFU\FPtFPF]FVFV$FIFAFC@FGDFJFRFP4FEF=F9F9HF;pF=FOFYFsHFx@FrFtF}Fs\FrFuTFnFXFlFFFFF&FVF~FF|FFNFFFxFFFFFFFJFFzhFwFxFzFuFoFj8FkFjTFldFm Fv\FF6FFx8FpFFFFFFNFF,FFFTF:FFLFFtFFdF:F6FjF FFFFF{@Fi(F]FYFb(FoFvF.F"FJFFFF@F>FFLFF"FxFBFFFdFFFzFFpFF$FF@FnFFF~FPFFFuhFfFalFZFXpF^XFoDF:FF}DFNFF(F:FFFFFfFFFFFF*FFFF@FFF"FFFFFFbFF2FvFFyFkF`F`F\FZ8FMFIFNFMXF\pFRFa0F`F\F]0F`XFZFXFVF]FdFbFeFpF~FFF2F<FFFFFF"F6FFF(FFFFyFu FspFdF FxtFFxFdF~,FtF~F|FvF~F|4FvFtFzFqFmFkFx,FyPFFF8FTF0FFZFhFF FFFFF|FFF@FFؔFװFF(FFjFFF@FvFFFFFRF$FFrFhF[F[FYF[FfFpF:FFjFFFF,FF FFjFFbFF6F\FFFFFFFHFFFFFFFF&FFF$FxFFFFhFFHF\FF FF2FFFRFlFFFdFFXFtFlFPFDFFF>F"F"F.FTFFFFFFFFFdFPF8FhF6F`FFVFFLGF$FFFPFٺFF6FPFtFFFFFF$FτFF"F FFΊFFvFbF\FdFFFFtFFJFJFFFFFGF0FFFFG.FFFFݴFFTF$FNFFFF.FFF FFTFFzFDFF`FF¸FnF0F̜FFFҮFbFFFFFFpFظFF.FF|F,FhF\FFFlFFFzFFFFӨFJFFFFF0FFBFFF GG wG{FRFF2FFFFFFhFJFF FFFFrFvFGGGGGkG_GGGGRGG VFFPFvFFFjF,FGGGG G>GGGG GjGG FFF8GGlG1G GGOGGGsGGGGGG*G.G&G?G G.GGGG.GGG GJGGGdG lGG XGGGG! G'|GA2G7}GESGHCG) G%bG!GG 4GwGG GuGG ;GGHG }GFGjGG GGfG@GG}G GVGF6F.GGHG mG<GGG GlGG G 'G G FFFdFbFFXFF\GGGGG[G<GGG&MG=G6G%G2fG|GFRG G,G%G1G[(G^GZGGcpGQrGN6GQG>G+G(G_G{GqGgGEFG]GgG 6GFZGGG,G G,GGGGGG G$GYG G%G&G*G5G6G&G GG GGGGFFFGGG!G#G$)GG =G-G GGG9G`GpGQGKiGHwG>TG4G+xGSGK[GVwGhHGRGIEGMPG82GG{GF@F|GsG GG2GNG^OGG{G_GMGHGYGNG6GB[G8GDVGG|GfGGGGGGGG}GiGbJGGGGG~qGAGG*G#)GlG(G4G7G9G:G@GOGXgGNG=G5G-G YG9G G?FF"FjFFFG[GFrFG GG2GG"GhG1GIG;G0}G1`G5G5G<;GVpGR.Gk Gt\Ge3GkEGGw`GVG<G3TG.mG"gGGGGGGFnGG%FFFFF(GG GGG+G/GCtG^OGjgGOmGPGW5GCG?G9GLG6G)G"GFFF8FGGGNF2F~FFFFhFtFFG |GlGGG! G(G oG#G4GQtGpGGGGeaGn6GV GSGAG+G')G7 G;GB|G-G!4G$G#G5GA1GMxG>GBGBG;|G2G'GGGG GGGG[GzG!GGGdGGGGGGG ^GG$G G(BG%G*;G-6GWG FFFFGG G1G#GF?G:G:G1G*G5G5G GGAG"GG1GG$G3GDG7GBG/{G4G(G2G% G0G"G%GGaGGGGGG GdGGGG GGGGPFzFF|FfF*FFFFFFJF2FGG G+2G+G)GGGGGgGGGGVGG^GGjGG|G GGGG aG GG }G XG GG_GFGGGJG.G?7GPG1~G(GGGGG*pG/G*aG)G`FFFHFFFRFFԴF`G-FF FFFFF`FtFG2GG3G&G G%GG*4G2G%G!GgG(:GmG#CGG-~G%GOGGG$G"YGGG $GvFrFG}F FFF4FZFFFFFFG AG'GG*FFFބFPFFFFFFnFHFrF*FFFF,F`FF}F{FFhFFvFFF"FZFr,FdF\8FZFW\FZF[FT|FTFSFMFUFLFIDF@F@8F9F7F0pF.F'F F<FHFF$PF!F!F&F: F;F>F5F6F.F&F"F(F3F5DF1PF*F*F0 FBF:F2F#<FF#F FPF 4FFFFFFF|F)|F3F5F5@F-$F2FJ FIFDFHXFn,EEE EEE0EE0E E E E#E E# E(PE5E7E20E7 E?E,E.E, E, E-E5E?PEPE`Ee@Ek`EjpEe@EaEaEiE]EfEmPE_EREFEJEUE\EfEoEjEgEfEbE\EjEzEEEEXE EHEEEEEhEEEhEEEEzEE`ExEhEEEEpEEEEEEXEEXE0EEEEEEEEEPEE E(EpE EEEE8EEhEE֠EŀEEEEEhEEEEEExEhEEEEpE8E EPEEEEEPEEE@EۀEXEEEEEِE׈EEEǨEEHEEE EEEHEHEѰE E0FEFFFFLF!FPFF"FxFDFEExEEEE0EFFFE8EE EEEEEE FFFFFEEE E`EE8EpFEEEPEE8E`E8EEE@EנE8EhEExF F F FF |FFFFFDFLFF@FHFlF4F FF XFF@F\F%xF$F hFF$FFF%F&F0F)DF0FDFJpFFFNFHFKFWFVFWFYF]Fe`F`0FiPFfF`Fb0FmF_DFZFLFOFWFC4F<F9F5F+tF$ FLFF (FF F4F FFTFFF!<F&F,F*F,F)F.F)F(F)4F1F7F,F1F0F8FF4FF`FFF"F(F1XF6lFL`F_FM(FJFHF6F*(F$FPF\FFF#(F&F,(F(F(F-tF1pF5F5F8(F=F=F>8FGFGpF?,F?FDFIFNFJF?FAFFFP FbdFcFSLFJFDxF?`FCpFHxFEFEFRHFGhFJFTpFSFPFM<FUFWDFRFTFQFN4FP FN<FUxFTFVFKFBFAF?F;F5F:F?XFAF:FA|FJFPFVF]DFZFEFDlF=F<FEXFHFKFFFN@FEFD8F8F98F>XFF(FYFd$FdFhFr,FoFwxFndFaFe$F_FYFS@FEFKFJFJF; F<FCFCFC$F=lFAF?|FI(FQFSF[FcpFg0FuF^FyFltF_FSFJFZXF^tF^F[hFXF[FbFWlFRXFP FQFU FSDFVFQFJF=HF.F7|F4hF3F:XFF9|F5F4FAPF9@F5pF6F3DF/lF)F,F/F5F6F1 F:F;FFF@FAF>dF5<F1F/$F38F/F5F4F@FM0FGFJFG`FBF8|F6hF@FC FBF@F:8F7F7F6(F8`F8F0F+4F)DF-DF.F;FJFF|FAF;@F8FBF5F2F1F,F*hF&LF&F-F/ F6(F9F8xFGFNFFFGFFFFFEFFpFC,F@PFFBF<F8F-F(FFF# F) F>4FC,FT<FbFfFdFRFN,FDF3F6F5F8PFdFJ(FYFOLFP8FQ FOFY\FcPFdlFoFrFb8FWFe@FwlF0FF~`F*FytFFuFd\FgF_F^(FZXFHFKFGF>FIFGlFPFPLFMFK<FJFPFhFrFF^FFFFFFFFFfFFFFF4FFFFHFFFFlF,FFFFFFF8FwFvhFwFv@F~F F~FFLFxFkFfFlFlFpFjFv8Fx`F"FFyFFzFFxFdF[tFW FQFHFCF<FAlF@FIDF@F>FEFTFn Fh@FiFm FaLFUFe FXFMFSF[Ff@FbtFb@Ft F{LFvFpFr$FpFj\FiFeF\FRFWF]FeFj|F\Fi0Fq(FuFjFm|FqFF{FgFXXFapFb$F[F\LFa,FbFYFKF@F84F>FCFYXFFF~FnFFRF}F6FF&FFvFFFFFFfFFFFFjF|FbFFhF$FFNFFFF\FFFvFRFFFnF||FphFplFyF|LF,FFFtF|FFFLFF:FF`FNFFF.FFFFFFFFF:FxFFFFFFF|,Fo,FgFh0FkhFm|FTFFrFLFhFFFFHF4FFRFFFFFF FF`FFFFfFpFFFFF~FFFFzFsFjFeTFe,FiTFPFFFFFF(FF~FFrF2FFlFFFhF*FFF|F8FRFFFFFbFFNFFjF4FFFF|FjFXF_FXFS4FQFTFSF_FaFkPFs(FtFr@F|FqFg(FkFcF_,FcFiPFt4FFPFFF$FFF`FFF FF&FNF6FVFFDFFNFNFFF|FF^FF|FF"FFFhFXFDF~$F~F|0FyFuFFzdFFF F~FF^F^F^FFFF*FFnFFFFFFNF<F8FۚFNF~FFzFFFFF(FFFFF|xFzFkhFiFsdFn|Fy,FtF2FFF|FFFFFF`FbFFFFhFFFFFF0FFHF FPFFFFFFDFFFFFFFFF,F>F$F>FFFFFFFFFRFnFF`F8FRFFFFFFF F\FxFDF&FFFF*FFFFLFJFɎFFFFF<G0G |FBFpFۨFdFFFFTFFFFxFFHFÔF׾FFxF|FǼFFɖFøFFrF$FF6F FlFFFFrFFFVFF&G6FVFfF&FFFFNFFXFFJFF:FFFFrFFFFFFFЂFFúFbF"FÂF6FFFѮF>FhFݢFGG FFVFFFxFFFFFpFF\F0F@FFFFF,FvFLFFFFFFF̔F\FFFFGGFFޠF6FFhFFFFF"FFFFFDFbF,FۈFGQGGNGG.GGGGGGGG G F&F$F>FFHF0FGGG <GGGGGGIG G*FG>GG G G"GGRGG")GGG GGGGG)G3G.G#GG"G#GGGGG /G<GGG ?GG7GGG$G+qG&[G#hG2QGC GD+GTGMG9GAfGJ#G*9G!GGDGGGFG"/G$'G+G'G*G/G GG%G"G8G$tGGG/G *G GG:GGG+G<G=fGGG?G<G+G_GG GGMFFnF4FFLF$GtG LG(GG"{G#GG G+G<G@GGGGUG96G4G0GGGG&&GAQGQ%GKGTGdGe G_GfGaGCG/)GGG G[GZG.FGG RFF\GGPGIG%RG#G' G=G%GG GoGoGaGGMGjGG-G,GG!GyGG GGDFGGoG zGGG lGzGCGG dG"G'GKGJ@GeGVGAKG?GCG@QGETG^iGesGgGxGc5GPGMNG3G&GGGG G AG*G*VGLHGVkGMGbGmGhGK GR0Gm*GbGXGOGHlGaGc#GGGGGGGGGGGpGGGGGqGG}G8G(3G$CG'HG6OGN$GYGGGD'GPGO?GOG85G,G3;G6G*G G qGFFFF`F FFFFGGGG%GuGG0G7G/G)G'G,<G4)G9GLnGTSG`GaGkGw\GvGVGDGBlG6AG%2G"GGGFlGpGGYG GFFTF$GGkG GGGG!+GAGU7GG!G[iGYGJG@TG8GFlG>G?G2$G/G$GJGG"GGGFFF0FFpF,FFFFFG GG pG ZG*G&OG'G/GRGsqGGGGnGiJGi+GK&GRG6G/G%iG0G:G1fG+eG"G_GG.G@~GKGIGKG?G:{G6G-0G$GGGGG*GG rGtGG9GG GFFG@GGGGwG G1IG5G.]G#G)8GYGGaFFhFFFGPG.GCbG5G+G?G4dG(G(rG&G(GGG G HG HGG[GG)G1G$?G#G"GjG' G!bG.G4G GGlGG%G KG G GGGG&.G*GGG>FFVFFFFFFF.FJF2FFBFܨFBGGGBGFFFFGG GGG9GG cG G xG@G rG pG,GGG_GG zGG2GG G GtGGG2[GBoGE7G6CGFFTF FFu FtFxF|FjFFF,FFFVFF|FfFjFkpF_F_`FT|FSFTFPXFFF?FAF?lFGFB8FIFBF?FH@F)F |F F%F%F%F)TF1hF@FBFK F6F=F6F*F*F4 F<0F4FFdFC8F3 FDxFAHF6F7`F+F lFFxF$F\FLFFFFLFpF F,XF2FIFRFOFHFGFMFK F\dFqtE&`E&`E"E`E'EEEEEEE%E/PE/E0E40E.E@0E80EPEJpEEEEMEd`EE@EzE(E{EuEpEm`EcEf@EmEaEbEW`EfE^En EEyPEhEpEy0E{@E`EE`EEExEE@E0EXEEE8EEE0EEEE`EyE`EEEEEXEEEEXEXEEEEEEPEǠE@EEðE@ExE0EE EEEEpEEpE@E0EEEEE EhExEEEE˜EEhEEEEE(EEEEEĘEȠEEȨEͨEǘEˀEEhEEE8E8E0EEhEhEEبExEPE(EEEĨEEEEpEEE@FdF F FFFF$ F*TFFF!FFE8EEEXE(EEFF$FF`EhEEEEEE8F FF F8F8F FFxEEFdF4F FHFPFEEpE@EEExEEpEXEEEFFFFPFXFFHFFF@FFpFF F F FF F FF|F$$F.F'LF6<F/F*hF#F$F)F.4F4xF/F3F8FGFRFUFRFXFYFX`F]Fj Fa<FbFpFsFwFt|F~ FpFe FoFgF]FPFZFNPFEF3F.dF,dF),F $FFhFhF4FtFFDF,F F%tF(XF#F&F/|F0DF2F6F2F2F)F0F8 FC\FAF<F)F!FFpF%\F$F(F5pF>FBFHFZFlF_FQFEF>(F+hF)F$ FFFFF,F0lF1DF.F-dF9FAF?FDFKFDFGFBFQHFUFWFTFTFMFRFOHFTFSFWFh`FgFiTF[xFQFF0FE$FHhFGXFKFQFVFU<FRxFWFSFPFR,F[F\,FWFaLFUxFK$FSFaTF[F\FSFRlFQFNFHFGFKFK8FFFI,FK,FRF_Fj`Fd@FlF\FXFNPFW$FTtFVFVxFTFVFUFPxFAF:tFCFMF^FjtFoF{F{FF{FzFwF{FoFi@F[hFSFVFNFPFCFBXFJ(FPFTFNHFKFH\FNF\FmFwFxhFp|FvPFFFRFlFjxFfFhFhXFeFb0Ff<FjFjFcF_4FRTFX,F]F\FhFgF[LFLFEFFFKtFNFL@FOFGFHFNFZF\FWlFQFUdFK$FAF;FDFEhF?F:FAFNPF?XF@F4F0F2XF70F<@F: F6F8F@FKhFP,FQFK8FHFAF;TF4XF:F9F<FF8(F=F?xF?<F5lF5|F+8F/F1FE\FI<FMFNFEFFHFIF?0F9F3F1F8F1F4LF1F1<F8<F=FGFUFV,FPFPFP4FLFPFPxFJpFIFTFPFUFHhF@F;F?F:F?\F@F;4F<4F=FFFNFVF_FdFnFd FkHFrFmFbFa\FiFiFp(FfFgFs`FiFuFrF FFFrFFzFxFdFbLFWFKdFS(F[F[ FUFP8FAFJXFPlFS,FRFVFN8FK8FHFEFHFIxFDFBFBF8F-0F+HF%F(F0F:FHFVF^FqtFk|F^FOFFF9LF0F8F:XF>FULFZ(F_DFa$FtFF}4FoFd`F_F_FUFkFnFqFc\F_FFFNxFVFVPFP$FMFP<FIFHHFEPFCFGFGFlFyF_HF^FcFmFkFnFwFrFvPFxFiFuFFFFFFFFPFDFvFl|FgFgF[FUFPxFNdFVF\dFTxF[Fd FUTF]xFdFpFFDFFxFFxFBFFTFFFFFFFZFFFxF0FxFF"FϾFFFFFF`FFFFFNFBFFFFF<FFFFF:FF>FFFbFFF8FFF@Fu8FmlFcF[FRFN8FFFDF@FI,FEFGFIFQFhFsFo0FlFe8Fc0F`FlF`FexFmFxFFFF*F@F.F F\F~FtFmFbF_FfXFnFyFFzFuFjFFFFyF|,F6FtlFpXFsFmFtFFPFwFw\FgFSFQ<FXFhpFvFFpF0FFFFFFF2FFFtFFFFFFPF FFFFFFFFPFtFFFFF`FF\FvFFPFFFFFFFFFFfFHFFFFFFFFFFFFFFF FF:FjF$FFƆFF8FFNFFFjFTFFFTFFtxFrFsFHF}\FFFFFFZFF2FF,FFFF@FFhF,FF@F2FFhFFFRFFFFFFTF(FFFF}FrDFi FlF0FJFFFF6FFfFF`FF$FոFpFѪFhFFFFFFF^F~F*FF>FFFXFFFFTFxF.FF(FpxF^FZF\$FXpFRtFTF[TF` Fa`Fg|FzFzFFJFHF|FtdFkFj8FeFlFwFyXF~XFFFFnFFFFFF,FFFFF FF F6FFFFFFF~FF&FFFFNFnFbFDFFFFFFFFFF\FFF&FFPFFF0FFFFFFRFFF*F܄F6FFFFFNFFFFFFFdFF4FFFFF~tFFFFFFjF2F FFFFF\FNFRFFFFDFBF`F4FFFFlF,FFFF&FFFBFFFF&FrF4FFXFFFFTF8FF"FFFtFȾFFFFFFFF.FF6FzFFFFPFFFºFàFFFFFF|FFҊFFFhFHFrFF"GpGG$LG(GGbFxFF>FpF٦F4FG.F"FNF F>F0FF4FFnFlFrF:FzF:FF$FњFFZF2FGG\FFF$FˈFՊFFF֨F(FFVFFLFvF̐F^F`FFFF6FvFFƦFFڂFFFμFфFFFFxFF4FLFFFѦFFFFGGG F|GGGFFFvF*FFF6FFF~FFFFFjFϼFFFfFF4FF*FbFچFFF FFhF&FږFښFFF&F̈FFF|FFFFFF:FF֎FXFGGGGGGGG!XG G#G%GcGG)GG yG FFFG GGGGGGGGGGFG9G 9GAG G zGHGiGDGGGG9GRG ~G ?GGG21G,G *GGGGGGnGvGG GGGG iGG 5G^G!G G%G-G<|GGsGLGKGYGHGGG^{G=oG-6G"GG!G/G'G3GG5 G/9G4`GfGGGG$G.GBG.G$G GGG G=G:G:G@G:GKGIIGPwGZG^G[HG,G :GG *FFHFFvFFFG~GGG!G)xG$GG%>G(G3yGK>GHG_G>G5G;G4YG*G$G/XG;2G]G]GQGiG~TGfGcGRGDGBTG!GEG G GGFfGGGG GFGGSG)SG8G:G"G!mGGGGGGGDGG=G TG5GGG*G}GhG GG GGKG G#GG G uF*GG GG#-G=G=pGRG^4GLG>G3G>GKGXG?GPG|WGcGY}GLGG;#G!;G+G+GGeG/G"G+\GTIGJGTGUKGgKGZGLGAGoG[GYGcHGl<Gp>G{cGGGGGGGGGGGmGGG{IGGcGX;G(3G#G'G'G?GUGNGEGCGHGS GOGXXGGG@G>-G3G*PGGGG G#GfGGFXFFFFGG IGEG6G=GGG&GLG%G!PG&0G>GCGVGPGbGGyG_dGBGP@G;G*G%SG#4G%G ]GGG G G!GGAGGGGLGG.G+FGG4G:GO)GKG^GUGbGYGGG8GG=G(G5G;GIGaG~GGrG{lGoGU:GKVG>G'GG"G1G26G(G G$G GDG-GFgG=GVGfGRGB7G9G.^G4G!GMG!@G. G6GG#GGGkGGGG8FtFJFHG G~G$G5GDG=G/G1G#G,GRGYFTFFF&FrFxG G%G0G2GCGIG(MGG!iG#GGGGG G GG7GG!GGGGDG%|G&G6G3jG4G$GuGG8GG GlGGdG#JG#G/CGG?FFF(F܆F2F`FݖFFFFFFƨFlFݲFGGFXF8FFFFFFFFFFGGWGWG/GvGG+G'GGHG@GmGGGGG!G?GGFG"_G)G/nGAG6 G(zGG GG@GBGG!G9G)GEGG)GG lG G GG AGG"FFGFFGFGGGXGGGGG#oG,}G]GGGG.-GDrG9GG!qG ]GGGG "G#FFF$F FֈFFFFFF2FNFrFFFFRFG :G GFFFFFFFFFFFFFFF}4FrF{FxhFjxFpFvPFwFyLFFZF<FFF|FDFvFFzFFzFqdF_FTFSFQ0FGtF@pF<F@FB8FB4FIFSFQ`FV FBF8F1F-F.dF,F3dF1F9TF<FIpF;F6\F5F5F1F2F9F=`FDF;F2FHdF4F*FFdF!FxFFFFFxFFF FF#F2FQFH`F>,FPFPFXFKXFEFVFoE&E&E-E& EEE!@EEEEEPE00E50E8E>E?`E@`E7ESE]pEdEWPEC`E?E>EJEJ@E\E|EEE(EEE} Ey`E8ElEuEqE}ElEhEuE{EEEyEpEhEEpEhExE@E EEEXEE`EEEE8E8EXEEEz EpEhEEE@EEExEXEE@EEEXE`EpExEEE0EEE@E0EE(EEE(ExExEEEEEEިEExEEE@E EEEEHEhEE8EEPEPEΠEEEːEE8EݨEհEEΨE0EרEјEݸEhEE E8F0FF@EE0E EE`EE(EPEEEpEhEPEEۨEEFF FF$FFF"F$FpFdFFF EEEEEEEFF@FF FTF FFEXFFF(F FFFFFF F$EFFF<FF|FtFhFFE`E`EEE(EEEpFpF\FFFFXF4F4FF<F|FF!4F@FF F F<F FhF F"@F'F2F1@F>8FDFD`F<\F2F5 F.F5FELFLHFEFLFXFbFcFkFj\FqLFiFFyFsTFpFyFFtF^FFsxFmFl4FaFT\FR`FTFMPFLF8F9F-F,dF'F#F'dF!LF"hF!lF#,F#F)F6F-XF*\F*dF'HF*dF(F2xF7F9xF2lF7DFAFMFSFSFTF?F-F)8F&xF'$F/F;F?FHFS`F]XFmFiFb FOFLF;dF/F&TF#F"F#HF#F+F@F:F:hF/`F0F:FC,FWF[ Fe$FbF^F` FsFsFmFgFdDFdFaF]Fa`FepFmFgFiFkdF]<FNFE`FG(FLFX F^FZF_FaF`FZ`FWFVFXF^F]FY|F[FVF\lFi`F_lF]FZFeF\DF]F[F^FUFQFUFbpFo`Fu<FpFnFhtFhFqXFgFaF^FYF[FaFYtFWlFTFXFRFPFJFYFl0FoF~FFFFhF~FFF~xFoF]FSFODFOFPFN FRdFXF]F\F`F\F\FlFxFFTFFtFFFFFFFyhFspFjFqFo@F| F{FuFs$FdFlFpFtFxFF\FFFFrDFqFtFsFwFs`FkFkFj@FhFhF_F]FTFNFPFGFJFFFEFG8FHdFI\FCF=F7(F9 F:F@F@F<F@dFK$FP8FZFYFXLFTdFQFIF>F9@F9HF:XF@FI@FRFclF\F\FOFF(FHFP$FN,FN`FLFQFNXFOFO(FRFAF;F: F=F;F@FI8FZFhFbFaxF]$FSFPFGF>xFBXFAF?FADF= F=FAFKFRFWxFYF\<FZFaF]|F]xFZFWhFWFeFbFQFN8FFFOFOFKFIFNFKFQlF[F]FpFVF FFrFyTFxDF{FFBF}F{F~FuFtFpFuF FFFfF FvFFF^FFpFpFjFgFdFgFcF_FWhFLFPFMFQFVFZ(FZFOxFWFWFJ`FKFKFIFF$FEF8F8F2F0lF; FBlFN$FYFaFj0FuFeF]FMFCFFtFwFFFFjF(FFF2FFF@FFFFzFFzFxF|lF*FFFNFFFF`F~FfF|FdFFFFFnFFFFTFF~FvFnF}FxTF:FFFF*FVFFFFF4FFtFhFzF$FFFFZF|F<FFFFFFFFfFFFFVFbFrFF@FFBF0FFFFFFNFtFFrFFFFtFF~FFF$FBFNFFLjF|FjFFزFF\FNJFVFFFFfFF6FFFF>FXFF~FFnFFFTFFFVFFjFFF(FFBFPF"FFЎFƄFFFFbF\FFFdFPF F`FFlFFFx,FyXFFFFFFFFFLF̦FF~FFFFLFjF$FFЈFɘF:F.FˌFFˤFXFFɢFFFFFF.FFF FFTFFlLFiF`4F],F]F]Fb4FfFjFu|F|<FFF F,F*FFFFuFFFFFFF|FFFFF`FF\FFьF0FFFF0FFFHFvFVFLFFPFFFFFBFF"FNFDFFnFFFF&FlFFZFFFӊFFFpFFF*FFxFF6FFnFF͌FFFFF߼FFFFFFFFFFFFFFF\F6FFJFFFFTFFFFLFFFFFFFFLFxFFPFNFFFXFFFFFFFF8FFhFFFpFF׀FFDFFFFFFFȰFѰF|FϪFϸFFFFFFìFTFF&FFDFFFFFXF͌F:FFFJFFFGG G +GFF FJGIGpG5G#GFXF&FFF(FF߰FGFF`FrFLFFF2FژFFfF2FfF4FF`FnGOF(F@FNFRGG GJG ?FdF޸F׸FFFΠFFFZF`F`FF8FFhFnFRF.FRFƮFFʎF֘FFF FٜF͘F\FFpF֘FۀFHF^FjFLFFFFtGGGDGG5FGGG~G G {GFFFDF8FFFFFRFFFFvFjFRFPFRFFFFߖF|FܨFFvFڂF@FӞFbFF FݮFFFFFFFhFbFFFƚFFJGG G 7G2GKGGGG"mG#LG'yGAGG cG!mG%GPGG*GG :G&G@G-GGG3GGGGTFGqGGG(GmGGQG!G=G G oGrG G G vGSGLG(G7G,]GG;GGGGLG zGGGGG%GGG QG>GwG&G&G,G@/G[GINGDGWGbtG]GldGSYG=QG6G8G2G/G1G=(GArG/kG2kG*GG$KG/}G.G+DG/GGG/TG.G9G6gGG)G!G5'GWNGRGAPGSGQXGWhGYGe GYG8G)EGG G7FFF`FFFFG 1GGGlGWG!]G*G2:G6GL$GBGLG;G,G$&G/G.G-bG4G>GUzGZGOGh;GGbGpfGDGBCGCGEG=G GGfG GMGGGG GGG!G*GDvGMkGMG3G%6GGbGGrGGGGGGG G>G&#G,G5 G'G^GG2GGGGWGYGF FGGiGcG%G5qGKGQGDtG(GG'GGoGaG1_G/G[Gi{GYGHGB G.UG%)G+G G rG cG0~GFGZGsGGgG]GS8GUGD_G` GcGtGpGgwGGGGGGGuGGGGGsGxGGGGylGTeGNG:uG/G$G,OGNGDYGJGVGMrGZGbGsHGxLGt-G`GD G5G2G-GGGGGUGGfFFTFFFGGG-GDGGG$GG G(#G$G"|G-G1GEGFZG[GlGbJGYCGPGP G6G,G(G^G!mGG G,GGG G!G|G|GbGG0uG,vG1NG2G'G'IG0&GNGe1GnGeGTGRGLGFG8G9G7 G6uG9G!2G'MG"oG$GbG`G|FRF@FFFFPFnF2FGG G yG GGGG'!G3`GRJGSGn^GmqGYGrIGdGYGOGBG(G!G'G7G3G$2G3GG#0G!GDG;G@YGbMG}Gt*G[RGE,G6OG:G=G%2G#G=ZG*G3G6G.eGQGGjG=GG$GLGGG vGkG4`GKiGjGdGM8GJG1GEGTFFFF~FߴFF^FxGG$G#hG%GG#GGBG/G-GGGG]GK<GSG GHGG$G-GGGGG$fG.6G7+GB@GYG=DG4G0G)|G'aG0>G&GG&G.+G+G%GGFhFjFF.F.FBFRF8FFFFrFVFFXFVFFLF:FFdFFFfFFFFFGGFGGGGGGG$]G G'G CGG `G%G"GlG/GG GG G:G*G&{GG#GUGG-GPG0&G.G(G0G7G1G2G&)G&GGGGGG GG\GfFhGGfG;G FG GGGG,2G$oG2G{G\GG&G>G<G6dGGG%YGFzFFFFbFFdFF΀FzFFJF~FFFTFFTFGG}G3G9FFFFFjFF FzFF FPF,FF`FF{FnFqF|<FFF~F}DFbFF`FZFFF(FFFFwFFyFaFVFO0FT,FLtFAF2F7F@FB8FTFj|FgFh0F[ FZTFQF?F0|F0$F0F4|F6F6F<F>F;F5tF/F)<F%F'F+F(F#F"F#`FF$FlF$FDF F F F XF tF FFFF"F3F=FAFIF@|FCtFLFS F?F4dFDFPE40E40E40E,@E!`E@E pEPEE@EEE$E+E@E6EEE@EHEZEiEhEoEf`EbE[ELELEO`EcPE`EEEE ExEExEm0ErEiEu`EEvExEEHEEEEEEpE8EEEEE(EEE EEEEEEEEpEEEEEEEEEEE`EEEEEEEEEEEEʈEE(EE(EEXEEEEEE@E@EEPE@EEEHEظEҀḚEEpE`EExE@EʐEEHE(EEPEhE8E۠EhE8EEPEEE0EpEEHE EEFF F EEEXEpEԨEEE0EE(EŨExEɐE@EޘEHEHFpFFPFF0FdF!FFLF FHF FEFEhEEEF FF@FpF XFFFFF$F F FF $FFHF"$F FtFFPFFF,FXFF ,F F dFHFE`EPE(EpEhEFFPFF|F8FFFFFFPFFFFF<FFhFF hFF"F',F+(F5F7FGhFIFWFBTF>F6F6F;FDFP|FdFp|FqdFsLFz`FtFtDFFFFFFbFFFDFFFFp@FlhFkFTFQ0FT F[(FY8FVFHdF?F<F?F9F1F3pF20F4|F4F/F0F5F6pF+@F.F)F)F&F+F2tF7F=DF@|FEFVFVhFdF[F[FGF8pF:F4hF9|FF0FOLFRHFe@Fj,FtFq|FrFgFYFVF9F2F+$F*HF.F3<F9hFDTFI0FKFA@F?FE8FN<FmFuHFw FFnFuFzFzF{FzFhFkFkFjhFrxFqFq0FsFr Fq`FoF^ FIF@(FGHFYPF^Fd(Fd(F_@FYHFZDF\FZHFTFVFWpF]F[Fa4FfFdF_F`xFfFcF`FWFW8F]lF``FXFTpFkF} Fr\FdTFcDFjFeHFhFaF[FXHF[8FYFc@F\LFadFa,FlFgF^F`FjFr0FF6FZFjF8FF6F|F8FF|FlFPlFJFLFL0FQ4FdFyF{ FxFvFw@FFFFFF>F@FFFpFzFJF$FFFFFNFFFFxFF\F4FF"FFfFFFFF FFFFFF|F|dFyFxFqFaDFYFX FRFR<FM FVpFWFOFTFRFKFGxFBF:\FFBFJLFNFTF[F\(F^FS@FKFFF@F:pF4`F7FEtFM@FVhF]FdFZFa8FU FOFXFN\FLFXFmFlFbF]F]lFUFMFO|FNFJFOFS@F`FyFmFdFcFXhFWFTFJ@FD@FFFDhFB<FF FJFFFF`F]4F` FlFqFuTFvFmFk(Fe FaFd@FjFpFgFXFTFXDFYFRFQ FVF^FkFFF*F~FFFFBFFFNFnF~lFFFFtFvFFFFpFfFFF@FlFFBFFFFF|FlFgF`(F`LF_FQFMFZFZ4F_F`FXpFRFSFOFPFMFLFH,FG@FCF=F?FHF?FLFNFU(F\4FmFzdFyFkF^\FNFJ(FN FMFZF`FxF<FFF&FFLFFLFRFdF$FFFrF.Fv,FlFiFeFaDFXpFRFQdFMFNFMFXFdFbpFhFyF,F2FFFFF FFF}F6FFFZFF"FFFFFFFthFjFm<FlFgFl$FxFotFv FoFuFwhFoFyFFFFFF FfFFFFFF"FzF*FTFlFF<F<FF\FpFˌF FFVFfFnFFVFưF&FFFF4F(FF FF"FFFFFFFxFFFF~FFFF6FDFFF~FFxdFsFoFpF{F~TFyFqPFm<FlFdFFFF{xFvFwF F6FNFF>F6FFjFFFF&FTFFFBF8FFF:FFRFFFFFFFFFFF~F^FFF4F\F&F"FF2FrFFFFhFPFTF<FnF`FFF|F|F FFFFFFrFJFFbFFFF"FFFF(FGFpF.FnF|FFFtFF FvFHFXFFbF*FFF,FFFFF2FFJFF:FFFFvFіFLF:FF4FlF(FF~FFFFF FFFFFFFFZFFHFF:FF(FhF<FFFF FjFFFnF.F*F*FȸFFFFFFF6FFFTFFFFFFFF FFnFFFXFFFFFFϜFRFFBGGGF FF0F*FNF$FpFF܊F̢FܨFF^F@FF:FxFFFFFF6FFp|FmFiFgFbFgTFspFuFFrFFF4FFvFFFFFFFFFFFFjFFF6FFFFFІF8FFbFjFF>FDF^F FF(FF8F@FFFF6FFFzFFhFJFFFFFFF6FFF~FBFRFBFFF$FF,FlFFvFFfFFDFFpG LG \FFFjFFFFFFFǰF,FTFFFFFF$F4FFFFF\FFFFÄFVF2FFF,FF,FFFFFF@FFFF~F~FfFFFF:FFFFFnFFFFFFFF۬F~FrF,F̄F8FFFFDF,FΘFNFFFNFF2FpFhFFFFךF0F0FFFݺFrGXG`GMGhGG,>G ZGPFFFG GyGZG G G)GG G GFFfGFFFFPFxFFF`FFTF߼FFFnGFGG G GG.GOG :GG G GGFFFzFޞFFG YGF&G GGPFFFFߔF6FF<FPFGFFFF|FϴFFRFFFF.FޒFVF^FFGGGGGG gGGGTG!GGGGFFFͪF,F$F2FFFFFFFFFbFFFFFFBF"FFFОFF F*F,GG FFhFɐFFFFFFFF8FdFF`FGGGOGGGGG%G$|GGG$G%8G,ZGhGG GJG mGGBG+G' G8GGGWGWGGpF6FFG GG GG G/GG G[G VGGG7GGGG0G2G%GG%G CG GG G GGGG_GF|G G iGG(qG%G(G;GWGGIrGJGRG[yGm}GphGWvGR5GV GTQGL/G8G5G9G?G:G:MG)G&G2GGwwGykGGv GHGCdGCUG$G>GG G hGGGGGGG:G.G.$G>BGF2G4G9G*G GdGGG"WG4JG+G_GGGeGG!G*<G#\G$GYGGG G+GGGGFPF.FG G kG/G G/ G;vG1G GG)G3GTUG1G-GBjGJ0GKbG<G1G'&G'G*GG#G&"G;G^GGrGGG^ G>(GKGLuG\GfGjGGt:G|GGG}GoGG{GGGGGlGjGvoGoGtGiGJG9G)#G-cG-G: Gh0GPGVRGnGmGGnGy$Gq=G|zGb4G]0GhGiG`G-G3GKGOG ^GFF6FFFFG:GFGG GGG4RG2G0G2G3GG!G-G8wG> G@G]GFpGJGDGIG?/G6G:'G.\GGGG@GGG)G!G) G%G GG)G-aG8NG-G70G1G:XGbGs1GGGq]GhGiG_GQG9G=G6GIG9cG2oGJwGCG1G!oG]G FFRFF>F\FF8FGG G.GrGGGG-/GC"GHGYkGeGXGGGGGIGEG&GFG<G7G:G,,G'|G!G"GAGG GGGGGfG^GGGjG(0G/G!RG WG GG wGG,LG1G6AGGG%GyG!GFFFFFF2FFFبFߐFzG FFRFFlFFG pFPFFFFtF*FPFFF|FXFpFF"FFFFF<FFFFFF.FF FFFFhFFFFFFtFfFmDFjFgXFVFTFOTFE F6F:F9FAFYFcFmpFqFh FiHF[ FCF64F34F9F*F+hF1F,F/F, F+F"LF&F FFF`F<FF!tF`F FFF FF PF F F F XFFFFF F$ F"xF\F0FEF9F1F+LF4F2F<E5E5EO`EHE5E%E$E0PE'E3PE,E.@E#E%PE1`EJ EGE9@EHPE`EoEpEE~EhEdEbEQPEMEPE|EE EEEE@EE{EoPEqEE~EEEE@EHEEEEEE(EEEEpEE8EEEHEE8EEEEEEEE(EEEPEEEE0EEEEEEEHEEEEE0EpE0EEEXEEEEEpEEEPEEEEPEEEEEEE EEpEPE͠EXEEXEEPEEHE(E0EEEEEEEEE(EhEE(E8F F,F F F TFF`EPEPEEE@EPEEÈEE̠EθEEEEFF\FF ,FFFFF<F$FFFFF0F EF,EFHFDFPFFlFFFF pFF|FFFF4F!FF"8F F F \F F$FF <FFF FFFFFF F(FFF F FFFtFXFFFF|FF0FF!dFXF%F#PFFTF'F+ F1F3(F9\F7FGFKpFMFNFMFMFPFItFLF_FFFFFFFvFFFFjFFFF*FdFZFFFF{Fp(FnF`FZFX0FLFPFOFRPFNFNF=lFpF>F7F;F8F54F3 F>F?F3F+@F'(F(F+F+F3PFEFNxFZ,FXF`Fq,FmHFnF_FLFDDF=lF>\FEFTFaFrFu|FwFvLFtFxFlF\FUF@F<F;F<0F;FE`FFFK$FGFHFHFGFPFx,F4FFFFyFxFyF\FFFn4FiFpFpFpFr|FhFhPFoF{<FrFUFEFBFMF]XFjFbFVTF\FSFYFalFYFP8FPhF[FjhFuLFmFfFb Fj,FltFqFpFuFqFbFetFdFfFqFoFu0Fn$Fm,FuFkHFeFj0FbFZDFdFeFi4Fn Fm$FsFnFp8FqXFuFxFwTF{FjFF8FLFFFNFFF"FFwFYdFPlFPxFXtFk|FFFF>FFFFFFFrFFrFxF@FFFFFFTFFFFF F FFF`F.FFF FF*F6F\F(F$FFFFFxFNFLF8FTFF}LFpFmF`LF^4Fd$FTdF_FbF`4FU@FN FFFD\FDtF?@F:F>4FCF@XFClFL@FKFMFUHFU<FZFOFGFBhF<F9F@FOF[FaFjFwFtFndFmF`F^F[F`Fr0FyXFoFvFnpF^Fb|FfF^F^F[FZFdFhFqFyFsFmFc<F]@FUFPFQF\<F\FZFYFaF^XFlTFkFuFFFXFFFuFoFo|FvFq0FxFFq FiFa$Fb F]F[FiFqFFFFDFFPFFFFFFFF|F FFFFFF&FF|F FFFFFFFFFF F^FqFrFslFlFkFd$F^F]FZFZ,Fa`F\<F[FYHF[ FUFTFRFH|FFFEF@hFETFIFILFO<FKFSFYPFstF.FF|LFeHFSFTdFXPFTFVF_ Fw,FFFFFFDFFFFFFFBFbFfFF&FxFrFsFfF]FVFOtFOtFZ`FiFkFn FtFFF FFFFFFFFLFFFFF6FFFFVF0FFF~Fp$Fu,FyFF}|FtFxFFoFtF|FFy\FFFFFFF΂F(FFzFFFhF4F\FF8FFFFPFFFNF^F4FBF̸FFbFŦF̰FF,FJFbFLFrFpF$FFFFZFHFFFFxFvFFݞFFF0FFFF.FnFFFFFFFpFFFFFFFF\FFxFPFFFDFHFFLFHFTFF̬FؚFFdFFFtFF.FPFFFF4FFHFFF F.F.FFFFLFFFFF$F|F@FFF>FFFFzF\F^G#FFFFF FhFtF6F FFF8FfFF&FFFnFFF^FXFFF|GGFFF~F׎F6FFF8F|FFfF FFFFZFFFFFRFFFFFHFFVF2FjFشF.FVFDFF*FFдFF FƲF.FFFpFBFFÆF FFRFF&FF8FFFFG G VFxFFŘFFFFnFZFڂFdF\F8FFFFFzFF͌FFFFFFFLFFTFF~F>F>FFF$FFF*FlFhFJFG:GG 2GGGFFFFFFnFvFFܼFFF|FFFFF,FFF*FTFFyF~Fu(Fo$FjFkXFuF~FjFFFFFxFxF(FXFpFFFFF FFFF~FFFFFFFjFDFݮF FˤFìFPFF|FlFF"FFFFFzFFFF<F"FFDFF"F&F,FFF FxF.FFFFF`FFFrF:F`FF^FJFHFFFFhF FG G FFFFFDFFFF4F&FzF6FFFvFFF(FF>FF4FƲF"F@F߾FFdFFFFF–F<FFFBFFFFFF FlFFFjF\FٲF۬FPFF̈́F׾FfG\GnG GFGFFBFzFjF^FFF޾FFFFFFFFpF|F,FFF\F$FLFژFؤFF<FGGGGbG(3G0G'G GFFFGG;GcG}GG G*GGG&GFGG%F,FFXFBF<FFFNFFFGGtGG6GG MG _GG GdG#GGGGGDG GF4GGG GGGGcGG GFlFlFFdFPFF2GlG KGFFFߖFF*FNFFFBF߲FDFFGqG _GGG%GGYGGGGG QG0GGGGF>FFLF`FBFFFFG =GOFغF~FĸFFFNFLFG<GhG QFvFFjFFJGGFVFFFpFtF FFNFGsGwGGZF FnFGGGGGXGGG*UG.6G#GkG%G,5GPGKG GGGG&G2*G#G2\G1G.#G$ZG G GFFFGGdGyGG)G8>G%jG~GG_GG <G`G "GGG%G1G-G*G#GPGG!GG<G(G`G!NG$G$GsGG wGqG%G(G4G>G\GZGG{GU GR,GguGqyGrGo&GGuGZG7GFZGAGOGJ)GHSG.vGG'G4G3^G.GP&GDG?G5yG?G:G4GCG^GRAG]GoG_G_GgGhuGzdG_:GLG8G+GG GpGFFFdFdFhF^GGG%%G&'GGQG G G$%G1GBGJG?G@G9G4%G8G:GHaGKGS$GvGyGnmGqdG~GGf6G2+GG-G.G#G.GjGG!.G@G@HG0G/G:G40G/G/G? GMxGC?G8G7G#G$G4 G1@G9G<G< GLGGGVGG$G-NG G#CG G+IG G&G GGGG VFFGG <G GGLG)G(G2G@ GGG$GASG>G@GTG>GGG8G@,G1G)yG5~G"5G.PG?GgGGGGGGrMGK}GIGQGRG\GpGmlGG~GusGqGqGtXG~GGGGGGvG|.GGr G]SGOGGeG<G0G/hG/G5GWVG\_GhGlGsGGGGGyG|GGytGG|Gh{GGBG6G8GWG{GGGG~GmGiGWGYGSG[GHSGMCGJeGLG@GKG?GWG G FBFrFFFFG+GGGGG$NG!GG(G8NGL(GNGN$GZUG7G(G3GD-G0=G'GG(G$G.eG4CG- G<GKG>G/G8G;GIGrGGGGcGRJGPbGNGDG:G6|G>/G:+G9G'JG'G GGGG)GGGG(wGBGGGGg2GG'G;G8G'GHG GFFRFFFބFfG=G kGOG@G HGG"G GG)G9GaG6~GKG*EG5G(G-G?`G@DGGG%PG G"G4GK GDGEGHGGOGS\G0DG1AG/G>G6G(G-)G$G0!GGGFFFFFFrG'FzF߄FdF(FFFFҾFɮFF~F>FFʌFԄFFGwGG 7FFF^FG /GGG%oG^{GFGBG:|GZG#G!G$GF<G/G2GGG*dGG G3G.G*PGG 6GG G#UG$5GJG ZG,G8GR%G_GLGNuGNGTG\WG8GDG:sG7GG'8GG G"G!GGGG GGGGGGGEG)G)G G\GmG!G/G)jGGGGgGTG\GLFFFǰFXFFFӈFdF6F@FzFFFxFFFFF$F֌FFȬFFNFFF"FFFFFFFFFFFFFbFFFxFbFuhFupFw8Fp|FqlF~FyFz FqFaFUFVFXFeF\FS,FPlFEFA$F9F:FEFMFU0FeFyFh,FfFWFRF0F(F)F' F!F.HF0F-F&FhF!<F |FpF F`FFFFTFFFFFF!FhFhFDFF$FFFFFFF,FF&F&FFDF FlFF"dEAEAEHEQEIE<E0E7E9E:E>`E7E<E=E- E9EHEGEM ES@Ei`EvEtEzEh E_E_EiEgPEYpEqE{0EE8EEEPEEPEE}E}EEEEEHEE`EEEEE0EE@EEEEpEEEEEE EE0EEEEEEEEEEEE`EEpEEEEE EEEĀEEE`E0EEEǸE(EEEEŐEpEEEEEEEEPEEE(EXE߈EEEXEшE`EEEٸEExE@EEE@EEEXE@EEEEEEEXEE FE0FtFF dF FEXEEӐEXExEE0EEEȸEE(EE@F|FXFFFFFpFFF0FFFEhFE(EFFHF(FFFF,FFFFDFF!FFF"F'F$FF F\FFF@F XFDFF,FFFLF FFpF FF F dFDF lFF4FHFFFFF DFFF(HF&tF(0F,F6F4F5 F4xF/F)(F*xF,LF/F>FB(FOFRFXdFj<FmTFdXF[FVFaFyFFHFLFRFFlFFFFhFF.FFFF`FjF<F2F|FsFfFc0FQFIlFNtFYlFgFZFVFGPFGFAF?FHXFGHF@F=F;F8F=XFFFGF:PF3F0HF7(F0F7lFMPF[lF[lF\HFgFxFzFhFhFSFMFIFPFRlF]FkPFx FvHF}LF|Fx|FyHFFwhF]FOHF?tF7F7,F>`FAFCFFFMFS0FVFXFY\F(F FFfFFF|F}F0FFFbF<FyHFsFqFrFrFnFyFvDFoFR$FBF:FFFXFeFhFX(F\lFWFWTFTF[FVtFUpF_Fo<FyFvFqFjlFqFkFFF}0F},FkFeFhXFjFl,FpFuF|(FFTFxFuFyFrFjFvFoFnFs(FvFvFw|Fu FFpF F FFFFFhF&FF4FFFFF*FvFgPF_FdF}(FBFDFF`FtF0FXF`FbFFFȤFFtF4FFFFFF,FFFFPFFFVFFpFFFZF<FFnjFjF FFdFF6FFFFhFFrFF8FrFqFpFhFjFkTFo|FeTF^F_F[FRFGFDTFDFBFEFCFN,FIFPFYF[FX\FVxFSFP FM<FG|FH<FSF_FlFxXFF@FtFF~F~PFwFs8F}lFFF^FpF~pFv,FsF}tFxFqPFsFkFtF{FFFHF|FrFhFa,F]FkFvFiFxFFFFFfFFjFrF^FPFFFFx0F|F}DFHFFFy@FmFf8Fg,FiFpFzFF|F,FF(FFFJFF>FFFFFFdFFFFPFFPFFFƮFFFFF FFFF4FFFFpFpF|Fx`FqpFmLFaF_FYF`FrF~ FoFeFdTFiFfF]PFWFZFQFV<FQFQFNFRHFZxFeFtFtFFFrFk(Fe$FZF_F^FoFF FFFFFNF"FFF$FNF4FrF6FJFPFFFwFr FoFkF^FYFYF[dFhPFFF*FF*F.FFFFpFF,F(FF.FpF FFFF~F:FNFFFFFFFtF|FFFxFXF F~FFFFFFNFFFFFFF>FšFVFFFFFJFtFFFfFFF"F F FFRF,FFذFF~FɎFBFfFnF FFFFFFFFLFF0FBF$FhFʒFNF.FFFFFtFFNFjFFFF.FF&FFFFF`FFFFFFFFFFFFBFBF&F8FnFFGF0FܐFNFΦFFF̎FFFFFLFFF FîF@FҖFnFF,FFFFFFFFƤFFF~FFfFFĆF"FFFBGFBFF~F FF0FFȶFF`FFFbFFFfF<FFFFFFFF*GFGFNFJF|FFFԚFFFF F|FF6FFFxFFĔFFFFFdFFZFFFFFrFFvFG GFFFFFǰFF@FFΔFFF\FFtFFFjFFF`FF^FFfFFFߤF~FFVFFFFFFF<FrF׊F|F\FFxFbFFbF͂FђFFFFFfFFF~FlF&F FtFFF8FдF^FFFF^GG G G G G GiGFFF*FnFXFPFFF$F>F٤FF@FTFF.FJFrFF*F&FFFzDFFFFfFF~F FFF4F>FFFFFXFFHFNFFFFFxF"FFFFFFLFFFF F4FFɠFFFF$F:FFFFFJFF&FFdFnF4FFF|FFFFVFFFFzFxF*F\FJFFbF\F FxFhFFǎFFΜFFFF(FGxG FhFFجF6FFGGTFF*FHFFrFF<FjFFF$F\FǞFFFG%F,FF^FFdFRFXFXFFdF~F4FFJFpFFFFFGF*FBFLF2FFXFXFFGG GGG eGGFLF|F^FFF.FpFFxF(FF FFF\FFFѮF&FFF F FG7GGuG+GGG NG'G,G,G G F\FtFvFGGHGGG G G 5G GGGG GFFFnF8FF~FF FDFFGGG^GG GGxG AG)GG@G[GmG GGG G<GyGGGhGGGbGGG[GGVGAFFFFTG7GG"vGGGF8FF"FFFPF|FFFPFHGG rGoG~GjG&GGaGjG<GGWGGGGTGG FFFFnFtGGG GjG FFܮFGG "GvG3G uG|G;G 1FFFFdFVG2G G yFFGGG#FF>FGG EG 5G G 0G=G 'GVGhG*G G!G(G'\G(NG)G$,GG!G!GGG$%GG!G(YG)3G0\G,G2qG@aG6G6G GWG_FhFNGNG_GqGnGG+G/-G,G,G+:GGGGGG9G#G-G/GCGPGG=G3eG#G$GGG#G! GGGGG[G GG&G,bG2G3GO?GQG?GJ!GiSGjGqGnqGeGhG]GO#G@8GVGXEG[tGvGeLG<G0G4G9G?G.G?GGGQEGVyGMGK5GDGUGTqG\GqGtGaGlsGtGnGtG^GNNG>bG3^GGBGkGFF.FFGGG,GaGZ G(GMG!G&G$VG!jG.GB GDGN/GEGHGO+GZGNGNGeGtGeGp Gh/GuxGqG]G7G$!G(BG(G!XG GGG0GFRGNGOG;G8-G*G5~G6GK GFGGA GAGF G6!G3G64GIBGX8GfGoGf/GKzG* GG#[G$nG"0GOG%G*6G50G6GEG3G$G2GG G GG GcGG G"GG'G$sG)rG+G,G7GBPGDG^GKGJGPGP8GLGEG.G*[G$)G-G:GUGGGGGGGNGI GJ1GXGnGpAGoGw{GuG^GwGvJG}GGGGGGGxGmGsGezGS;GHG;G6G2G-G0G=CGCGM%GdGyGmG|"GGGGGGGGGc7G\GI\G1G G,GPGFrFFݎFtFF:FJFlG GLGG&G! G+G,G9GpG"^G#G%pG%LG)G0=G72GTGHGTGUDGI&GEGH}G2G#uG#GVG!fG#G=G#'G'G+G)GG0G2GJGWG6dG7G;GCGOGZGvGGGzGu~GZ}GZ}GTJGWGWCGTBGSxGWGQ GDGGOG=G G GZGFFG1FG 4G GGLG"G#G(IG$G#2G6GCmGJG=GAGP9G-vG! G#G'<G.G% GGeGG%G$G&G6GBG7G5G9GAGDGNSGlGGGrG`%GXGM>G@G5GDTGC2G>8G5G$?G$G'G#+G GGGGG0G1<GHeGfG|GGrGmGSG8vG3GGSG~GFFFF G<GGGDG"G)G.GGGG!EGRGyGMDGFGJ G-[G0=GQGGOwGG"GJG.G.G6G6@G>9GHGWGYPGHG1AG03G1G+G+8G3G.G!GGGGmFFFrFFFFFFLFFFȌFF\FFFFӢFȢFFɆF՚F&GQGZGG GGGAFG4G G&G"G7G:G=GGG>G#QG+G=G!CGUG0GGGLGtG G-GGwGGG!G BGGyGG1G)GI GKG_GTaGbGU+GfGHGBxGDG0G*G(GG*G1G/G!GaGGG aG G zGG ZG:GDGGzGEGG"GGGG8G-GrG=G:FFF*FtFFFFԦF&FJFXF FFFjFFFFlFFFFNFF@FFFFF@FsdFs8FqpFdFF8FbFF^FFӬFFF(FxFHFbF[FXF[FTF_8F]4F^XFVFWFRFGFRFXpFKFBF7F;F;F7 FEFUFvFgPFoFlDFYFPFMF8`F8F-F*F$DF0 F<F7F&F$|FF\FFF DFF$FFFF,FFxF*xF*F(F(8FFFFFFFFF dFDFFFE EFF|FFE4E4EHEL ED@E<EGEMPEJPEJ0EAE@E@ EDEK`E@0E8@E@`EBE>EWEr`EaEs@EbE]EcpEm EhEEXEEEEEEEEPEE EEEE`EEpEPEEEEEE EEEEEHEE E0EEEEEE8EHE@E@EEEEEE(EExE@EEExEE0EEEEEEEEPEEŘExE@EpEXEEEEE EE(EEŨEPEӸEhEXEpEEEEhEEE8E@EEEEEEHEEEEEpEEEEhE EEEE E`EEPEHFXEFFFEXEEHE`EpEEPEE˸EրE EHEEEEHF F FFPFLF FF\FFTFXEXEEFFLFFF TFtFHFFTF"F*F%F'$F"<F"PFF$ F+xF)F!FFF$F|F,F@FFF FpFF\FFFF8FFF 4F 8F F\FFPF4F8FF4FFF,@F.F,lF2F:FGF@hF<F54F2$F1F0F*F-F;\FGFTFPFZF_Fn0Fp4Fj FbFaFlTF(FFFxFFDFF~F@FFFF`FFjF"FFFFJFsDFc@FTFNxFJxFLFWF`FaxFXFOxFOFN FGFDFJF=FAFJFS`FRF[F\ FTFHhF;F;F5F6FCFR0F_FiFs\FrPFPFxFeFcF_FV$FYF[Fd0FnFLFFF}FzFFFdFeFStF>F2F3F:pF?\FDFK4FPhFUF[FgFo`FFrPFF$FLF"FNFFpFJFHFBFFFFFyFvFvFrxFwFnF`FP|FUtFWFhFj|FpF{Fr FjFb(FZHFWFZpF`dFfFqFsFq,FvFxlFq Fu(F|lFFhF|Fo(FgF`FrFkFuDF}FFJFFF{dF{@FxF{Fp<FkFjFlFw@Fw4FvFXFFFF\FFFF>FBF FFFFpFFFFbF>FtFwFxFNFFFF\FFFFFFFֈFzFľFVFtF~FFFFFPFFFFF*FјFZFFF`FHF8FĒF&FFFFFFhFFFFF FFRF,F&F F~FFvFvFo`Fq FzFtXFvTFhFaPFWFRLF[F\dFQFPhFZlF\FalFcxFbFcFcFa4F`F\xFVFYFaFi|F8FpFF>F$FFFzF~TFFPFFzFXF~FFFFFFRFFFF|FF F(FFFuFtFsFFFFxFFFFFhFFFFFFFFFNFFPF4FFFFzFuFj(FptFxdF\FFrFFFFFFF6FFTFFFFFF,FFFF|FFϜFXFNFFьFF~FÎFFF<FFFFF>F$FFNFFwFyPFhFhFjFlF{PFF}Fw|FtFF0FqLFrFqhFgFf FjhFdFfFeFfFyFFFFFLFFFyFo\FoF{tFFFfFTFFrFF\F FFF`FFFBFFFpFFXFBF~$FF|FlFeFcFf,FuFFFFFFfFFTFfFdFF2FFFNFFFFdFF(FNFFBFʾFĤFFFFF,FF@FFFFbF F F(FF>F`FF,FFPFnFFfFFFFpFJFFFFFXFF$FF|FFFFF0FFF(FF4FPFF(F:FF FPFFtFF(FFFFنFDFFFF~F>FFFF0FF6F FF0FjFFZFFFFFFFF0FF~FF,FXFFFF(FFFGGG GFFFFFjFFʰFFFFFFFnFFFFFFFFFpFTFFFFМFFF0FFFFFFFGZFFFFXF‚FFjFݤFBFղFFF F|FF„FFŠFFFfFƊF۾FjFF`F"G GG FF|FGFFFFFFFFʾFFFØFF|FFFRFFFFFrFjFFFGzG!GjGGFFF`FFXFF8FF FbFxFFZFԲFFFDFbFF4FnFʌFFFFF FHFF>FFGG!FFfFFFFؐFӈF؊FHFFXFhFxFxF~FbFFFF6FFbFFPF؀FږFFJFpGGGF:FGGG G FFFbG/FGG zGGiG G{G FFFTFFNFxFFrFFbFFZFxF|FF*FxFDFFFFFFFFFÎFfFF"FFF@FFFFFF.FFFFFF"FFFFFF\F`F|FFɸFܘFPGFdFFFFtFFbFF\FFFlFFF\F^FFFFŠFF,FFF0FF.FFLFF FьFFFXFG=G?G FFFFtF"FFG<FF.FF0FFHFɀFF F˞FFVF*G)G GGG FbG(GG G<FFPFFrFF4FF~FͦFF6FG GF\F:FFFGG GGGGG GG?GGGGG,G XFFF&FF@FNFF&FxF G}GGGFFFFFFrGfGJG _G G GG'GVG)G%9G&G.fG"G UG}FF FG}G 7G%G ZGFRFGG`FNFGoGFFNFGFGFGG BGG GGG#GGVGGXG7GGG$G#G, G,FG#G"WGGAG\G-G G G G GnGGG G MGG FVGGGGG G+)G'G G#GgGFFFFGGGPFGvGZG"G/G&G,$G3G!G'G,G-GG;GKGGG5GGGgG@FGfGG5G"GXG G,G/FxGkG GKGGG|GGG6GFFFG GGlGlG YGG GrG ,GPGuGGGG#GUG*G5GBGG NG &GGGFG"G)G,G;5G*G)G#GGG&G+HG",GbG,G=GDG7GTGZGEG8GGG GG GGG5G G/G4'G9 GD>G+G!G!GG\GG!vG+(G34G--G:tGEGA!G1G!-G!GGG$G\GGGGwG>G GG"mG+=G5G5GG G?TG7'GBGalGvGo$Gd'Gh/Gk'Gs~GgcGJGZGhGpGnmGpGPG4G<GBGQG<)G:GSG^HGcGZGJ=GASGJ?G]GXLGasGguGYGeGtGGvGc$GQVG@G=G1G,mG'GGF$F.GGG1G:GgG[`G?G(G=?G*FG,G$G4G=GNGPGMxG\GSGUGUeGPGhG~iGsGsGo<Gj(G_YGWgG%%G"GG!EG$G*G.G4G?GG[GewGUCGIGkG^eGc6GEGMFGGG>G=PGNGFGDGOGYGm]GsGGyG[`G>G3G24G1G*gGG$G+aG:G(G25G(G,G^G jGGGGGJGGG2GKG bGG&G3G1(G5KG?GJGjGhGb GZ:G[GO(G>FG,G+G!G(G=SGNGyGGGGGG}GNGQGV[GbG{GmwGpAGjGfGmGe'GeQG}GGGGGGGGe]Gf#GV1GCG;{G9G2G/TG5}G8G?GKG[GsGxxGGGGGGGGGGyGLGV2G>G.GGGFFFhFFFF FGG GGG#G G4|GGG#G' G#1GeGG)hG0yG=GAZGLG@GJ_GIGBG.=G&HG G"GGG-G+G0G, G/G5}G6nGAG@G-G)G0G?xG_2GsGGGGGsGGeGUGXG[G[GOGUGhGcGYG?FG/'G^G CGF$F(F2GGG lG tG WG#G'G+gG)fGG+GOG:G9G6G6G/<G!GGGG G -G GGGG/G&G@ G2G1G4G5?G*G>GEGEG}.GGr#GGt5Gt\GSGEG7G3G:MG+GRG>GIG,GGG GG#G'vG-G>@GVGWGwG_`GlG_iGJnG6tGWG GGBGFPF&FzGG G sGnGtGxG+cG"GGG{G>YGG5G7G@G>GIGcGGoGaGa@GJMG7,G1G5G+GC,GETG>G>G?G>G4G.G!RG G%GLGGGFGF\FfF`FF@FӒFFbFԶFFF FFòFFǴFԠFzFFLFFFGFG>GG FFFTGGG6GG-{G-LG>GGGG$G5kG!iGGGiGG TG G G GVG GdGG~G(vG,PGGG-G4GHGMG\GcGhGiGGRGLG8'G3G8tG''G(G'G+G#GG nGtGG ~GFGGFFfGGGGGG=GG0_G QG G-GGCG+FFF\FFFFFLFFF\F8F0F̆FFF&FǦFюFFvFFFF\FFFFDFo`FiFnxF}FFFFlFF\FF FFNFF` FOFChFJFS`FUtFXTFW4FNFO`FQHFOFb$FPF?|F2F04F-F,FETFL$FSFqFe$FTpFXlFgF]FK(FBFHF4XF6F2F8F:LF4@F@,F2F& FF`FF$FF\FF FpF0F$F0FH(FELF<F6F3F&FFF#F$FFF FEExEEEE@EF|F(E E E2E@0E7 E6E?ET0EYEJ0EV E:E8@E@@E^pEQ0EIpEJ`EJE_@EU`EaPEiEvpEpEoE]EnEEhEE(EPE EEEhE@EExEhEEE EEEEE(EEEEEEEpEEPEͨEEEXEEEPEEPEEhEEEpEEEEEEEHEEEE EEE(EEEEEEEE͠E EEEpEEpE EEEEEEE˸EpEސEE8EߠE8E EEEܘEEEEExEExEPEEEEEFXF\EExE@EpEHEEEE@EE0EEEpEEEEEEE܈EEEpEEͨEEEXEEE EE@FTFEEEhEFF |F 0FF EEEEFF FDFF F$F!F$pF-,F/F.F.F'F'F%F(8F.4F'F!hF tFF!F"0F"LF&F%F"FTFFFF|FF<FF$FhF4FF@FF"F"PFFF F F)F,F<0F?,FC8FAFG$FCFOF=LF9F@F>F;F=FBFEFMFMFWDFfFkFoFsFqFzHFupFwFLF.FXFFFFFjFF}FF,FlFF@F:FFFFyFbFNFMlFLFRFPFXFQ|FZFXLFWPFT|FYFU0FNFPDFNFRFd4F`Fg0FXFYtFTFM FDF?F?lF>hFL0FXFg FoHFs@FxpFFuFmxFl,FqdFmFvFnFzF4FjFF|FspFqFzFnFZFKtF;$F4F4F2F9DF7FHFO<FRFfFspFyFTFfF:FZF"FFFzFRFFPF,FFFFFHFFFF8FsFfFctF[F\Fc FkFmFu<FFF~<FxFe(FZFb8Fd FeFlFrFrTFwFwFkFoFuTF~XFxXF{ Fq0F`F]FgPFq Fw@FFFF^FNFF{FNF}Fr(FjFrFw F}Fy FFVFFFfFF.FnFVFJFFzFXFFbFxFjFxFjFFFF|FFFFFFLF FFFFFDFBFFhF~F@FpFVF¤FFFF FFtF¾FF0F F\FFF$FFlF>FҤFBFFFnFFFFFFFFFF"FF.FpFxXFlFFF F FFFFuFqFjFpFnFhFsFs FthFqDFoFjFkFg<FeFc<FgFbFmFFFFHFFFTFFF~|FuF}FFNFFFFFdFFFTFFFF<FFFFFFF@FF.FF,FFFZFFFFF>F F:F^FFFJFFFPFpFF4FFfFsxFqFyFVFrFFhFFFFFFFFhF<FFF:FRFtFFpF0FFFrFF@F٨FFFڎFF@FFFxF FFFF,F FFVF}|FwF~FFHF*FFFFF^F}Fw8FvFmFh0Fl0FjTFoFuFxFZFFFFFFjFFFFFFbFFlF FFFFFHFFFFFF"FF"FFFFFFF0FzFo`FwFwFw0FFFF$FFFF^FFxFFF|F8FFFFFFFF4FFFŞFFFFFFFlFFFFFFFF\FBFXFF|FFF͔F͚FVFJFĈF FrF6FPFFFFFFFFFFhFԸFFF\FXFnFFFFҊFFFDFFFFFZFFFFFFF*F&FFԪFFFFFF̺F,FXFF FFFFFFxFFFF FFFFZFFFBFFF0FFvFLFFFӼFݸFG GGG _GFFFFҘFFFFFDFׄFF0F@FdF FF FFFFFFbFXFFݔF޶FFFFlF\FFFvFF\GFxFF|FlFVFdF֪FJFFFZGFFHFlF@FbFFFtFGG.GGGpGG G2G iGlG.GFxFیFIJF<FF FFʊFpFըFGFFF֊FfFFFFFFG3GG,GGGGGFF\FzF@FǬFRFFF FFԺF֔FFǀFPFFFFLFVFFFFFFŤFBFFFFG G FFFFFFTFF.FPFώF֒FdFFFFFFnFF<FFԼFXFޠFFFDFFGSGlGQGGGGG1G G (FTGG 2GGGGGGGeGQGG BFFhFFPFFFFFFFFrF<FFFFvFFJF&FFFFFF\FFFLFF FΦFlF܌FRF:FFFF@FNFžFdFFG1FtFF2FFFFɆF֐FGGG|F2FИFFFFFFFF$FFFFϘFFʈFHF FڨFBF0FFF FFFFFFHG+GGTG GxGHFFF F~FFF0FFF<F G GGG KF@F*FF*GxGGG,G6G'GGGG'G"@GPGGG GJGFFFFކFFFF~G@GFGF~FFGqG:GGG[GGzG#!GG"*G!NG$xG!{G"G#G1GGMGGFGG LG4GGGhGkGG&GGGGGG GoGGGGG G1G%G"G4G(G$G G :GF&FFGG&GG!GGGGFF<FGFhF.GGGGGG2G!GvGG&G.G1oG( G6GPG'DGGdG\GG$fG+G88G2G0G&GGG G!xGAGGG jG GGGG`GG+G GGG$G=\G6 G.VGGG BGFFFFG G G GmG GG&G&UG5G=GEG1@G$G&G#G"G#G G#G+G"G+G ;GG|G<GG&\GvG vGG GG )G|GGGGGG0G(G+GGG,GG G"VGG G?GG0G6G!GG GGGG$G'G2GMGMG6<G'^GG;GG{GG$ G)G34G^GDG@G-GG&rGGG~G1GQGaGWGhGXlGDVG?"G2rG6GGGYG GG\G#G?FGNXG8GDG3G)G+G\G_GG'GG2G6G7G8GA~GL<G=G2G'G'9G*wG-SGGGGcG GqGGGG(G-tG8GGG;G6GGGcG}G~3Ga GaCGxzGrGUGDBGbGG} GGGIGEGEG3GGG>_GEOGL^G_GiGUGS;GHGG^GKGNwGmGwGeGW3G^!GdGiG[GUGKzGHG<\G-GGaGG5GGGG)GGGRGZG`GIG?GJGFKG6G*G.GEG=G=;GNGT,GPGb"GuGxGGGGG|GGmGW GEG#=G%%G!G*G:G.G0G:]GTGkGZGdGiGVGYGUlGPGYGPGVkGkGo&GVGLG]G}GmGGoMGh GUG?JG4FG/G)G.G.GG%G&G2G^GGG G&GGGGGnGGG$G&sG3G3EG&yG'G3G=GFGZGqGiGyJGoGX;G?G'GGG#DG=wGVGGGGGGGbGcGVWG\GcGzGG}G\GJGQGQG^OG{GGGGGGGGlbG^>GR8GCVG: G5IG;6G2G,~G4$G8MGPGvCGGGGGGGGGGGGGaGDGCG4GGG FFFFFFFGG4GG"G3G5G'G.?GGG&2G,pG4G%G#)G@G6GHYGM}GXGMHG;xGIGDG-G#G!GGG:GGG G(G1G5]G=GJGJPG89G0G(ZG(G2GIGaGt}GGa GnUGiGbGYGaGSGeGaG_G]GrGZG`GCSG:GG jGcFFxF.FzG(G fGMGG6GG%oG"GG"G8=G G-G%xG&G,G)G!GGGGGWG GG*G/G,GBG&\G-G4HG<G-G(G.G4GaxGwG_GsGtGGPGDG1G)G&TG' GGGG -GGWGEGDG G&GG*!GBGVGV/G1 G8G,GCRG&.G DGG(GGGLFFbFGGG GeG#GGGG~GG!GcG$G>G;GGFFFdF<G GGGG GYGGG-GGGG`GG G GsGGPGGGNGGG_G+G,G3G,G-nG7G>GORGnHGb}Gk-GGaGLcGNoG/G DG!GiGGGG FFGGF^FFFFFF FG dGGG GGG9:GG }GqG F8FFFFFF8FZF,FFFnFTFFFF¢FlFǸFâFFFF>FFF&F0FFzF4FFw@FiFshFx(FFFFFhFfFFHFJF(FFjFJPF@FCFKFKFDF?DFAF=FBFMFcF[FGF/F+tF+F7FPlFP`FQ8FXFm4FiFaFWF\FLF<F9FLFF F@FK`FBFdF2`F!FFFFFF\FF @FHFF|F2FBpFHF:pFAF5F+F"F (F)\F3xF$HFhF"(F \F EExE(EpEވEExFlE+E+E.E1E0E6E/E:EG0E[`EMEBE-E9EW`ElEV ERE`EW0E]EiEdpEl EEqPErEzEE(EpEEE E EEEEHE0EEEE`EE8EEEEE@E0EExEEE@E@EEٸE@EEExEEEExExEEEEEEEhEEE8EE8EE0EEE@EEEEEEȸEPEӀEpE(EPEEEEHE@EE8EEpE€E0EPE@EEEEEEEEרEXE(EEHExEhEE8FE8EEEEhFpF <FEpE(EEPFlEEXEExEpEոEEEEE@EEEEԐE؀EҘEՀE EEEXEEEXE(ExEF\F E`EFFxF F`FF E8ExEHEFFDFFF#F/F1F+F3F8FA<F@F0 F(F%8F&F&F,F-$F#F4F%F)F)HF!F$F' F&hF%(F$F$FhFFDFFF\FFF F<FFFF $F$lF$F%F:8F@FD FNFCFGF\LFXFZ\FKxFBF=<F?F?<FFFP8FY$FeHF`Fi FtFrFq0F|F{PF}FyFFFFFF FF>FFrFF2FFFFzFFFFzFjFYFS4FQFaFaFgF]FcFuhFspFsFkFiFYF[PFY`F_FdtFm|Fl8F_`FaFb0F\FPFAFC<F=FGFWFeFuFuFv`F}FFFFvFwFyF*FtFFFFwtFnFvpFfF_xFQ FKPFD(F?F9F4<F0F3 FAFL,FYFh0F~ F FNF F6FFFFF@FFFFFFF>FF$F$FFF|FpFjFdFn,FnhFmFkF~F>F&FnFzFqLFhTFbFaFe\FeFqFzpFz<FpFqtFlhFsFt(FmhFrFt|FqFhFvHFtF}FFFFFF6FFFFFFFFF$FFF.FFjFzFFDFF|FhFFFFhFfFFFrFFFFFFvFlFFFFFFFFFF˴FzFFPFF*FњFvF>FjFVFPFNFFF6F&F&FFɪF>FFFFvFFFFFFFFFF†FFFnFF8FFFFF\FFFFF.FFFF@FF:F^FFFZF FFFzTFpFqFn\FlFg<FgFl,FpdFsFFF F\F@FFLFF.FFDF}FFFFHFFF(F*F8F\FFFvFFFFFFFFF0FFFFlF2FDF^FFJF`F<FFpFDFPFFVFFFFFFFFFF}FTFF FFFFF FF0FXFdFF&FnFRFF*FFFF FRFƖFFFF8FG-G zGFFFҰFFFFFFFF.F`F4FFFFFF2FFF:FFFFTFPFFFyFvxFn FvhF}F}FDFFBF F@FFXF|FxFFFFFF^FFvFFFFFFFFF&F FF"FFXFxF|FdFFPF{FzFxF}FyPFFFvF,F4FF~FJFF:F>FF8FrF FFFVFtFF^FFF`FF,FXFXFF6FFF2FFF@FFFFFlFFFFFxF(FPFFF&FF>FFdFԂFNFVFϬFhF:F`FŀF>FXFpF^F>F~FF0FVFʜFPF F6FrF FFFF F FF2FFF@FJFFF FFFFFF,FFFFfFFFRF$FFFFȚFFFF(FؔFʹF*FƨFDF0FFFFFFFFG@GGGGFFFFFF:FFF$FF׌FFFFF،F:F˲FFFF F&FtFFtFѺFbFFF`F<F0FGG_G GFFLF֮FPFFҌFFGGGGIF"FFFfFFGGG G!G.GG9GaG G GG(GGGFRF|FǰF|FlF.FFFF FFFFFBF`F4F^FFF.GGGZG'mG,G5GGG+GFFFؔFF*F(F(FF@FѴF6FظFFFFHFFʨFטFFTF8FFFXFhFLFFGG G FF4F&FFFZFFҌFF|FFFF&F,FFFFF0FFF(GFFDF GG"G#"G#GGGG]GG%G!GuGG2G GIGGGG GG(>G*GGGFHFF̬FFFFFF2FtFvFDFF6FHFTFFFɶF:FFLFFF FPFF,GFFFFFF^F6FFdžFFFF٢FGGG4F(F<FFFFHFVFGGLG lGFF~FfFFFFdFFF̦F0F֘FF6FFИFVFlF"FPFFFFFFFFF6FGGGGGGFFzFFFFFGGGG )G*G"|G.GFFxF8FPG GG GA,GPG=G0G(MG*G6G6G=VG-G.1G.G(nG FNF`FFdFFLFFG^GGQG6F4FFGNGG!XG2GvG GG$TG)FG(G-:G1G3G7G,GBGG GG PG 'GPG+G2G:G)GG!G1G0IG*G'G%GGG'G4G0?G-kG+G&9G&G#G#G!8G G',G SG GWG AG|FFhGEG CGFFGIG }GF*FF\FGkGG"G(cG1~G3G3EG0G2GrG*G6$G7G'G/ G, GyGG KGG&G-G0G<GMGXCGaG>_G7{G)G)G$GGGBG G^GlGGGGGG)BG G0G1zG=GOGF5G5G)GGGFPFGGlGGGGGG-G/{GDGZGYG7kG!sG RG)QG/G)oG(G+5G,2G':GGG"9G/OG4G0G)fG"G-WGG G#IGGGSGG,GrGGG.G<_G%#GG GGvGG$G%G%FG!0G&cG6G%GGGGGG2G0G6zGDGLdGKG<G.G) G*GzGGG&G9 G-GWGZGi\GLG5GCG0sG%GGMGpGpGu`GwGhGRSG>G0G&GG ?GeGG NG1G>GKGNG>=G=CG3,G*G5 G,GG#7G;G?5G;*GGGODGFGFG@UGCG4G$G%G-G%G# GGGGQGkGWGGG,G1G>G?\G4G7GbGdGg:GQkGUG`VG}VG^GPGi'GGGGyGN,GJGNoGDG=G?\GNG]VGsGGkGe{GF&GIGGGIGiG}GsAG_bG[GjrGj|GW5GH1GBG;G5G+GG]G0GGHG".G*G8\GQGrPGfGQGAGJGP-G4LG/JG8"G9G=TG8G>+GR0GaGm+G|!GGzGGGGpQGqGZGLG?@G!GG%BG2 G9G3G5GAG[G|GmG`GfGiGkiGRG>GKGh]GsGGGeGi?G]cGjGGGz G``GYG?G=HG7G2G3G/KG*GiG!G:GGGGqG tG\G G0GGG:G#G.?G.3G:MG?RG.G$;G/7G;GKyGeGw$GGGGtjGDG,GGG+G=GU?GGGGGGGe GOGZGV$GK>GbG|GvGWGQlGLGU<GYGsGoGGGGGuZGqGu&GdG\*GP2G>GG3G.G%G*G/G6TGNlG}DGGGGGGGGGGGGGnGJG=GFG0GGRGKGGGGGGG GLG%G+G.G3G2+G)G!G%G5G>G?VG;cG<GKCGJGPGVGhGXmGHG[RG_vG%G!GG3G%_GGGGG*%G4 G<G=GFGLGH#G8"G&GGG5GEGTGjQGaG]{Ga0GVGOGbmGZGgGaG\G\GjGk~GcGSG?|GG GFFFF>GGWG G G%GG)GG2G(GGGGG{G+sG0qGGG$GGGLGG(G)G7G:G8G:2G2qG]/G.4G 8G{G"G=GA\GSGeGzGGj8G?}G9G.G+G,G#GGG sG(G(GGG}G)G8GG#G;G*jGGjG(G.G`GFG{GrFFHF2G FGGGG#SG"8GMG|G G G~G vG(oG/YG?GKJGIGFGSGvG?8G2G7GKAG/kG/yG/\G4sG-mG5cG2YG5`G.G%HG!GGG5GG G iGFFFnF>FFTFdFFFFzFFԖF:FF|FFTF4FF(FFNFfFhFFFFF FFFFݎFF0G1G[GG'GG GGGFG GG GRGG*GGGG!GwGQGGGG"gG1G.G"wG0G'G>GDG}oGZdGfGoGp\GVG^G2GGGGlGGFրFFTFFDFɆFΜF׾FͰFzFXFFG GJG GGxG(GG1G GwFFF$FFВFFF8FFDFHFHFBFFFFNFԈFF>FF~FF(FF2FF8FTFFF}dFBFtF{FFFF\FFFbFFpF(FvFpDFYFM<FBFD$FPTFJF?4F;F?FIFMFPFHhFJF;F1F)F8FNFN`FH FLpFDF]Fe@FEF5F>F8F04F@DF>hF@FQFI,F<F, F(F#FFHFFF(FFF XFF xFF!DF> FAFJFGPFCF-0F%F3F(0F2 F)F|FpFF(FhEEEE׀EpE֠EE0E0E.PE'E-E2 E+`E7pE;E<`E< ECE4pE4@EAEHEgE] EaEcPEOpEQE`0EqEfEs@Ei EzEPEEPEhEE0E`EEE(E0EE`EEpEhE8E E8EExEEEEE8EE`EpEE֘EEPEPE ExEExEEHEXE(EEEPEpEEEXEpEEE@E@EEEEEpE(EEEEEǨEEXEEĨEøEPEEEEEEEhEEȨEE0E׸EEpEEPEEEXE0E`EHEEEEEEEEEPEEFFHF 4FHEEEE EEXEE@EEEEހEPE٘EEE EXEE0E8EEEٰE0EEEHEEEpEHEHFEFF$F0F F 0FFF(EEF|FFFF$ F+4F&DF:F<`F7dF:@F><FE<F=F.TF1PF(F,PF&F(F)F+pF&F'F*LF$F)(F-`F+F,F#F FFFtFF$(FxFlFTF"F!F|FDF$FF TF!F&8F;TFDLFD F]FL FSTFOxFa`FfHF\FKFSFAFD(FQFkFrdFkFm8FchFo Fr$FsFnFqlFu(Fr FzXFyFFF~FF~F$FFbFFZFFFFFFF.FFFwFo<FwFyFvF|FxFF}8FxFF FyFmDFhFh4FvFFqFmFjFc0F\FftFgFaFUFJFLFQFXFaFd4FvFqFs|FFFF&FbF|xF FbFFFFtFtFmXFcF[FTFMFGFNHFA(F4TF3F2F@FKxFWXF`Fx8FNFFLFnF&F\FFFBFFFVFF>FF0FfFFFF2FVFHFpFn\Fq(Fx$FyFxFFFFFF}FoFhDF[`F``FalFlPFnFnFp$FsTFqFq$FrFqFq\FvHFF$F~(F:FF"FFFFFFJF~FFF|F^FzFHFFFFFF FfF~FbF,FTFFDFFFFFFFnFZFFFFbFxFFFVF>FFFFF2FF`FbFFF|F FRFFFFרFrF"FƺFF\FǪFFǘFͺFTFFJFFFͶF:FF$FFF˘FFFFFFzFFrFLFFFF*FFF"FFFF@FF<FFFF<FPFF|FyFpFz8FkFl,Fi0FjFsFyFFFZFFFjF FFFFF|FFFFF4FFFFZFF"F:FFF0FFF,FFFF:FFFFBFF0F:FHF FFJFVFFFFrF(F6FZFF0F|FFFFFFFFDF^FpFFFFFFLFʺFFJFמFFFFhFLjFPFˠF΀FغFʀFʹFFGG;GFJFFFϼFfFFFFF(FzFFFFFFFpFdF.FFxFFFFFFFHFFy0F*FNFFFFFFFvFfFFFFFFF"FFF€FNFNFNFF>FJFFFFFF|F4FFFFHFFFFLFdFFFfFFFFFF FFFFFFFTF@FFF6F F6FFFFFFNF4FFF8FFFTFnFFFFFFFFFFF8F.FfF\F.FFFXFNFFpFFFF\FʞFXFF6FtFFFFFFFݸF֌F>FFhFFTFF.FVF݈FF\FȾFפF^FFZFF"FFFF^FF0FFFF>FFFvFxFFpFFF(F$FFFGAFzFFFFF,FFFrFFVFɆFxFF GGGGVGGGTFFFFFTF6FFrFZFHFZFFFߖFղF FF2FªFFɺF0FFFFF(FF FЮFFGG YG (G GG F FF&F:FVFF*GiG GG[G*FrF4FGG kGGGG'G&G"G!GG;GG&WG!oGGAGDFFעFFèFFFFFFF8F2FFvFbFF:FfFvFFRGGG%G%:G @G"NGwG G<GF$FnFFشF&F߄FFF0FFмF$F¸FFFFF̬FFDF.F"F8FFFܚFGG G VG)G GUFXFFF&FFFޘF(FFɈFFFdFF|FFFϲFJFFFGGmG/G wGRG)G,G"G#MGGCG%G-G/7G(GyGGGGG G2G<G5?G<7G& G*GGF\FFF FʊFdFF,FFǀFFFFFFFFFдFFۨFFZFPFGfGGEG GGRGFFF۶FTFF4F FFߢF&G'G G G G yG AGFFFZFFG GG G G FFF׌FFێFtFFFFvFvFFFFӪF*F0FFFŢFǞFFFF@FVFFG|GG GGFGFFFF~FFnGGCGG yGSG hG:G9G GGGWGGCG.7G8GEGbGMjG?G:G7GP[GPDGKhG;^G,|GbGGGnFFFF FFF\FGFG:GGG .GqG(GGGG!G'G(G.G0G.G4G5|G/G-G%zGGoGG"G*G*G;G;G@G2RG5SGDG;oG5 G-GG+G4Gk3GG4G1G-G3G$WG@G$oGGG G&G"G&aGG GGGGGGGFpFPGGGF6FFFG G \G9GEGJGOGFPGITG4G7G8GJGPWG.G,DG5hG.GFG G~G0G5G4G@G]1GZ;GoG_GGxG8G9GLGD9G(GGGGG$sG GG#G%G*G/G=GJUGJGVGPGI`G9G.G G FGFBGyGGYGG!G%lG/GAGF"GEGZG\"G5G[G"6G.TG'G.G-G(G78G7cG9zG5G,G@GQGEGJGZ2GPMGBeGMG9WG5G/G5G3,G+GSG%G3qG?G9G.-G"GGGGG(`G,BG-G(G,1G<9GGGGG-bG<GDG[GGZGiGVGV|GB+GLGJGEG8G//G:G<*GHG~ GGGGRmGCG>qG?9GI-GqGGGGG{G`GN*GX>G7G+G0G*G,G.G5#G>GLGIGIkGCG.EG'G6G>G(G'G7VG?_GGN)GIGIGJ,G\GcZG\G\<GP\GQGUG[LGlGGGG~GrG`GkGmGT`GS`GG|G/NG,G"iG'G0G=GQGlGGGGGGGGGGGGGe6GWGP,GIG@G1G'GCGGG AGKGGG9GG G/G+G:G6G$G$7G=GR-GRGdGhKGPxGCGOG\:GiMGrGZGYGSGRGM~G@*G G.GG G{GGG%G0G7G?G?G@G2G%]GGG!gG+GCGUGFLGS/GRG^GnGlGp@GjGdaGWGnGoG^LG[GOVGDG3G%GGFF,FFzF2GGGGG$PG3GhGwG%CGZGGmGG.KG73GGAG&GGGUGG&@G/G?G>G9oG1$G2qG25G,mGGeG#G%uG,GVGX(G_GpGgRGV^G=G7<G2_G2G0 G6G0G$G G5G&GG G G GGG _GG_GG`GJG @GZFFFGFFF^G G G!GG'GPGgG!GGWG1G4G-G.>G<G>G2G;GM:GbUG*G$)G&G3G4G*G+G[G+G(G-,G-G+GNGAGpGxG GGQGGbFFٌFF<FʒF.FFF:FFFFFF\FFFFFFF^FFFFF6F2FFFDFFFF>FFGIG GFFFFFFFFGGGGGGGhG GbG GGG G5G(G7qG7BG*G3GFG6}GP GUGbG]}G]9GWGBG6!GvGaGGFF6FFFFFnFFF FFFFfFG*FFG[G vGAG GG G FFFpF FbFFFFzFF(FFNFFVF FF"FFF"FFF6FFFF2FHFFFBFFvlFsFh(FcFx8FFhFFjFJFFF^FDFtFfFQHFJFAFIpF[F^FUFGFKFKFTtFFPFHF8F)F$F0FA FB,F> F2F/DF,F:DF0F"`F!F3F/F4F)F F%lF5F3F%HFF,F@F `F FLFdFFxFFFFF+F4,F90F9`F4F.\F1F2F'F(4F$dFPFFF FFlEEpEE`EEEͰE2E2E:E1E-PE5pE6E7E9E=E3E2E6E4E@PEGED0ENESEhPEaPEHESEWpEkEn`Er0EjEvPE`EEhExEEE@EEEEEEEhEEHE EEE@EXEEEEEEHE0EސE@E`E(EXE`EHEEEE(EEEEEEEEEEEXEEE8EE`E@EEEExEEEEͨEE(EEEpEEEEE8EEEEE@EE`EE EEEEpEEhE(EFXF8EXEEEE@EEEFF TFPFFFEhEEEEEhEEEEE@EވEE8EޠE(EEE@EpEEEEEExEE0EEEPEE FhFFFF FF F@FFF FEXF FFdF"lF+F6 F<`FA`F?FJ<FOhFD`FGFD|F1F.PF2F'hF% F&F&F*F*F'F)F"F*F)F14F*F%<F!FFFF(F dF&F!FF%XF%F&8F!FF|F% F+xF1F8LFCF@FXFaF\FgFxFmFi`FVFDFGFa<FFFFrFhFelFg<FlF_F]FmLFl<FnFsFFFFF&F(FF~FFFzFFFFFF*FFhFFRFdF FTF~F*F FFFvFF|F|XFqF| FF}4FuLFoFk0FkpFlFtFr(F[,FMFHTFRFWFSFYlFdhFtF}|FFF2FFFFFFjFF4F FtDFmlFaFVFU FXHFV|FRFPF?FAHFAHFJFQFOFc|F|FjF FhFFFFFZFF FFFF:F8F8FFjFFFF|FF"FxFvFy|F{F|FF*FFFF F8FtFi(FaFitFgFnxFkFpdFw|FyFLFwFu FqFxlFwF"FF,FFFFFFFFrFF~FF2F F|FRF&FFFF"FFF8FF8FFHFFFFdFFFzFF\F2FFFF<FFFFFFFlFDFlFFF.FВFF@FDFFFFFF FFHF2FFFFĖFhF<FɘFFŐFFFFƤFvF FvFJFFF(FFFF*FFFFfFFFhFFFXFFFLFZFFFFFF6FF{F|F}FxFoFp<FoFr F~TF{FFhFFF FF2F>FpFFFnFdFFF0FFDF6FFFNF FfFFFFFFFF8FrFFFRFFFFvF̎FnFFJFF"FFFFFFFFFFNF`FdFHFFFRFFHFFdFFFvFFFFFzFFFlFFFFFTFFF׺FF҆FنFF6GG GFFFF:FFFF2FHF6FFFnFF F0FtFF&FFpFFZFF^FvFPFFFFF(FFF@FFF:FFFtFǾFPFFF F:FFFZFɤFFPFFzFFFFFFFZFĜFFFFFZFFFFnFFFFFFtFFFFFFFJFFFFdFFF|F"FFFFFZFF2FFVF8FFRF2F*FFFF&FF"FBFFFFFFFF(FFLFFVFF*FFFFGzFFF̴FVFFFFFF6F"FZFFNFHFDFdF|FfFFFF,FİFFFfFGFvGFRGOFFdFFFFF԰FFVFFFFFFFGGFFFFLFG+G GwGFFFʬFFF>FFžFFFF~GG GG jGIG GFxF FFFFF2FbF8FTFFxF~FF٘FdFFЀFFZFXFϰFFϨFF"FFFFGGG GXGGGGFzFBFFGG2G GG G,GVGG.G (G<GaG;HGLUG4SG4=G58G,G"-GMGSG'6G'G*G!GMGG7FFFvFzF|FʎFtFVFdF$FFF@FFFFFF"F@G<G aGG#[G'}G)G!-G~GTGFFtFFHFF׊FۮFڔFTFȰF6F~FrFFF^FnF̾FF,FFGeFFF0F2GG aG GGG:FFtFF FF|FFjF٪FF0FjFFFZFFFF FҀF(G 1GJG G MGG%|G:GWG=G2&G-G-G)G1G;G+GYGGG!)G<GG:G?G/G+/G-nG*G'|G{GF`FFFFTFRFFFFFǦFźFxF~F.FFF FFFFF*FG=GGG"GZGFGvFFFF$FnFFXF־FXFbFGG GGGGG(G GGGGGqGGGG3GGFF|FFdFGjFFFFrFFnF0FFFFFPFȖF(FNFFHFLFRFۊF(FGNFzF"FbGFFFFFLFG}GGGGiG3eGUNGKG1G%GfG sG4G)yG7GCGBG\VGmGGG<GKXGrEGiG[/GI;G+yG.(G$G%FBFBF&FxFxF<GGFG/GFFGG!GGGcG.G)ZG+^G3G,G$G)G-G1PG4IGAWG9XGAG>WG-gGGG7$G/G7xG1}G:GB7G6KGDGPGHlGCjGAaG"G/IGRGOGyGuOGXG1G9G* G!G!GG#GGaGfG$!GGFGGGvG{G 5G ?GFpF:FFFF<FjG GG'XG=G\G_;GTGG%GRGR}G@5GLG[5GVqGEG2rG/G,G#fG)G.|GAGIGJOGjG}5GGGkGR"GHG^GG].G<G/gG!,GG$jG*G&G-G:G2 GGG=GNGWwG[Gc GpGd GY{G<G=oG FG`GG GPGCG#MG)G9)GGCGUPGPiGDGKGRG1$GG!zG-G1lG:$G2G.G<GMWGIG:G;bGOMGXG^_GjGTGZGOGEhG;TG.:G+G*%G'oG?GGJG0G#VG0pG=G+pG+GG$GAGG0+G2&G,BG,"G0=G8G<9GG%GGG0G@HGNGZ{G](GeGySGdGaG_GfGjWGelGBGCGNiG`GGGGGG|GbGtbGGGGGGGGG`GbGOGBG>LGGeGLG<GG!-G&G'GVG G%G G2G0G-G2]G5~GB(GHG\JG`!GIG;G9]GS"GSGKGbGGGGGa3GLOGenGWGKGSCG\G^GnGGdGI;GZvGP GLGXaG|7GqG{G\GS>GZuGYGHG8G,G(G4MG1GEG1GAG;G=G<G;GUG_MG_G[G?~G?GK3GUIG>G9G>uGDGP<GLGAgGOiGYGbhGGGGGGGl GpGQzG8G6}G)GHGG'\G/G4G4GBGR,GmGhGTGaGmGdGiG_MGjG{GGGGGG{G]GPGzGhzGcGYG]GOGCG6G4G4 GGGG :G #GG GzGSGGGG-G% GG1~G=G?GV9GWGFJG5}G.G0G5GQGLGlGGGGYmG<GG)G@G_GGnGGGGGGTGCqG<G<G6G>_GIGVG[=GSGOGM GRG`VGk;GkGx)GaVGGG{dGmGdGc/GFGD8G9:G1G1G(uG$G*G- G8GQGGGGGGGGGGGGk=GbeGeGbGkGOGCG+DGuGGGGG+G GZGGGkG/<G,G6cG2iG(G)G0GQXGfGaXGcGLGXGdIG_GbTGVeG[hGaGNGHaGNG8G1G GGNG G 9GGIG&fG4TGLGCDGB?G6!G#GSGGGG=G["G/dGDGY!GvGp!GxxGGGeGTG]GkGgGW6GEGF?GIG1G"$GFFbF|F4F4GG GGVGGGGG@G|GHG0GG#G(G G GGGwG G&G-uG>G@GQ\G5G+G*G$GGG QGGGGG-GcdG^KGb<G[)GN,GBoG30G8G=EG5`GGG?mG?G-eG+G2G2G)GGGGFFF FFGFFFFtFFnFFF GG GGGGGGGbGRG#G=G:kGMG[G@,G;G<~G/[G=GGG,G"jG'G,GGGGG'JG GGGGG (G GGpGGuGGFFծFɂFFFFFFF FFFFFFDFFhFFƢF`FBFFF8FDFFFF0FFrFF4FDGKFGMG FHFdFFFFLFFFFRFGG GGG'>GGG GGGGG#G/G-G,G0&G3fG:GCxG6eG6GAG??G*NG3G*qG#GFF,FF8FFFϜFF°FFFFFF@FFtF:FGGGFGG XG FFўF`FF^FFvF@FFFHFzFFFͪFFlFFRFvFFF`FFzFFFFjFRFFqFyFfFZF]PFhFsF2FFF4FFFNFdFc,F`FR FF4FLtFOHFH|FOFftFYFK0FHF0dF&FF+ FF@FF&F*F$F'F+F"FF!F$F#DF$hF)F)$FTFFHFFFFFFF F|EFLFF$F<FTFFFFpFFLF FFF!F)lF FTFFF,F (FFDExEE0EhEĠEE(E70E70E9ECE-E/E2`E= ECE;E9E1E8E=E?EGPEQ`ENEHEVEbE_pEY@EREWE_PEbEWEhE~`EEEEPEEEEEhEEEEE@EHEEEEEXEEEEpEEEXEԐEEpExEEhEpEEE EEEEhEHE EEEEEEhE`EEEE0E8E0EpEhEhEEEpEPE۰E@EF,EEHEEEEE0EEEEEEEEހE0E(FF@EEE0EEhF dF@EEEhEҘE@EEE@FFFFFF|FE(E0EEEXEEE׈EEEhEՐE E`EֈEpEEEPEEhEEEE8EHEEEEEEpFFF \F LF F FF FTF4F F tFFF"F1HF8dFAFAF>FIFQFI@FUHFLlFHF:F1F2\F(8FF F)F-DF'|FdFF'F'$F-,F-F00F'FFFFxFLFF&,FF#$F)(F/F'(F&F&F FF'F/F2F@FDFPFk(FkFaFd|Fp\Fn0F_FKFYHF|FvF^FFdFzFxFmF_FSFYF]Fg Fj FgtFlDFF.FFFFF,FvFFFFFFFFpFF,FlFFFFFtFFFbFFhF>F~PF"FXFF\FFFx0Ft8F~8FFPFsFdFXFOhFUFUpFYF_FaFqFFhFzFFFFlFFhFF"FFDF FuF_FWFUTFWFVFSFLFGDFKDFIFNFOFQF_Ft$FyFFFFF4FFFFFFFfFZFrFFFFFFF~F,FFFFfFFFXF`FFFF"FFF FFx<F~4F,F}F~FrFvF.FF|FrFztFFFFF$FFFFtFF(FF@F F F8FF\F~FFFFFFF F*FFFF`FFFt$Fy8FzF\FFFF|F FFFFBFLFFF&FFF FFrFFbFѰF|FFFVFFFF$FF:FF&F<FFFFF`FFPFFFǶFFFFFFdF.FȸFZF4FʢFFFFFFFPF6FF2F6FRF^FTFĒFFFtFbFF8FFF\FF"FF<F}\FrxF`F2FFFF"FFFXF8F(FF4FFFFF^FFFFFFF$FF0FFRFFF&FFFHFFJFFFFFpF"FFFFFޠFFFFFFFFFF2FBFBFFFFbFFFFjFnFJFF0FDFFFF`FFFF F(FӤFNFTFFFlFTF FтFьFpFFbFFF@FHFޠFFFFFFF,FFPFFF:FFFF8F6FFLFpFFPFFFFFvFJFPFF$FFRFTFFFF FLFFVFFJFFvFŒFFF̊F@FFFFPFFɢFFF8FƴFFBFFbFFF6F\FF^FFFFfFFFXFFFFFFpFFF6FfFLFFFFVFFF>F\F FFFFFFFpF>F&FFFFFFF*FFrFVFFF݀FFFpFºFF͞FF՘F:FG!G GFFFFF,FF>FFGMF>FTFFFFzF:FFFFӆFFGGGGGGyGGG "FxF~FFZFӌFFF>FnFFFFFGjG/GFdGFjFnGbG G:G GgFZFFbFdFF.FF&FFvFFGGGiGVGCFDFFF2F.GGFFFFFFFF"FFlFFFNFFƘFFFFPGGfFFF0GG GGGGG $GlFFլF0FFGmG GtGLG3G&4GGG&G1GHGFGTGZGBGSG>UG+G&XG!oG+]G6GKjG=jG/rGGJFFRFДFFhFFBFF(F8FDFRFFF2FlF4FFFPFFhG`GBGGGgGG-G GYGFFZFјF2FFvF(FFFȠF.FFRFFFǢF֊F(FFFFFڀFBGhGCGGG wGRG :G'G=FFbGFFF*FFFFվFѬF*F՞FXF FڸFٌFFG[GG%GGG)3G8Gi3GxmG2&G9/G,GMGN>G\GG>G&gGhG.#GOGA?GCG9G-G,G7G+G$ GFF6F.FFF؞F.FζFjF*FǦF@FnF͖FFxF<F݊FFGFFF"GGMG*CG1G/G!2GvGFFFF,FւFFF*F6FF^GG (GG GGG .G)G LGG &GGGGG#G_GG3GG,FG EFF FFFFFFFFFFͼFF2FFVF.FnFfFZFzFG~GGGGqGvFFrFF,GGGtG!GG G;GR GXG5G+G <G;GG%G8fGXtGXNGq;GGaGIGGGaGhGeG\GCG1G:>G-GvFBFF0FFGGhF*GFG0GG MGGAGG$G70G/G*wG5G'8G"2G)[G=:GOGJGNGCGBG;XG$JG)G)LG1}G1G1VG1bG@G1G;_GNJGNG` GMUG8rGGFGI%GUGGG{GmgGfGaBGXGJG>bG/iG(G5G<GFGKdGLGXGRGMZGB.GVG`GaGX$G@GCGCGOGSGQ6GL<GQGEGA8GHGTGZ;GiGGGGGGGhGXGLEG7G0GGGG#rG&G:G;GIGbLGd$GZGVjGUGiGiGtGcG\GgWGGGGGxG{pGvGWGhZGhGX_G[iGZ G\MGH=G1G:AG"GG GGWGIGG+GGUGvG GGG`GG+yG6G@hGQGObGGG3G&G"G#GG6GAGC)GH<GHGR&GR#GCGFcG1|G*G=bG2GyG GFFބF2F>F^FFFFF$FGGsFBGG ,G$G?G7G#}GGNGGG%G/GGGKGTGYGSbG?G+ G#GGG GGlGG\GG G GGGGFFGGGfG G PGFFFF`FFvFRFFFFFFFFjFFFFȞF FFFNFFFFVFFFFFFFFFޤFۊF@FFFFF8FɸFŀF6F>F8F~FF6FtFdG ~G~G&XGG<G=GG!GG@GG^G1FG&eG&G01G/G'G%nG&JG,^G-G2G&G*G#GGGGFFdFFˢFFFFFxFFF8FǺF@FlF~FF(FFHFFFF6FF$FFFFFtFFFFFFFFF.FFF2FHFFFFFFRF^FFrFFFFpDF\FdTFUFEFHFDXFWFYFh@F|F~F`FZFFxF_FZFXFTDFJFEFDFZlFeF_FKPF?F-F@FF|FTFFF(F#TF&(F$F&DF#FLFdFF8FFLF&FlFF|FhF<FTFxFFFdF FFlEE8E8EEEFDEhFFFF FFPFHFF0FF F FF FF8E(E(EEEʈEEPPEPPE@E;E5E-E/E7E<ECE;E=EK`E@ E<`EE EIELESESEY@EhE^@EQEEPEQERE`E[0EupEhEExEEPEEE8EEEE EXEEExEEEE@EExEEEpEE8EhEExE(EEEE E`EEEEEpEEpEEEEEEEEE0EEhEEEEE`EEExEXEEE EEEEE8EEȀE EE@E`EEϸE EEpE8EE(F XFDEFFFF`FDEE8EEE8E8EEHFFTEEEpEEEE0EEpEEPE(EEۀEpExEEEڀEE EE@FF FFFFEFEXFEEEPEPFdFFF XFF FDFF\F F0FF <FF-F9XF9HF?FB`FNpFR$FL FQ\FFF>FBTFP,FL F5F'F"TFF#8F F!XFFPFF%0F'TF$F%,F(FFLFFF!@F#F%F.LF1F1XF.F5hF/0F*F)F#F'F(F0F9PFHFQXFaFj FXF_`FsFpF`FVFn FnFjFF"FFFFmFbFYdFSFSFOFTF](FbXFjFwHFFFHFwFpFFFHFFFFFF FF^FF`FPFFFF| FyFFlFFF^FzFFLFdFFHFbFFFFFx@FnFaTFX0FVLFMFWF[FiFgF~dF}F~LF@FDF{FbFFFF,FFz0FxFv FmLFXFV8FRFWFVFFFK8FLFKFPFYXFXFX$F[ FdFFTFFBFFpF:FF>FrFlFFFFF8FFFFFF.FFFLF\FFNFFF\F0FFLFFF>FrF~FFF|FFFFNFF4F\FxFFnFfFF(FFFFF&FFF.FFFFFFlFFhFFhFFFF FFFF}xFpFohFqFpFvFFz FFLFFjF@FbFF|FFFFFFBF͒FF۲FPFnFF|FtFFFFZFFF,F&F~FFFFƈFFFFVFFňFFF6FφFтFFFFFF.FFRF F*FF&FF F8FFFFF2FFFF"FF*FFFF:FVFFF2F"FVFFPFFFFzFF:FF`FFFFFJFFF$FF,F4FFFFFDFLF>F.FǦFFFFTFBFVFDFFFFFVFFFFFF͎FFFFF@FFFFDFFFFhF0FHFFFFFFFJFFFFF0F`F4FFDFFFfFF>FFpF`FrF FFF`FfF"FzFۆFPFF0FͨFJFFFFFFFF6FFrFFFRFlF&FRFFF`FFFFF:FFF FFFFFFdFFFvFF FBFFNFFF$FHFFFİFŊFFF,FFÀFFFFFF FFF`FFfFZF`FRFFFBFFFF0FF@FFFFFFFF.FFFFFFF"FF$FFdF(FFFFFFFFF$FpFFFFF|FFFɘFFXF<FPFvF FÌFF`F.FݸGoG=_GGGFdF(FFGXFdFGGGFFFF؞FdFFFFFFjFFGqGGG5GG`GQGGGFXF:FF\FFFHFvFFĄFF GOGAGG G'GkGEGG@GG G FF&FFFĎFF@F"F^FHF$FF:FG VGIG G2FFDFFnFFF:FvFbFJFtFFF\FܴFFFVF,FjFF҄FTFFvFG GG'G=FG)GG GGG GJG)F^FtFFFG;GmGgG#G49G)G-GGG&G>fGMQGMGeGoGQ%GJGRvG7G.G3G5nGQGaGMG5G-G.G$F:FFRFFFGFFnFtFFFFFF"FFFFGGGGG fGpGGGdGwGFFFՈFFˆF>FfF~FFXFFFpF‚F<FѶFF|F\FFF`FFLGhGG GG aG G G}G>GG<GGFtF|FF*FlFFFFdFrFzFHF\FGLGGG/JG+GG"G3GsGfGFFG/G>5GNEGgGj[G{\GSG4RG)qG.G1hGGGIGB*G8VG8G2G#wGG _GFdFFFF\FFFFFFÈFFFFHFG)G8GG GmFF:GGG.GZ)GRG.GG wGFFFFG1GFFFFFFGGGG GGGG GG oG*G*=GGG#G\GGFGG G5G FFFFGGGFFFFFjF0FjFXF`FFɶF,FRFܼFFGG G^GG/GG@FG HG CG%iG-G&0GOG*G/(G;GJyG7G3MG+}G#G!}G-GDGSGWvGZGGJGIGI?GDqGWaGa5G^RGCG4+G?IGCG6GGjGG.GqGZFGG GG ^GeGG]GG*zG3}G7G/ G"&G8G0G/G4GBGJGKGLGKG?GVG)G(G$G/G1G;G="G6@G2+G'G9xGAGGvGXGDVG@NG?|G>GiGnGUG@-G-G4GG|G2GGG(XG7G1 G2!G**G"G+G(GG GF F F`FF FG-G G&:G!3G/GQGb7GYG]GREGVGUG^GGYG[FGoGPG8`G6G3G5G;G1dGAGJGcGhyGGGGGGGGG~GeGQ>G6nG;CG/G,G5G5G5*G=,GDGN0GLAGRdGSIGbGk!GdGlGKGGG=G*GGG$G-IG8G9GJGC\G>DG?G8G6SGG(G8G&vGG"G.G5G5G<GFJGV(G\GOGlGGG}GgGsGm'GgGb GwG`tGInG>GEGCGbGTxGBGCGCG4G,}G'G%G.7G,G,uG4G+G3qG1,G&G"G"GG%G9AGNGNGX?GrrGGGGG|GGG{4GtGcG`GtGGGGGGGGGGGGGGGGGGxGZGcNGn3G]GKGBGGP5GPIGKGPGTGSFGQOGRG\GXGSGJjGVGpGsbGGG~G}cGrGfGgG|G|GGXGK,G8 G+KG&GGGG G(GG*G$GG!G0G3G;NGJG[GWOG_HGv?GGGGGGGGGGrGbGfFGGGGGGGQ GDfGF$GC!GMLGGGGGsGW(GJxG7G4G$ G*VG>GKGFVGYGsGfGqGlG_;GiaGkGc GR G7G=GAkGMGNqGNGDGJGLGLGMBGYG\GYGkGGGqbG|G}GTyG8hG<G1G. G&?GGGG%G<G<G@G['GZ7GPGAGIGcSG["GiGjGbGlGzGGGpGeGwGGluGkGsXGfIGkGdqGGG;G3G9~GGG8GGFFF(GGpGGRG- G'GGGG)G.G<GSGJ<G8G=G-GGG%.G+GY;Gz}GCG?G:G4G0xG>DGEGRJGsXGGd)GmGwGrGaGF(G8OG7qG"@GG$lG,G.GG@rGA G:G5GJtGWG\GsGYGOjGI G?cG=GSGNGOqGBG4G,G+GG#GG#G"G6kGL&GYGGGhGWEGLXGeSGp7G_GXmGfG]GQGKGaGdG]G\GL0G1G0G+G(WG#GGG GG GGmGG"oG*G7RG4GQGaGo-G`GLGFGWGj7GdgG08G9GJGNGHGG7G*G)vG#G GG kG G G GG%G-G!G&G*MG!GiGhGGGG+G(G6GD\GUGbGzGTGa>GhG`}GMGJlGXUGYaGGGRGLAGHGD6GGSGMGHGGDGGG-G!G"GSGGGGG G/GhG(*GGGeG7FLGGGG'*G+G"G7G*G%G!GGvG |G GGG1\G?GTGX`GXWGGG9G8GBVGHGNGC|GWGVG]G\#G[GP`GFG=GBG2G#GFFtFFӸFxFF6FFF<GrG{FFG G*KG(NG;KGFtG2G%qGGGSGRG2[GAG>@G<*GB G@G*G GG FbFGG JG GGGG GGeFF|FרFFG FFFGFFFݬF~FFRFFFPFZFFFFFFF\FFFFFFFJFF*FFhFFF~FFF FF:F0FFFڞFFʪFvFFF>FF̈́FFFȺFєFGGYGGwGF*FGGGGG:G4G/wG;GG 2G%GG"G GG%GGRGFGtFFFFRFFdFNFjFFFFF F.F(FfFF*FfFFLFFF<FFƆFFF$FFFFFFFFvFFFjFFF\FFF(FFrFZFFdFFF(F"FFFFrFoFMFBF>F5F/dF20FAFL,FS4FqF}FFF\FlF]xFR`FHFBF?F7FNFapFkFTFCF0F!F<F FF (F0FFF#F F!FFF F8F(F ,FFFFFxF<FFFhF'FFTFF<FtFEEEE`EpEEF4FE(EF F(F FFFhFhFF<F FFPEPEhE8E0EѐE@EJEJEZpED@E10E/E-pE+E*pE=pE2E> E8PENECE?E>@E>EU EdpEY E]`EpEgE`EX`ELEVERPEmpErEzEEEEE EEEEEEEEEEEEEEEEEXE(ExEEΘEE˨E0EEEEEHEE(EpEEEEEpEEE0EHEEExE EEXEEHEEEEEPEE EِEE(EEEEШEE8EhExEEPEϨEEXE`EEEhEhEEF F DF\F hF0FF pF<FE0EEEXEEEEEE(E8EEEEװEEڠEpEEE EHEE(E@E؈EֈEEEE(EF HFF hF `FFFFF`FEhEEEFFFxFFFF @F FF F HF (FF1F=,F=hFEFCdFNFXFNFD0FFFKlFJdFFFPlFE4F0F%$F(<FFlF$FPFFFF F%\FhFF$F<F!F#F(F*$F5(F>F;`F3tF1F1XF/tF1(F0F)F*tF)dF1 F:FFFG@FPFS(FLTFL@F_FtFdXF\FzFFBFFFFF,FZFg`F_FSDFFXF>FH(FWHF_xFhFgPFnF~Fs FoFbFsF0FF,F2F@FjFF FJFF FpF2FtFPFFF|XF|F~4FFFlFFFF.FFFFF:FFzFu,FkFZ FYFO,FGFDxFKdFZFhFnFu<FZFPFHF\FFFFFFRFFqFeFdFZFN`FMFThFNFOFPFOFRLFPFLFU<FaFS0F_FcFvFFF@FzFFFFFFFFFFFFFF>FF FFFXFFFhFFFFFFFFFpFFFFFFFFxFF F FJF~tFRF F2FdFjFhFFFFFF6FF(FFFFpFFF|FNFdF0FF"FfFF`FfFFxTF| FFv|FsFFyF F@FbFDFFFFVF|FFjFÄFHFFTFF(FjFݒFFFFF FFrGGlFRFF4FHF6FF`FFǞF.F"FRFVF~F`F۠FjFFtFFۺF FrFFFpF FF6F FvFrFxF6FFFFFҲFŰFFxFFVFFFFF8FF$FFFFBFFFFFvFF(FFFF\FtFF$F FFNF2FfFFFtFJFFFFdFFzFRF^FFlFFFFFvFFF:FdFFpFFLFFFFFFrFDFFrFF:F,FPF@FNF FFFVFFFF\FF@F<FFF2FJF̌FFFFFFdFFFFF6FjFxFbF֪FFFFFF FzF6F6FFFJFFFF8FFŬFJFFF˲FˌFvFF FĸFFFFFF,FFFhF@FFFF^FFFFFFFF FFF̸F\FΠFhFNF<FFFFFFlFFtFˆFFjFHFbF<FPFBFFFFFdFFFFFFFFPF*FxFDFFF~FHFF2FFtFF<FRFFFFFF:FFFFFF4FFFFjFFVFFFFF.FFݦFFFFFF̬FȒFFNFFXFJG G GG FFZFFFFF$F<G GFxFFF`FF0FFVF FFlFG IGG"qG*G%G'G#GjG FFFVFܤF֊FٶFFɘF`FF"F>GZGGG\GxG G [G~FFGFGFF FFԤFFFFF FԲFFPFFFfFFTF8FFnFFF^F\FF FFFrF\FFF͖F|FdFFFFRFFFGG )GGGG G;G DGGZGG EG GG-G FFPFGG GcG}G'G4G/G.GG%G.G>GM#GbG`8GcGbG;G9G-G1+G5G>GB;GC@G.G#NG!HGlGFBF FFFGGGFG{GG(G,FFFFdFFGtG*GGGGnG^GG EGzFFvF4FFެF.F$FFRFJFFFFFFFFF`F~FvFFܔF~FHFhFFG;GG NG bGYG)G {G GG6GG FFFFFFlGzFF~FFF&F G GG*OG/G1G*;G-0G(GR^Gi,GQKG;G9GSGlG`GoGLG=G2G50G@-G_GNGKG6 G-G1G G+G FFFBGF~FxF0FF:FȒFJFFˀFF8G~G G SG G.G:GGJGGlG<G/GS+GOG?G#GG nG<FFpFFGFFFFGFGGGGGG vG GLGG#G;JG,G$GGQGG%GmGGGGnGG)GUGGG.F FPFF>FjFFȊFFjFJFȜFFFFFG 3GGGGGYGGbG+G.cG(MG$G.MG,G5^G1G3G=G5tG%0G#G(G-iG6GFGLGNGZGGGI?GJGB_GFGKGJvGAG:[GDGHG<G"GsGsGG9GG GGGGGG wGjGG GG4G5/G)`G wG5iGGDhG<$G4G&G$GGGGFF"FnF@FG~G UGuG#uG3G=GsGGoGiGQGNGP-GoGj1GeGl1GROG94G4G:G4G.G3zGJ{GYVGa_GGGGGGGGvGGGeGNGAG<G/G'^G)G* G1G<GAGDGDXGQGWGVGtGkGKGJGDGAG$4GG*G' G-G0KG76G:uGH=G6UG8eG4PG+G:G#GGGG)G8'G0=G;GBAGDGZ_Ga/GuGGGGGGqG~GGGGWGXGJ5GGGlGYG>oGLGC6G5vG)UG(.G"G.G-G.fG0?G1G.G+#G^GG!nG(?G$G6IGJrGkIGu{GGGGGGGGGGv0GoGk&GyGGGGGGGGGGGGGGGGGGGoGm6GG|GmOGX!GTG[aGWsGQ,GJ&GMGSGWxGgGa%GQG^GiGyGGGGG~GpGjGkGzGGGlGU6G@G+?G.$GeG GG GGG-G9gG'G#G.G,zG0GJG\ GpNGeGx6GGGGGGGGGGGsEGq`GGGGGGG^RGSGHGGxGKGGGGzGmGgvGN8G1G*tG'FG.G>OGV5GeGlGGG~+GGGGnG]DGTnGJGQGKGFG\:GK}GFGAGPGGG?GVGSaGMZG]GbGYGMGYEGRG=G-`G2G.!G+ G%G}GG"G$9G1[G8G=GKUGM G?G6G@GN2GLGeGUGWGfGpGGGbGFGO GtGiHGeG^GYGUGN(G: G1PG0G5GFFFjGFVFPFPGG?GGyG&G"%G!G(G.G0GEGEGcGHBGP=GT`G;G4G8'G0G2G;G-G-G-G-3G&G&G#G#G-wG+G+7GCQGQ7G]%GG]GRG:GGGXoGHGHQG<%G<G?nGGGN GBGMG`GIG@G<G;G>G:.G2G-G`GdG5G#G G GG&G1SG7GV`G[cGbGdGHWG>\GMGQG6(G6\G3OG7@GG+GPG.G cGhG;GG GGGG-GGGPGGGGGiG GGG7G5G<GFG?GH^GEG:+G,G3FG@#G-GA+GMrGOGNGVGKGClG5QG1G*4G&GFXF׌FJFFFFFF$FGG3G GGG) G?GR!GMGDG=G$GmG GG"G@G.}G8$G,G;&G*G[G}G F2FGGGGGXG"GGGFFڌFĤFFFFFzF.FFFFFFvF.F0F<FFFFFFF~FFFFTFF8F$FLFFŊFF@FhF(FFFFFF(FFFFކFFFtFFFBFFFFF<FFFVFFDFFJFFXFGF FFGG0GGG#&G%G&%GG"G$GtGGG:GGGSGF2FFF FFFFPFFfFFFPFvFXFFFFvFFFF FFFFFFFFFFFFFFFrFxFF&FFF`F~FFJFFF.FLFFF:FFF8FjF{FpFqFQF;F5F%F#lFF%F'F1FOtFd8Ff FyFFmF_FBF9FDF<F@xFRF\<Ff8FdFR(F1F%FFpFpFFFFFF F F\F F $FFF(F\FlFdF |F \F<FFF'F0$F)F#xFF$F FEE@EPEEPEװEE`EEEF\FhFFF(FF F F F!F8F<EEEEEhEڸE? E? E:@EU EGE8`E/E)E$`E&E/E8 E00EBEREPE;E>`E<EJ EVEXEUPEmEgEipERE\ERE`@ErExEu0EvEEE0EEEEE(EE0E(EHEPEEEEEEEEEEEE`EEʨEEàEpEEEEEE8E(EEEE`EEEEEHE`E0EEEE0EEEpEEE ExEEE֠EԐEEEhEEEEEHE8EExEE@E8E`EpEEhEFFFF,F FFpF XEEXEEEPE޸E EEEXFE EE0EEExEEEEEE`E8EEްEݠEֈEE@EEEFFFFF`F F`F FF F FEEEF F(F(FlF hF F FFPFXF FTF"dF7FA8FLFLlFGHFNFMFCF=8FDDFKFFF?pF?0F4F1F+F%FF`FFPFFF\FFhFhFFFF% F%F(F-FBF<F5F5lF;F8F48F6F)F/F1F9F<F<F<8FIdFP FHF?FCFY4FdFjFuF8FzFFvF^FF>F4Fv Fd(F]FOF=(FAFJFZ@F[F^lFhFoFsFvXFnFlF{dFfF@FF6FvF6FFFNF\FFLF8F@FFFFJFF~DF~FFF.FFFF^FFFFFFzFo,F]FSFO(FLPFD@F@FIFPDFXFhtFkFslF|FNF>FFNF4FFFtF}xFkFdxFa@F_FRFPFN<FIFJFK FEFMFNFHFTLFcF]dF[FUFb<FxFFF$FVFFFFF~FF4F FXFtFFFHFFXFTF&FFFF$FFFFF FzFFZFFZFF.FFFFFFdFFF4FF<FFPFFFRFFF\FFFFfFFFFFFFhFFFJFFFnF2FFnFFFFFFF|FnFxPF{F~8F|FFF FFFFF&FFF,F:FFFЖFھFF^FFFFFvFvFFF<FpFFFBFFF FFFڠFFFrF>FFlFFFFRFFrFDFFFFFVF<FFFXFFxFLFF^FFLFɪFɸFƴFfFFFFFJFJFFzFhFFF,FF,FFvF\